diff options
Diffstat (limited to 'VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static')
68 files changed, 15114 insertions, 0 deletions
diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/basic.css b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/basic.css new file mode 100644 index 00000000..01192852 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/basic.css @@ -0,0 +1,768 @@ +/* + * basic.css + * ~~~~~~~~~ + * + * Sphinx stylesheet -- basic theme. + * + * :copyright: Copyright 2007-2020 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +/* -- main layout ----------------------------------------------------------- */ + +div.clearer { + clear: both; +} + +/* -- relbar ---------------------------------------------------------------- */ + +div.related { + width: 100%; + font-size: 90%; +} + +div.related h3 { + display: none; +} + +div.related ul { + margin: 0; + padding: 0 0 0 10px; + list-style: none; +} + +div.related li { + display: inline; +} + +div.related li.right { + float: right; + margin-right: 5px; +} + +/* -- sidebar --------------------------------------------------------------- */ + +div.sphinxsidebarwrapper { + padding: 10px 5px 0 10px; +} + +div.sphinxsidebar { + float: left; + width: 230px; + margin-left: -100%; + font-size: 90%; + word-wrap: break-word; + overflow-wrap : break-word; +} + +div.sphinxsidebar ul { + list-style: none; +} + +div.sphinxsidebar ul ul, +div.sphinxsidebar ul.want-points { + margin-left: 20px; + list-style: square; +} + +div.sphinxsidebar ul ul { + margin-top: 0; + margin-bottom: 0; +} + +div.sphinxsidebar form { + margin-top: 10px; +} + +div.sphinxsidebar input { + border: 1px solid #98dbcc; + font-family: sans-serif; + font-size: 1em; +} + +div.sphinxsidebar #searchbox form.search { + overflow: hidden; +} + +div.sphinxsidebar #searchbox input[type="text"] { + float: left; + width: 80%; + padding: 0.25em; + box-sizing: border-box; +} + +div.sphinxsidebar #searchbox input[type="submit"] { + float: left; + width: 20%; + border-left: none; + padding: 0.25em; + box-sizing: border-box; +} + + +img { + border: 0; + max-width: 100%; +} + +/* -- search page ----------------------------------------------------------- */ + +ul.search { + margin: 10px 0 0 20px; + padding: 0; +} + +ul.search li { + padding: 5px 0 5px 20px; + background-image: url(file.png); + background-repeat: no-repeat; + background-position: 0 7px; +} + +ul.search li a { + font-weight: bold; +} + +ul.search li div.context { + color: #888; + margin: 2px 0 0 30px; + text-align: left; +} + +ul.keywordmatches li.goodmatch a { + font-weight: bold; +} + +/* -- index page ------------------------------------------------------------ */ + +table.contentstable { + width: 90%; + margin-left: auto; + margin-right: auto; +} + +table.contentstable p.biglink { + line-height: 150%; +} + +a.biglink { + font-size: 1.3em; +} + +span.linkdescr { + font-style: italic; + padding-top: 5px; + font-size: 90%; +} + +/* -- general index --------------------------------------------------------- */ + +table.indextable { + width: 100%; +} + +table.indextable td { + text-align: left; + vertical-align: top; +} + +table.indextable ul { + margin-top: 0; + margin-bottom: 0; + list-style-type: none; +} + +table.indextable > tbody > tr > td > ul { + padding-left: 0em; +} + +table.indextable tr.pcap { + height: 10px; +} + +table.indextable tr.cap { + margin-top: 10px; + background-color: #f2f2f2; +} + +img.toggler { + margin-right: 3px; + margin-top: 3px; + cursor: pointer; +} + +div.modindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +div.genindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +/* -- domain module index --------------------------------------------------- */ + +table.modindextable td { + padding: 2px; + border-collapse: collapse; +} + +/* -- general body styles --------------------------------------------------- */ + +div.body { + min-width: 450px; + max-width: 800px; +} + +div.body p, div.body dd, div.body li, div.body blockquote { + -moz-hyphens: auto; + -ms-hyphens: auto; + -webkit-hyphens: auto; + hyphens: auto; +} + +a.headerlink { + visibility: hidden; +} + +a.brackets:before, +span.brackets > a:before{ + content: "["; +} + +a.brackets:after, +span.brackets > a:after { + content: "]"; +} + +h1:hover > a.headerlink, +h2:hover > a.headerlink, +h3:hover > a.headerlink, +h4:hover > a.headerlink, +h5:hover > a.headerlink, +h6:hover > a.headerlink, +dt:hover > a.headerlink, +caption:hover > a.headerlink, +p.caption:hover > a.headerlink, +div.code-block-caption:hover > a.headerlink { + visibility: visible; +} + +div.body p.caption { + text-align: inherit; +} + +div.body td { + text-align: left; +} + +.first { + margin-top: 0 !important; +} + +p.rubric { + margin-top: 30px; + font-weight: bold; +} + +img.align-left, .figure.align-left, object.align-left { + clear: left; + float: left; + margin-right: 1em; +} + +img.align-right, .figure.align-right, object.align-right { + clear: right; + float: right; + margin-left: 1em; +} + +img.align-center, .figure.align-center, object.align-center { + display: block; + margin-left: auto; + margin-right: auto; +} + +img.align-default, .figure.align-default { + display: block; + margin-left: auto; + margin-right: auto; +} + +.align-left { + text-align: left; +} + +.align-center { + text-align: center; +} + +.align-default { + text-align: center; +} + +.align-right { + text-align: right; +} + +/* -- sidebars -------------------------------------------------------------- */ + +div.sidebar { + margin: 0 0 0.5em 1em; + border: 1px solid #ddb; + padding: 7px 7px 0 7px; + background-color: #ffe; + width: 40%; + float: right; +} + +p.sidebar-title { + font-weight: bold; +} + +/* -- topics ---------------------------------------------------------------- */ + +div.topic { + border: 1px solid #ccc; + padding: 7px 7px 0 7px; + margin: 10px 0 10px 0; +} + +p.topic-title { + font-size: 1.1em; + font-weight: bold; + margin-top: 10px; +} + +/* -- admonitions ----------------------------------------------------------- */ + +div.admonition { + margin-top: 10px; + margin-bottom: 10px; + padding: 7px; +} + +div.admonition dt { + font-weight: bold; +} + +div.admonition dl { + margin-bottom: 0; +} + +p.admonition-title { + margin: 0px 10px 5px 0px; + font-weight: bold; +} + +div.body p.centered { + text-align: center; + margin-top: 25px; +} + +/* -- tables ---------------------------------------------------------------- */ + +table.docutils { + border: 0; + border-collapse: collapse; +} + +table.align-center { + margin-left: auto; + margin-right: auto; +} + +table.align-default { + margin-left: auto; + margin-right: auto; +} + +table caption span.caption-number { + font-style: italic; +} + +table caption span.caption-text { +} + +table.docutils td, table.docutils th { + padding: 1px 8px 1px 5px; + border-top: 0; + border-left: 0; + border-right: 0; + border-bottom: 1px solid #aaa; +} + +table.footnote td, table.footnote th { + border: 0 !important; +} + +th { + text-align: left; + padding-right: 5px; +} + +table.citation { + border-left: solid 1px gray; + margin-left: 1px; +} + +table.citation td { + border-bottom: none; +} + +th > p:first-child, +td > p:first-child { + margin-top: 0px; +} + +th > p:last-child, +td > p:last-child { + margin-bottom: 0px; +} + +/* -- figures --------------------------------------------------------------- */ + +div.figure { + margin: 0.5em; + padding: 0.5em; +} + +div.figure p.caption { + padding: 0.3em; +} + +div.figure p.caption span.caption-number { + font-style: italic; +} + +div.figure p.caption span.caption-text { +} + +/* -- field list styles ----------------------------------------------------- */ + +table.field-list td, table.field-list th { + border: 0 !important; +} + +.field-list ul { + margin: 0; + padding-left: 1em; +} + +.field-list p { + margin: 0; +} + +.field-name { + -moz-hyphens: manual; + -ms-hyphens: manual; + -webkit-hyphens: manual; + hyphens: manual; +} + +/* -- hlist styles ---------------------------------------------------------- */ + +table.hlist td { + vertical-align: top; +} + + +/* -- other body styles ----------------------------------------------------- */ + +ol.arabic { + list-style: decimal; +} + +ol.loweralpha { + list-style: lower-alpha; +} + +ol.upperalpha { + list-style: upper-alpha; +} + +ol.lowerroman { + list-style: lower-roman; +} + +ol.upperroman { + list-style: upper-roman; +} + +li > p:first-child { + margin-top: 0px; +} + +li > p:last-child { + margin-bottom: 0px; +} + +dl.footnote > dt, +dl.citation > dt { + float: left; +} + +dl.footnote > dd, +dl.citation > dd { + margin-bottom: 0em; +} + +dl.footnote > dd:after, +dl.citation > dd:after { + content: ""; + clear: both; +} + +dl.field-list { + display: grid; + grid-template-columns: fit-content(30%) auto; +} + +dl.field-list > dt { + font-weight: bold; + word-break: break-word; + padding-left: 0.5em; + padding-right: 5px; +} + +dl.field-list > dt:after { + content: ":"; +} + +dl.field-list > dd { + padding-left: 0.5em; + margin-top: 0em; + margin-left: 0em; + margin-bottom: 0em; +} + +dl { + margin-bottom: 15px; +} + +dd > p:first-child { + margin-top: 0px; +} + +dd ul, dd table { + margin-bottom: 10px; +} + +dd { + margin-top: 3px; + margin-bottom: 10px; + margin-left: 30px; +} + +dt:target, span.highlighted { + background-color: #fbe54e; +} + +rect.highlighted { + fill: #fbe54e; +} + +dl.glossary dt { + font-weight: bold; + font-size: 1.1em; +} + +.optional { + font-size: 1.3em; +} + +.sig-paren { + font-size: larger; +} + +.versionmodified { + font-style: italic; +} + +.system-message { + background-color: #fda; + padding: 5px; + border: 3px solid red; +} + +.footnote:target { + background-color: #ffa; +} + +.line-block { + display: block; + margin-top: 1em; + margin-bottom: 1em; +} + +.line-block .line-block { + margin-top: 0; + margin-bottom: 0; + margin-left: 1.5em; +} + +.guilabel, .menuselection { + font-family: sans-serif; +} + +.accelerator { + text-decoration: underline; +} + +.classifier { + font-style: oblique; +} + +.classifier:before { + font-style: normal; + margin: 0.5em; + content: ":"; +} + +abbr, acronym { + border-bottom: dotted 1px; + cursor: help; +} + +/* -- code displays --------------------------------------------------------- */ + +pre { + overflow: auto; + overflow-y: hidden; /* fixes display issues on Chrome browsers */ +} + +span.pre { + -moz-hyphens: none; + -ms-hyphens: none; + -webkit-hyphens: none; + hyphens: none; +} + +td.linenos pre { + padding: 5px 0px; + border: 0; + background-color: transparent; + color: #aaa; +} + +table.highlighttable { + margin-left: 0.5em; +} + +table.highlighttable td { + padding: 0 0.5em 0 0.5em; +} + +div.code-block-caption { + padding: 2px 5px; + font-size: small; +} + +div.code-block-caption code { + background-color: transparent; +} + +div.code-block-caption + div > div.highlight > pre { + margin-top: 0; +} + +div.doctest > div.highlight span.gp { /* gp: Generic.Prompt */ + user-select: none; +} + +div.code-block-caption span.caption-number { + padding: 0.1em 0.3em; + font-style: italic; +} + +div.code-block-caption span.caption-text { +} + +div.literal-block-wrapper { + padding: 1em 1em 0; +} + +div.literal-block-wrapper div.highlight { + margin: 0; +} + +code.descname { + background-color: transparent; + font-weight: bold; + font-size: 1.2em; +} + +code.descclassname { + background-color: transparent; +} + +code.xref, a code { + background-color: transparent; + font-weight: bold; +} + +h1 code, h2 code, h3 code, h4 code, h5 code, h6 code { + background-color: transparent; +} + +.viewcode-link { + float: right; +} + +.viewcode-back { + float: right; + font-family: sans-serif; +} + +div.viewcode-block:target { + margin: -1px -10px; + padding: 0 10px; +} + +/* -- math display ---------------------------------------------------------- */ + +img.math { + vertical-align: middle; +} + +div.body div.math p { + text-align: center; +} + +span.eqno { + float: right; +} + +span.eqno a.headerlink { + position: relative; + left: 0px; + z-index: 1; +} + +div.math:hover a.headerlink { + visibility: visible; +} + +/* -- printout stylesheet --------------------------------------------------- */ + +@media print { + div.document, + div.documentwrapper, + div.bodywrapper { + margin: 0 !important; + width: 100%; + } + + div.sphinxsidebar, + div.related, + div.footer, + #top-link { + display: none; + } +}
\ No newline at end of file diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/basic.css.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/basic.css.meta new file mode 100644 index 00000000..c13301d0 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/basic.css.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: e46bdd45e5b42ea49bdf7d69f1837426 +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css.meta new file mode 100644 index 00000000..aa878134 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css.meta @@ -0,0 +1,8 @@ +fileFormatVersion: 2 +guid: e85827579a482ae49ba6ba454828dd7b +folderAsset: yes +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css/badge_only.css b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css/badge_only.css new file mode 100644 index 00000000..c26274b5 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css/badge_only.css @@ -0,0 +1,2 @@ +.fa:before{-webkit-font-smoothing:antialiased}.clearfix{*zoom:1}.clearfix:before,.clearfix:after{display:table;content:""}.clearfix:after{clear:both}@font-face{font-family:FontAwesome;font-weight:normal;font-style:normal;src:url("../fonts/fontawesome-webfont.eot");src:url("../fonts/fontawesome-webfont.eot?#iefix") format("embedded-opentype"),url("../fonts/fontawesome-webfont.woff") format("woff"),url("../fonts/fontawesome-webfont.ttf") format("truetype"),url("../fonts/fontawesome-webfont.svg#FontAwesome") format("svg")}.fa:before{display:inline-block;font-family:FontAwesome;font-style:normal;font-weight:normal;line-height:1;text-decoration:inherit}a .fa{display:inline-block;text-decoration:inherit}li .fa{display:inline-block}li .fa-large:before,li .fa-large:before{width:1.875em}ul.fas{list-style-type:none;margin-left:2em;text-indent:-0.8em}ul.fas li .fa{width:.8em}ul.fas li .fa-large:before,ul.fas li .fa-large:before{vertical-align:baseline}.fa-book:before{content:""}.icon-book:before{content:""}.fa-caret-down:before{content:""}.icon-caret-down:before{content:""}.fa-caret-up:before{content:""}.icon-caret-up:before{content:""}.fa-caret-left:before{content:""}.icon-caret-left:before{content:""}.fa-caret-right:before{content:""}.icon-caret-right:before{content:""}.rst-versions{position:fixed;bottom:0;left:0;width:300px;color:#fcfcfc;background:#1f1d1d;border-top:solid 10px #343131;font-family:"Lato","proxima-nova","Helvetica Neue",Arial,sans-serif;z-index:400}.rst-versions a{color:#2980B9;text-decoration:none}.rst-versions .rst-badge-small{display:none}.rst-versions .rst-current-version{padding:12px;background-color:#272525;display:block;text-align:right;font-size:90%;cursor:pointer;color:#27AE60;*zoom:1}.rst-versions .rst-current-version:before,.rst-versions .rst-current-version:after{display:table;content:""}.rst-versions .rst-current-version:after{clear:both}.rst-versions .rst-current-version .fa{color:#fcfcfc}.rst-versions .rst-current-version .fa-book{float:left}.rst-versions .rst-current-version .icon-book{float:left}.rst-versions .rst-current-version.rst-out-of-date{background-color:#E74C3C;color:#fff}.rst-versions .rst-current-version.rst-active-old-version{background-color:#F1C40F;color:#000}.rst-versions.shift-up .rst-other-versions{display:block}.rst-versions .rst-other-versions{font-size:90%;padding:12px;color:gray;display:none}.rst-versions .rst-other-versions hr{display:block;height:1px;border:0;margin:20px 0;padding:0;border-top:solid 1px #413d3d}.rst-versions .rst-other-versions dd{display:inline-block;margin:0}.rst-versions .rst-other-versions dd a{display:inline-block;padding:6px;color:#fcfcfc}.rst-versions.rst-badge{width:auto;bottom:20px;right:20px;left:auto;border:none;max-width:300px}.rst-versions.rst-badge .icon-book{float:none}.rst-versions.rst-badge .fa-book{float:none}.rst-versions.rst-badge.shift-up .rst-current-version{text-align:right}.rst-versions.rst-badge.shift-up .rst-current-version .fa-book{float:left}.rst-versions.rst-badge.shift-up .rst-current-version .icon-book{float:left}.rst-versions.rst-badge .rst-current-version{width:auto;height:30px;line-height:30px;padding:0 6px;display:block;text-align:center}@media screen and (max-width: 768px){.rst-versions{width:85%;display:none}.rst-versions.shift{display:block}} +/*# sourceMappingURL=badge_only.css.map */ diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css/badge_only.css.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css/badge_only.css.meta new file mode 100644 index 00000000..493d5d07 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css/badge_only.css.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: a21b0262f2088e844a0382f9ab317e2e +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css/theme.css b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css/theme.css new file mode 100644 index 00000000..aa01f3f4 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css/theme.css @@ -0,0 +1,5 @@ +*{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}article,aside,details,figcaption,figure,footer,header,hgroup,nav,section{display:block}audio,canvas,video{display:inline-block;*display:inline;*zoom:1}audio:not([controls]){display:none}[hidden]{display:none}*{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}html{font-size:100%;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%}body{margin:0}a:hover,a:active{outline:0}abbr[title]{border-bottom:1px dotted}b,strong{font-weight:bold}blockquote{margin:0}dfn{font-style:italic}ins{background:#ff9;color:#000;text-decoration:none}mark{background:#ff0;color:#000;font-style:italic;font-weight:bold}pre,code,.rst-content tt,.rst-content code,kbd,samp{font-family:monospace,serif;_font-family:"courier new",monospace;font-size:1em}pre{white-space:pre}q{quotes:none}q:before,q:after{content:"";content:none}small{font-size:85%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sup{top:-0.5em}sub{bottom:-0.25em}ul,ol,dl{margin:0;padding:0;list-style:none;list-style-image:none}li{list-style:none}dd{margin:0}img{border:0;-ms-interpolation-mode:bicubic;vertical-align:middle;max-width:100%}svg:not(:root){overflow:hidden}figure{margin:0}form{margin:0}fieldset{border:0;margin:0;padding:0}label{cursor:pointer}legend{border:0;*margin-left:-7px;padding:0;white-space:normal}button,input,select,textarea{font-size:100%;margin:0;vertical-align:baseline;*vertical-align:middle}button,input{line-height:normal}button,input[type="button"],input[type="reset"],input[type="submit"]{cursor:pointer;-webkit-appearance:button;*overflow:visible}button[disabled],input[disabled]{cursor:default}input[type="checkbox"],input[type="radio"]{box-sizing:border-box;padding:0;*width:13px;*height:13px}input[type="search"]{-webkit-appearance:textfield;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;box-sizing:content-box}input[type="search"]::-webkit-search-decoration,input[type="search"]::-webkit-search-cancel-button{-webkit-appearance:none}button::-moz-focus-inner,input::-moz-focus-inner{border:0;padding:0}textarea{overflow:auto;vertical-align:top;resize:vertical}table{border-collapse:collapse;border-spacing:0}td{vertical-align:top}.chromeframe{margin:.2em 0;background:#ccc;color:#000;padding:.2em 0}.ir{display:block;border:0;text-indent:-999em;overflow:hidden;background-color:transparent;background-repeat:no-repeat;text-align:left;direction:ltr;*line-height:0}.ir br{display:none}.hidden{display:none !important;visibility:hidden}.visuallyhidden{border:0;clip:rect(0 0 0 0);height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;width:1px}.visuallyhidden.focusable:active,.visuallyhidden.focusable:focus{clip:auto;height:auto;margin:0;overflow:visible;position:static;width:auto}.invisible{visibility:hidden}.relative{position:relative}big,small{font-size:100%}@media print{html,body,section{background:none !important}*{box-shadow:none !important;text-shadow:none !important;filter:none !important;-ms-filter:none !important}a,a:visited{text-decoration:underline}.ir a:after,a[href^="javascript:"]:after,a[href^="#"]:after{content:""}pre,blockquote{page-break-inside:avoid}thead{display:table-header-group}tr,img{page-break-inside:avoid}img{max-width:100% !important}@page{margin:.5cm}p,h2,.rst-content .toctree-wrapper p.caption,h3{orphans:3;widows:3}h2,.rst-content .toctree-wrapper p.caption,h3{page-break-after:avoid}}.fa:before,.wy-menu-vertical li span.toctree-expand:before,.wy-menu-vertical li.on a span.toctree-expand:before,.wy-menu-vertical li.current>a span.toctree-expand:before,.rst-content .admonition-title:before,.rst-content h1 .headerlink:before,.rst-content h2 .headerlink:before,.rst-content h3 .headerlink:before,.rst-content h4 .headerlink:before,.rst-content h5 .headerlink:before,.rst-content h6 .headerlink:before,.rst-content dl dt .headerlink:before,.rst-content p.caption .headerlink:before,.rst-content tt.download span:first-child:before,.rst-content code.download span:first-child:before,.icon:before,.wy-dropdown .caret:before,.wy-inline-validate.wy-inline-validate-success .wy-input-context:before,.wy-inline-validate.wy-inline-validate-danger .wy-input-context:before,.wy-inline-validate.wy-inline-validate-warning .wy-input-context:before,.wy-inline-validate.wy-inline-validate-info .wy-input-context:before,.wy-alert,.rst-content .note,.rst-content .attention,.rst-content .caution,.rst-content .danger,.rst-content .error,.rst-content .hint,.rst-content .important,.rst-content .tip,.rst-content .warning,.rst-content .seealso,.rst-content .admonition-todo,.btn,input[type="text"],input[type="password"],input[type="email"],input[type="url"],input[type="date"],input[type="month"],input[type="time"],input[type="datetime"],input[type="datetime-local"],input[type="week"],input[type="number"],input[type="search"],input[type="tel"],input[type="color"],select,textarea,.wy-menu-vertical li.on a,.wy-menu-vertical li.current>a,.wy-side-nav-search>a,.wy-side-nav-search .wy-dropdown>a,.wy-nav-top a{-webkit-font-smoothing:antialiased}.clearfix{*zoom:1}.clearfix:before,.clearfix:after{display:table;content:""}.clearfix:after{clear:both}/*! + * Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome + * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License) + */@font-face{font-family:'FontAwesome';src:url("../fonts/fontawesome-webfont.eot?v=4.7.0");src:url("../fonts/fontawesome-webfont.eot?#iefix&v=4.7.0") format("embedded-opentype"),url("../fonts/fontawesome-webfont.woff2?v=4.7.0") format("woff2"),url("../fonts/fontawesome-webfont.woff?v=4.7.0") format("woff"),url("../fonts/fontawesome-webfont.ttf?v=4.7.0") format("truetype"),url("../fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular") format("svg");font-weight:normal;font-style:normal}.fa,.wy-menu-vertical li span.toctree-expand,.wy-menu-vertical li.on a span.toctree-expand,.wy-menu-vertical li.current>a span.toctree-expand,.rst-content .admonition-title,.rst-content h1 .headerlink,.rst-content h2 .headerlink,.rst-content h3 .headerlink,.rst-content h4 .headerlink,.rst-content h5 .headerlink,.rst-content h6 .headerlink,.rst-content dl dt .headerlink,.rst-content p.caption .headerlink,.rst-content tt.download span:first-child,.rst-content code.download span:first-child,.icon{display:inline-block;font:normal normal normal 14px/1 FontAwesome;font-size:inherit;text-rendering:auto;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.fa-lg{font-size:1.33333em;line-height:.75em;vertical-align:-15%}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-fw{width:1.28571em;text-align:center}.fa-ul{padding-left:0;margin-left:2.14286em;list-style-type:none}.fa-ul>li{position:relative}.fa-li{position:absolute;left:-2.14286em;width:2.14286em;top:.14286em;text-align:center}.fa-li.fa-lg{left:-1.85714em}.fa-border{padding:.2em .25em .15em;border:solid 0.08em #eee;border-radius:.1em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left,.wy-menu-vertical li span.fa-pull-left.toctree-expand,.wy-menu-vertical li.on a span.fa-pull-left.toctree-expand,.wy-menu-vertical li.current>a span.fa-pull-left.toctree-expand,.rst-content .fa-pull-left.admonition-title,.rst-content h1 .fa-pull-left.headerlink,.rst-content h2 .fa-pull-left.headerlink,.rst-content h3 .fa-pull-left.headerlink,.rst-content h4 .fa-pull-left.headerlink,.rst-content h5 .fa-pull-left.headerlink,.rst-content h6 .fa-pull-left.headerlink,.rst-content dl dt .fa-pull-left.headerlink,.rst-content p.caption .fa-pull-left.headerlink,.rst-content tt.download span.fa-pull-left:first-child,.rst-content code.download span.fa-pull-left:first-child,.fa-pull-left.icon{margin-right:.3em}.fa.fa-pull-right,.wy-menu-vertical li span.fa-pull-right.toctree-expand,.wy-menu-vertical li.on a span.fa-pull-right.toctree-expand,.wy-menu-vertical li.current>a span.fa-pull-right.toctree-expand,.rst-content .fa-pull-right.admonition-title,.rst-content h1 .fa-pull-right.headerlink,.rst-content h2 .fa-pull-right.headerlink,.rst-content h3 .fa-pull-right.headerlink,.rst-content h4 .fa-pull-right.headerlink,.rst-content h5 .fa-pull-right.headerlink,.rst-content h6 .fa-pull-right.headerlink,.rst-content dl dt .fa-pull-right.headerlink,.rst-content p.caption .fa-pull-right.headerlink,.rst-content tt.download span.fa-pull-right:first-child,.rst-content code.download span.fa-pull-right:first-child,.fa-pull-right.icon{margin-left:.3em}.pull-right{float:right}.pull-left{float:left}.fa.pull-left,.wy-menu-vertical li span.pull-left.toctree-expand,.wy-menu-vertical li.on a span.pull-left.toctree-expand,.wy-menu-vertical li.current>a span.pull-left.toctree-expand,.rst-content .pull-left.admonition-title,.rst-content h1 .pull-left.headerlink,.rst-content h2 .pull-left.headerlink,.rst-content h3 .pull-left.headerlink,.rst-content h4 .pull-left.headerlink,.rst-content h5 .pull-left.headerlink,.rst-content h6 .pull-left.headerlink,.rst-content dl dt .pull-left.headerlink,.rst-content p.caption .pull-left.headerlink,.rst-content tt.download span.pull-left:first-child,.rst-content code.download span.pull-left:first-child,.pull-left.icon{margin-right:.3em}.fa.pull-right,.wy-menu-vertical li span.pull-right.toctree-expand,.wy-menu-vertical li.on a span.pull-right.toctree-expand,.wy-menu-vertical li.current>a span.pull-right.toctree-expand,.rst-content .pull-right.admonition-title,.rst-content h1 .pull-right.headerlink,.rst-content h2 .pull-right.headerlink,.rst-content h3 .pull-right.headerlink,.rst-content h4 .pull-right.headerlink,.rst-content h5 .pull-right.headerlink,.rst-content h6 .pull-right.headerlink,.rst-content dl dt .pull-right.headerlink,.rst-content p.caption .pull-right.headerlink,.rst-content tt.download span.pull-right:first-child,.rst-content code.download span.pull-right:first-child,.pull-right.icon{margin-left:.3em}.fa-spin{-webkit-animation:fa-spin 2s infinite linear;animation:fa-spin 2s infinite linear}.fa-pulse{-webkit-animation:fa-spin 1s infinite steps(8);animation:fa-spin 1s infinite steps(8)}@-webkit-keyframes fa-spin{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}100%{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}@keyframes fa-spin{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}100%{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}.fa-rotate-90{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)";-webkit-transform:rotate(90deg);-ms-transform:rotate(90deg);transform:rotate(90deg)}.fa-rotate-180{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)";-webkit-transform:rotate(180deg);-ms-transform:rotate(180deg);transform:rotate(180deg)}.fa-rotate-270{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)";-webkit-transform:rotate(270deg);-ms-transform:rotate(270deg);transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)";-webkit-transform:scale(-1, 1);-ms-transform:scale(-1, 1);transform:scale(-1, 1)}.fa-flip-vertical{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)";-webkit-transform:scale(1, -1);-ms-transform:scale(1, -1);transform:scale(1, -1)}:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270,:root .fa-flip-horizontal,:root .fa-flip-vertical{filter:none}.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-glass:before{content:""}.fa-music:before{content:""}.fa-search:before,.icon-search:before{content:""}.fa-envelope-o:before{content:""}.fa-heart:before{content:""}.fa-star:before{content:""}.fa-star-o:before{content:""}.fa-user:before{content:""}.fa-film:before{content:""}.fa-th-large:before{content:""}.fa-th:before{content:""}.fa-th-list:before{content:""}.fa-check:before{content:""}.fa-remove:before,.fa-close:before,.fa-times:before{content:""}.fa-search-plus:before{content:""}.fa-search-minus:before{content:""}.fa-power-off:before{content:""}.fa-signal:before{content:""}.fa-gear:before,.fa-cog:before{content:""}.fa-trash-o:before{content:""}.fa-home:before,.icon-home:before{content:""}.fa-file-o:before{content:""}.fa-clock-o:before{content:""}.fa-road:before{content:""}.fa-download:before,.rst-content tt.download span:first-child:before,.rst-content code.download span:first-child:before{content:""}.fa-arrow-circle-o-down:before{content:""}.fa-arrow-circle-o-up:before{content:""}.fa-inbox:before{content:""}.fa-play-circle-o:before{content:""}.fa-rotate-right:before,.fa-repeat:before{content:""}.fa-refresh:before{content:""}.fa-list-alt:before{content:""}.fa-lock:before{content:""}.fa-flag:before{content:""}.fa-headphones:before{content:""}.fa-volume-off:before{content:""}.fa-volume-down:before{content:""}.fa-volume-up:before{content:""}.fa-qrcode:before{content:""}.fa-barcode:before{content:""}.fa-tag:before{content:""}.fa-tags:before{content:""}.fa-book:before,.icon-book:before{content:""}.fa-bookmark:before{content:""}.fa-print:before{content:""}.fa-camera:before{content:""}.fa-font:before{content:""}.fa-bold:before{content:""}.fa-italic:before{content:""}.fa-text-height:before{content:""}.fa-text-width:before{content:""}.fa-align-left:before{content:""}.fa-align-center:before{content:""}.fa-align-right:before{content:""}.fa-align-justify:before{content:""}.fa-list:before{content:""}.fa-dedent:before,.fa-outdent:before{content:""}.fa-indent:before{content:""}.fa-video-camera:before{content:""}.fa-photo:before,.fa-image:before,.fa-picture-o:before{content:""}.fa-pencil:before{content:""}.fa-map-marker:before{content:""}.fa-adjust:before{content:""}.fa-tint:before{content:""}.fa-edit:before,.fa-pencil-square-o:before{content:""}.fa-share-square-o:before{content:""}.fa-check-square-o:before{content:""}.fa-arrows:before{content:""}.fa-step-backward:before{content:""}.fa-fast-backward:before{content:""}.fa-backward:before{content:""}.fa-play:before{content:""}.fa-pause:before{content:""}.fa-stop:before{content:""}.fa-forward:before{content:""}.fa-fast-forward:before{content:""}.fa-step-forward:before{content:""}.fa-eject:before{content:""}.fa-chevron-left:before{content:""}.fa-chevron-right:before{content:""}.fa-plus-circle:before{content:""}.fa-minus-circle:before{content:""}.fa-times-circle:before,.wy-inline-validate.wy-inline-validate-danger .wy-input-context:before{content:""}.fa-check-circle:before,.wy-inline-validate.wy-inline-validate-success .wy-input-context:before{content:""}.fa-question-circle:before{content:""}.fa-info-circle:before{content:""}.fa-crosshairs:before{content:""}.fa-times-circle-o:before{content:""}.fa-check-circle-o:before{content:""}.fa-ban:before{content:""}.fa-arrow-left:before{content:""}.fa-arrow-right:before{content:""}.fa-arrow-up:before{content:""}.fa-arrow-down:before{content:""}.fa-mail-forward:before,.fa-share:before{content:""}.fa-expand:before{content:""}.fa-compress:before{content:""}.fa-plus:before{content:""}.fa-minus:before{content:""}.fa-asterisk:before{content:""}.fa-exclamation-circle:before,.wy-inline-validate.wy-inline-validate-warning .wy-input-context:before,.wy-inline-validate.wy-inline-validate-info .wy-input-context:before,.rst-content .admonition-title:before{content:""}.fa-gift:before{content:""}.fa-leaf:before{content:""}.fa-fire:before,.icon-fire:before{content:""}.fa-eye:before{content:""}.fa-eye-slash:before{content:""}.fa-warning:before,.fa-exclamation-triangle:before{content:""}.fa-plane:before{content:""}.fa-calendar:before{content:""}.fa-random:before{content:""}.fa-comment:before{content:""}.fa-magnet:before{content:""}.fa-chevron-up:before{content:""}.fa-chevron-down:before{content:""}.fa-retweet:before{content:""}.fa-shopping-cart:before{content:""}.fa-folder:before{content:""}.fa-folder-open:before{content:""}.fa-arrows-v:before{content:""}.fa-arrows-h:before{content:""}.fa-bar-chart-o:before,.fa-bar-chart:before{content:""}.fa-twitter-square:before{content:""}.fa-facebook-square:before{content:""}.fa-camera-retro:before{content:""}.fa-key:before{content:""}.fa-gears:before,.fa-cogs:before{content:""}.fa-comments:before{content:""}.fa-thumbs-o-up:before{content:""}.fa-thumbs-o-down:before{content:""}.fa-star-half:before{content:""}.fa-heart-o:before{content:""}.fa-sign-out:before{content:""}.fa-linkedin-square:before{content:""}.fa-thumb-tack:before{content:""}.fa-external-link:before{content:""}.fa-sign-in:before{content:""}.fa-trophy:before{content:""}.fa-github-square:before{content:""}.fa-upload:before{content:""}.fa-lemon-o:before{content:""}.fa-phone:before{content:""}.fa-square-o:before{content:""}.fa-bookmark-o:before{content:""}.fa-phone-square:before{content:""}.fa-twitter:before{content:""}.fa-facebook-f:before,.fa-facebook:before{content:""}.fa-github:before,.icon-github:before{content:""}.fa-unlock:before{content:""}.fa-credit-card:before{content:""}.fa-feed:before,.fa-rss:before{content:""}.fa-hdd-o:before{content:""}.fa-bullhorn:before{content:""}.fa-bell:before{content:""}.fa-certificate:before{content:""}.fa-hand-o-right:before{content:""}.fa-hand-o-left:before{content:""}.fa-hand-o-up:before{content:""}.fa-hand-o-down:before{content:""}.fa-arrow-circle-left:before,.icon-circle-arrow-left:before{content:""}.fa-arrow-circle-right:before,.icon-circle-arrow-right:before{content:""}.fa-arrow-circle-up:before{content:""}.fa-arrow-circle-down:before{content:""}.fa-globe:before{content:""}.fa-wrench:before{content:""}.fa-tasks:before{content:""}.fa-filter:before{content:""}.fa-briefcase:before{content:""}.fa-arrows-alt:before{content:""}.fa-group:before,.fa-users:before{content:""}.fa-chain:before,.fa-link:before,.icon-link:before{content:""}.fa-cloud:before{content:""}.fa-flask:before{content:""}.fa-cut:before,.fa-scissors:before{content:""}.fa-copy:before,.fa-files-o:before{content:""}.fa-paperclip:before{content:""}.fa-save:before,.fa-floppy-o:before{content:""}.fa-square:before{content:""}.fa-navicon:before,.fa-reorder:before,.fa-bars:before{content:""}.fa-list-ul:before{content:""}.fa-list-ol:before{content:""}.fa-strikethrough:before{content:""}.fa-underline:before{content:""}.fa-table:before{content:""}.fa-magic:before{content:""}.fa-truck:before{content:""}.fa-pinterest:before{content:""}.fa-pinterest-square:before{content:""}.fa-google-plus-square:before{content:""}.fa-google-plus:before{content:""}.fa-money:before{content:""}.fa-caret-down:before,.wy-dropdown .caret:before,.icon-caret-down:before{content:""}.fa-caret-up:before{content:""}.fa-caret-left:before{content:""}.fa-caret-right:before{content:""}.fa-columns:before{content:""}.fa-unsorted:before,.fa-sort:before{content:""}.fa-sort-down:before,.fa-sort-desc:before{content:""}.fa-sort-up:before,.fa-sort-asc:before{content:""}.fa-envelope:before{content:""}.fa-linkedin:before{content:""}.fa-rotate-left:before,.fa-undo:before{content:""}.fa-legal:before,.fa-gavel:before{content:""}.fa-dashboard:before,.fa-tachometer:before{content:""}.fa-comment-o:before{content:""}.fa-comments-o:before{content:""}.fa-flash:before,.fa-bolt:before{content:""}.fa-sitemap:before{content:""}.fa-umbrella:before{content:""}.fa-paste:before,.fa-clipboard:before{content:""}.fa-lightbulb-o:before{content:""}.fa-exchange:before{content:""}.fa-cloud-download:before{content:""}.fa-cloud-upload:before{content:""}.fa-user-md:before{content:""}.fa-stethoscope:before{content:""}.fa-suitcase:before{content:""}.fa-bell-o:before{content:""}.fa-coffee:before{content:""}.fa-cutlery:before{content:""}.fa-file-text-o:before{content:""}.fa-building-o:before{content:""}.fa-hospital-o:before{content:""}.fa-ambulance:before{content:""}.fa-medkit:before{content:""}.fa-fighter-jet:before{content:""}.fa-beer:before{content:""}.fa-h-square:before{content:""}.fa-plus-square:before{content:""}.fa-angle-double-left:before{content:""}.fa-angle-double-right:before{content:""}.fa-angle-double-up:before{content:""}.fa-angle-double-down:before{content:""}.fa-angle-left:before{content:""}.fa-angle-right:before{content:""}.fa-angle-up:before{content:""}.fa-angle-down:before{content:""}.fa-desktop:before{content:""}.fa-laptop:before{content:""}.fa-tablet:before{content:""}.fa-mobile-phone:before,.fa-mobile:before{content:""}.fa-circle-o:before{content:""}.fa-quote-left:before{content:""}.fa-quote-right:before{content:""}.fa-spinner:before{content:""}.fa-circle:before{content:""}.fa-mail-reply:before,.fa-reply:before{content:""}.fa-github-alt:before{content:""}.fa-folder-o:before{content:""}.fa-folder-open-o:before{content:""}.fa-smile-o:before{content:""}.fa-frown-o:before{content:""}.fa-meh-o:before{content:""}.fa-gamepad:before{content:""}.fa-keyboard-o:before{content:""}.fa-flag-o:before{content:""}.fa-flag-checkered:before{content:""}.fa-terminal:before{content:""}.fa-code:before{content:""}.fa-mail-reply-all:before,.fa-reply-all:before{content:""}.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:""}.fa-location-arrow:before{content:""}.fa-crop:before{content:""}.fa-code-fork:before{content:""}.fa-unlink:before,.fa-chain-broken:before{content:""}.fa-question:before{content:""}.fa-info:before{content:""}.fa-exclamation:before{content:""}.fa-superscript:before{content:""}.fa-subscript:before{content:""}.fa-eraser:before{content:""}.fa-puzzle-piece:before{content:""}.fa-microphone:before{content:""}.fa-microphone-slash:before{content:""}.fa-shield:before{content:""}.fa-calendar-o:before{content:""}.fa-fire-extinguisher:before{content:""}.fa-rocket:before{content:""}.fa-maxcdn:before{content:""}.fa-chevron-circle-left:before{content:""}.fa-chevron-circle-right:before{content:""}.fa-chevron-circle-up:before{content:""}.fa-chevron-circle-down:before{content:""}.fa-html5:before{content:""}.fa-css3:before{content:""}.fa-anchor:before{content:""}.fa-unlock-alt:before{content:""}.fa-bullseye:before{content:""}.fa-ellipsis-h:before{content:""}.fa-ellipsis-v:before{content:""}.fa-rss-square:before{content:""}.fa-play-circle:before{content:""}.fa-ticket:before{content:""}.fa-minus-square:before{content:""}.fa-minus-square-o:before,.wy-menu-vertical li.on a span.toctree-expand:before,.wy-menu-vertical li.current>a span.toctree-expand:before{content:""}.fa-level-up:before{content:""}.fa-level-down:before{content:""}.fa-check-square:before{content:""}.fa-pencil-square:before{content:""}.fa-external-link-square:before{content:""}.fa-share-square:before{content:""}.fa-compass:before{content:""}.fa-toggle-down:before,.fa-caret-square-o-down:before{content:""}.fa-toggle-up:before,.fa-caret-square-o-up:before{content:""}.fa-toggle-right:before,.fa-caret-square-o-right:before{content:""}.fa-euro:before,.fa-eur:before{content:""}.fa-gbp:before{content:""}.fa-dollar:before,.fa-usd:before{content:""}.fa-rupee:before,.fa-inr:before{content:""}.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:""}.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:""}.fa-won:before,.fa-krw:before{content:""}.fa-bitcoin:before,.fa-btc:before{content:""}.fa-file:before{content:""}.fa-file-text:before{content:""}.fa-sort-alpha-asc:before{content:""}.fa-sort-alpha-desc:before{content:""}.fa-sort-amount-asc:before{content:""}.fa-sort-amount-desc:before{content:""}.fa-sort-numeric-asc:before{content:""}.fa-sort-numeric-desc:before{content:""}.fa-thumbs-up:before{content:""}.fa-thumbs-down:before{content:""}.fa-youtube-square:before{content:""}.fa-youtube:before{content:""}.fa-xing:before{content:""}.fa-xing-square:before{content:""}.fa-youtube-play:before{content:""}.fa-dropbox:before{content:""}.fa-stack-overflow:before{content:""}.fa-instagram:before{content:""}.fa-flickr:before{content:""}.fa-adn:before{content:""}.fa-bitbucket:before,.icon-bitbucket:before{content:""}.fa-bitbucket-square:before{content:""}.fa-tumblr:before{content:""}.fa-tumblr-square:before{content:""}.fa-long-arrow-down:before{content:""}.fa-long-arrow-up:before{content:""}.fa-long-arrow-left:before{content:""}.fa-long-arrow-right:before{content:""}.fa-apple:before{content:""}.fa-windows:before{content:""}.fa-android:before{content:""}.fa-linux:before{content:""}.fa-dribbble:before{content:""}.fa-skype:before{content:""}.fa-foursquare:before{content:""}.fa-trello:before{content:""}.fa-female:before{content:""}.fa-male:before{content:""}.fa-gittip:before,.fa-gratipay:before{content:""}.fa-sun-o:before{content:""}.fa-moon-o:before{content:""}.fa-archive:before{content:""}.fa-bug:before{content:""}.fa-vk:before{content:""}.fa-weibo:before{content:""}.fa-renren:before{content:""}.fa-pagelines:before{content:""}.fa-stack-exchange:before{content:""}.fa-arrow-circle-o-right:before{content:""}.fa-arrow-circle-o-left:before{content:""}.fa-toggle-left:before,.fa-caret-square-o-left:before{content:""}.fa-dot-circle-o:before{content:""}.fa-wheelchair:before{content:""}.fa-vimeo-square:before{content:""}.fa-turkish-lira:before,.fa-try:before{content:""}.fa-plus-square-o:before,.wy-menu-vertical li span.toctree-expand:before{content:""}.fa-space-shuttle:before{content:""}.fa-slack:before{content:""}.fa-envelope-square:before{content:""}.fa-wordpress:before{content:""}.fa-openid:before{content:""}.fa-institution:before,.fa-bank:before,.fa-university:before{content:""}.fa-mortar-board:before,.fa-graduation-cap:before{content:""}.fa-yahoo:before{content:""}.fa-google:before{content:""}.fa-reddit:before{content:""}.fa-reddit-square:before{content:""}.fa-stumbleupon-circle:before{content:""}.fa-stumbleupon:before{content:""}.fa-delicious:before{content:""}.fa-digg:before{content:""}.fa-pied-piper-pp:before{content:""}.fa-pied-piper-alt:before{content:""}.fa-drupal:before{content:""}.fa-joomla:before{content:""}.fa-language:before{content:""}.fa-fax:before{content:""}.fa-building:before{content:""}.fa-child:before{content:""}.fa-paw:before{content:""}.fa-spoon:before{content:""}.fa-cube:before{content:""}.fa-cubes:before{content:""}.fa-behance:before{content:""}.fa-behance-square:before{content:""}.fa-steam:before{content:""}.fa-steam-square:before{content:""}.fa-recycle:before{content:""}.fa-automobile:before,.fa-car:before{content:""}.fa-cab:before,.fa-taxi:before{content:""}.fa-tree:before{content:""}.fa-spotify:before{content:""}.fa-deviantart:before{content:""}.fa-soundcloud:before{content:""}.fa-database:before{content:""}.fa-file-pdf-o:before{content:""}.fa-file-word-o:before{content:""}.fa-file-excel-o:before{content:""}.fa-file-powerpoint-o:before{content:""}.fa-file-photo-o:before,.fa-file-picture-o:before,.fa-file-image-o:before{content:""}.fa-file-zip-o:before,.fa-file-archive-o:before{content:""}.fa-file-sound-o:before,.fa-file-audio-o:before{content:""}.fa-file-movie-o:before,.fa-file-video-o:before{content:""}.fa-file-code-o:before{content:""}.fa-vine:before{content:""}.fa-codepen:before{content:""}.fa-jsfiddle:before{content:""}.fa-life-bouy:before,.fa-life-buoy:before,.fa-life-saver:before,.fa-support:before,.fa-life-ring:before{content:""}.fa-circle-o-notch:before{content:""}.fa-ra:before,.fa-resistance:before,.fa-rebel:before{content:""}.fa-ge:before,.fa-empire:before{content:""}.fa-git-square:before{content:""}.fa-git:before{content:""}.fa-y-combinator-square:before,.fa-yc-square:before,.fa-hacker-news:before{content:""}.fa-tencent-weibo:before{content:""}.fa-qq:before{content:""}.fa-wechat:before,.fa-weixin:before{content:""}.fa-send:before,.fa-paper-plane:before{content:""}.fa-send-o:before,.fa-paper-plane-o:before{content:""}.fa-history:before{content:""}.fa-circle-thin:before{content:""}.fa-header:before{content:""}.fa-paragraph:before{content:""}.fa-sliders:before{content:""}.fa-share-alt:before{content:""}.fa-share-alt-square:before{content:""}.fa-bomb:before{content:""}.fa-soccer-ball-o:before,.fa-futbol-o:before{content:""}.fa-tty:before{content:""}.fa-binoculars:before{content:""}.fa-plug:before{content:""}.fa-slideshare:before{content:""}.fa-twitch:before{content:""}.fa-yelp:before{content:""}.fa-newspaper-o:before{content:""}.fa-wifi:before{content:""}.fa-calculator:before{content:""}.fa-paypal:before{content:""}.fa-google-wallet:before{content:""}.fa-cc-visa:before{content:""}.fa-cc-mastercard:before{content:""}.fa-cc-discover:before{content:""}.fa-cc-amex:before{content:""}.fa-cc-paypal:before{content:""}.fa-cc-stripe:before{content:""}.fa-bell-slash:before{content:""}.fa-bell-slash-o:before{content:""}.fa-trash:before{content:""}.fa-copyright:before{content:""}.fa-at:before{content:""}.fa-eyedropper:before{content:""}.fa-paint-brush:before{content:""}.fa-birthday-cake:before{content:""}.fa-area-chart:before{content:""}.fa-pie-chart:before{content:""}.fa-line-chart:before{content:""}.fa-lastfm:before{content:""}.fa-lastfm-square:before{content:""}.fa-toggle-off:before{content:""}.fa-toggle-on:before{content:""}.fa-bicycle:before{content:""}.fa-bus:before{content:""}.fa-ioxhost:before{content:""}.fa-angellist:before{content:""}.fa-cc:before{content:""}.fa-shekel:before,.fa-sheqel:before,.fa-ils:before{content:""}.fa-meanpath:before{content:""}.fa-buysellads:before{content:""}.fa-connectdevelop:before{content:""}.fa-dashcube:before{content:""}.fa-forumbee:before{content:""}.fa-leanpub:before{content:""}.fa-sellsy:before{content:""}.fa-shirtsinbulk:before{content:""}.fa-simplybuilt:before{content:""}.fa-skyatlas:before{content:""}.fa-cart-plus:before{content:""}.fa-cart-arrow-down:before{content:""}.fa-diamond:before{content:""}.fa-ship:before{content:""}.fa-user-secret:before{content:""}.fa-motorcycle:before{content:""}.fa-street-view:before{content:""}.fa-heartbeat:before{content:""}.fa-venus:before{content:""}.fa-mars:before{content:""}.fa-mercury:before{content:""}.fa-intersex:before,.fa-transgender:before{content:""}.fa-transgender-alt:before{content:""}.fa-venus-double:before{content:""}.fa-mars-double:before{content:""}.fa-venus-mars:before{content:""}.fa-mars-stroke:before{content:""}.fa-mars-stroke-v:before{content:""}.fa-mars-stroke-h:before{content:""}.fa-neuter:before{content:""}.fa-genderless:before{content:""}.fa-facebook-official:before{content:""}.fa-pinterest-p:before{content:""}.fa-whatsapp:before{content:""}.fa-server:before{content:""}.fa-user-plus:before{content:""}.fa-user-times:before{content:""}.fa-hotel:before,.fa-bed:before{content:""}.fa-viacoin:before{content:""}.fa-train:before{content:""}.fa-subway:before{content:""}.fa-medium:before{content:""}.fa-yc:before,.fa-y-combinator:before{content:""}.fa-optin-monster:before{content:""}.fa-opencart:before{content:""}.fa-expeditedssl:before{content:""}.fa-battery-4:before,.fa-battery:before,.fa-battery-full:before{content:""}.fa-battery-3:before,.fa-battery-three-quarters:before{content:""}.fa-battery-2:before,.fa-battery-half:before{content:""}.fa-battery-1:before,.fa-battery-quarter:before{content:""}.fa-battery-0:before,.fa-battery-empty:before{content:""}.fa-mouse-pointer:before{content:""}.fa-i-cursor:before{content:""}.fa-object-group:before{content:""}.fa-object-ungroup:before{content:""}.fa-sticky-note:before{content:""}.fa-sticky-note-o:before{content:""}.fa-cc-jcb:before{content:""}.fa-cc-diners-club:before{content:""}.fa-clone:before{content:""}.fa-balance-scale:before{content:""}.fa-hourglass-o:before{content:""}.fa-hourglass-1:before,.fa-hourglass-start:before{content:""}.fa-hourglass-2:before,.fa-hourglass-half:before{content:""}.fa-hourglass-3:before,.fa-hourglass-end:before{content:""}.fa-hourglass:before{content:""}.fa-hand-grab-o:before,.fa-hand-rock-o:before{content:""}.fa-hand-stop-o:before,.fa-hand-paper-o:before{content:""}.fa-hand-scissors-o:before{content:""}.fa-hand-lizard-o:before{content:""}.fa-hand-spock-o:before{content:""}.fa-hand-pointer-o:before{content:""}.fa-hand-peace-o:before{content:""}.fa-trademark:before{content:""}.fa-registered:before{content:""}.fa-creative-commons:before{content:""}.fa-gg:before{content:""}.fa-gg-circle:before{content:""}.fa-tripadvisor:before{content:""}.fa-odnoklassniki:before{content:""}.fa-odnoklassniki-square:before{content:""}.fa-get-pocket:before{content:""}.fa-wikipedia-w:before{content:""}.fa-safari:before{content:""}.fa-chrome:before{content:""}.fa-firefox:before{content:""}.fa-opera:before{content:""}.fa-internet-explorer:before{content:""}.fa-tv:before,.fa-television:before{content:""}.fa-contao:before{content:""}.fa-500px:before{content:""}.fa-amazon:before{content:""}.fa-calendar-plus-o:before{content:""}.fa-calendar-minus-o:before{content:""}.fa-calendar-times-o:before{content:""}.fa-calendar-check-o:before{content:""}.fa-industry:before{content:""}.fa-map-pin:before{content:""}.fa-map-signs:before{content:""}.fa-map-o:before{content:""}.fa-map:before{content:""}.fa-commenting:before{content:""}.fa-commenting-o:before{content:""}.fa-houzz:before{content:""}.fa-vimeo:before{content:""}.fa-black-tie:before{content:""}.fa-fonticons:before{content:""}.fa-reddit-alien:before{content:""}.fa-edge:before{content:""}.fa-credit-card-alt:before{content:""}.fa-codiepie:before{content:""}.fa-modx:before{content:""}.fa-fort-awesome:before{content:""}.fa-usb:before{content:""}.fa-product-hunt:before{content:""}.fa-mixcloud:before{content:""}.fa-scribd:before{content:""}.fa-pause-circle:before{content:""}.fa-pause-circle-o:before{content:""}.fa-stop-circle:before{content:""}.fa-stop-circle-o:before{content:""}.fa-shopping-bag:before{content:""}.fa-shopping-basket:before{content:""}.fa-hashtag:before{content:""}.fa-bluetooth:before{content:""}.fa-bluetooth-b:before{content:""}.fa-percent:before{content:""}.fa-gitlab:before,.icon-gitlab:before{content:""}.fa-wpbeginner:before{content:""}.fa-wpforms:before{content:""}.fa-envira:before{content:""}.fa-universal-access:before{content:""}.fa-wheelchair-alt:before{content:""}.fa-question-circle-o:before{content:""}.fa-blind:before{content:""}.fa-audio-description:before{content:""}.fa-volume-control-phone:before{content:""}.fa-braille:before{content:""}.fa-assistive-listening-systems:before{content:""}.fa-asl-interpreting:before,.fa-american-sign-language-interpreting:before{content:""}.fa-deafness:before,.fa-hard-of-hearing:before,.fa-deaf:before{content:""}.fa-glide:before{content:""}.fa-glide-g:before{content:""}.fa-signing:before,.fa-sign-language:before{content:""}.fa-low-vision:before{content:""}.fa-viadeo:before{content:""}.fa-viadeo-square:before{content:""}.fa-snapchat:before{content:""}.fa-snapchat-ghost:before{content:""}.fa-snapchat-square:before{content:""}.fa-pied-piper:before{content:""}.fa-first-order:before{content:""}.fa-yoast:before{content:""}.fa-themeisle:before{content:""}.fa-google-plus-circle:before,.fa-google-plus-official:before{content:""}.fa-fa:before,.fa-font-awesome:before{content:""}.fa-handshake-o:before{content:""}.fa-envelope-open:before{content:""}.fa-envelope-open-o:before{content:""}.fa-linode:before{content:""}.fa-address-book:before{content:""}.fa-address-book-o:before{content:""}.fa-vcard:before,.fa-address-card:before{content:""}.fa-vcard-o:before,.fa-address-card-o:before{content:""}.fa-user-circle:before{content:""}.fa-user-circle-o:before{content:""}.fa-user-o:before{content:""}.fa-id-badge:before{content:""}.fa-drivers-license:before,.fa-id-card:before{content:""}.fa-drivers-license-o:before,.fa-id-card-o:before{content:""}.fa-quora:before{content:""}.fa-free-code-camp:before{content:""}.fa-telegram:before{content:""}.fa-thermometer-4:before,.fa-thermometer:before,.fa-thermometer-full:before{content:""}.fa-thermometer-3:before,.fa-thermometer-three-quarters:before{content:""}.fa-thermometer-2:before,.fa-thermometer-half:before{content:""}.fa-thermometer-1:before,.fa-thermometer-quarter:before{content:""}.fa-thermometer-0:before,.fa-thermometer-empty:before{content:""}.fa-shower:before{content:""}.fa-bathtub:before,.fa-s15:before,.fa-bath:before{content:""}.fa-podcast:before{content:""}.fa-window-maximize:before{content:""}.fa-window-minimize:before{content:""}.fa-window-restore:before{content:""}.fa-times-rectangle:before,.fa-window-close:before{content:""}.fa-times-rectangle-o:before,.fa-window-close-o:before{content:""}.fa-bandcamp:before{content:""}.fa-grav:before{content:""}.fa-etsy:before{content:""}.fa-imdb:before{content:""}.fa-ravelry:before{content:""}.fa-eercast:before{content:""}.fa-microchip:before{content:""}.fa-snowflake-o:before{content:""}.fa-superpowers:before{content:""}.fa-wpexplorer:before{content:""}.fa-meetup:before{content:""}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0, 0, 0, 0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}.fa,.wy-menu-vertical li span.toctree-expand,.wy-menu-vertical li.on a span.toctree-expand,.wy-menu-vertical li.current>a span.toctree-expand,.rst-content .admonition-title,.rst-content h1 .headerlink,.rst-content h2 .headerlink,.rst-content h3 .headerlink,.rst-content h4 .headerlink,.rst-content h5 .headerlink,.rst-content h6 .headerlink,.rst-content dl dt .headerlink,.rst-content p.caption .headerlink,.rst-content tt.download span:first-child,.rst-content code.download span:first-child,.icon,.wy-dropdown .caret,.wy-inline-validate.wy-inline-validate-success .wy-input-context,.wy-inline-validate.wy-inline-validate-danger .wy-input-context,.wy-inline-validate.wy-inline-validate-warning .wy-input-context,.wy-inline-validate.wy-inline-validate-info .wy-input-context{font-family:inherit}.fa:before,.wy-menu-vertical li span.toctree-expand:before,.wy-menu-vertical li.on a span.toctree-expand:before,.wy-menu-vertical li.current>a span.toctree-expand:before,.rst-content .admonition-title:before,.rst-content h1 .headerlink:before,.rst-content h2 .headerlink:before,.rst-content h3 .headerlink:before,.rst-content h4 .headerlink:before,.rst-content h5 .headerlink:before,.rst-content h6 .headerlink:before,.rst-content dl dt .headerlink:before,.rst-content p.caption .headerlink:before,.rst-content tt.download span:first-child:before,.rst-content code.download span:first-child:before,.icon:before,.wy-dropdown .caret:before,.wy-inline-validate.wy-inline-validate-success .wy-input-context:before,.wy-inline-validate.wy-inline-validate-danger .wy-input-context:before,.wy-inline-validate.wy-inline-validate-warning .wy-input-context:before,.wy-inline-validate.wy-inline-validate-info .wy-input-context:before{font-family:"FontAwesome";display:inline-block;font-style:normal;font-weight:normal;line-height:1;text-decoration:inherit}a .fa,a .wy-menu-vertical li span.toctree-expand,.wy-menu-vertical li a span.toctree-expand,.wy-menu-vertical li.on a span.toctree-expand,.wy-menu-vertical li.current>a span.toctree-expand,a .rst-content .admonition-title,.rst-content a .admonition-title,a .rst-content h1 .headerlink,.rst-content h1 a .headerlink,a .rst-content h2 .headerlink,.rst-content h2 a .headerlink,a .rst-content h3 .headerlink,.rst-content h3 a .headerlink,a .rst-content h4 .headerlink,.rst-content h4 a .headerlink,a .rst-content h5 .headerlink,.rst-content h5 a .headerlink,a .rst-content h6 .headerlink,.rst-content h6 a .headerlink,a .rst-content dl dt .headerlink,.rst-content dl dt a .headerlink,a .rst-content p.caption .headerlink,.rst-content p.caption a .headerlink,a .rst-content tt.download span:first-child,.rst-content tt.download a span:first-child,a .rst-content code.download span:first-child,.rst-content code.download a span:first-child,a .icon{display:inline-block;text-decoration:inherit}.btn .fa,.btn .wy-menu-vertical li span.toctree-expand,.wy-menu-vertical li .btn span.toctree-expand,.btn .wy-menu-vertical li.on a span.toctree-expand,.wy-menu-vertical li.on a .btn span.toctree-expand,.btn .wy-menu-vertical li.current>a span.toctree-expand,.wy-menu-vertical li.current>a .btn span.toctree-expand,.btn .rst-content .admonition-title,.rst-content .btn .admonition-title,.btn .rst-content h1 .headerlink,.rst-content h1 .btn .headerlink,.btn .rst-content h2 .headerlink,.rst-content h2 .btn .headerlink,.btn .rst-content h3 .headerlink,.rst-content h3 .btn .headerlink,.btn .rst-content h4 .headerlink,.rst-content h4 .btn .headerlink,.btn .rst-content h5 .headerlink,.rst-content h5 .btn .headerlink,.btn .rst-content h6 .headerlink,.rst-content h6 .btn .headerlink,.btn .rst-content dl dt .headerlink,.rst-content dl dt .btn .headerlink,.btn .rst-content p.caption .headerlink,.rst-content p.caption .btn .headerlink,.btn .rst-content tt.download span:first-child,.rst-content tt.download .btn span:first-child,.btn .rst-content code.download span:first-child,.rst-content code.download .btn span:first-child,.btn .icon,.nav .fa,.nav .wy-menu-vertical li span.toctree-expand,.wy-menu-vertical li .nav span.toctree-expand,.nav .wy-menu-vertical li.on a span.toctree-expand,.wy-menu-vertical li.on a .nav span.toctree-expand,.nav .wy-menu-vertical li.current>a span.toctree-expand,.wy-menu-vertical li.current>a .nav span.toctree-expand,.nav .rst-content .admonition-title,.rst-content .nav .admonition-title,.nav .rst-content h1 .headerlink,.rst-content h1 .nav .headerlink,.nav .rst-content h2 .headerlink,.rst-content h2 .nav .headerlink,.nav .rst-content h3 .headerlink,.rst-content h3 .nav .headerlink,.nav .rst-content h4 .headerlink,.rst-content h4 .nav .headerlink,.nav .rst-content h5 .headerlink,.rst-content h5 .nav .headerlink,.nav .rst-content h6 .headerlink,.rst-content h6 .nav .headerlink,.nav .rst-content dl dt .headerlink,.rst-content dl dt .nav .headerlink,.nav .rst-content p.caption .headerlink,.rst-content p.caption .nav .headerlink,.nav .rst-content tt.download span:first-child,.rst-content tt.download .nav span:first-child,.nav .rst-content code.download span:first-child,.rst-content code.download .nav span:first-child,.nav .icon{display:inline}.btn .fa.fa-large,.btn .wy-menu-vertical li span.fa-large.toctree-expand,.wy-menu-vertical li .btn span.fa-large.toctree-expand,.btn .rst-content .fa-large.admonition-title,.rst-content .btn .fa-large.admonition-title,.btn .rst-content h1 .fa-large.headerlink,.rst-content h1 .btn .fa-large.headerlink,.btn .rst-content h2 .fa-large.headerlink,.rst-content h2 .btn .fa-large.headerlink,.btn .rst-content h3 .fa-large.headerlink,.rst-content h3 .btn .fa-large.headerlink,.btn .rst-content h4 .fa-large.headerlink,.rst-content h4 .btn .fa-large.headerlink,.btn .rst-content h5 .fa-large.headerlink,.rst-content h5 .btn .fa-large.headerlink,.btn .rst-content h6 .fa-large.headerlink,.rst-content h6 .btn .fa-large.headerlink,.btn .rst-content dl dt .fa-large.headerlink,.rst-content dl dt .btn .fa-large.headerlink,.btn .rst-content p.caption .fa-large.headerlink,.rst-content p.caption .btn .fa-large.headerlink,.btn .rst-content tt.download span.fa-large:first-child,.rst-content tt.download .btn span.fa-large:first-child,.btn .rst-content code.download span.fa-large:first-child,.rst-content code.download .btn span.fa-large:first-child,.btn .fa-large.icon,.nav .fa.fa-large,.nav .wy-menu-vertical li span.fa-large.toctree-expand,.wy-menu-vertical li .nav span.fa-large.toctree-expand,.nav .rst-content .fa-large.admonition-title,.rst-content .nav .fa-large.admonition-title,.nav .rst-content h1 .fa-large.headerlink,.rst-content h1 .nav .fa-large.headerlink,.nav .rst-content h2 .fa-large.headerlink,.rst-content h2 .nav .fa-large.headerlink,.nav .rst-content h3 .fa-large.headerlink,.rst-content h3 .nav .fa-large.headerlink,.nav .rst-content h4 .fa-large.headerlink,.rst-content h4 .nav .fa-large.headerlink,.nav .rst-content h5 .fa-large.headerlink,.rst-content h5 .nav .fa-large.headerlink,.nav .rst-content h6 .fa-large.headerlink,.rst-content h6 .nav .fa-large.headerlink,.nav .rst-content dl dt .fa-large.headerlink,.rst-content dl dt .nav .fa-large.headerlink,.nav .rst-content p.caption .fa-large.headerlink,.rst-content p.caption .nav .fa-large.headerlink,.nav .rst-content tt.download span.fa-large:first-child,.rst-content tt.download .nav span.fa-large:first-child,.nav .rst-content code.download span.fa-large:first-child,.rst-content code.download .nav span.fa-large:first-child,.nav .fa-large.icon{line-height:.9em}.btn .fa.fa-spin,.btn .wy-menu-vertical li span.fa-spin.toctree-expand,.wy-menu-vertical li .btn span.fa-spin.toctree-expand,.btn .rst-content .fa-spin.admonition-title,.rst-content .btn .fa-spin.admonition-title,.btn .rst-content h1 .fa-spin.headerlink,.rst-content h1 .btn .fa-spin.headerlink,.btn .rst-content h2 .fa-spin.headerlink,.rst-content h2 .btn .fa-spin.headerlink,.btn .rst-content h3 .fa-spin.headerlink,.rst-content h3 .btn .fa-spin.headerlink,.btn .rst-content h4 .fa-spin.headerlink,.rst-content h4 .btn .fa-spin.headerlink,.btn .rst-content h5 .fa-spin.headerlink,.rst-content h5 .btn .fa-spin.headerlink,.btn .rst-content h6 .fa-spin.headerlink,.rst-content h6 .btn .fa-spin.headerlink,.btn .rst-content dl dt .fa-spin.headerlink,.rst-content dl dt .btn .fa-spin.headerlink,.btn .rst-content p.caption .fa-spin.headerlink,.rst-content p.caption .btn .fa-spin.headerlink,.btn .rst-content tt.download span.fa-spin:first-child,.rst-content tt.download .btn span.fa-spin:first-child,.btn .rst-content code.download span.fa-spin:first-child,.rst-content code.download .btn span.fa-spin:first-child,.btn .fa-spin.icon,.nav .fa.fa-spin,.nav .wy-menu-vertical li span.fa-spin.toctree-expand,.wy-menu-vertical li .nav span.fa-spin.toctree-expand,.nav .rst-content .fa-spin.admonition-title,.rst-content .nav .fa-spin.admonition-title,.nav .rst-content h1 .fa-spin.headerlink,.rst-content h1 .nav .fa-spin.headerlink,.nav .rst-content h2 .fa-spin.headerlink,.rst-content h2 .nav .fa-spin.headerlink,.nav .rst-content h3 .fa-spin.headerlink,.rst-content h3 .nav .fa-spin.headerlink,.nav .rst-content h4 .fa-spin.headerlink,.rst-content h4 .nav .fa-spin.headerlink,.nav .rst-content h5 .fa-spin.headerlink,.rst-content h5 .nav .fa-spin.headerlink,.nav .rst-content h6 .fa-spin.headerlink,.rst-content h6 .nav .fa-spin.headerlink,.nav .rst-content dl dt .fa-spin.headerlink,.rst-content dl dt .nav .fa-spin.headerlink,.nav .rst-content p.caption .fa-spin.headerlink,.rst-content p.caption .nav .fa-spin.headerlink,.nav .rst-content tt.download span.fa-spin:first-child,.rst-content tt.download .nav span.fa-spin:first-child,.nav .rst-content code.download span.fa-spin:first-child,.rst-content code.download .nav span.fa-spin:first-child,.nav .fa-spin.icon{display:inline-block}.btn.fa:before,.wy-menu-vertical li span.btn.toctree-expand:before,.rst-content .btn.admonition-title:before,.rst-content h1 .btn.headerlink:before,.rst-content h2 .btn.headerlink:before,.rst-content h3 .btn.headerlink:before,.rst-content h4 .btn.headerlink:before,.rst-content h5 .btn.headerlink:before,.rst-content h6 .btn.headerlink:before,.rst-content dl dt .btn.headerlink:before,.rst-content p.caption .btn.headerlink:before,.rst-content tt.download span.btn:first-child:before,.rst-content code.download span.btn:first-child:before,.btn.icon:before{opacity:.5;-webkit-transition:opacity .05s ease-in;-moz-transition:opacity .05s ease-in;transition:opacity .05s ease-in}.btn.fa:hover:before,.wy-menu-vertical li span.btn.toctree-expand:hover:before,.rst-content .btn.admonition-title:hover:before,.rst-content h1 .btn.headerlink:hover:before,.rst-content h2 .btn.headerlink:hover:before,.rst-content h3 .btn.headerlink:hover:before,.rst-content h4 .btn.headerlink:hover:before,.rst-content h5 .btn.headerlink:hover:before,.rst-content h6 .btn.headerlink:hover:before,.rst-content dl dt .btn.headerlink:hover:before,.rst-content p.caption .btn.headerlink:hover:before,.rst-content tt.download span.btn:first-child:hover:before,.rst-content code.download span.btn:first-child:hover:before,.btn.icon:hover:before{opacity:1}.btn-mini .fa:before,.btn-mini .wy-menu-vertical li span.toctree-expand:before,.wy-menu-vertical li .btn-mini span.toctree-expand:before,.btn-mini .rst-content .admonition-title:before,.rst-content .btn-mini .admonition-title:before,.btn-mini .rst-content h1 .headerlink:before,.rst-content h1 .btn-mini .headerlink:before,.btn-mini .rst-content h2 .headerlink:before,.rst-content h2 .btn-mini .headerlink:before,.btn-mini .rst-content h3 .headerlink:before,.rst-content h3 .btn-mini .headerlink:before,.btn-mini .rst-content h4 .headerlink:before,.rst-content h4 .btn-mini .headerlink:before,.btn-mini .rst-content h5 .headerlink:before,.rst-content h5 .btn-mini .headerlink:before,.btn-mini .rst-content h6 .headerlink:before,.rst-content h6 .btn-mini .headerlink:before,.btn-mini .rst-content dl dt .headerlink:before,.rst-content dl dt .btn-mini .headerlink:before,.btn-mini .rst-content p.caption .headerlink:before,.rst-content p.caption .btn-mini .headerlink:before,.btn-mini .rst-content tt.download span:first-child:before,.rst-content tt.download .btn-mini span:first-child:before,.btn-mini .rst-content code.download span:first-child:before,.rst-content code.download .btn-mini span:first-child:before,.btn-mini .icon:before{font-size:14px;vertical-align:-15%}.wy-alert,.rst-content .note,.rst-content .attention,.rst-content .caution,.rst-content .danger,.rst-content .error,.rst-content .hint,.rst-content .important,.rst-content .tip,.rst-content .warning,.rst-content .seealso,.rst-content .admonition-todo{padding:12px;line-height:24px;margin-bottom:24px;background:#e7f2fa}.wy-alert-title,.rst-content .admonition-title{color:#fff;font-weight:bold;display:block;color:#fff;background:#6ab0de;margin:-12px;padding:6px 12px;margin-bottom:12px}.wy-alert.wy-alert-danger,.rst-content .wy-alert-danger.note,.rst-content .wy-alert-danger.attention,.rst-content .wy-alert-danger.caution,.rst-content .danger,.rst-content .error,.rst-content .wy-alert-danger.hint,.rst-content .wy-alert-danger.important,.rst-content .wy-alert-danger.tip,.rst-content .wy-alert-danger.warning,.rst-content .wy-alert-danger.seealso,.rst-content .wy-alert-danger.admonition-todo{background:#fdf3f2}.wy-alert.wy-alert-danger .wy-alert-title,.rst-content .wy-alert-danger.note .wy-alert-title,.rst-content .wy-alert-danger.attention .wy-alert-title,.rst-content .wy-alert-danger.caution .wy-alert-title,.rst-content .danger .wy-alert-title,.rst-content .error .wy-alert-title,.rst-content .wy-alert-danger.hint .wy-alert-title,.rst-content .wy-alert-danger.important .wy-alert-title,.rst-content .wy-alert-danger.tip .wy-alert-title,.rst-content .wy-alert-danger.warning .wy-alert-title,.rst-content .wy-alert-danger.seealso .wy-alert-title,.rst-content .wy-alert-danger.admonition-todo .wy-alert-title,.wy-alert.wy-alert-danger .rst-content .admonition-title,.rst-content .wy-alert.wy-alert-danger .admonition-title,.rst-content .wy-alert-danger.note .admonition-title,.rst-content .wy-alert-danger.attention .admonition-title,.rst-content .wy-alert-danger.caution .admonition-title,.rst-content .danger .admonition-title,.rst-content .error .admonition-title,.rst-content .wy-alert-danger.hint .admonition-title,.rst-content .wy-alert-danger.important .admonition-title,.rst-content .wy-alert-danger.tip .admonition-title,.rst-content .wy-alert-danger.warning .admonition-title,.rst-content .wy-alert-danger.seealso .admonition-title,.rst-content .wy-alert-danger.admonition-todo .admonition-title{background:#f29f97}.wy-alert.wy-alert-warning,.rst-content .wy-alert-warning.note,.rst-content .attention,.rst-content .caution,.rst-content .wy-alert-warning.danger,.rst-content .wy-alert-warning.error,.rst-content .wy-alert-warning.hint,.rst-content .wy-alert-warning.important,.rst-content .wy-alert-warning.tip,.rst-content .warning,.rst-content .wy-alert-warning.seealso,.rst-content .admonition-todo{background:#ffedcc}.wy-alert.wy-alert-warning .wy-alert-title,.rst-content .wy-alert-warning.note .wy-alert-title,.rst-content .attention .wy-alert-title,.rst-content .caution .wy-alert-title,.rst-content .wy-alert-warning.danger .wy-alert-title,.rst-content .wy-alert-warning.error .wy-alert-title,.rst-content .wy-alert-warning.hint .wy-alert-title,.rst-content .wy-alert-warning.important .wy-alert-title,.rst-content .wy-alert-warning.tip .wy-alert-title,.rst-content .warning .wy-alert-title,.rst-content .wy-alert-warning.seealso .wy-alert-title,.rst-content .admonition-todo .wy-alert-title,.wy-alert.wy-alert-warning .rst-content .admonition-title,.rst-content .wy-alert.wy-alert-warning .admonition-title,.rst-content .wy-alert-warning.note .admonition-title,.rst-content .attention .admonition-title,.rst-content .caution .admonition-title,.rst-content .wy-alert-warning.danger .admonition-title,.rst-content .wy-alert-warning.error .admonition-title,.rst-content .wy-alert-warning.hint .admonition-title,.rst-content .wy-alert-warning.important .admonition-title,.rst-content .wy-alert-warning.tip .admonition-title,.rst-content .warning .admonition-title,.rst-content .wy-alert-warning.seealso .admonition-title,.rst-content .admonition-todo .admonition-title{background:#f0b37e}.wy-alert.wy-alert-info,.rst-content .note,.rst-content .wy-alert-info.attention,.rst-content .wy-alert-info.caution,.rst-content .wy-alert-info.danger,.rst-content .wy-alert-info.error,.rst-content .wy-alert-info.hint,.rst-content .wy-alert-info.important,.rst-content .wy-alert-info.tip,.rst-content .wy-alert-info.warning,.rst-content .seealso,.rst-content .wy-alert-info.admonition-todo{background:#e7f2fa}.wy-alert.wy-alert-info .wy-alert-title,.rst-content .note .wy-alert-title,.rst-content .wy-alert-info.attention .wy-alert-title,.rst-content .wy-alert-info.caution .wy-alert-title,.rst-content .wy-alert-info.danger .wy-alert-title,.rst-content .wy-alert-info.error .wy-alert-title,.rst-content .wy-alert-info.hint .wy-alert-title,.rst-content .wy-alert-info.important .wy-alert-title,.rst-content .wy-alert-info.tip .wy-alert-title,.rst-content .wy-alert-info.warning .wy-alert-title,.rst-content .seealso .wy-alert-title,.rst-content .wy-alert-info.admonition-todo .wy-alert-title,.wy-alert.wy-alert-info .rst-content .admonition-title,.rst-content .wy-alert.wy-alert-info .admonition-title,.rst-content .note .admonition-title,.rst-content .wy-alert-info.attention .admonition-title,.rst-content .wy-alert-info.caution .admonition-title,.rst-content .wy-alert-info.danger .admonition-title,.rst-content .wy-alert-info.error .admonition-title,.rst-content .wy-alert-info.hint .admonition-title,.rst-content .wy-alert-info.important .admonition-title,.rst-content .wy-alert-info.tip .admonition-title,.rst-content .wy-alert-info.warning .admonition-title,.rst-content .seealso .admonition-title,.rst-content .wy-alert-info.admonition-todo .admonition-title{background:#6ab0de}.wy-alert.wy-alert-success,.rst-content .wy-alert-success.note,.rst-content .wy-alert-success.attention,.rst-content .wy-alert-success.caution,.rst-content .wy-alert-success.danger,.rst-content .wy-alert-success.error,.rst-content .hint,.rst-content .important,.rst-content .tip,.rst-content .wy-alert-success.warning,.rst-content .wy-alert-success.seealso,.rst-content .wy-alert-success.admonition-todo{background:#dbfaf4}.wy-alert.wy-alert-success .wy-alert-title,.rst-content .wy-alert-success.note .wy-alert-title,.rst-content .wy-alert-success.attention .wy-alert-title,.rst-content .wy-alert-success.caution .wy-alert-title,.rst-content .wy-alert-success.danger .wy-alert-title,.rst-content .wy-alert-success.error .wy-alert-title,.rst-content .hint .wy-alert-title,.rst-content .important .wy-alert-title,.rst-content .tip .wy-alert-title,.rst-content .wy-alert-success.warning .wy-alert-title,.rst-content .wy-alert-success.seealso .wy-alert-title,.rst-content .wy-alert-success.admonition-todo .wy-alert-title,.wy-alert.wy-alert-success .rst-content .admonition-title,.rst-content .wy-alert.wy-alert-success .admonition-title,.rst-content .wy-alert-success.note .admonition-title,.rst-content .wy-alert-success.attention .admonition-title,.rst-content .wy-alert-success.caution .admonition-title,.rst-content .wy-alert-success.danger .admonition-title,.rst-content .wy-alert-success.error .admonition-title,.rst-content .hint .admonition-title,.rst-content .important .admonition-title,.rst-content .tip .admonition-title,.rst-content .wy-alert-success.warning .admonition-title,.rst-content .wy-alert-success.seealso .admonition-title,.rst-content .wy-alert-success.admonition-todo .admonition-title{background:#1abc9c}.wy-alert.wy-alert-neutral,.rst-content .wy-alert-neutral.note,.rst-content .wy-alert-neutral.attention,.rst-content .wy-alert-neutral.caution,.rst-content .wy-alert-neutral.danger,.rst-content .wy-alert-neutral.error,.rst-content .wy-alert-neutral.hint,.rst-content .wy-alert-neutral.important,.rst-content .wy-alert-neutral.tip,.rst-content .wy-alert-neutral.warning,.rst-content .wy-alert-neutral.seealso,.rst-content .wy-alert-neutral.admonition-todo{background:#f3f6f6}.wy-alert.wy-alert-neutral .wy-alert-title,.rst-content .wy-alert-neutral.note .wy-alert-title,.rst-content .wy-alert-neutral.attention .wy-alert-title,.rst-content .wy-alert-neutral.caution .wy-alert-title,.rst-content .wy-alert-neutral.danger .wy-alert-title,.rst-content .wy-alert-neutral.error .wy-alert-title,.rst-content .wy-alert-neutral.hint .wy-alert-title,.rst-content .wy-alert-neutral.important .wy-alert-title,.rst-content .wy-alert-neutral.tip .wy-alert-title,.rst-content .wy-alert-neutral.warning .wy-alert-title,.rst-content .wy-alert-neutral.seealso .wy-alert-title,.rst-content .wy-alert-neutral.admonition-todo .wy-alert-title,.wy-alert.wy-alert-neutral .rst-content .admonition-title,.rst-content .wy-alert.wy-alert-neutral .admonition-title,.rst-content .wy-alert-neutral.note .admonition-title,.rst-content .wy-alert-neutral.attention .admonition-title,.rst-content .wy-alert-neutral.caution .admonition-title,.rst-content .wy-alert-neutral.danger .admonition-title,.rst-content .wy-alert-neutral.error .admonition-title,.rst-content .wy-alert-neutral.hint .admonition-title,.rst-content .wy-alert-neutral.important .admonition-title,.rst-content .wy-alert-neutral.tip .admonition-title,.rst-content .wy-alert-neutral.warning .admonition-title,.rst-content .wy-alert-neutral.seealso .admonition-title,.rst-content .wy-alert-neutral.admonition-todo .admonition-title{color:#404040;background:#e1e4e5}.wy-alert.wy-alert-neutral a,.rst-content .wy-alert-neutral.note a,.rst-content .wy-alert-neutral.attention a,.rst-content .wy-alert-neutral.caution a,.rst-content .wy-alert-neutral.danger a,.rst-content .wy-alert-neutral.error a,.rst-content .wy-alert-neutral.hint a,.rst-content .wy-alert-neutral.important a,.rst-content .wy-alert-neutral.tip a,.rst-content .wy-alert-neutral.warning a,.rst-content .wy-alert-neutral.seealso a,.rst-content .wy-alert-neutral.admonition-todo a{color:#2980B9}.wy-alert p:last-child,.rst-content .note p:last-child,.rst-content .attention p:last-child,.rst-content .caution p:last-child,.rst-content .danger p:last-child,.rst-content .error p:last-child,.rst-content .hint p:last-child,.rst-content .important p:last-child,.rst-content .tip p:last-child,.rst-content .warning p:last-child,.rst-content .seealso p:last-child,.rst-content .admonition-todo p:last-child{margin-bottom:0}.wy-tray-container{position:fixed;bottom:0px;left:0;z-index:600}.wy-tray-container li{display:block;width:300px;background:transparent;color:#fff;text-align:center;box-shadow:0 5px 5px 0 rgba(0,0,0,0.1);padding:0 24px;min-width:20%;opacity:0;height:0;line-height:56px;overflow:hidden;-webkit-transition:all .3s ease-in;-moz-transition:all .3s ease-in;transition:all .3s ease-in}.wy-tray-container li.wy-tray-item-success{background:#27AE60}.wy-tray-container li.wy-tray-item-info{background:#2980B9}.wy-tray-container li.wy-tray-item-warning{background:#E67E22}.wy-tray-container li.wy-tray-item-danger{background:#E74C3C}.wy-tray-container li.on{opacity:1;height:56px}@media screen and (max-width: 768px){.wy-tray-container{bottom:auto;top:0;width:100%}.wy-tray-container li{width:100%}}button{font-size:100%;margin:0;vertical-align:baseline;*vertical-align:middle;cursor:pointer;line-height:normal;-webkit-appearance:button;*overflow:visible}button::-moz-focus-inner,input::-moz-focus-inner{border:0;padding:0}button[disabled]{cursor:default}.btn{display:inline-block;border-radius:2px;line-height:normal;white-space:nowrap;text-align:center;cursor:pointer;font-size:100%;padding:6px 12px 8px 12px;color:#fff;border:1px solid rgba(0,0,0,0.1);background-color:#27AE60;text-decoration:none;font-weight:normal;font-family:"Lato","proxima-nova","Helvetica Neue",Arial,sans-serif;box-shadow:0px 1px 2px -1px rgba(255,255,255,0.5) inset,0px -2px 0px 0px rgba(0,0,0,0.1) inset;outline-none:false;vertical-align:middle;*display:inline;zoom:1;-webkit-user-drag:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;-webkit-transition:all .1s linear;-moz-transition:all .1s linear;transition:all .1s linear}.btn-hover{background:#2e8ece;color:#fff}.btn:hover{background:#2cc36b;color:#fff}.btn:focus{background:#2cc36b;outline:0}.btn:active{box-shadow:0px -1px 0px 0px rgba(0,0,0,0.05) inset,0px 2px 0px 0px rgba(0,0,0,0.1) inset;padding:8px 12px 6px 12px}.btn:visited{color:#fff}.btn:disabled{background-image:none;filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);filter:alpha(opacity=40);opacity:.4;cursor:not-allowed;box-shadow:none}.btn-disabled{background-image:none;filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);filter:alpha(opacity=40);opacity:.4;cursor:not-allowed;box-shadow:none}.btn-disabled:hover,.btn-disabled:focus,.btn-disabled:active{background-image:none;filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);filter:alpha(opacity=40);opacity:.4;cursor:not-allowed;box-shadow:none}.btn::-moz-focus-inner{padding:0;border:0}.btn-small{font-size:80%}.btn-info{background-color:#2980B9 !important}.btn-info:hover{background-color:#2e8ece !important}.btn-neutral{background-color:#f3f6f6 !important;color:#404040 !important}.btn-neutral:hover{background-color:#e5ebeb !important;color:#404040}.btn-neutral:visited{color:#404040 !important}.btn-success{background-color:#27AE60 !important}.btn-success:hover{background-color:#295 !important}.btn-danger{background-color:#E74C3C !important}.btn-danger:hover{background-color:#ea6153 !important}.btn-warning{background-color:#E67E22 !important}.btn-warning:hover{background-color:#e98b39 !important}.btn-invert{background-color:#222}.btn-invert:hover{background-color:#2f2f2f !important}.btn-link{background-color:transparent !important;color:#2980B9;box-shadow:none;border-color:transparent !important}.btn-link:hover{background-color:transparent !important;color:#409ad5 !important;box-shadow:none}.btn-link:active{background-color:transparent !important;color:#409ad5 !important;box-shadow:none}.btn-link:visited{color:#9B59B6}.wy-btn-group .btn,.wy-control .btn{vertical-align:middle}.wy-btn-group{margin-bottom:24px;*zoom:1}.wy-btn-group:before,.wy-btn-group:after{display:table;content:""}.wy-btn-group:after{clear:both}.wy-dropdown{position:relative;display:inline-block}.wy-dropdown-active .wy-dropdown-menu{display:block}.wy-dropdown-menu{position:absolute;left:0;display:none;float:left;top:100%;min-width:100%;background:#fcfcfc;z-index:100;border:solid 1px #cfd7dd;box-shadow:0 2px 2px 0 rgba(0,0,0,0.1);padding:12px}.wy-dropdown-menu>dd>a{display:block;clear:both;color:#404040;white-space:nowrap;font-size:90%;padding:0 12px;cursor:pointer}.wy-dropdown-menu>dd>a:hover{background:#2980B9;color:#fff}.wy-dropdown-menu>dd.divider{border-top:solid 1px #cfd7dd;margin:6px 0}.wy-dropdown-menu>dd.search{padding-bottom:12px}.wy-dropdown-menu>dd.search input[type="search"]{width:100%}.wy-dropdown-menu>dd.call-to-action{background:#e3e3e3;text-transform:uppercase;font-weight:500;font-size:80%}.wy-dropdown-menu>dd.call-to-action:hover{background:#e3e3e3}.wy-dropdown-menu>dd.call-to-action .btn{color:#fff}.wy-dropdown.wy-dropdown-up .wy-dropdown-menu{bottom:100%;top:auto;left:auto;right:0}.wy-dropdown.wy-dropdown-bubble .wy-dropdown-menu{background:#fcfcfc;margin-top:2px}.wy-dropdown.wy-dropdown-bubble .wy-dropdown-menu a{padding:6px 12px}.wy-dropdown.wy-dropdown-bubble .wy-dropdown-menu a:hover{background:#2980B9;color:#fff}.wy-dropdown.wy-dropdown-left .wy-dropdown-menu{right:0;left:auto;text-align:right}.wy-dropdown-arrow:before{content:" ";border-bottom:5px solid #f5f5f5;border-left:5px solid transparent;border-right:5px solid transparent;position:absolute;display:block;top:-4px;left:50%;margin-left:-3px}.wy-dropdown-arrow.wy-dropdown-arrow-left:before{left:11px}.wy-form-stacked select{display:block}.wy-form-aligned input,.wy-form-aligned textarea,.wy-form-aligned select,.wy-form-aligned .wy-help-inline,.wy-form-aligned label{display:inline-block;*display:inline;*zoom:1;vertical-align:middle}.wy-form-aligned .wy-control-group>label{display:inline-block;vertical-align:middle;width:10em;margin:6px 12px 0 0;float:left}.wy-form-aligned .wy-control{float:left}.wy-form-aligned .wy-control label{display:block}.wy-form-aligned .wy-control select{margin-top:6px}fieldset{border:0;margin:0;padding:0}legend{display:block;width:100%;border:0;padding:0;white-space:normal;margin-bottom:24px;font-size:150%;*margin-left:-7px}label{display:block;margin:0 0 .3125em 0;color:#333;font-size:90%}input,select,textarea{font-size:100%;margin:0;vertical-align:baseline;*vertical-align:middle}.wy-control-group{margin-bottom:24px;*zoom:1;max-width:68em;margin-left:auto;margin-right:auto;*zoom:1}.wy-control-group:before,.wy-control-group:after{display:table;content:""}.wy-control-group:after{clear:both}.wy-control-group:before,.wy-control-group:after{display:table;content:""}.wy-control-group:after{clear:both}.wy-control-group.wy-control-group-required>label:after{content:" *";color:#E74C3C}.wy-control-group .wy-form-full,.wy-control-group .wy-form-halves,.wy-control-group .wy-form-thirds{padding-bottom:12px}.wy-control-group .wy-form-full select,.wy-control-group .wy-form-halves select,.wy-control-group .wy-form-thirds select{width:100%}.wy-control-group .wy-form-full input[type="text"],.wy-control-group .wy-form-full input[type="password"],.wy-control-group .wy-form-full input[type="email"],.wy-control-group .wy-form-full input[type="url"],.wy-control-group .wy-form-full input[type="date"],.wy-control-group .wy-form-full input[type="month"],.wy-control-group .wy-form-full input[type="time"],.wy-control-group .wy-form-full input[type="datetime"],.wy-control-group .wy-form-full input[type="datetime-local"],.wy-control-group .wy-form-full input[type="week"],.wy-control-group .wy-form-full input[type="number"],.wy-control-group .wy-form-full input[type="search"],.wy-control-group .wy-form-full input[type="tel"],.wy-control-group .wy-form-full input[type="color"],.wy-control-group .wy-form-halves input[type="text"],.wy-control-group .wy-form-halves input[type="password"],.wy-control-group .wy-form-halves input[type="email"],.wy-control-group .wy-form-halves input[type="url"],.wy-control-group .wy-form-halves input[type="date"],.wy-control-group .wy-form-halves input[type="month"],.wy-control-group .wy-form-halves input[type="time"],.wy-control-group .wy-form-halves input[type="datetime"],.wy-control-group .wy-form-halves input[type="datetime-local"],.wy-control-group .wy-form-halves input[type="week"],.wy-control-group .wy-form-halves input[type="number"],.wy-control-group .wy-form-halves input[type="search"],.wy-control-group .wy-form-halves input[type="tel"],.wy-control-group .wy-form-halves input[type="color"],.wy-control-group .wy-form-thirds input[type="text"],.wy-control-group .wy-form-thirds input[type="password"],.wy-control-group .wy-form-thirds input[type="email"],.wy-control-group .wy-form-thirds input[type="url"],.wy-control-group .wy-form-thirds input[type="date"],.wy-control-group .wy-form-thirds input[type="month"],.wy-control-group .wy-form-thirds input[type="time"],.wy-control-group .wy-form-thirds input[type="datetime"],.wy-control-group .wy-form-thirds input[type="datetime-local"],.wy-control-group .wy-form-thirds input[type="week"],.wy-control-group .wy-form-thirds input[type="number"],.wy-control-group .wy-form-thirds input[type="search"],.wy-control-group .wy-form-thirds input[type="tel"],.wy-control-group .wy-form-thirds input[type="color"]{width:100%}.wy-control-group .wy-form-full{float:left;display:block;margin-right:2.35765%;width:100%;margin-right:0}.wy-control-group .wy-form-full:last-child{margin-right:0}.wy-control-group .wy-form-halves{float:left;display:block;margin-right:2.35765%;width:48.82117%}.wy-control-group .wy-form-halves:last-child{margin-right:0}.wy-control-group .wy-form-halves:nth-of-type(2n){margin-right:0}.wy-control-group .wy-form-halves:nth-of-type(2n+1){clear:left}.wy-control-group .wy-form-thirds{float:left;display:block;margin-right:2.35765%;width:31.76157%}.wy-control-group .wy-form-thirds:last-child{margin-right:0}.wy-control-group .wy-form-thirds:nth-of-type(3n){margin-right:0}.wy-control-group .wy-form-thirds:nth-of-type(3n+1){clear:left}.wy-control-group.wy-control-group-no-input .wy-control{margin:6px 0 0 0;font-size:90%}.wy-control-no-input{display:inline-block;margin:6px 0 0 0;font-size:90%}.wy-control-group.fluid-input input[type="text"],.wy-control-group.fluid-input input[type="password"],.wy-control-group.fluid-input input[type="email"],.wy-control-group.fluid-input input[type="url"],.wy-control-group.fluid-input input[type="date"],.wy-control-group.fluid-input input[type="month"],.wy-control-group.fluid-input input[type="time"],.wy-control-group.fluid-input input[type="datetime"],.wy-control-group.fluid-input input[type="datetime-local"],.wy-control-group.fluid-input input[type="week"],.wy-control-group.fluid-input input[type="number"],.wy-control-group.fluid-input input[type="search"],.wy-control-group.fluid-input input[type="tel"],.wy-control-group.fluid-input input[type="color"]{width:100%}.wy-form-message-inline{display:inline-block;padding-left:.3em;color:#666;vertical-align:middle;font-size:90%}.wy-form-message{display:block;color:#999;font-size:70%;margin-top:.3125em;font-style:italic}.wy-form-message p{font-size:inherit;font-style:italic;margin-bottom:6px}.wy-form-message p:last-child{margin-bottom:0}input{line-height:normal}input[type="button"],input[type="reset"],input[type="submit"]{-webkit-appearance:button;cursor:pointer;font-family:"Lato","proxima-nova","Helvetica Neue",Arial,sans-serif;*overflow:visible}input[type="text"],input[type="password"],input[type="email"],input[type="url"],input[type="date"],input[type="month"],input[type="time"],input[type="datetime"],input[type="datetime-local"],input[type="week"],input[type="number"],input[type="search"],input[type="tel"],input[type="color"]{-webkit-appearance:none;padding:6px;display:inline-block;border:1px solid #ccc;font-size:80%;font-family:"Lato","proxima-nova","Helvetica Neue",Arial,sans-serif;box-shadow:inset 0 1px 3px #ddd;border-radius:0;-webkit-transition:border .3s linear;-moz-transition:border .3s linear;transition:border .3s linear}input[type="datetime-local"]{padding:.34375em .625em}input[disabled]{cursor:default}input[type="checkbox"],input[type="radio"]{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;padding:0;margin-right:.3125em;*height:13px;*width:13px}input[type="search"]{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}input[type="search"]::-webkit-search-cancel-button,input[type="search"]::-webkit-search-decoration{-webkit-appearance:none}input[type="text"]:focus,input[type="password"]:focus,input[type="email"]:focus,input[type="url"]:focus,input[type="date"]:focus,input[type="month"]:focus,input[type="time"]:focus,input[type="datetime"]:focus,input[type="datetime-local"]:focus,input[type="week"]:focus,input[type="number"]:focus,input[type="search"]:focus,input[type="tel"]:focus,input[type="color"]:focus{outline:0;outline:thin dotted \9;border-color:#333}input.no-focus:focus{border-color:#ccc !important}input[type="file"]:focus,input[type="radio"]:focus,input[type="checkbox"]:focus{outline:thin dotted #333;outline:1px auto #129FEA}input[type="text"][disabled],input[type="password"][disabled],input[type="email"][disabled],input[type="url"][disabled],input[type="date"][disabled],input[type="month"][disabled],input[type="time"][disabled],input[type="datetime"][disabled],input[type="datetime-local"][disabled],input[type="week"][disabled],input[type="number"][disabled],input[type="search"][disabled],input[type="tel"][disabled],input[type="color"][disabled]{cursor:not-allowed;background-color:#fafafa}input:focus:invalid,textarea:focus:invalid,select:focus:invalid{color:#E74C3C;border:1px solid #E74C3C}input:focus:invalid:focus,textarea:focus:invalid:focus,select:focus:invalid:focus{border-color:#E74C3C}input[type="file"]:focus:invalid:focus,input[type="radio"]:focus:invalid:focus,input[type="checkbox"]:focus:invalid:focus{outline-color:#E74C3C}input.wy-input-large{padding:12px;font-size:100%}textarea{overflow:auto;vertical-align:top;width:100%;font-family:"Lato","proxima-nova","Helvetica Neue",Arial,sans-serif}select,textarea{padding:.5em .625em;display:inline-block;border:1px solid #ccc;font-size:80%;box-shadow:inset 0 1px 3px #ddd;-webkit-transition:border .3s linear;-moz-transition:border .3s linear;transition:border .3s linear}select{border:1px solid #ccc;background-color:#fff}select[multiple]{height:auto}select:focus,textarea:focus{outline:0}select[disabled],textarea[disabled],input[readonly],select[readonly],textarea[readonly]{cursor:not-allowed;background-color:#fafafa}input[type="radio"][disabled],input[type="checkbox"][disabled]{cursor:not-allowed}.wy-checkbox,.wy-radio{margin:6px 0;color:#404040;display:block}.wy-checkbox input,.wy-radio input{vertical-align:baseline}.wy-form-message-inline{display:inline-block;*display:inline;*zoom:1;vertical-align:middle}.wy-input-prefix,.wy-input-suffix{white-space:nowrap;padding:6px}.wy-input-prefix .wy-input-context,.wy-input-suffix .wy-input-context{line-height:27px;padding:0 8px;display:inline-block;font-size:80%;background-color:#f3f6f6;border:solid 1px #ccc;color:#999}.wy-input-suffix .wy-input-context{border-left:0}.wy-input-prefix .wy-input-context{border-right:0}.wy-switch{position:relative;display:block;height:24px;margin-top:12px;cursor:pointer}.wy-switch:before{position:absolute;content:"";display:block;left:0;top:0;width:36px;height:12px;border-radius:4px;background:#ccc;-webkit-transition:all .2s ease-in-out;-moz-transition:all .2s ease-in-out;transition:all .2s ease-in-out}.wy-switch:after{position:absolute;content:"";display:block;width:18px;height:18px;border-radius:4px;background:#999;left:-3px;top:-3px;-webkit-transition:all .2s ease-in-out;-moz-transition:all .2s ease-in-out;transition:all .2s ease-in-out}.wy-switch span{position:absolute;left:48px;display:block;font-size:12px;color:#ccc;line-height:1}.wy-switch.active:before{background:#1e8449}.wy-switch.active:after{left:24px;background:#27AE60}.wy-switch.disabled{cursor:not-allowed;opacity:.8}.wy-control-group.wy-control-group-error .wy-form-message,.wy-control-group.wy-control-group-error>label{color:#E74C3C}.wy-control-group.wy-control-group-error input[type="text"],.wy-control-group.wy-control-group-error input[type="password"],.wy-control-group.wy-control-group-error input[type="email"],.wy-control-group.wy-control-group-error input[type="url"],.wy-control-group.wy-control-group-error input[type="date"],.wy-control-group.wy-control-group-error input[type="month"],.wy-control-group.wy-control-group-error input[type="time"],.wy-control-group.wy-control-group-error input[type="datetime"],.wy-control-group.wy-control-group-error input[type="datetime-local"],.wy-control-group.wy-control-group-error input[type="week"],.wy-control-group.wy-control-group-error input[type="number"],.wy-control-group.wy-control-group-error input[type="search"],.wy-control-group.wy-control-group-error input[type="tel"],.wy-control-group.wy-control-group-error input[type="color"]{border:solid 1px #E74C3C}.wy-control-group.wy-control-group-error textarea{border:solid 1px #E74C3C}.wy-inline-validate{white-space:nowrap}.wy-inline-validate .wy-input-context{padding:.5em .625em;display:inline-block;font-size:80%}.wy-inline-validate.wy-inline-validate-success .wy-input-context{color:#27AE60}.wy-inline-validate.wy-inline-validate-danger .wy-input-context{color:#E74C3C}.wy-inline-validate.wy-inline-validate-warning .wy-input-context{color:#E67E22}.wy-inline-validate.wy-inline-validate-info .wy-input-context{color:#2980B9}.rotate-90{-webkit-transform:rotate(90deg);-moz-transform:rotate(90deg);-ms-transform:rotate(90deg);-o-transform:rotate(90deg);transform:rotate(90deg)}.rotate-180{-webkit-transform:rotate(180deg);-moz-transform:rotate(180deg);-ms-transform:rotate(180deg);-o-transform:rotate(180deg);transform:rotate(180deg)}.rotate-270{-webkit-transform:rotate(270deg);-moz-transform:rotate(270deg);-ms-transform:rotate(270deg);-o-transform:rotate(270deg);transform:rotate(270deg)}.mirror{-webkit-transform:scaleX(-1);-moz-transform:scaleX(-1);-ms-transform:scaleX(-1);-o-transform:scaleX(-1);transform:scaleX(-1)}.mirror.rotate-90{-webkit-transform:scaleX(-1) rotate(90deg);-moz-transform:scaleX(-1) rotate(90deg);-ms-transform:scaleX(-1) rotate(90deg);-o-transform:scaleX(-1) rotate(90deg);transform:scaleX(-1) rotate(90deg)}.mirror.rotate-180{-webkit-transform:scaleX(-1) rotate(180deg);-moz-transform:scaleX(-1) rotate(180deg);-ms-transform:scaleX(-1) rotate(180deg);-o-transform:scaleX(-1) rotate(180deg);transform:scaleX(-1) rotate(180deg)}.mirror.rotate-270{-webkit-transform:scaleX(-1) rotate(270deg);-moz-transform:scaleX(-1) rotate(270deg);-ms-transform:scaleX(-1) rotate(270deg);-o-transform:scaleX(-1) rotate(270deg);transform:scaleX(-1) rotate(270deg)}@media only screen and (max-width: 480px){.wy-form button[type="submit"]{margin:.7em 0 0}.wy-form input[type="text"],.wy-form input[type="password"],.wy-form input[type="email"],.wy-form input[type="url"],.wy-form input[type="date"],.wy-form input[type="month"],.wy-form input[type="time"],.wy-form input[type="datetime"],.wy-form input[type="datetime-local"],.wy-form input[type="week"],.wy-form input[type="number"],.wy-form input[type="search"],.wy-form input[type="tel"],.wy-form input[type="color"]{margin-bottom:.3em;display:block}.wy-form label{margin-bottom:.3em;display:block}.wy-form input[type="password"],.wy-form input[type="email"],.wy-form input[type="url"],.wy-form input[type="date"],.wy-form input[type="month"],.wy-form input[type="time"],.wy-form input[type="datetime"],.wy-form input[type="datetime-local"],.wy-form input[type="week"],.wy-form input[type="number"],.wy-form input[type="search"],.wy-form input[type="tel"],.wy-form input[type="color"]{margin-bottom:0}.wy-form-aligned .wy-control-group label{margin-bottom:.3em;text-align:left;display:block;width:100%}.wy-form-aligned .wy-control{margin:1.5em 0 0 0}.wy-form .wy-help-inline,.wy-form-message-inline,.wy-form-message{display:block;font-size:80%;padding:6px 0}}@media screen and (max-width: 768px){.tablet-hide{display:none}}@media screen and (max-width: 480px){.mobile-hide{display:none}}.float-left{float:left}.float-right{float:right}.full-width{width:100%}.wy-table,.rst-content table.docutils,.rst-content table.field-list{border-collapse:collapse;border-spacing:0;empty-cells:show;margin-bottom:24px}.wy-table caption,.rst-content table.docutils caption,.rst-content table.field-list caption{color:#000;font:italic 85%/1 arial,sans-serif;padding:1em 0;text-align:center}.wy-table td,.rst-content table.docutils td,.rst-content table.field-list td,.wy-table th,.rst-content table.docutils th,.rst-content table.field-list th{font-size:90%;margin:0;overflow:visible;padding:8px 16px}.wy-table td:first-child,.rst-content table.docutils td:first-child,.rst-content table.field-list td:first-child,.wy-table th:first-child,.rst-content table.docutils th:first-child,.rst-content table.field-list th:first-child{border-left-width:0}.wy-table thead,.rst-content table.docutils thead,.rst-content table.field-list thead{color:#000;text-align:left;vertical-align:bottom;white-space:nowrap}.wy-table thead th,.rst-content table.docutils thead th,.rst-content table.field-list thead th{font-weight:bold;border-bottom:solid 2px #e1e4e5}.wy-table td,.rst-content table.docutils td,.rst-content table.field-list td{background-color:transparent;vertical-align:middle}.wy-table td p,.rst-content table.docutils td p,.rst-content table.field-list td p{line-height:18px}.wy-table td p:last-child,.rst-content table.docutils td p:last-child,.rst-content table.field-list td p:last-child{margin-bottom:0}.wy-table .wy-table-cell-min,.rst-content table.docutils .wy-table-cell-min,.rst-content table.field-list .wy-table-cell-min{width:1%;padding-right:0}.wy-table .wy-table-cell-min input[type=checkbox],.rst-content table.docutils .wy-table-cell-min input[type=checkbox],.rst-content table.field-list .wy-table-cell-min input[type=checkbox],.wy-table .wy-table-cell-min input[type=checkbox],.rst-content table.docutils .wy-table-cell-min input[type=checkbox],.rst-content table.field-list .wy-table-cell-min input[type=checkbox]{margin:0}.wy-table-secondary{color:gray;font-size:90%}.wy-table-tertiary{color:gray;font-size:80%}.wy-table-odd td,.wy-table-striped tr:nth-child(2n-1) td,.rst-content table.docutils:not(.field-list) tr:nth-child(2n-1) td{background-color:#f3f6f6}.wy-table-backed{background-color:#f3f6f6}.wy-table-bordered-all,.rst-content table.docutils{border:1px solid #e1e4e5}.wy-table-bordered-all td,.rst-content table.docutils td{border-bottom:1px solid #e1e4e5;border-left:1px solid #e1e4e5}.wy-table-bordered-all tbody>tr:last-child td,.rst-content table.docutils tbody>tr:last-child td{border-bottom-width:0}.wy-table-bordered{border:1px solid #e1e4e5}.wy-table-bordered-rows td{border-bottom:1px solid #e1e4e5}.wy-table-bordered-rows tbody>tr:last-child td{border-bottom-width:0}.wy-table-horizontal tbody>tr:last-child td{border-bottom-width:0}.wy-table-horizontal td,.wy-table-horizontal th{border-width:0 0 1px 0;border-bottom:1px solid #e1e4e5}.wy-table-horizontal tbody>tr:last-child td{border-bottom-width:0}.wy-table-responsive{margin-bottom:24px;max-width:100%;overflow:auto}.wy-table-responsive table{margin-bottom:0 !important}.wy-table-responsive table td,.wy-table-responsive table th{white-space:nowrap}a{color:#2980B9;text-decoration:none;cursor:pointer}a:hover{color:#3091d1}a:visited{color:#9B59B6}html{height:100%;overflow-x:hidden}body{font-family:"Lato","proxima-nova","Helvetica Neue",Arial,sans-serif;font-weight:normal;color:#404040;min-height:100%;overflow-x:hidden;background:#edf0f2}.wy-text-left{text-align:left}.wy-text-center{text-align:center}.wy-text-right{text-align:right}.wy-text-large{font-size:120%}.wy-text-normal{font-size:100%}.wy-text-small,small{font-size:80%}.wy-text-strike{text-decoration:line-through}.wy-text-warning{color:#E67E22 !important}a.wy-text-warning:hover{color:#eb9950 !important}.wy-text-info{color:#2980B9 !important}a.wy-text-info:hover{color:#409ad5 !important}.wy-text-success{color:#27AE60 !important}a.wy-text-success:hover{color:#36d278 !important}.wy-text-danger{color:#E74C3C !important}a.wy-text-danger:hover{color:#ed7669 !important}.wy-text-neutral{color:#404040 !important}a.wy-text-neutral:hover{color:#595959 !important}h1,h2,.rst-content .toctree-wrapper p.caption,h3,h4,h5,h6,legend{margin-top:0;font-weight:700;font-family:"Roboto Slab","ff-tisa-web-pro","Georgia",Arial,sans-serif}p{line-height:24px;margin:0;font-size:16px;margin-bottom:24px}h1{font-size:175%}h2,.rst-content .toctree-wrapper p.caption{font-size:150%}h3{font-size:125%}h4{font-size:115%}h5{font-size:110%}h6{font-size:100%}hr{display:block;height:1px;border:0;border-top:1px solid #e1e4e5;margin:24px 0;padding:0}code,.rst-content tt,.rst-content code{white-space:nowrap;max-width:100%;background:#fff;border:solid 1px #e1e4e5;font-size:75%;padding:0 5px;font-family:Consolas,"Andale Mono WT","Andale Mono","Lucida Console","Lucida Sans Typewriter","DejaVu Sans Mono","Bitstream Vera Sans Mono","Liberation Mono","Nimbus Mono L",Monaco,"Courier New",Courier,monospace;color:#E74C3C;overflow-x:auto}code.code-large,.rst-content tt.code-large{font-size:90%}.wy-plain-list-disc,.rst-content .section ul,.rst-content .toctree-wrapper ul,article ul{list-style:disc;line-height:24px;margin-bottom:24px}.wy-plain-list-disc li,.rst-content .section ul li,.rst-content .toctree-wrapper ul li,article ul li{list-style:disc;margin-left:24px}.wy-plain-list-disc li p:last-child,.rst-content .section ul li p:last-child,.rst-content .toctree-wrapper ul li p:last-child,article ul li p:last-child{margin-bottom:0}.wy-plain-list-disc li ul,.rst-content .section ul li ul,.rst-content .toctree-wrapper ul li ul,article ul li ul{margin-bottom:0}.wy-plain-list-disc li li,.rst-content .section ul li li,.rst-content .toctree-wrapper ul li li,article ul li li{list-style:circle}.wy-plain-list-disc li li li,.rst-content .section ul li li li,.rst-content .toctree-wrapper ul li li li,article ul li li li{list-style:square}.wy-plain-list-disc li ol li,.rst-content .section ul li ol li,.rst-content .toctree-wrapper ul li ol li,article ul li ol li{list-style:decimal}.wy-plain-list-decimal,.rst-content .section ol,.rst-content ol.arabic,article ol{list-style:decimal;line-height:24px;margin-bottom:24px}.wy-plain-list-decimal li,.rst-content .section ol li,.rst-content ol.arabic li,article ol li{list-style:decimal;margin-left:24px}.wy-plain-list-decimal li p:last-child,.rst-content .section ol li p:last-child,.rst-content ol.arabic li p:last-child,article ol li p:last-child{margin-bottom:0}.wy-plain-list-decimal li ul,.rst-content .section ol li ul,.rst-content ol.arabic li ul,article ol li ul{margin-bottom:0}.wy-plain-list-decimal li ul li,.rst-content .section ol li ul li,.rst-content ol.arabic li ul li,article ol li ul li{list-style:disc}.codeblock-example{border:1px solid #e1e4e5;border-bottom:none;padding:24px;padding-top:48px;font-weight:500;background:#fff;position:relative}.codeblock-example:after{content:"Example";position:absolute;top:0px;left:0px;background:#9B59B6;color:#fff;padding:6px 12px}.codeblock-example.prettyprint-example-only{border:1px solid #e1e4e5;margin-bottom:24px}.codeblock,pre.literal-block,.rst-content .literal-block,.rst-content pre.literal-block,div[class^='highlight']{border:1px solid #e1e4e5;padding:0px;overflow-x:auto;background:#fff;margin:1px 0 24px 0}.codeblock div[class^='highlight'],pre.literal-block div[class^='highlight'],.rst-content .literal-block div[class^='highlight'],div[class^='highlight'] div[class^='highlight']{border:none;background:none;margin:0}div[class^='highlight'] td.code{width:100%}.linenodiv pre{border-right:solid 1px #e6e9ea;margin:0;padding:12px 12px;font-family:Consolas,"Andale Mono WT","Andale Mono","Lucida Console","Lucida Sans Typewriter","DejaVu Sans Mono","Bitstream Vera Sans Mono","Liberation Mono","Nimbus Mono L",Monaco,"Courier New",Courier,monospace;font-size:12px;line-height:1.5;color:#d9d9d9}div[class^='highlight'] pre{white-space:pre;margin:0;padding:12px 12px;font-family:Consolas,"Andale Mono WT","Andale Mono","Lucida Console","Lucida Sans Typewriter","DejaVu Sans Mono","Bitstream Vera Sans Mono","Liberation Mono","Nimbus Mono L",Monaco,"Courier New",Courier,monospace;font-size:12px;line-height:1.5;display:block;overflow:auto;color:#404040}@media print{.codeblock,pre.literal-block,.rst-content .literal-block,.rst-content pre.literal-block,div[class^='highlight'],div[class^='highlight'] pre{white-space:pre-wrap}}.hll{background-color:#ffc;margin:0 -12px;padding:0 12px;display:block}.c{color:#998;font-style:italic}.err{color:#a61717;background-color:#e3d2d2}.k{font-weight:bold}.o{font-weight:bold}.cm{color:#998;font-style:italic}.cp{color:#999;font-weight:bold}.c1{color:#998;font-style:italic}.cs{color:#999;font-weight:bold;font-style:italic}.gd{color:#000;background-color:#fdd}.gd .x{color:#000;background-color:#faa}.ge{font-style:italic}.gr{color:#a00}.gh{color:#999}.gi{color:#000;background-color:#dfd}.gi .x{color:#000;background-color:#afa}.go{color:#888}.gp{color:#555}.gs{font-weight:bold}.gu{color:purple;font-weight:bold}.gt{color:#a00}.kc{font-weight:bold}.kd{font-weight:bold}.kn{font-weight:bold}.kp{font-weight:bold}.kr{font-weight:bold}.kt{color:#458;font-weight:bold}.m{color:#099}.s{color:#d14}.n{color:#333}.na{color:teal}.nb{color:#0086b3}.nc{color:#458;font-weight:bold}.no{color:teal}.ni{color:purple}.ne{color:#900;font-weight:bold}.nf{color:#900;font-weight:bold}.nn{color:#555}.nt{color:navy}.nv{color:teal}.ow{font-weight:bold}.w{color:#bbb}.mf{color:#099}.mh{color:#099}.mi{color:#099}.mo{color:#099}.sb{color:#d14}.sc{color:#d14}.sd{color:#d14}.s2{color:#d14}.se{color:#d14}.sh{color:#d14}.si{color:#d14}.sx{color:#d14}.sr{color:#009926}.s1{color:#d14}.ss{color:#990073}.bp{color:#999}.vc{color:teal}.vg{color:teal}.vi{color:teal}.il{color:#099}.gc{color:#999;background-color:#EAF2F5}.wy-breadcrumbs li{display:inline-block}.wy-breadcrumbs li.wy-breadcrumbs-aside{float:right}.wy-breadcrumbs li a{display:inline-block;padding:5px}.wy-breadcrumbs li a:first-child{padding-left:0}.wy-breadcrumbs li code,.wy-breadcrumbs li .rst-content tt,.rst-content .wy-breadcrumbs li tt{padding:5px;border:none;background:none}.wy-breadcrumbs li code.literal,.wy-breadcrumbs li .rst-content tt.literal,.rst-content .wy-breadcrumbs li tt.literal{color:#404040}.wy-breadcrumbs-extra{margin-bottom:0;color:#b3b3b3;font-size:80%;display:inline-block}@media screen and (max-width: 480px){.wy-breadcrumbs-extra{display:none}.wy-breadcrumbs li.wy-breadcrumbs-aside{display:none}}@media print{.wy-breadcrumbs li.wy-breadcrumbs-aside{display:none}}.wy-affix{position:fixed;top:1.618em}.wy-menu a:hover{text-decoration:none}.wy-menu-horiz{*zoom:1}.wy-menu-horiz:before,.wy-menu-horiz:after{display:table;content:""}.wy-menu-horiz:after{clear:both}.wy-menu-horiz ul,.wy-menu-horiz li{display:inline-block}.wy-menu-horiz li:hover{background:rgba(255,255,255,0.1)}.wy-menu-horiz li.divide-left{border-left:solid 1px #404040}.wy-menu-horiz li.divide-right{border-right:solid 1px #404040}.wy-menu-horiz a{height:32px;display:inline-block;line-height:32px;padding:0 16px}.wy-menu-vertical{width:300px}.wy-menu-vertical header,.wy-menu-vertical p.caption{height:32px;display:inline-block;line-height:32px;padding:0 1.618em;margin-bottom:0;display:block;font-weight:bold;text-transform:uppercase;font-size:80%;color:#6f6f6f;white-space:nowrap}.wy-menu-vertical ul{margin-bottom:0}.wy-menu-vertical li.divide-top{border-top:solid 1px #404040}.wy-menu-vertical li.divide-bottom{border-bottom:solid 1px #404040}.wy-menu-vertical li.current{background:#e3e3e3}.wy-menu-vertical li.current a{color:gray;border-right:solid 1px #c9c9c9;padding:.4045em 2.427em}.wy-menu-vertical li.current a:hover{background:#d6d6d6}.wy-menu-vertical li code,.wy-menu-vertical li .rst-content tt,.rst-content .wy-menu-vertical li tt{border:none;background:inherit;color:inherit;padding-left:0;padding-right:0}.wy-menu-vertical li span.toctree-expand{display:block;float:left;margin-left:-1.2em;font-size:.8em;line-height:1.6em;color:#4d4d4d}.wy-menu-vertical li.on a,.wy-menu-vertical li.current>a{color:#404040;padding:.4045em 1.618em;font-weight:bold;position:relative;background:#fcfcfc;border:none;border-bottom:solid 1px #c9c9c9;border-top:solid 1px #c9c9c9;padding-left:1.618em -4px}.wy-menu-vertical li.on a:hover,.wy-menu-vertical li.current>a:hover{background:#fcfcfc}.wy-menu-vertical li.on a:hover span.toctree-expand,.wy-menu-vertical li.current>a:hover span.toctree-expand{color:gray}.wy-menu-vertical li.on a span.toctree-expand,.wy-menu-vertical li.current>a span.toctree-expand{display:block;font-size:.8em;line-height:1.6em;color:#333}.wy-menu-vertical li.toctree-l1.current li.toctree-l2>ul,.wy-menu-vertical li.toctree-l2.current li.toctree-l3>ul{display:none}.wy-menu-vertical li.toctree-l1.current li.toctree-l2.current>ul,.wy-menu-vertical li.toctree-l2.current li.toctree-l3.current>ul{display:block}.wy-menu-vertical li.toctree-l2.current>a{background:#c9c9c9;padding:.4045em 2.427em}.wy-menu-vertical li.toctree-l2.current li.toctree-l3>a{display:block;background:#c9c9c9;padding:.4045em 4.045em}.wy-menu-vertical li.toctree-l2 a:hover span.toctree-expand{color:gray}.wy-menu-vertical li.toctree-l2 span.toctree-expand{color:#a3a3a3}.wy-menu-vertical li.toctree-l3{font-size:.9em}.wy-menu-vertical li.toctree-l3.current>a{background:#bdbdbd;padding:.4045em 4.045em}.wy-menu-vertical li.toctree-l3.current li.toctree-l4>a{display:block;background:#bdbdbd;padding:.4045em 5.663em;border-top:none;border-bottom:none}.wy-menu-vertical li.toctree-l3 a:hover span.toctree-expand{color:gray}.wy-menu-vertical li.toctree-l3 span.toctree-expand{color:#969696}.wy-menu-vertical li.toctree-l4{font-size:.9em}.wy-menu-vertical li.current ul{display:block}.wy-menu-vertical li ul{margin-bottom:0;display:none}.wy-menu-vertical .local-toc li ul{display:block}.wy-menu-vertical li ul li a{margin-bottom:0;color:#b3b3b3;font-weight:normal}.wy-menu-vertical a{display:inline-block;line-height:18px;padding:.4045em 1.618em;display:block;position:relative;font-size:90%;color:#b3b3b3}.wy-menu-vertical a:hover{background-color:#4e4a4a;cursor:pointer}.wy-menu-vertical a:hover span.toctree-expand{color:#b3b3b3}.wy-menu-vertical a:active{background-color:#2980B9;cursor:pointer;color:#fff}.wy-menu-vertical a:active span.toctree-expand{color:#fff}.wy-side-nav-search{display:block;width:300px;padding:.809em;margin-bottom:.809em;z-index:200;background-color:#2980B9;text-align:center;padding:.809em;display:block;color:#fcfcfc;margin-bottom:.809em}.wy-side-nav-search input[type=text]{width:100%;border-radius:50px;padding:6px 12px;border-color:#2472a4}.wy-side-nav-search img{display:block;margin:auto auto .809em auto;height:45px;width:45px;background-color:#2980B9;padding:5px;border-radius:100%}.wy-side-nav-search>a,.wy-side-nav-search .wy-dropdown>a{color:#fcfcfc;font-size:100%;font-weight:bold;display:inline-block;padding:4px 6px;margin-bottom:.809em}.wy-side-nav-search>a:hover,.wy-side-nav-search .wy-dropdown>a:hover{background:rgba(255,255,255,0.1)}.wy-side-nav-search>a img.logo,.wy-side-nav-search .wy-dropdown>a img.logo{display:block;margin:0 auto;height:auto;width:auto;border-radius:0;max-width:100%;background:transparent}.wy-side-nav-search>a.icon img.logo,.wy-side-nav-search .wy-dropdown>a.icon img.logo{margin-top:.85em}.wy-side-nav-search>div.version{margin-top:-.4045em;margin-bottom:.809em;font-weight:normal;color:rgba(255,255,255,0.3)}.wy-nav .wy-menu-vertical header{color:#2980B9}.wy-nav .wy-menu-vertical a{color:#b3b3b3}.wy-nav .wy-menu-vertical a:hover{background-color:#2980B9;color:#fff}[data-menu-wrap]{-webkit-transition:all .2s ease-in;-moz-transition:all .2s ease-in;transition:all .2s ease-in;position:absolute;opacity:1;width:100%;opacity:0}[data-menu-wrap].move-center{left:0;right:auto;opacity:1}[data-menu-wrap].move-left{right:auto;left:-100%;opacity:0}[data-menu-wrap].move-right{right:-100%;left:auto;opacity:0}.wy-body-for-nav{background:left repeat-y #fcfcfc;background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAEAAAABCAIAAACQd1PeAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyRpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuMy1jMDExIDY2LjE0NTY2MSwgMjAxMi8wMi8wNi0xNDo1NjoyNyAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENTNiAoTWFjaW50b3NoKSIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDoxOERBMTRGRDBFMUUxMUUzODUwMkJCOThDMEVFNURFMCIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDoxOERBMTRGRTBFMUUxMUUzODUwMkJCOThDMEVFNURFMCI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOjE4REExNEZCMEUxRTExRTM4NTAyQkI5OEMwRUU1REUwIiBzdFJlZjpkb2N1bWVudElEPSJ4bXAuZGlkOjE4REExNEZDMEUxRTExRTM4NTAyQkI5OEMwRUU1REUwIi8+IDwvcmRmOkRlc2NyaXB0aW9uPiA8L3JkZjpSREY+IDwveDp4bXBtZXRhPiA8P3hwYWNrZXQgZW5kPSJyIj8+EwrlwAAAAA5JREFUeNpiMDU0BAgwAAE2AJgB9BnaAAAAAElFTkSuQmCC);background-size:300px 1px}.wy-grid-for-nav{position:absolute;width:100%;height:100%}.wy-nav-side{position:fixed;top:0;bottom:0;left:0;padding-bottom:2em;width:300px;overflow-x:hidden;overflow-y:hidden;min-height:100%;background:#343131;z-index:200}.wy-side-scroll{width:320px;position:relative;overflow-x:hidden;overflow-y:scroll;height:100%}.wy-nav-top{display:none;background:#2980B9;color:#fff;padding:.4045em .809em;position:relative;line-height:50px;text-align:center;font-size:100%;*zoom:1}.wy-nav-top:before,.wy-nav-top:after{display:table;content:""}.wy-nav-top:after{clear:both}.wy-nav-top a{color:#fff;font-weight:bold}.wy-nav-top img{margin-right:12px;height:45px;width:45px;background-color:#2980B9;padding:5px;border-radius:100%}.wy-nav-top i{font-size:30px;float:left;cursor:pointer;padding-top:inherit}.wy-nav-content-wrap{margin-left:300px;background:#fcfcfc;min-height:100%}.wy-nav-content{padding:1.618em 3.236em;height:100%;max-width:800px;margin:auto}.wy-body-mask{position:fixed;width:100%;height:100%;background:rgba(0,0,0,0.2);display:none;z-index:499}.wy-body-mask.on{display:block}footer{color:gray}footer p{margin-bottom:12px}footer span.commit code,footer span.commit .rst-content tt,.rst-content footer span.commit tt{padding:0px;font-family:Consolas,"Andale Mono WT","Andale Mono","Lucida Console","Lucida Sans Typewriter","DejaVu Sans Mono","Bitstream Vera Sans Mono","Liberation Mono","Nimbus Mono L",Monaco,"Courier New",Courier,monospace;font-size:1em;background:none;border:none;color:gray}.rst-footer-buttons{*zoom:1}.rst-footer-buttons:before,.rst-footer-buttons:after{width:100%}.rst-footer-buttons:before,.rst-footer-buttons:after{display:table;content:""}.rst-footer-buttons:after{clear:both}.rst-breadcrumbs-buttons{margin-top:12px;*zoom:1}.rst-breadcrumbs-buttons:before,.rst-breadcrumbs-buttons:after{display:table;content:""}.rst-breadcrumbs-buttons:after{clear:both}#search-results .search li{margin-bottom:24px;border-bottom:solid 1px #e1e4e5;padding-bottom:24px}#search-results .search li:first-child{border-top:solid 1px #e1e4e5;padding-top:24px}#search-results .search li a{font-size:120%;margin-bottom:12px;display:inline-block}#search-results .context{color:gray;font-size:90%}@media screen and (max-width: 768px){.wy-body-for-nav{background:#fcfcfc}.wy-nav-top{display:block}.wy-nav-side{left:-300px}.wy-nav-side.shift{width:85%;left:0}.wy-side-scroll{width:auto}.wy-side-nav-search{width:auto}.wy-menu.wy-menu-vertical{width:auto}.wy-nav-content-wrap{margin-left:0}.wy-nav-content-wrap .wy-nav-content{padding:1.618em}.wy-nav-content-wrap.shift{position:fixed;min-width:100%;left:85%;top:0;height:100%;overflow:hidden}}@media screen and (min-width: 1400px){.wy-nav-content-wrap{background:rgba(0,0,0,0.05)}.wy-nav-content{margin:0;background:#fcfcfc}}@media print{.rst-versions,footer,.wy-nav-side{display:none}.wy-nav-content-wrap{margin-left:0}}.rst-versions{position:fixed;bottom:0;left:0;width:300px;color:#fcfcfc;background:#1f1d1d;border-top:solid 10px #343131;font-family:"Lato","proxima-nova","Helvetica Neue",Arial,sans-serif;z-index:400}.rst-versions a{color:#2980B9;text-decoration:none}.rst-versions .rst-badge-small{display:none}.rst-versions .rst-current-version{padding:12px;background-color:#272525;display:block;text-align:right;font-size:90%;cursor:pointer;color:#27AE60;*zoom:1}.rst-versions .rst-current-version:before,.rst-versions .rst-current-version:after{display:table;content:""}.rst-versions .rst-current-version:after{clear:both}.rst-versions .rst-current-version .fa,.rst-versions .rst-current-version .wy-menu-vertical li span.toctree-expand,.wy-menu-vertical li .rst-versions .rst-current-version span.toctree-expand,.rst-versions .rst-current-version .rst-content .admonition-title,.rst-content .rst-versions .rst-current-version .admonition-title,.rst-versions .rst-current-version .rst-content h1 .headerlink,.rst-content h1 .rst-versions .rst-current-version .headerlink,.rst-versions .rst-current-version .rst-content h2 .headerlink,.rst-content h2 .rst-versions .rst-current-version .headerlink,.rst-versions .rst-current-version .rst-content h3 .headerlink,.rst-content h3 .rst-versions .rst-current-version .headerlink,.rst-versions .rst-current-version .rst-content h4 .headerlink,.rst-content h4 .rst-versions .rst-current-version .headerlink,.rst-versions .rst-current-version .rst-content h5 .headerlink,.rst-content h5 .rst-versions .rst-current-version .headerlink,.rst-versions .rst-current-version .rst-content h6 .headerlink,.rst-content h6 .rst-versions .rst-current-version .headerlink,.rst-versions .rst-current-version .rst-content dl dt .headerlink,.rst-content dl dt .rst-versions .rst-current-version .headerlink,.rst-versions .rst-current-version .rst-content p.caption .headerlink,.rst-content p.caption .rst-versions .rst-current-version .headerlink,.rst-versions .rst-current-version .rst-content tt.download span:first-child,.rst-content tt.download .rst-versions .rst-current-version span:first-child,.rst-versions .rst-current-version .rst-content code.download span:first-child,.rst-content code.download .rst-versions .rst-current-version span:first-child,.rst-versions .rst-current-version .icon{color:#fcfcfc}.rst-versions .rst-current-version .fa-book,.rst-versions .rst-current-version .icon-book{float:left}.rst-versions .rst-current-version .icon-book{float:left}.rst-versions .rst-current-version.rst-out-of-date{background-color:#E74C3C;color:#fff}.rst-versions .rst-current-version.rst-active-old-version{background-color:#F1C40F;color:#000}.rst-versions.shift-up .rst-other-versions{display:block}.rst-versions .rst-other-versions{font-size:90%;padding:12px;color:gray;display:none}.rst-versions .rst-other-versions hr{display:block;height:1px;border:0;margin:20px 0;padding:0;border-top:solid 1px #413d3d}.rst-versions .rst-other-versions dd{display:inline-block;margin:0}.rst-versions .rst-other-versions dd a{display:inline-block;padding:6px;color:#fcfcfc}.rst-versions.rst-badge{width:auto;bottom:20px;right:20px;left:auto;border:none;max-width:300px}.rst-versions.rst-badge .icon-book{float:none}.rst-versions.rst-badge .fa-book,.rst-versions.rst-badge .icon-book{float:none}.rst-versions.rst-badge.shift-up .rst-current-version{text-align:right}.rst-versions.rst-badge.shift-up .rst-current-version .fa-book,.rst-versions.rst-badge.shift-up .rst-current-version .icon-book{float:left}.rst-versions.rst-badge.shift-up .rst-current-version .icon-book{float:left}.rst-versions.rst-badge .rst-current-version{width:auto;height:30px;line-height:30px;padding:0 6px;display:block;text-align:center}@media screen and (max-width: 768px){.rst-versions{width:85%;display:none}.rst-versions.shift{display:block}}.rst-content img{max-width:100%;height:auto !important}.rst-content .highlight>pre,.rst-content .linenodiv>pre{line-height:normal}.rst-content div.figure{margin-bottom:24px}.rst-content div.figure p.caption{font-style:italic}.rst-content div.figure.align-center{text-align:center}.rst-content .section>img,.rst-content .section>a>img{margin-bottom:24px}.rst-content blockquote{margin-left:24px;line-height:24px;margin-bottom:24px}.rst-content .note .last,.rst-content .attention .last,.rst-content .caution .last,.rst-content .danger .last,.rst-content .error .last,.rst-content .hint .last,.rst-content .important .last,.rst-content .tip .last,.rst-content .warning .last,.rst-content .seealso .last,.rst-content .admonition-todo .last{margin-bottom:0}.rst-content .admonition-title:before{margin-right:4px}.rst-content .admonition table{border-color:rgba(0,0,0,0.1)}.rst-content .admonition table td,.rst-content .admonition table th{background:transparent !important;border-color:rgba(0,0,0,0.1) !important}.rst-content .section ol.loweralpha,.rst-content .section ol.loweralpha li{list-style:lower-alpha}.rst-content .section ol.upperalpha,.rst-content .section ol.upperalpha li{list-style:upper-alpha}.rst-content .section ol p,.rst-content .section ul p{margin-bottom:12px}.rst-content .line-block{margin-left:24px}.rst-content .topic-title{font-weight:bold;margin-bottom:12px}.rst-content .toc-backref{color:#404040}.rst-content .align-right{float:right;margin:0px 0px 24px 24px}.rst-content .align-left{float:left;margin:0px 24px 24px 0px}.rst-content .align-center{margin:auto;display:block}.rst-content h1 .headerlink,.rst-content h2 .headerlink,.rst-content .toctree-wrapper p.caption .headerlink,.rst-content h3 .headerlink,.rst-content h4 .headerlink,.rst-content h5 .headerlink,.rst-content h6 .headerlink,.rst-content dl dt .headerlink,.rst-content p.caption .headerlink{display:none;visibility:hidden;font-size:14px}.rst-content h1 .headerlink:after,.rst-content h2 .headerlink:after,.rst-content .toctree-wrapper p.caption .headerlink:after,.rst-content h3 .headerlink:after,.rst-content h4 .headerlink:after,.rst-content h5 .headerlink:after,.rst-content h6 .headerlink:after,.rst-content dl dt .headerlink:after,.rst-content p.caption .headerlink:after{visibility:visible;content:"";font-family:FontAwesome;display:inline-block}.rst-content h1:hover .headerlink,.rst-content h2:hover .headerlink,.rst-content .toctree-wrapper p.caption:hover .headerlink,.rst-content h3:hover .headerlink,.rst-content h4:hover .headerlink,.rst-content h5:hover .headerlink,.rst-content h6:hover .headerlink,.rst-content dl dt:hover .headerlink,.rst-content p.caption:hover .headerlink{display:inline-block}.rst-content .centered{text-align:center}.rst-content .sidebar{float:right;width:40%;display:block;margin:0 0 24px 24px;padding:24px;background:#f3f6f6;border:solid 1px #e1e4e5}.rst-content .sidebar p,.rst-content .sidebar ul,.rst-content .sidebar dl{font-size:90%}.rst-content .sidebar .last{margin-bottom:0}.rst-content .sidebar .sidebar-title{display:block;font-family:"Roboto Slab","ff-tisa-web-pro","Georgia",Arial,sans-serif;font-weight:bold;background:#e1e4e5;padding:6px 12px;margin:-24px;margin-bottom:24px;font-size:100%}.rst-content .highlighted{background:#F1C40F;display:inline-block;font-weight:bold;padding:0 6px}.rst-content .footnote-reference,.rst-content .citation-reference{vertical-align:super;font-size:90%}.rst-content table.docutils.citation,.rst-content table.docutils.footnote{background:none;border:none;color:gray}.rst-content table.docutils.citation td,.rst-content table.docutils.citation tr,.rst-content table.docutils.footnote td,.rst-content table.docutils.footnote tr{border:none;background-color:transparent !important;white-space:normal}.rst-content table.docutils.citation td.label,.rst-content table.docutils.footnote td.label{padding-left:0;padding-right:0;vertical-align:top}.rst-content table.docutils.citation tt,.rst-content table.docutils.citation code,.rst-content table.docutils.footnote tt,.rst-content table.docutils.footnote code{color:#555}.rst-content table.field-list{border:none}.rst-content table.field-list td{border:none}.rst-content table.field-list td>strong{display:inline-block}.rst-content table.field-list .field-name{padding-right:10px;text-align:left;white-space:nowrap}.rst-content table.field-list .field-body{text-align:left}.rst-content tt,.rst-content tt,.rst-content code{color:#000;padding:2px 5px}.rst-content tt big,.rst-content tt em,.rst-content tt big,.rst-content code big,.rst-content tt em,.rst-content code em{font-size:100% !important;line-height:normal}.rst-content tt.literal,.rst-content tt.literal,.rst-content code.literal{color:#E74C3C}.rst-content tt.xref,a .rst-content tt,.rst-content tt.xref,.rst-content code.xref,a .rst-content tt,a .rst-content code{font-weight:bold;color:#404040}.rst-content a tt,.rst-content a tt,.rst-content a code{color:#2980B9}.rst-content dl{margin-bottom:24px}.rst-content dl dt{font-weight:bold}.rst-content dl p,.rst-content dl table,.rst-content dl ul,.rst-content dl ol{margin-bottom:12px !important}.rst-content dl dd{margin:0 0 12px 24px}.rst-content dl:not(.docutils){margin-bottom:24px}.rst-content dl:not(.docutils) dt{display:table;margin:6px 0;font-size:90%;line-height:normal;background:#e7f2fa;color:#2980B9;border-top:solid 3px #6ab0de;padding:6px;position:relative}.rst-content dl:not(.docutils) dt:before{color:#6ab0de}.rst-content dl:not(.docutils) dt .headerlink{color:#404040;font-size:100% !important}.rst-content dl:not(.docutils) dl dt{margin-bottom:6px;border:none;border-left:solid 3px #ccc;background:#f0f0f0;color:#555}.rst-content dl:not(.docutils) dl dt .headerlink{color:#404040;font-size:100% !important}.rst-content dl:not(.docutils) dt:first-child{margin-top:0}.rst-content dl:not(.docutils) tt,.rst-content dl:not(.docutils) tt,.rst-content dl:not(.docutils) code{font-weight:bold}.rst-content dl:not(.docutils) tt.descname,.rst-content dl:not(.docutils) tt.descclassname,.rst-content dl:not(.docutils) tt.descname,.rst-content dl:not(.docutils) code.descname,.rst-content dl:not(.docutils) tt.descclassname,.rst-content dl:not(.docutils) code.descclassname{background-color:transparent;border:none;padding:0;font-size:100% !important}.rst-content dl:not(.docutils) tt.descname,.rst-content dl:not(.docutils) tt.descname,.rst-content dl:not(.docutils) code.descname{font-weight:bold}.rst-content dl:not(.docutils) .optional{display:inline-block;padding:0 4px;color:#000;font-weight:bold}.rst-content dl:not(.docutils) .property{display:inline-block;padding-right:8px}.rst-content .viewcode-link,.rst-content .viewcode-back{display:inline-block;color:#27AE60;font-size:80%;padding-left:24px}.rst-content .viewcode-back{display:block;float:right}.rst-content p.rubric{margin-bottom:12px;font-weight:bold}.rst-content tt.download,.rst-content code.download{background:inherit;padding:inherit;font-weight:normal;font-family:inherit;font-size:inherit;color:inherit;border:inherit;white-space:inherit}.rst-content tt.download span:first-child,.rst-content code.download span:first-child{-webkit-font-smoothing:subpixel-antialiased}.rst-content tt.download span:first-child:before,.rst-content code.download span:first-child:before{margin-right:4px}.rst-content .guilabel{border:1px solid #7fbbe3;background:#e7f2fa;font-size:80%;font-weight:700;border-radius:4px;padding:2.4px 6px;margin:auto 2px}.rst-content .versionmodified{font-style:italic}@media screen and (max-width: 480px){.rst-content .sidebar{width:100%}}span[id*='MathJax-Span']{color:#404040}.math{text-align:center}@font-face{font-family:"Inconsolata";font-style:normal;font-weight:400;src:local("Inconsolata"),local("Inconsolata-Regular"),url(../fonts/Inconsolata-Regular.ttf) format("truetype")}@font-face{font-family:"Inconsolata";font-style:normal;font-weight:700;src:local("Inconsolata Bold"),local("Inconsolata-Bold"),url(../fonts/Inconsolata-Bold.ttf) format("truetype")}@font-face{font-family:"Lato";font-style:normal;font-weight:400;src:local("Lato Regular"),local("Lato-Regular"),url(../fonts/Lato-Regular.ttf) format("truetype")}@font-face{font-family:"Lato";font-style:normal;font-weight:700;src:local("Lato Bold"),local("Lato-Bold"),url(../fonts/Lato-Bold.ttf) format("truetype")}@font-face{font-family:"Lato";font-style:italic;font-weight:400;src:local("Lato Italic"),local("Lato-Italic"),url(../fonts/Lato-Italic.ttf) format("truetype")}@font-face{font-family:"Lato";font-style:italic;font-weight:700;src:local("Lato Bold Italic"),local("Lato-BoldItalic"),url(../fonts/Lato-BoldItalic.ttf) format("truetype")}@font-face{font-family:"Roboto Slab";font-style:normal;font-weight:400;src:local("Roboto Slab Regular"),local("RobotoSlab-Regular"),url(../fonts/RobotoSlab-Regular.ttf) format("truetype")}@font-face{font-family:"Roboto Slab";font-style:normal;font-weight:700;src:local("Roboto Slab Bold"),local("RobotoSlab-Bold"),url(../fonts/RobotoSlab-Bold.ttf) format("truetype")} +/*# sourceMappingURL=theme.css.map */ diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css/theme.css.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css/theme.css.meta new file mode 100644 index 00000000..0b99b466 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/css/theme.css.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 17d316ac4af30b640939501f1dc2f310 +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/doctools.js b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/doctools.js new file mode 100644 index 00000000..daccd209 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/doctools.js @@ -0,0 +1,315 @@ +/* + * doctools.js + * ~~~~~~~~~~~ + * + * Sphinx JavaScript utilities for all documentation. + * + * :copyright: Copyright 2007-2020 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +/** + * select a different prefix for underscore + */ +$u = _.noConflict(); + +/** + * make the code below compatible with browsers without + * an installed firebug like debugger +if (!window.console || !console.firebug) { + var names = ["log", "debug", "info", "warn", "error", "assert", "dir", + "dirxml", "group", "groupEnd", "time", "timeEnd", "count", "trace", + "profile", "profileEnd"]; + window.console = {}; + for (var i = 0; i < names.length; ++i) + window.console[names[i]] = function() {}; +} + */ + +/** + * small helper function to urldecode strings + */ +jQuery.urldecode = function(x) { + return decodeURIComponent(x).replace(/\+/g, ' '); +}; + +/** + * small helper function to urlencode strings + */ +jQuery.urlencode = encodeURIComponent; + +/** + * This function returns the parsed url parameters of the + * current request. Multiple values per key are supported, + * it will always return arrays of strings for the value parts. + */ +jQuery.getQueryParameters = function(s) { + if (typeof s === 'undefined') + s = document.location.search; + var parts = s.substr(s.indexOf('?') + 1).split('&'); + var result = {}; + for (var i = 0; i < parts.length; i++) { + var tmp = parts[i].split('=', 2); + var key = jQuery.urldecode(tmp[0]); + var value = jQuery.urldecode(tmp[1]); + if (key in result) + result[key].push(value); + else + result[key] = [value]; + } + return result; +}; + +/** + * highlight a given string on a jquery object by wrapping it in + * span elements with the given class name. + */ +jQuery.fn.highlightText = function(text, className) { + function highlight(node, addItems) { + if (node.nodeType === 3) { + var val = node.nodeValue; + var pos = val.toLowerCase().indexOf(text); + if (pos >= 0 && + !jQuery(node.parentNode).hasClass(className) && + !jQuery(node.parentNode).hasClass("nohighlight")) { + var span; + var isInSVG = jQuery(node).closest("body, svg, foreignObject").is("svg"); + if (isInSVG) { + span = document.createElementNS("http://www.w3.org/2000/svg", "tspan"); + } else { + span = document.createElement("span"); + span.className = className; + } + span.appendChild(document.createTextNode(val.substr(pos, text.length))); + node.parentNode.insertBefore(span, node.parentNode.insertBefore( + document.createTextNode(val.substr(pos + text.length)), + node.nextSibling)); + node.nodeValue = val.substr(0, pos); + if (isInSVG) { + var rect = document.createElementNS("http://www.w3.org/2000/svg", "rect"); + var bbox = node.parentElement.getBBox(); + rect.x.baseVal.value = bbox.x; + rect.y.baseVal.value = bbox.y; + rect.width.baseVal.value = bbox.width; + rect.height.baseVal.value = bbox.height; + rect.setAttribute('class', className); + addItems.push({ + "parent": node.parentNode, + "target": rect}); + } + } + } + else if (!jQuery(node).is("button, select, textarea")) { + jQuery.each(node.childNodes, function() { + highlight(this, addItems); + }); + } + } + var addItems = []; + var result = this.each(function() { + highlight(this, addItems); + }); + for (var i = 0; i < addItems.length; ++i) { + jQuery(addItems[i].parent).before(addItems[i].target); + } + return result; +}; + +/* + * backward compatibility for jQuery.browser + * This will be supported until firefox bug is fixed. + */ +if (!jQuery.browser) { + jQuery.uaMatch = function(ua) { + ua = ua.toLowerCase(); + + var match = /(chrome)[ \/]([\w.]+)/.exec(ua) || + /(webkit)[ \/]([\w.]+)/.exec(ua) || + /(opera)(?:.*version|)[ \/]([\w.]+)/.exec(ua) || + /(msie) ([\w.]+)/.exec(ua) || + ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec(ua) || + []; + + return { + browser: match[ 1 ] || "", + version: match[ 2 ] || "0" + }; + }; + jQuery.browser = {}; + jQuery.browser[jQuery.uaMatch(navigator.userAgent).browser] = true; +} + +/** + * Small JavaScript module for the documentation. + */ +var Documentation = { + + init : function() { + this.fixFirefoxAnchorBug(); + this.highlightSearchWords(); + this.initIndexTable(); + if (DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) { + this.initOnKeyListeners(); + } + }, + + /** + * i18n support + */ + TRANSLATIONS : {}, + PLURAL_EXPR : function(n) { return n === 1 ? 0 : 1; }, + LOCALE : 'unknown', + + // gettext and ngettext don't access this so that the functions + // can safely bound to a different name (_ = Documentation.gettext) + gettext : function(string) { + var translated = Documentation.TRANSLATIONS[string]; + if (typeof translated === 'undefined') + return string; + return (typeof translated === 'string') ? translated : translated[0]; + }, + + ngettext : function(singular, plural, n) { + var translated = Documentation.TRANSLATIONS[singular]; + if (typeof translated === 'undefined') + return (n == 1) ? singular : plural; + return translated[Documentation.PLURALEXPR(n)]; + }, + + addTranslations : function(catalog) { + for (var key in catalog.messages) + this.TRANSLATIONS[key] = catalog.messages[key]; + this.PLURAL_EXPR = new Function('n', 'return +(' + catalog.plural_expr + ')'); + this.LOCALE = catalog.locale; + }, + + /** + * add context elements like header anchor links + */ + addContextElements : function() { + $('div[id] > :header:first').each(function() { + $('<a class="headerlink">\u00B6</a>'). + attr('href', '#' + this.id). + attr('title', _('Permalink to this headline')). + appendTo(this); + }); + $('dt[id]').each(function() { + $('<a class="headerlink">\u00B6</a>'). + attr('href', '#' + this.id). + attr('title', _('Permalink to this definition')). + appendTo(this); + }); + }, + + /** + * workaround a firefox stupidity + * see: https://bugzilla.mozilla.org/show_bug.cgi?id=645075 + */ + fixFirefoxAnchorBug : function() { + if (document.location.hash && $.browser.mozilla) + window.setTimeout(function() { + document.location.href += ''; + }, 10); + }, + + /** + * highlight the search words provided in the url in the text + */ + highlightSearchWords : function() { + var params = $.getQueryParameters(); + var terms = (params.highlight) ? params.highlight[0].split(/\s+/) : []; + if (terms.length) { + var body = $('div.body'); + if (!body.length) { + body = $('body'); + } + window.setTimeout(function() { + $.each(terms, function() { + body.highlightText(this.toLowerCase(), 'highlighted'); + }); + }, 10); + $('<p class="highlight-link"><a href="javascript:Documentation.' + + 'hideSearchWords()">' + _('Hide Search Matches') + '</a></p>') + .appendTo($('#searchbox')); + } + }, + + /** + * init the domain index toggle buttons + */ + initIndexTable : function() { + var togglers = $('img.toggler').click(function() { + var src = $(this).attr('src'); + var idnum = $(this).attr('id').substr(7); + $('tr.cg-' + idnum).toggle(); + if (src.substr(-9) === 'minus.png') + $(this).attr('src', src.substr(0, src.length-9) + 'plus.png'); + else + $(this).attr('src', src.substr(0, src.length-8) + 'minus.png'); + }).css('display', ''); + if (DOCUMENTATION_OPTIONS.COLLAPSE_INDEX) { + togglers.click(); + } + }, + + /** + * helper function to hide the search marks again + */ + hideSearchWords : function() { + $('#searchbox .highlight-link').fadeOut(300); + $('span.highlighted').removeClass('highlighted'); + }, + + /** + * make the url absolute + */ + makeURL : function(relativeURL) { + return DOCUMENTATION_OPTIONS.URL_ROOT + '/' + relativeURL; + }, + + /** + * get the current relative url + */ + getCurrentURL : function() { + var path = document.location.pathname; + var parts = path.split(/\//); + $.each(DOCUMENTATION_OPTIONS.URL_ROOT.split(/\//), function() { + if (this === '..') + parts.pop(); + }); + var url = parts.join('/'); + return path.substring(url.lastIndexOf('/') + 1, path.length - 1); + }, + + initOnKeyListeners: function() { + $(document).keydown(function(event) { + var activeElementType = document.activeElement.tagName; + // don't navigate when in search box or textarea + if (activeElementType !== 'TEXTAREA' && activeElementType !== 'INPUT' && activeElementType !== 'SELECT' + && !event.altKey && !event.ctrlKey && !event.metaKey && !event.shiftKey) { + switch (event.keyCode) { + case 37: // left + var prevHref = $('link[rel="prev"]').prop('href'); + if (prevHref) { + window.location.href = prevHref; + return false; + } + case 39: // right + var nextHref = $('link[rel="next"]').prop('href'); + if (nextHref) { + window.location.href = nextHref; + return false; + } + } + } + }); + } +}; + +// quick alias for translations +_ = Documentation.gettext; + +$(document).ready(function() { + Documentation.init(); +}); diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/doctools.js.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/doctools.js.meta new file mode 100644 index 00000000..809214b9 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/doctools.js.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 17e343820a83eac4ca6b849fc0f0993f +TextScriptImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/documentation_options.js b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/documentation_options.js new file mode 100644 index 00000000..5f972348 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/documentation_options.js @@ -0,0 +1,11 @@ +var DOCUMENTATION_OPTIONS = { + URL_ROOT: document.getElementById("documentation_options").getAttribute('data-url_root'), + VERSION: '1.0', + LANGUAGE: 'None', + COLLAPSE_INDEX: false, + BUILDER: 'html', + FILE_SUFFIX: '.html', + HAS_SOURCE: true, + SOURCELINK_SUFFIX: '.txt', + NAVIGATION_WITH_KEYS: false +};
\ No newline at end of file diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/documentation_options.js.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/documentation_options.js.meta new file mode 100644 index 00000000..19429e30 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/documentation_options.js.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 455b6455c7a4a0b4d95b2d11b5fd1364 +TextScriptImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/file.png b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/file.png Binary files differnew file mode 100644 index 00000000..a858a410 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/file.png diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/file.png.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/file.png.meta new file mode 100644 index 00000000..54824bc3 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/file.png.meta @@ -0,0 +1,88 @@ +fileFormatVersion: 2 +guid: 7f6ca0ee9d10d7d4da94d7d16f2d6eab +TextureImporter: + fileIDToRecycleName: {} + externalObjects: {} + serializedVersion: 9 + mipmaps: + mipMapMode: 0 + enableMipMap: 1 + sRGBTexture: 1 + linearTexture: 0 + fadeOut: 0 + borderMipMap: 0 + mipMapsPreserveCoverage: 0 + alphaTestReferenceValue: 0.5 + mipMapFadeDistanceStart: 1 + mipMapFadeDistanceEnd: 3 + bumpmap: + convertToNormalMap: 0 + externalNormalMap: 0 + heightScale: 0.25 + normalMapFilter: 0 + isReadable: 0 + streamingMipmaps: 0 + streamingMipmapsPriority: 0 + grayScaleToAlpha: 0 + generateCubemap: 6 + cubemapConvolution: 0 + seamlessCubemap: 0 + textureFormat: 1 + maxTextureSize: 2048 + textureSettings: + serializedVersion: 2 + filterMode: -1 + aniso: -1 + mipBias: -100 + wrapU: -1 + wrapV: -1 + wrapW: -1 + nPOTScale: 1 + lightmap: 0 + compressionQuality: 50 + spriteMode: 0 + spriteExtrude: 1 + spriteMeshType: 1 + alignment: 0 + spritePivot: {x: 0.5, y: 0.5} + spritePixelsToUnits: 100 + spriteBorder: {x: 0, y: 0, z: 0, w: 0} + spriteGenerateFallbackPhysicsShape: 1 + alphaUsage: 1 + alphaIsTransparency: 0 + spriteTessellationDetail: -1 + textureType: 0 + textureShape: 1 + singleChannelComponent: 0 + maxTextureSizeSet: 0 + compressionQualitySet: 0 + textureFormatSet: 0 + platformSettings: + - serializedVersion: 2 + buildTarget: DefaultTexturePlatform + maxTextureSize: 2048 + resizeAlgorithm: 0 + textureFormat: -1 + textureCompression: 1 + compressionQuality: 50 + crunchedCompression: 0 + allowsAlphaSplitting: 0 + overridden: 0 + androidETC2FallbackOverride: 0 + spriteSheet: + serializedVersion: 2 + sprites: [] + outline: [] + physicsShape: [] + bones: [] + spriteID: + vertices: [] + indices: + edges: [] + weights: [] + spritePackingTag: + pSDRemoveMatte: 0 + pSDShowRemoveMatteOption: 0 + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts.meta new file mode 100644 index 00000000..e16cd6a3 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts.meta @@ -0,0 +1,8 @@ +fileFormatVersion: 2 +guid: 85798ee792c2b504cbc41f72111618fc +folderAsset: yes +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Inconsolata-Bold.ttf b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Inconsolata-Bold.ttf Binary files differnew file mode 100644 index 00000000..809c1f58 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Inconsolata-Bold.ttf diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Inconsolata-Bold.ttf.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Inconsolata-Bold.ttf.meta new file mode 100644 index 00000000..13996475 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Inconsolata-Bold.ttf.meta @@ -0,0 +1,22 @@ +fileFormatVersion: 2 +guid: 452f7d8d1a7418943b69d2df35655ebe +TrueTypeFontImporter: + externalObjects: {} + serializedVersion: 4 + fontSize: 16 + forceTextureCase: -2 + characterSpacing: 0 + characterPadding: 1 + includeFontData: 1 + fontName: Inconsolata + fontNames: + - Inconsolata + fallbackFontReferences: [] + customCharacters: + fontRenderingMode: 0 + ascentCalculationMode: 1 + useLegacyBoundsCalculation: 0 + shouldRoundAdvanceValue: 1 + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Inconsolata-Regular.ttf b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Inconsolata-Regular.ttf Binary files differnew file mode 100644 index 00000000..fc981ce7 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Inconsolata-Regular.ttf diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Inconsolata-Regular.ttf.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Inconsolata-Regular.ttf.meta new file mode 100644 index 00000000..fdb9700c --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Inconsolata-Regular.ttf.meta @@ -0,0 +1,23 @@ +fileFormatVersion: 2 +guid: e3027d149d2f75647b130d9ed7f7014c +TrueTypeFontImporter: + externalObjects: {} + serializedVersion: 4 + fontSize: 16 + forceTextureCase: -2 + characterSpacing: 0 + characterPadding: 1 + includeFontData: 1 + fontName: Inconsolata + fontNames: + - Inconsolata + fallbackFontReferences: + - {fileID: 12800000, guid: 452f7d8d1a7418943b69d2df35655ebe, type: 3} + customCharacters: + fontRenderingMode: 0 + ascentCalculationMode: 1 + useLegacyBoundsCalculation: 0 + shouldRoundAdvanceValue: 1 + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Lato-Bold.ttf b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Lato-Bold.ttf Binary files differnew file mode 100644 index 00000000..1d23c706 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Lato-Bold.ttf diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Lato-Bold.ttf.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Lato-Bold.ttf.meta new file mode 100644 index 00000000..c4bd79d0 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Lato-Bold.ttf.meta @@ -0,0 +1,23 @@ +fileFormatVersion: 2 +guid: d8a7948bc83b01f45ab5078c10dd8e04 +TrueTypeFontImporter: + externalObjects: {} + serializedVersion: 4 + fontSize: 16 + forceTextureCase: -2 + characterSpacing: 0 + characterPadding: 1 + includeFontData: 1 + fontName: Lato + fontNames: + - Lato + fallbackFontReferences: + - {fileID: 12800000, guid: 98baae691215eb546a697ff7d942a5bb, type: 3} + customCharacters: + fontRenderingMode: 0 + ascentCalculationMode: 1 + useLegacyBoundsCalculation: 0 + shouldRoundAdvanceValue: 1 + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Lato-Regular.ttf b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Lato-Regular.ttf Binary files differnew file mode 100644 index 00000000..0f3d0f83 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Lato-Regular.ttf diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Lato-Regular.ttf.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Lato-Regular.ttf.meta new file mode 100644 index 00000000..3c4255c8 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/Lato-Regular.ttf.meta @@ -0,0 +1,22 @@ +fileFormatVersion: 2 +guid: 98baae691215eb546a697ff7d942a5bb +TrueTypeFontImporter: + externalObjects: {} + serializedVersion: 4 + fontSize: 16 + forceTextureCase: -2 + characterSpacing: 0 + characterPadding: 1 + includeFontData: 1 + fontName: Lato + fontNames: + - Lato + fallbackFontReferences: [] + customCharacters: + fontRenderingMode: 0 + ascentCalculationMode: 1 + useLegacyBoundsCalculation: 0 + shouldRoundAdvanceValue: 1 + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/RobotoSlab-Bold.ttf b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/RobotoSlab-Bold.ttf Binary files differnew file mode 100644 index 00000000..df5d1df2 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/RobotoSlab-Bold.ttf diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/RobotoSlab-Bold.ttf.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/RobotoSlab-Bold.ttf.meta new file mode 100644 index 00000000..4d20c6a4 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/RobotoSlab-Bold.ttf.meta @@ -0,0 +1,22 @@ +fileFormatVersion: 2 +guid: 79f72428ef5a94f44a224932dfc8bc22 +TrueTypeFontImporter: + externalObjects: {} + serializedVersion: 4 + fontSize: 16 + forceTextureCase: -2 + characterSpacing: 0 + characterPadding: 1 + includeFontData: 1 + fontName: Roboto Slab + fontNames: + - Roboto Slab + fallbackFontReferences: [] + customCharacters: + fontRenderingMode: 0 + ascentCalculationMode: 1 + useLegacyBoundsCalculation: 0 + shouldRoundAdvanceValue: 1 + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/RobotoSlab-Regular.ttf b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/RobotoSlab-Regular.ttf Binary files differnew file mode 100644 index 00000000..eb52a790 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/RobotoSlab-Regular.ttf diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/RobotoSlab-Regular.ttf.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/RobotoSlab-Regular.ttf.meta new file mode 100644 index 00000000..118e066e --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/RobotoSlab-Regular.ttf.meta @@ -0,0 +1,23 @@ +fileFormatVersion: 2 +guid: f23c08f75b40f494b9b74462d7310dfb +TrueTypeFontImporter: + externalObjects: {} + serializedVersion: 4 + fontSize: 16 + forceTextureCase: -2 + characterSpacing: 0 + characterPadding: 1 + includeFontData: 1 + fontName: Roboto Slab + fontNames: + - Roboto Slab + fallbackFontReferences: + - {fileID: 12800000, guid: 79f72428ef5a94f44a224932dfc8bc22, type: 3} + customCharacters: + fontRenderingMode: 0 + ascentCalculationMode: 1 + useLegacyBoundsCalculation: 0 + shouldRoundAdvanceValue: 1 + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.eot b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.eot Binary files differnew file mode 100644 index 00000000..c7b00d2b --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.eot diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.eot.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.eot.meta new file mode 100644 index 00000000..98704eed --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.eot.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 958b822f881cee94fa3ce9e448ce0163 +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.svg b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.svg new file mode 100644 index 00000000..8b66187f --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.svg @@ -0,0 +1,685 @@ +<?xml version="1.0" standalone="no"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" > +<svg xmlns="http://www.w3.org/2000/svg"> +<metadata></metadata> +<defs> +<font id="fontawesomeregular" horiz-adv-x="1536" > +<font-face units-per-em="1792" ascent="1536" descent="-256" /> +<missing-glyph horiz-adv-x="448" /> +<glyph unicode=" " horiz-adv-x="448" /> +<glyph unicode="	" horiz-adv-x="448" /> +<glyph unicode=" " horiz-adv-x="448" /> +<glyph unicode="¨" horiz-adv-x="1792" /> +<glyph unicode="©" horiz-adv-x="1792" /> +<glyph unicode="®" horiz-adv-x="1792" /> +<glyph unicode="´" horiz-adv-x="1792" /> +<glyph unicode="Æ" horiz-adv-x="1792" /> +<glyph unicode="Ø" horiz-adv-x="1792" /> +<glyph unicode=" " horiz-adv-x="768" /> +<glyph unicode=" " horiz-adv-x="1537" /> +<glyph unicode=" " horiz-adv-x="768" /> +<glyph unicode=" " horiz-adv-x="1537" /> +<glyph unicode=" " horiz-adv-x="512" /> +<glyph unicode=" " horiz-adv-x="384" /> +<glyph unicode=" " horiz-adv-x="256" /> +<glyph unicode=" " horiz-adv-x="256" /> +<glyph unicode=" " horiz-adv-x="192" /> +<glyph unicode=" " horiz-adv-x="307" /> +<glyph unicode=" " horiz-adv-x="85" /> +<glyph unicode=" " horiz-adv-x="307" /> +<glyph unicode=" " horiz-adv-x="384" /> +<glyph unicode="™" horiz-adv-x="1792" /> +<glyph unicode="∞" horiz-adv-x="1792" /> +<glyph unicode="≠" horiz-adv-x="1792" /> +<glyph unicode="◼" horiz-adv-x="500" d="M0 0z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1699 1350q0 -35 -43 -78l-632 -632v-768h320q26 0 45 -19t19 -45t-19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45t45 19h320v768l-632 632q-43 43 -43 78q0 23 18 36.5t38 17.5t43 4h1408q23 0 43 -4t38 -17.5t18 -36.5z" /> +<glyph unicode="" d="M1536 1312v-1120q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v537l-768 -237v-709q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89 t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v967q0 31 19 56.5t49 35.5l832 256q12 4 28 4q40 0 68 -28t28 -68z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -52 -38 -90t-90 -38q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5 t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1664 32v768q-32 -36 -69 -66q-268 -206 -426 -338q-51 -43 -83 -67t-86.5 -48.5t-102.5 -24.5h-1h-1q-48 0 -102.5 24.5t-86.5 48.5t-83 67q-158 132 -426 338q-37 30 -69 66v-768q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1664 1083v11v13.5t-0.5 13 t-3 12.5t-5.5 9t-9 7.5t-14 2.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5q0 -168 147 -284q193 -152 401 -317q6 -5 35 -29.5t46 -37.5t44.5 -31.5t50.5 -27.5t43 -9h1h1q20 0 43 9t50.5 27.5t44.5 31.5t46 37.5t35 29.5q208 165 401 317q54 43 100.5 115.5t46.5 131.5z M1792 1120v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" /> +<glyph unicode="" horiz-adv-x="1792" d="M896 -128q-26 0 -44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5q224 0 351 -124t127 -344q0 -221 -229 -450l-623 -600 q-18 -18 -44 -18z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -21 -10.5 -35.5t-30.5 -14.5q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455 l502 -73q56 -9 56 -46z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1137 532l306 297l-422 62l-189 382l-189 -382l-422 -62l306 -297l-73 -421l378 199l377 -199zM1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -50 -41 -50q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500 l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455l502 -73q56 -9 56 -46z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1408 131q0 -120 -73 -189.5t-194 -69.5h-874q-121 0 -194 69.5t-73 189.5q0 53 3.5 103.5t14 109t26.5 108.5t43 97.5t62 81t85.5 53.5t111.5 20q9 0 42 -21.5t74.5 -48t108 -48t133.5 -21.5t133.5 21.5t108 48t74.5 48t42 21.5q61 0 111.5 -20t85.5 -53.5t62 -81 t43 -97.5t26.5 -108.5t14 -109t3.5 -103.5zM1088 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5z" /> +<glyph unicode="" horiz-adv-x="1920" d="M384 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 320v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 704v128q0 26 -19 45t-45 19h-128 q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 -64v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM384 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45 t45 -19h128q26 0 45 19t19 45zM1792 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 704v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1792 320v128 q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 704v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19 t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1920 1248v-1344q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1344q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" /> +<glyph unicode="" horiz-adv-x="1664" d="M768 512v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM768 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 512v-384q0 -52 -38 -90t-90 -38 h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" /> +<glyph unicode="" horiz-adv-x="1792" d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 288v-192q0 -40 -28 -68t-68 -28h-320 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28 h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192 q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68z" /> +<glyph unicode="" horiz-adv-x="1792" d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-960 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28 h960q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1671 970q0 -40 -28 -68l-724 -724l-136 -136q-28 -28 -68 -28t-68 28l-136 136l-362 362q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -295l656 657q28 28 68 28t68 -28l136 -136q28 -28 28 -68z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1298 214q0 -40 -28 -68l-136 -136q-28 -28 -68 -28t-68 28l-294 294l-294 -294q-28 -28 -68 -28t-68 28l-136 136q-28 28 -28 68t28 68l294 294l-294 294q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -294l294 294q28 28 68 28t68 -28l136 -136q28 -28 28 -68 t-28 -68l-294 -294l294 -294q28 -28 28 -68z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-224q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v224h-224q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h224v224q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5v-224h224 q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5 t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-576q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h576q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5z M1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z " /> +<glyph unicode="" d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61t-298 61t-245 164t-164 245t-61 298q0 182 80.5 343t226.5 270q43 32 95.5 25t83.5 -50q32 -42 24.5 -94.5t-49.5 -84.5q-98 -74 -151.5 -181t-53.5 -228q0 -104 40.5 -198.5t109.5 -163.5t163.5 -109.5 t198.5 -40.5t198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5q0 121 -53.5 228t-151.5 181q-42 32 -49.5 84.5t24.5 94.5q31 43 84 50t95 -25q146 -109 226.5 -270t80.5 -343zM896 1408v-640q0 -52 -38 -90t-90 -38t-90 38t-38 90v640q0 52 38 90t90 38t90 -38t38 -90z" /> +<glyph unicode="" horiz-adv-x="1792" d="M256 96v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM640 224v-320q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1024 480v-576q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23 v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1408 864v-960q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 1376v-1472q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1472q0 14 9 23t23 9h192q14 0 23 -9t9 -23z" /> +<glyph unicode="" d="M1024 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1536 749v-222q0 -12 -8 -23t-20 -13l-185 -28q-19 -54 -39 -91q35 -50 107 -138q10 -12 10 -25t-9 -23q-27 -37 -99 -108t-94 -71q-12 0 -26 9l-138 108q-44 -23 -91 -38 q-16 -136 -29 -186q-7 -28 -36 -28h-222q-14 0 -24.5 8.5t-11.5 21.5l-28 184q-49 16 -90 37l-141 -107q-10 -9 -25 -9q-14 0 -25 11q-126 114 -165 168q-7 10 -7 23q0 12 8 23q15 21 51 66.5t54 70.5q-27 50 -41 99l-183 27q-13 2 -21 12.5t-8 23.5v222q0 12 8 23t19 13 l186 28q14 46 39 92q-40 57 -107 138q-10 12 -10 24q0 10 9 23q26 36 98.5 107.5t94.5 71.5q13 0 26 -10l138 -107q44 23 91 38q16 136 29 186q7 28 36 28h222q14 0 24.5 -8.5t11.5 -21.5l28 -184q49 -16 90 -37l142 107q9 9 24 9q13 0 25 -10q129 -119 165 -170q7 -8 7 -22 q0 -12 -8 -23q-15 -21 -51 -66.5t-54 -70.5q26 -50 41 -98l183 -28q13 -2 21 -12.5t8 -23.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M512 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM768 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1024 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576 q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1152 76v948h-896v-948q0 -22 7 -40.5t14.5 -27t10.5 -8.5h832q3 0 10.5 8.5t14.5 27t7 40.5zM480 1152h448l-48 117q-7 9 -17 11h-317q-10 -2 -17 -11zM1408 1120v-64q0 -14 -9 -23t-23 -9h-96v-948q0 -83 -47 -143.5t-113 -60.5h-832 q-66 0 -113 58.5t-47 141.5v952h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h309l70 167q15 37 54 63t79 26h320q40 0 79 -26t54 -63l70 -167h309q14 0 23 -9t9 -23z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1408 544v-480q0 -26 -19 -45t-45 -19h-384v384h-256v-384h-384q-26 0 -45 19t-19 45v480q0 1 0.5 3t0.5 3l575 474l575 -474q1 -2 1 -6zM1631 613l-62 -74q-8 -9 -21 -11h-3q-13 0 -21 7l-692 577l-692 -577q-12 -8 -24 -7q-13 2 -21 11l-62 74q-8 10 -7 23.5t11 21.5 l719 599q32 26 76 26t76 -26l244 -204v195q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-408l219 -182q10 -8 11 -21.5t-7 -23.5z" /> +<glyph unicode="" d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z " /> +<glyph unicode="" d="M896 992v-448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1111 540v4l-24 320q-1 13 -11 22.5t-23 9.5h-186q-13 0 -23 -9.5t-11 -22.5l-24 -320v-4q-1 -12 8 -20t21 -8h244q12 0 21 8t8 20zM1870 73q0 -73 -46 -73h-704q13 0 22 9.5t8 22.5l-20 256q-1 13 -11 22.5t-23 9.5h-272q-13 0 -23 -9.5t-11 -22.5l-20 -256 q-1 -13 8 -22.5t22 -9.5h-704q-46 0 -46 73q0 54 26 116l417 1044q8 19 26 33t38 14h339q-13 0 -23 -9.5t-11 -22.5l-15 -192q-1 -14 8 -23t22 -9h166q13 0 22 9t8 23l-15 192q-1 13 -11 22.5t-23 9.5h339q20 0 38 -14t26 -33l417 -1044q26 -62 26 -116z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1280 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 416v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h465l135 -136 q58 -56 136 -56t136 56l136 136h464q40 0 68 -28t28 -68zM1339 985q17 -41 -14 -70l-448 -448q-18 -19 -45 -19t-45 19l-448 448q-31 29 -14 70q17 39 59 39h256v448q0 26 19 45t45 19h256q26 0 45 -19t19 -45v-448h256q42 0 59 -39z" /> +<glyph unicode="" d="M1120 608q0 -12 -10 -24l-319 -319q-11 -9 -23 -9t-23 9l-320 320q-15 16 -7 35q8 20 30 20h192v352q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-352h192q14 0 23 -9t9 -23zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273 t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1118 660q-8 -20 -30 -20h-192v-352q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v352h-192q-14 0 -23 9t-9 23q0 12 10 24l319 319q11 9 23 9t23 -9l320 -320q15 -16 7 -35zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198 t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1023 576h316q-1 3 -2.5 8t-2.5 8l-212 496h-708l-212 -496q-1 -2 -2.5 -8t-2.5 -8h316l95 -192h320zM1536 546v-482q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v482q0 62 25 123l238 552q10 25 36.5 42t52.5 17h832q26 0 52.5 -17t36.5 -42l238 -552 q25 -61 25 -123z" /> +<glyph unicode="" d="M1184 640q0 -37 -32 -55l-544 -320q-15 -9 -32 -9q-16 0 -32 8q-32 19 -32 56v640q0 37 32 56q33 18 64 -1l544 -320q32 -18 32 -55zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l138 138q-148 137 -349 137q-104 0 -198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5q119 0 225 52t179 147q7 10 23 12q14 0 25 -9 l137 -138q9 -8 9.5 -20.5t-7.5 -22.5q-109 -132 -264 -204.5t-327 -72.5q-156 0 -298 61t-245 164t-164 245t-61 298t61 298t164 245t245 164t298 61q147 0 284.5 -55.5t244.5 -156.5l130 129q29 31 70 14q39 -17 39 -59z" /> +<glyph unicode="" d="M1511 480q0 -5 -1 -7q-64 -268 -268 -434.5t-478 -166.5q-146 0 -282.5 55t-243.5 157l-129 -129q-19 -19 -45 -19t-45 19t-19 45v448q0 26 19 45t45 19h448q26 0 45 -19t19 -45t-19 -45l-137 -137q71 -66 161 -102t187 -36q134 0 250 65t186 179q11 17 53 117 q8 23 30 23h192q13 0 22.5 -9.5t9.5 -22.5zM1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-26 0 -45 19t-19 45t19 45l138 138q-148 137 -349 137q-134 0 -250 -65t-186 -179q-11 -17 -53 -117q-8 -23 -30 -23h-199q-13 0 -22.5 9.5t-9.5 22.5v7q65 268 270 434.5t480 166.5 q146 0 284 -55.5t245 -156.5l130 129q19 19 45 19t45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1792" d="M384 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M384 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1536 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5z M1536 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5zM1536 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5 t9.5 -22.5zM1664 160v832q0 13 -9.5 22.5t-22.5 9.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1792 1248v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47 t47 -113z" /> +<glyph unicode="" horiz-adv-x="1152" d="M320 768h512v192q0 106 -75 181t-181 75t-181 -75t-75 -181v-192zM1152 672v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v192q0 184 132 316t316 132t316 -132t132 -316v-192h32q40 0 68 -28t28 -68z" /> +<glyph unicode="" horiz-adv-x="1792" d="M320 1280q0 -72 -64 -110v-1266q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v1266q-64 38 -64 110q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -25 -12.5 -38.5t-39.5 -27.5q-215 -116 -369 -116q-61 0 -123.5 22t-108.5 48 t-115.5 48t-142.5 22q-192 0 -464 -146q-17 -9 -33 -9q-26 0 -45 19t-19 45v742q0 32 31 55q21 14 79 43q236 120 421 120q107 0 200 -29t219 -88q38 -19 88 -19q54 0 117.5 21t110 47t88 47t54.5 21q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1664 650q0 -166 -60 -314l-20 -49l-185 -33q-22 -83 -90.5 -136.5t-156.5 -53.5v-32q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-32q71 0 130 -35.5t93 -95.5l68 12q29 95 29 193q0 148 -88 279t-236.5 209t-315.5 78 t-315.5 -78t-236.5 -209t-88 -279q0 -98 29 -193l68 -12q34 60 93 95.5t130 35.5v32q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v32q-88 0 -156.5 53.5t-90.5 136.5l-185 33l-20 49q-60 148 -60 314q0 151 67 291t179 242.5 t266 163.5t320 61t320 -61t266 -163.5t179 -242.5t67 -291z" /> +<glyph unicode="" horiz-adv-x="768" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1152" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 35.5 t12 57t-12 57t-29 35.5t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142z" /> +<glyph unicode="" horiz-adv-x="1664" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 35.5 t12 57t-12 57t-29 35.5t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142zM1408 640q0 -153 -85 -282.5t-225 -188.5q-13 -5 -25 -5q-27 0 -46 19t-19 45q0 39 39 59q56 29 76 44q74 54 115.5 135.5t41.5 173.5t-41.5 173.5 t-115.5 135.5q-20 15 -76 44q-39 20 -39 59q0 26 19 45t45 19q13 0 26 -5q140 -59 225 -188.5t85 -282.5zM1664 640q0 -230 -127 -422.5t-338 -283.5q-13 -5 -26 -5q-26 0 -45 19t-19 45q0 36 39 59q7 4 22.5 10.5t22.5 10.5q46 25 82 51q123 91 192 227t69 289t-69 289 t-192 227q-36 26 -82 51q-7 4 -22.5 10.5t-22.5 10.5q-39 23 -39 59q0 26 19 45t45 19q13 0 26 -5q211 -91 338 -283.5t127 -422.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M384 384v-128h-128v128h128zM384 1152v-128h-128v128h128zM1152 1152v-128h-128v128h128zM128 129h384v383h-384v-383zM128 896h384v384h-384v-384zM896 896h384v384h-384v-384zM640 640v-640h-640v640h640zM1152 128v-128h-128v128h128zM1408 128v-128h-128v128h128z M1408 640v-384h-384v128h-128v-384h-128v640h384v-128h128v128h128zM640 1408v-640h-640v640h640zM1408 1408v-640h-640v640h640z" /> +<glyph unicode="" horiz-adv-x="1792" d="M63 0h-63v1408h63v-1408zM126 1h-32v1407h32v-1407zM220 1h-31v1407h31v-1407zM377 1h-31v1407h31v-1407zM534 1h-62v1407h62v-1407zM660 1h-31v1407h31v-1407zM723 1h-31v1407h31v-1407zM786 1h-31v1407h31v-1407zM943 1h-63v1407h63v-1407zM1100 1h-63v1407h63v-1407z M1226 1h-63v1407h63v-1407zM1352 1h-63v1407h63v-1407zM1446 1h-63v1407h63v-1407zM1635 1h-94v1407h94v-1407zM1698 1h-32v1407h32v-1407zM1792 0h-63v1408h63v-1408z" /> +<glyph unicode="" d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5 l715 -714q37 -39 37 -91z" /> +<glyph unicode="" horiz-adv-x="1920" d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5 l715 -714q37 -39 37 -91zM1899 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-36 0 -59 14t-53 45l470 470q37 37 37 90q0 52 -37 91l-715 714q-38 38 -102 64.5t-117 26.5h224q53 0 117 -26.5t102 -64.5l715 -714q37 -39 37 -91z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1639 1058q40 -57 18 -129l-275 -906q-19 -64 -76.5 -107.5t-122.5 -43.5h-923q-77 0 -148.5 53.5t-99.5 131.5q-24 67 -2 127q0 4 3 27t4 37q1 8 -3 21.5t-3 19.5q2 11 8 21t16.5 23.5t16.5 23.5q23 38 45 91.5t30 91.5q3 10 0.5 30t-0.5 28q3 11 17 28t17 23 q21 36 42 92t25 90q1 9 -2.5 32t0.5 28q4 13 22 30.5t22 22.5q19 26 42.5 84.5t27.5 96.5q1 8 -3 25.5t-2 26.5q2 8 9 18t18 23t17 21q8 12 16.5 30.5t15 35t16 36t19.5 32t26.5 23.5t36 11.5t47.5 -5.5l-1 -3q38 9 51 9h761q74 0 114 -56t18 -130l-274 -906 q-36 -119 -71.5 -153.5t-128.5 -34.5h-869q-27 0 -38 -15q-11 -16 -1 -43q24 -70 144 -70h923q29 0 56 15.5t35 41.5l300 987q7 22 5 57q38 -15 59 -43zM575 1056q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5 t-16.5 -22.5zM492 800q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5t-16.5 -22.5z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289q0 34 19.5 62t52.5 41q21 9 44 9h1048z" /> +<glyph unicode="" horiz-adv-x="1664" d="M384 0h896v256h-896v-256zM384 640h896v384h-160q-40 0 -68 28t-28 68v160h-640v-640zM1536 576q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 576v-416q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-160q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68 v160h-224q-13 0 -22.5 9.5t-9.5 22.5v416q0 79 56.5 135.5t135.5 56.5h64v544q0 40 28 68t68 28h672q40 0 88 -20t76 -48l152 -152q28 -28 48 -76t20 -88v-256h64q79 0 135.5 -56.5t56.5 -135.5z" /> +<glyph unicode="" horiz-adv-x="1920" d="M960 864q119 0 203.5 -84.5t84.5 -203.5t-84.5 -203.5t-203.5 -84.5t-203.5 84.5t-84.5 203.5t84.5 203.5t203.5 84.5zM1664 1280q106 0 181 -75t75 -181v-896q0 -106 -75 -181t-181 -75h-1408q-106 0 -181 75t-75 181v896q0 106 75 181t181 75h224l51 136 q19 49 69.5 84.5t103.5 35.5h512q53 0 103.5 -35.5t69.5 -84.5l51 -136h224zM960 128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> +<glyph unicode="" horiz-adv-x="1664" d="M725 977l-170 -450q33 0 136.5 -2t160.5 -2q19 0 57 2q-87 253 -184 452zM0 -128l2 79q23 7 56 12.5t57 10.5t49.5 14.5t44.5 29t31 50.5l237 616l280 724h75h53q8 -14 11 -21l205 -480q33 -78 106 -257.5t114 -274.5q15 -34 58 -144.5t72 -168.5q20 -45 35 -57 q19 -15 88 -29.5t84 -20.5q6 -38 6 -57q0 -4 -0.5 -13t-0.5 -13q-63 0 -190 8t-191 8q-76 0 -215 -7t-178 -8q0 43 4 78l131 28q1 0 12.5 2.5t15.5 3.5t14.5 4.5t15 6.5t11 8t9 11t2.5 14q0 16 -31 96.5t-72 177.5t-42 100l-450 2q-26 -58 -76.5 -195.5t-50.5 -162.5 q0 -22 14 -37.5t43.5 -24.5t48.5 -13.5t57 -8.5t41 -4q1 -19 1 -58q0 -9 -2 -27q-58 0 -174.5 10t-174.5 10q-8 0 -26.5 -4t-21.5 -4q-80 -14 -188 -14z" /> +<glyph unicode="" horiz-adv-x="1408" d="M555 15q74 -32 140 -32q376 0 376 335q0 114 -41 180q-27 44 -61.5 74t-67.5 46.5t-80.5 25t-84 10.5t-94.5 2q-73 0 -101 -10q0 -53 -0.5 -159t-0.5 -158q0 -8 -1 -67.5t-0.5 -96.5t4.5 -83.5t12 -66.5zM541 761q42 -7 109 -7q82 0 143 13t110 44.5t74.5 89.5t25.5 142 q0 70 -29 122.5t-79 82t-108 43.5t-124 14q-50 0 -130 -13q0 -50 4 -151t4 -152q0 -27 -0.5 -80t-0.5 -79q0 -46 1 -69zM0 -128l2 94q15 4 85 16t106 27q7 12 12.5 27t8.5 33.5t5.5 32.5t3 37.5t0.5 34v35.5v30q0 982 -22 1025q-4 8 -22 14.5t-44.5 11t-49.5 7t-48.5 4.5 t-30.5 3l-4 83q98 2 340 11.5t373 9.5q23 0 68.5 -0.5t67.5 -0.5q70 0 136.5 -13t128.5 -42t108 -71t74 -104.5t28 -137.5q0 -52 -16.5 -95.5t-39 -72t-64.5 -57.5t-73 -45t-84 -40q154 -35 256.5 -134t102.5 -248q0 -100 -35 -179.5t-93.5 -130.5t-138 -85.5t-163.5 -48.5 t-176 -14q-44 0 -132 3t-132 3q-106 0 -307 -11t-231 -12z" /> +<glyph unicode="" horiz-adv-x="1024" d="M0 -126l17 85q6 2 81.5 21.5t111.5 37.5q28 35 41 101q1 7 62 289t114 543.5t52 296.5v25q-24 13 -54.5 18.5t-69.5 8t-58 5.5l19 103q33 -2 120 -6.5t149.5 -7t120.5 -2.5q48 0 98.5 2.5t121 7t98.5 6.5q-5 -39 -19 -89q-30 -10 -101.5 -28.5t-108.5 -33.5 q-8 -19 -14 -42.5t-9 -40t-7.5 -45.5t-6.5 -42q-27 -148 -87.5 -419.5t-77.5 -355.5q-2 -9 -13 -58t-20 -90t-16 -83.5t-6 -57.5l1 -18q17 -4 185 -31q-3 -44 -16 -99q-11 0 -32.5 -1.5t-32.5 -1.5q-29 0 -87 10t-86 10q-138 2 -206 2q-51 0 -143 -9t-121 -11z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1744 128q33 0 42 -18.5t-11 -44.5l-126 -162q-20 -26 -49 -26t-49 26l-126 162q-20 26 -11 44.5t42 18.5h80v1024h-80q-33 0 -42 18.5t11 44.5l126 162q20 26 49 26t49 -26l126 -162q20 -26 11 -44.5t-42 -18.5h-80v-1024h80zM81 1407l54 -27q12 -5 211 -5q44 0 132 2 t132 2q36 0 107.5 -0.5t107.5 -0.5h293q6 0 21 -0.5t20.5 0t16 3t17.5 9t15 17.5l42 1q4 0 14 -0.5t14 -0.5q2 -112 2 -336q0 -80 -5 -109q-39 -14 -68 -18q-25 44 -54 128q-3 9 -11 48t-14.5 73.5t-7.5 35.5q-6 8 -12 12.5t-15.5 6t-13 2.5t-18 0.5t-16.5 -0.5 q-17 0 -66.5 0.5t-74.5 0.5t-64 -2t-71 -6q-9 -81 -8 -136q0 -94 2 -388t2 -455q0 -16 -2.5 -71.5t0 -91.5t12.5 -69q40 -21 124 -42.5t120 -37.5q5 -40 5 -50q0 -14 -3 -29l-34 -1q-76 -2 -218 8t-207 10q-50 0 -151 -9t-152 -9q-3 51 -3 52v9q17 27 61.5 43t98.5 29t78 27 q19 42 19 383q0 101 -3 303t-3 303v117q0 2 0.5 15.5t0.5 25t-1 25.5t-3 24t-5 14q-11 12 -162 12q-33 0 -93 -12t-80 -26q-19 -13 -34 -72.5t-31.5 -111t-42.5 -53.5q-42 26 -56 44v383z" /> +<glyph unicode="" d="M81 1407l54 -27q12 -5 211 -5q44 0 132 2t132 2q70 0 246.5 1t304.5 0.5t247 -4.5q33 -1 56 31l42 1q4 0 14 -0.5t14 -0.5q2 -112 2 -336q0 -80 -5 -109q-39 -14 -68 -18q-25 44 -54 128q-3 9 -11 47.5t-15 73.5t-7 36q-10 13 -27 19q-5 2 -66 2q-30 0 -93 1t-103 1 t-94 -2t-96 -7q-9 -81 -8 -136l1 -152v52q0 -55 1 -154t1.5 -180t0.5 -153q0 -16 -2.5 -71.5t0 -91.5t12.5 -69q40 -21 124 -42.5t120 -37.5q5 -40 5 -50q0 -14 -3 -29l-34 -1q-76 -2 -218 8t-207 10q-50 0 -151 -9t-152 -9q-3 51 -3 52v9q17 27 61.5 43t98.5 29t78 27 q7 16 11.5 74t6 145.5t1.5 155t-0.5 153.5t-0.5 89q0 7 -2.5 21.5t-2.5 22.5q0 7 0.5 44t1 73t0 76.5t-3 67.5t-6.5 32q-11 12 -162 12q-41 0 -163 -13.5t-138 -24.5q-19 -12 -34 -71.5t-31.5 -111.5t-42.5 -54q-42 26 -56 44v383zM1310 125q12 0 42 -19.5t57.5 -41.5 t59.5 -49t36 -30q26 -21 26 -49t-26 -49q-4 -3 -36 -30t-59.5 -49t-57.5 -41.5t-42 -19.5q-13 0 -20.5 10.5t-10 28.5t-2.5 33.5t1.5 33t1.5 19.5h-1024q0 -2 1.5 -19.5t1.5 -33t-2.5 -33.5t-10 -28.5t-20.5 -10.5q-12 0 -42 19.5t-57.5 41.5t-59.5 49t-36 30q-26 21 -26 49 t26 49q4 3 36 30t59.5 49t57.5 41.5t42 19.5q13 0 20.5 -10.5t10 -28.5t2.5 -33.5t-1.5 -33t-1.5 -19.5h1024q0 2 -1.5 19.5t-1.5 33t2.5 33.5t10 28.5t20.5 10.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45 t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h896q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45t-45 -19 h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h640q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45 t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45 t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1792" d="M256 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM256 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5 t9.5 -22.5zM256 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344 q13 0 22.5 -9.5t9.5 -22.5zM256 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5 t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192 q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M384 992v-576q0 -13 -9.5 -22.5t-22.5 -9.5q-14 0 -23 9l-288 288q-9 9 -9 23t9 23l288 288q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5 t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088 q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M352 704q0 -14 -9 -23l-288 -288q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v576q0 13 9.5 22.5t22.5 9.5q14 0 23 -9l288 -288q9 -9 9 -23zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5 t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088 q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 1184v-1088q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-403 403v-166q0 -119 -84.5 -203.5t-203.5 -84.5h-704q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h704q119 0 203.5 -84.5t84.5 -203.5v-165l403 402q18 19 45 19q12 0 25 -5 q39 -17 39 -59z" /> +<glyph unicode="" horiz-adv-x="1920" d="M640 960q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 576v-448h-1408v192l320 320l160 -160l512 512zM1760 1280h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5v1216 q0 13 -9.5 22.5t-22.5 9.5zM1920 1248v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" /> +<glyph unicode="" d="M363 0l91 91l-235 235l-91 -91v-107h128v-128h107zM886 928q0 22 -22 22q-10 0 -17 -7l-542 -542q-7 -7 -7 -17q0 -22 22 -22q10 0 17 7l542 542q7 7 7 17zM832 1120l416 -416l-832 -832h-416v416zM1515 1024q0 -53 -37 -90l-166 -166l-416 416l166 165q36 38 90 38 q53 0 91 -38l235 -234q37 -39 37 -91z" /> +<glyph unicode="" horiz-adv-x="1024" d="M768 896q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1024 896q0 -109 -33 -179l-364 -774q-16 -33 -47.5 -52t-67.5 -19t-67.5 19t-46.5 52l-365 774q-33 70 -33 179q0 212 150 362t362 150t362 -150t150 -362z" /> +<glyph unicode="" d="M768 96v1088q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1024" d="M512 384q0 36 -20 69q-1 1 -15.5 22.5t-25.5 38t-25 44t-21 50.5q-4 16 -21 16t-21 -16q-7 -23 -21 -50.5t-25 -44t-25.5 -38t-15.5 -22.5q-20 -33 -20 -69q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 512q0 -212 -150 -362t-362 -150t-362 150t-150 362 q0 145 81 275q6 9 62.5 90.5t101 151t99.5 178t83 201.5q9 30 34 47t51 17t51.5 -17t33.5 -47q28 -93 83 -201.5t99.5 -178t101 -151t62.5 -90.5q81 -127 81 -275z" /> +<glyph unicode="" horiz-adv-x="1792" d="M888 352l116 116l-152 152l-116 -116v-56h96v-96h56zM1328 1072q-16 16 -33 -1l-350 -350q-17 -17 -1 -33t33 1l350 350q17 17 1 33zM1408 478v-190q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832 q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-14 -14 -32 -8q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v126q0 13 9 22l64 64q15 15 35 7t20 -29zM1312 1216l288 -288l-672 -672h-288v288zM1756 1084l-92 -92 l-288 288l92 92q28 28 68 28t68 -28l152 -152q28 -28 28 -68t-28 -68z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1408 547v-259q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h255v0q13 0 22.5 -9.5t9.5 -22.5q0 -27 -26 -32q-77 -26 -133 -60q-10 -4 -16 -4h-112q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832 q66 0 113 47t47 113v214q0 19 18 29q28 13 54 37q16 16 35 8q21 -9 21 -29zM1645 1043l-384 -384q-18 -19 -45 -19q-12 0 -25 5q-39 17 -39 59v192h-160q-323 0 -438 -131q-119 -137 -74 -473q3 -23 -20 -34q-8 -2 -12 -2q-16 0 -26 13q-10 14 -21 31t-39.5 68.5t-49.5 99.5 t-38.5 114t-17.5 122q0 49 3.5 91t14 90t28 88t47 81.5t68.5 74t94.5 61.5t124.5 48.5t159.5 30.5t196.5 11h160v192q0 42 39 59q13 5 25 5q26 0 45 -19l384 -384q19 -19 19 -45t-19 -45z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1408 606v-318q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-10 -10 -23 -10q-3 0 -9 2q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832 q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v254q0 13 9 22l64 64q10 10 23 10q6 0 12 -3q20 -8 20 -29zM1639 1095l-814 -814q-24 -24 -57 -24t-57 24l-430 430q-24 24 -24 57t24 57l110 110q24 24 57 24t57 -24l263 -263l647 647q24 24 57 24t57 -24l110 -110 q24 -24 24 -57t-24 -57z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-384v-384h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v384h-384v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45 t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h384v384h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45t-19 -45t-45 -19h-128v-384h384v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" /> +<glyph unicode="" horiz-adv-x="1024" d="M979 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 11 13 19z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1747 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 11 13 19l710 710 q19 19 32 13t13 -32v-710q4 11 13 19z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1619 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-8 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-19 19 -19 45t19 45l710 710q19 19 32 13t13 -32v-710q5 11 13 19z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1384 609l-1328 -738q-23 -13 -39.5 -3t-16.5 36v1472q0 26 16.5 36t39.5 -3l1328 -738q23 -13 23 -31t-23 -31z" /> +<glyph unicode="" d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45zM640 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45z" /> +<glyph unicode="" d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1664" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v710q0 26 13 32t32 -13l710 -710q19 -19 19 -45t-19 -45l-710 -710q-19 -19 -32 -13t-13 32v710q-5 -10 -13 -19z" /> +<glyph unicode="" horiz-adv-x="1792" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v710q0 26 13 32t32 -13l710 -710q8 -8 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-5 -10 -13 -19l-710 -710 q-19 -19 -32 -13t-13 32v710q-5 -10 -13 -19z" /> +<glyph unicode="" horiz-adv-x="1024" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-5 -10 -13 -19z" /> +<glyph unicode="" horiz-adv-x="1538" d="M14 557l710 710q19 19 45 19t45 -19l710 -710q19 -19 13 -32t-32 -13h-1472q-26 0 -32 13t13 32zM1473 0h-1408q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1408q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1171 1235l-531 -531l531 -531q19 -19 19 -45t-19 -45l-166 -166q-19 -19 -45 -19t-45 19l-742 742q-19 19 -19 45t19 45l742 742q19 19 45 19t45 -19l166 -166q19 -19 19 -45t-19 -45z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1107 659l-742 -742q-19 -19 -45 -19t-45 19l-166 166q-19 19 -19 45t19 45l531 531l-531 531q-19 19 -19 45t19 45l166 166q19 19 45 19t45 -19l742 -742q19 -19 19 -45t-19 -45z" /> +<glyph unicode="" d="M1216 576v128q0 26 -19 45t-45 19h-256v256q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-256h-256q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h256v-256q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v256h256q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5 t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1216 576v128q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5 t103 -385.5z" /> +<glyph unicode="" d="M1149 414q0 26 -19 45l-181 181l181 181q19 19 19 45q0 27 -19 46l-90 90q-19 19 -46 19q-26 0 -45 -19l-181 -181l-181 181q-19 19 -45 19q-27 0 -46 -19l-90 -90q-19 -19 -19 -46q0 -26 19 -45l181 -181l-181 -181q-19 -19 -19 -45q0 -27 19 -46l90 -90q19 -19 46 -19 q26 0 45 19l181 181l181 -181q19 -19 45 -19q27 0 46 19l90 90q19 19 19 46zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1284 802q0 28 -18 46l-91 90q-19 19 -45 19t-45 -19l-408 -407l-226 226q-19 19 -45 19t-45 -19l-91 -90q-18 -18 -18 -46q0 -27 18 -45l362 -362q19 -19 45 -19q27 0 46 19l543 543q18 18 18 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M896 160v192q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h192q14 0 23 9t9 23zM1152 832q0 88 -55.5 163t-138.5 116t-170 41q-243 0 -371 -213q-15 -24 8 -42l132 -100q7 -6 19 -6q16 0 25 12q53 68 86 92q34 24 86 24q48 0 85.5 -26t37.5 -59 q0 -38 -20 -61t-68 -45q-63 -28 -115.5 -86.5t-52.5 -125.5v-36q0 -14 9 -23t23 -9h192q14 0 23 9t9 23q0 19 21.5 49.5t54.5 49.5q32 18 49 28.5t46 35t44.5 48t28 60.5t12.5 81zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1024 160v160q0 14 -9 23t-23 9h-96v512q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h96v-320h-96q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h448q14 0 23 9t9 23zM896 1056v160q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23 t23 -9h192q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1197 512h-109q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h109q-32 108 -112.5 188.5t-188.5 112.5v-109q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v109q-108 -32 -188.5 -112.5t-112.5 -188.5h109q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-109 q32 -108 112.5 -188.5t188.5 -112.5v109q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-109q108 32 188.5 112.5t112.5 188.5zM1536 704v-128q0 -26 -19 -45t-45 -19h-143q-37 -161 -154.5 -278.5t-278.5 -154.5v-143q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v143 q-161 37 -278.5 154.5t-154.5 278.5h-143q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h143q37 161 154.5 278.5t278.5 154.5v143q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-143q161 -37 278.5 -154.5t154.5 -278.5h143q26 0 45 -19t19 -45z" /> +<glyph unicode="" d="M1097 457l-146 -146q-10 -10 -23 -10t-23 10l-137 137l-137 -137q-10 -10 -23 -10t-23 10l-146 146q-10 10 -10 23t10 23l137 137l-137 137q-10 10 -10 23t10 23l146 146q10 10 23 10t23 -10l137 -137l137 137q10 10 23 10t23 -10l146 -146q10 -10 10 -23t-10 -23 l-137 -137l137 -137q10 -10 10 -23t-10 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5 t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1171 723l-422 -422q-19 -19 -45 -19t-45 19l-294 294q-19 19 -19 45t19 45l102 102q19 19 45 19t45 -19l147 -147l275 275q19 19 45 19t45 -19l102 -102q19 -19 19 -45t-19 -45zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198 t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1312 643q0 161 -87 295l-754 -753q137 -89 297 -89q111 0 211.5 43.5t173.5 116.5t116 174.5t43 212.5zM313 344l755 754q-135 91 -300 91q-148 0 -273 -73t-198 -199t-73 -274q0 -162 89 -299zM1536 643q0 -157 -61 -300t-163.5 -246t-245 -164t-298.5 -61t-298.5 61 t-245 164t-163.5 246t-61 300t61 299.5t163.5 245.5t245 164t298.5 61t298.5 -61t245 -164t163.5 -245.5t61 -299.5z" /> +<glyph unicode="" d="M1536 640v-128q0 -53 -32.5 -90.5t-84.5 -37.5h-704l293 -294q38 -36 38 -90t-38 -90l-75 -76q-37 -37 -90 -37q-52 0 -91 37l-651 652q-37 37 -37 90q0 52 37 91l651 650q38 38 91 38q52 0 90 -38l75 -74q38 -38 38 -91t-38 -91l-293 -293h704q52 0 84.5 -37.5 t32.5 -90.5z" /> +<glyph unicode="" d="M1472 576q0 -54 -37 -91l-651 -651q-39 -37 -91 -37q-51 0 -90 37l-75 75q-38 38 -38 91t38 91l293 293h-704q-52 0 -84.5 37.5t-32.5 90.5v128q0 53 32.5 90.5t84.5 37.5h704l-293 294q-38 36 -38 90t38 90l75 75q38 38 90 38q53 0 91 -38l651 -651q37 -35 37 -90z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1611 565q0 -51 -37 -90l-75 -75q-38 -38 -91 -38q-54 0 -90 38l-294 293v-704q0 -52 -37.5 -84.5t-90.5 -32.5h-128q-53 0 -90.5 32.5t-37.5 84.5v704l-294 -293q-36 -38 -90 -38t-90 38l-75 75q-38 38 -38 90q0 53 38 91l651 651q35 37 90 37q54 0 91 -37l651 -651 q37 -39 37 -91z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1611 704q0 -53 -37 -90l-651 -652q-39 -37 -91 -37q-53 0 -90 37l-651 652q-38 36 -38 90q0 53 38 91l74 75q39 37 91 37q53 0 90 -37l294 -294v704q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-704l294 294q37 37 90 37q52 0 91 -37l75 -75q37 -39 37 -91z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 896q0 -26 -19 -45l-512 -512q-19 -19 -45 -19t-45 19t-19 45v256h-224q-98 0 -175.5 -6t-154 -21.5t-133 -42.5t-105.5 -69.5t-80 -101t-48.5 -138.5t-17.5 -181q0 -55 5 -123q0 -6 2.5 -23.5t2.5 -26.5q0 -15 -8.5 -25t-23.5 -10q-16 0 -28 17q-7 9 -13 22 t-13.5 30t-10.5 24q-127 285 -127 451q0 199 53 333q162 403 875 403h224v256q0 26 19 45t45 19t45 -19l512 -512q19 -19 19 -45z" /> +<glyph unicode="" d="M755 480q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23zM1536 1344v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332 q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45z" /> +<glyph unicode="" d="M768 576v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45zM1523 1248q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45 t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1408 800v-192q0 -40 -28 -68t-68 -28h-416v-416q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v416h-416q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h416v416q0 40 28 68t68 28h192q40 0 68 -28t28 -68v-416h416q40 0 68 -28t28 -68z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1408 800v-192q0 -40 -28 -68t-68 -28h-1216q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h1216q40 0 68 -28t28 -68z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1482 486q46 -26 59.5 -77.5t-12.5 -97.5l-64 -110q-26 -46 -77.5 -59.5t-97.5 12.5l-266 153v-307q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v307l-266 -153q-46 -26 -97.5 -12.5t-77.5 59.5l-64 110q-26 46 -12.5 97.5t59.5 77.5l266 154l-266 154 q-46 26 -59.5 77.5t12.5 97.5l64 110q26 46 77.5 59.5t97.5 -12.5l266 -153v307q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-307l266 153q46 26 97.5 12.5t77.5 -59.5l64 -110q26 -46 12.5 -97.5t-59.5 -77.5l-266 -154z" /> +<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM896 161v190q0 14 -9 23.5t-22 9.5h-192q-13 0 -23 -10t-10 -23v-190q0 -13 10 -23t23 -10h192 q13 0 22 9.5t9 23.5zM894 505l18 621q0 12 -10 18q-10 8 -24 8h-220q-14 0 -24 -8q-10 -6 -10 -18l17 -621q0 -10 10 -17.5t24 -7.5h185q14 0 23.5 7.5t10.5 17.5z" /> +<glyph unicode="" d="M928 180v56v468v192h-320v-192v-468v-56q0 -25 18 -38.5t46 -13.5h192q28 0 46 13.5t18 38.5zM472 1024h195l-126 161q-26 31 -69 31q-40 0 -68 -28t-28 -68t28 -68t68 -28zM1160 1120q0 40 -28 68t-68 28q-43 0 -69 -31l-125 -161h194q40 0 68 28t28 68zM1536 864v-320 q0 -14 -9 -23t-23 -9h-96v-416q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v416h-96q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h440q-93 0 -158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5q107 0 168 -77l128 -165l128 165q61 77 168 77q93 0 158.5 -65.5t65.5 -158.5 t-65.5 -158.5t-158.5 -65.5h440q14 0 23 -9t9 -23z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1280 832q0 26 -19 45t-45 19q-172 0 -318 -49.5t-259.5 -134t-235.5 -219.5q-19 -21 -19 -45q0 -26 19 -45t45 -19q24 0 45 19q27 24 74 71t67 66q137 124 268.5 176t313.5 52q26 0 45 19t19 45zM1792 1030q0 -95 -20 -193q-46 -224 -184.5 -383t-357.5 -268 q-214 -108 -438 -108q-148 0 -286 47q-15 5 -88 42t-96 37q-16 0 -39.5 -32t-45 -70t-52.5 -70t-60 -32q-30 0 -51 11t-31 24t-27 42q-2 4 -6 11t-5.5 10t-3 9.5t-1.5 13.5q0 35 31 73.5t68 65.5t68 56t31 48q0 4 -14 38t-16 44q-9 51 -9 104q0 115 43.5 220t119 184.5 t170.5 139t204 95.5q55 18 145 25.5t179.5 9t178.5 6t163.5 24t113.5 56.5l29.5 29.5t29.5 28t27 20t36.5 16t43.5 4.5q39 0 70.5 -46t47.5 -112t24 -124t8 -96z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1408 -160v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1152 896q0 -78 -24.5 -144t-64 -112.5t-87.5 -88t-96 -77.5t-87.5 -72t-64 -81.5t-24.5 -96.5q0 -96 67 -224l-4 1l1 -1 q-90 41 -160 83t-138.5 100t-113.5 122.5t-72.5 150.5t-27.5 184q0 78 24.5 144t64 112.5t87.5 88t96 77.5t87.5 72t64 81.5t24.5 96.5q0 94 -66 224l3 -1l-1 1q90 -41 160 -83t138.5 -100t113.5 -122.5t72.5 -150.5t27.5 -184z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1664 576q-152 236 -381 353q61 -104 61 -225q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 121 61 225q-229 -117 -381 -353q133 -205 333.5 -326.5t434.5 -121.5t434.5 121.5t333.5 326.5zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5 t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1792 576q0 -34 -20 -69q-140 -230 -376.5 -368.5t-499.5 -138.5t-499.5 139t-376.5 368q-20 35 -20 69t20 69q140 229 376.5 368t499.5 139t499.5 -139t376.5 -368q20 -35 20 -69z" /> +<glyph unicode="" horiz-adv-x="1792" d="M555 201l78 141q-87 63 -136 159t-49 203q0 121 61 225q-229 -117 -381 -353q167 -258 427 -375zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1307 1151q0 -7 -1 -9 q-105 -188 -315 -566t-316 -567l-49 -89q-10 -16 -28 -16q-12 0 -134 70q-16 10 -16 28q0 12 44 87q-143 65 -263.5 173t-208.5 245q-20 31 -20 69t20 69q153 235 380 371t496 136q89 0 180 -17l54 97q10 16 28 16q5 0 18 -6t31 -15.5t33 -18.5t31.5 -18.5t19.5 -11.5 q16 -10 16 -27zM1344 704q0 -139 -79 -253.5t-209 -164.5l280 502q8 -45 8 -84zM1792 576q0 -35 -20 -69q-39 -64 -109 -145q-150 -172 -347.5 -267t-419.5 -95l74 132q212 18 392.5 137t301.5 307q-115 179 -282 294l63 112q95 -64 182.5 -153t144.5 -184q20 -34 20 -69z " /> +<glyph unicode="" horiz-adv-x="1792" d="M1024 161v190q0 14 -9.5 23.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -23.5v-190q0 -14 9.5 -23.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 23.5zM1022 535l18 459q0 12 -10 19q-13 11 -24 11h-220q-11 0 -24 -11q-10 -7 -10 -21l17 -457q0 -10 10 -16.5t24 -6.5h185 q14 0 23.5 6.5t10.5 16.5zM1008 1469l768 -1408q35 -63 -2 -126q-17 -29 -46.5 -46t-63.5 -17h-1536q-34 0 -63.5 17t-46.5 46q-37 63 -2 126l768 1408q17 31 47 49t65 18t65 -18t47 -49z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1376 1376q44 -52 12 -148t-108 -172l-161 -161l160 -696q5 -19 -12 -33l-128 -96q-7 -6 -19 -6q-4 0 -7 1q-15 3 -21 16l-279 508l-259 -259l53 -194q5 -17 -8 -31l-96 -96q-9 -9 -23 -9h-2q-15 2 -24 13l-189 252l-252 189q-11 7 -13 23q-1 13 9 25l96 97q9 9 23 9 q6 0 8 -1l194 -53l259 259l-508 279q-14 8 -17 24q-2 16 9 27l128 128q14 13 30 8l665 -159l160 160q76 76 172 108t148 -12z" /> +<glyph unicode="" horiz-adv-x="1664" d="M128 -128h288v288h-288v-288zM480 -128h320v288h-320v-288zM128 224h288v320h-288v-320zM480 224h320v320h-320v-320zM128 608h288v288h-288v-288zM864 -128h320v288h-320v-288zM480 608h320v288h-320v-288zM1248 -128h288v288h-288v-288zM864 224h320v320h-320v-320z M512 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1248 224h288v320h-288v-320zM864 608h320v288h-320v-288zM1248 608h288v288h-288v-288zM1280 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64 q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47 h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" /> +<glyph unicode="" horiz-adv-x="1792" d="M666 1055q-60 -92 -137 -273q-22 45 -37 72.5t-40.5 63.5t-51 56.5t-63 35t-81.5 14.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q250 0 410 -225zM1792 256q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192q-32 0 -85 -0.5t-81 -1t-73 1 t-71 5t-64 10.5t-63 18.5t-58 28.5t-59 40t-55 53.5t-56 69.5q59 93 136 273q22 -45 37 -72.5t40.5 -63.5t51 -56.5t63 -35t81.5 -14.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1792 1152q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5 v192h-256q-48 0 -87 -15t-69 -45t-51 -61.5t-45 -77.5q-32 -62 -78 -171q-29 -66 -49.5 -111t-54 -105t-64 -100t-74 -83t-90 -68.5t-106.5 -42t-128 -16.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q48 0 87 15t69 45t51 61.5t45 77.5q32 62 78 171q29 66 49.5 111 t54 105t64 100t74 83t90 68.5t106.5 42t128 16.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22q-17 -2 -30.5 9t-17.5 29v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281 q0 130 71 248.5t191 204.5t286 136.5t348 50.5q244 0 450 -85.5t326 -233t120 -321.5z" /> +<glyph unicode="" d="M1536 704v-128q0 -201 -98.5 -362t-274 -251.5t-395.5 -90.5t-395.5 90.5t-274 251.5t-98.5 362v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-128q0 -52 23.5 -90t53.5 -57t71 -30t64 -13t44 -2t44 2t64 13t71 30t53.5 57t23.5 90v128q0 26 19 45t45 19h384 q26 0 45 -19t19 -45zM512 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45zM1536 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1683 205l-166 -165q-19 -19 -45 -19t-45 19l-531 531l-531 -531q-19 -19 -45 -19t-45 19l-166 165q-19 19 -19 45.5t19 45.5l742 741q19 19 45 19t45 -19l742 -741q19 -19 19 -45.5t-19 -45.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1683 728l-742 -741q-19 -19 -45 -19t-45 19l-742 741q-19 19 -19 45.5t19 45.5l166 165q19 19 45 19t45 -19l531 -531l531 531q19 19 45 19t45 -19l166 -165q19 -19 19 -45.5t-19 -45.5z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1280 32q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-8 0 -13.5 2t-9 7t-5.5 8t-3 11.5t-1 11.5v13v11v160v416h-192q-26 0 -45 19t-19 45q0 24 15 41l320 384q19 22 49 22t49 -22l320 -384q15 -17 15 -41q0 -26 -19 -45t-45 -19h-192v-384h576q16 0 25 -11l160 -192q7 -11 7 -21 zM1920 448q0 -24 -15 -41l-320 -384q-20 -23 -49 -23t-49 23l-320 384q-15 17 -15 41q0 26 19 45t45 19h192v384h-576q-16 0 -25 12l-160 192q-7 9 -7 20q0 13 9.5 22.5t22.5 9.5h960q8 0 13.5 -2t9 -7t5.5 -8t3 -11.5t1 -11.5v-13v-11v-160v-416h192q26 0 45 -19t19 -45z " /> +<glyph unicode="" horiz-adv-x="1664" d="M640 0q0 -52 -38 -90t-90 -38t-90 38t-38 90t38 90t90 38t90 -38t38 -90zM1536 0q0 -52 -38 -90t-90 -38t-90 38t-38 90t38 90t90 38t90 -38t38 -90zM1664 1088v-512q0 -24 -16.5 -42.5t-40.5 -21.5l-1044 -122q13 -60 13 -70q0 -16 -24 -64h920q26 0 45 -19t19 -45 t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 11 8 31.5t16 36t21.5 40t15.5 29.5l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t19.5 -15.5t13 -24.5t8 -26t5.5 -29.5t4.5 -26h1201q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1879 584q0 -31 -31 -66l-336 -396q-43 -51 -120.5 -86.5t-143.5 -35.5h-1088q-34 0 -60.5 13t-26.5 43q0 31 31 66l336 396q43 51 120.5 86.5t143.5 35.5h1088q34 0 60.5 -13t26.5 -43zM1536 928v-160h-832q-94 0 -197 -47.5t-164 -119.5l-337 -396l-5 -6q0 4 -0.5 12.5 t-0.5 12.5v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158z" /> +<glyph unicode="" horiz-adv-x="768" d="M704 1216q0 -26 -19 -45t-45 -19h-128v-1024h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v1024h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-1024v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h1024v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" /> +<glyph unicode="" horiz-adv-x="2048" d="M640 640v-512h-256v512h256zM1024 1152v-1024h-256v1024h256zM2048 0v-128h-2048v1536h128v-1408h1920zM1408 896v-768h-256v768h256zM1792 1280v-1152h-256v1152h256z" /> +<glyph unicode="" d="M1280 926q-56 -25 -121 -34q68 40 93 117q-65 -38 -134 -51q-61 66 -153 66q-87 0 -148.5 -61.5t-61.5 -148.5q0 -29 5 -48q-129 7 -242 65t-192 155q-29 -50 -29 -106q0 -114 91 -175q-47 1 -100 26v-2q0 -75 50 -133.5t123 -72.5q-29 -8 -51 -8q-13 0 -39 4 q21 -63 74.5 -104t121.5 -42q-116 -90 -261 -90q-26 0 -50 3q148 -94 322 -94q112 0 210 35.5t168 95t120.5 137t75 162t24.5 168.5q0 18 -1 27q63 45 105 109zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5 t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-188v595h199l30 232h-229v148q0 56 23.5 84t91.5 28l122 1v207q-63 9 -178 9q-136 0 -217.5 -80t-81.5 -226v-171h-200v-232h200v-595h-532q-119 0 -203.5 84.5t-84.5 203.5v960 q0 119 84.5 203.5t203.5 84.5h960z" /> +<glyph unicode="" horiz-adv-x="1792" d="M928 704q0 14 -9 23t-23 9q-66 0 -113 -47t-47 -113q0 -14 9 -23t23 -9t23 9t9 23q0 40 28 68t68 28q14 0 23 9t9 23zM1152 574q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM128 0h1536v128h-1536v-128zM1280 574q0 159 -112.5 271.5 t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM256 1216h384v128h-384v-128zM128 1024h1536v118v138h-828l-64 -128h-644v-128zM1792 1280v-1280q0 -53 -37.5 -90.5t-90.5 -37.5h-1536q-53 0 -90.5 37.5t-37.5 90.5v1280 q0 53 37.5 90.5t90.5 37.5h1536q53 0 90.5 -37.5t37.5 -90.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M832 1024q0 80 -56 136t-136 56t-136 -56t-56 -136q0 -42 19 -83q-41 19 -83 19q-80 0 -136 -56t-56 -136t56 -136t136 -56t136 56t56 136q0 42 -19 83q41 -19 83 -19q80 0 136 56t56 136zM1683 320q0 -17 -49 -66t-66 -49q-9 0 -28.5 16t-36.5 33t-38.5 40t-24.5 26 l-96 -96l220 -220q28 -28 28 -68q0 -42 -39 -81t-81 -39q-40 0 -68 28l-671 671q-176 -131 -365 -131q-163 0 -265.5 102.5t-102.5 265.5q0 160 95 313t248 248t313 95q163 0 265.5 -102.5t102.5 -265.5q0 -189 -131 -365l355 -355l96 96q-3 3 -26 24.5t-40 38.5t-33 36.5 t-16 28.5q0 17 49 66t66 49q13 0 23 -10q6 -6 46 -44.5t82 -79.5t86.5 -86t73 -78t28.5 -41z" /> +<glyph unicode="" horiz-adv-x="1920" d="M896 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1664 128q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 1152q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5 t90.5 37.5t37.5 90.5zM1280 731v-185q0 -10 -7 -19.5t-16 -10.5l-155 -24q-11 -35 -32 -76q34 -48 90 -115q7 -10 7 -20q0 -12 -7 -19q-23 -30 -82.5 -89.5t-78.5 -59.5q-11 0 -21 7l-115 90q-37 -19 -77 -31q-11 -108 -23 -155q-7 -24 -30 -24h-186q-11 0 -20 7.5t-10 17.5 l-23 153q-34 10 -75 31l-118 -89q-7 -7 -20 -7q-11 0 -21 8q-144 133 -144 160q0 9 7 19q10 14 41 53t47 61q-23 44 -35 82l-152 24q-10 1 -17 9.5t-7 19.5v185q0 10 7 19.5t16 10.5l155 24q11 35 32 76q-34 48 -90 115q-7 11 -7 20q0 12 7 20q22 30 82 89t79 59q11 0 21 -7 l115 -90q34 18 77 32q11 108 23 154q7 24 30 24h186q11 0 20 -7.5t10 -17.5l23 -153q34 -10 75 -31l118 89q8 7 20 7q11 0 21 -8q144 -133 144 -160q0 -9 -7 -19q-12 -16 -42 -54t-45 -60q23 -48 34 -82l152 -23q10 -2 17 -10.5t7 -19.5zM1920 198v-140q0 -16 -149 -31 q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20 t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31zM1920 1222v-140q0 -16 -149 -31q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68 q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70 q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1408 768q0 -139 -94 -257t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224 q0 139 94 257t256.5 186.5t353.5 68.5t353.5 -68.5t256.5 -186.5t94 -257zM1792 512q0 -120 -71 -224.5t-195 -176.5q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7 q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230z" /> +<glyph unicode="" d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 768q0 51 -39 89.5t-89 38.5h-352q0 58 48 159.5t48 160.5q0 98 -32 145t-128 47q-26 -26 -38 -85t-30.5 -125.5t-59.5 -109.5q-22 -23 -77 -91q-4 -5 -23 -30t-31.5 -41t-34.5 -42.5 t-40 -44t-38.5 -35.5t-40 -27t-35.5 -9h-32v-640h32q13 0 31.5 -3t33 -6.5t38 -11t35 -11.5t35.5 -12.5t29 -10.5q211 -73 342 -73h121q192 0 192 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5q32 1 53.5 47t21.5 81zM1536 769 q0 -89 -49 -163q9 -33 9 -69q0 -77 -38 -144q3 -21 3 -43q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5h-36h-93q-96 0 -189.5 22.5t-216.5 65.5q-116 40 -138 40h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h274q36 24 137 155q58 75 107 128 q24 25 35.5 85.5t30.5 126.5t62 108q39 37 90 37q84 0 151 -32.5t102 -101.5t35 -186q0 -93 -48 -192h176q104 0 180 -76t76 -179z" /> +<glyph unicode="" d="M256 1088q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 512q0 35 -21.5 81t-53.5 47q15 17 25 47.5t10 55.5q0 69 -53 119q18 32 18 69t-17.5 73.5t-47.5 52.5q5 30 5 56q0 85 -49 126t-136 41h-128q-131 0 -342 -73q-5 -2 -29 -10.5 t-35.5 -12.5t-35 -11.5t-38 -11t-33 -6.5t-31.5 -3h-32v-640h32q16 0 35.5 -9t40 -27t38.5 -35.5t40 -44t34.5 -42.5t31.5 -41t23 -30q55 -68 77 -91q41 -43 59.5 -109.5t30.5 -125.5t38 -85q96 0 128 47t32 145q0 59 -48 160.5t-48 159.5h352q50 0 89 38.5t39 89.5z M1536 511q0 -103 -76 -179t-180 -76h-176q48 -99 48 -192q0 -118 -35 -186q-35 -69 -102 -101.5t-151 -32.5q-51 0 -90 37q-34 33 -54 82t-25.5 90.5t-17.5 84.5t-31 64q-48 50 -107 127q-101 131 -137 155h-274q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5 h288q22 0 138 40q128 44 223 66t200 22h112q140 0 226.5 -79t85.5 -216v-5q60 -77 60 -178q0 -22 -3 -43q38 -67 38 -144q0 -36 -9 -69q49 -74 49 -163z" /> +<glyph unicode="" horiz-adv-x="896" d="M832 1504v-1339l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1664 940q0 81 -21.5 143t-55 98.5t-81.5 59.5t-94 31t-98 8t-112 -25.5t-110.5 -64t-86.5 -72t-60 -61.5q-18 -22 -49 -22t-49 22q-24 28 -60 61.5t-86.5 72t-110.5 64t-112 25.5t-98 -8t-94 -31t-81.5 -59.5t-55 -98.5t-21.5 -143q0 -168 187 -355l581 -560l580 559 q188 188 188 356zM1792 940q0 -221 -229 -450l-623 -600q-18 -18 -44 -18t-44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5 q224 0 351 -124t127 -344z" /> +<glyph unicode="" horiz-adv-x="1664" d="M640 96q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h320q13 0 22.5 -9.5t9.5 -22.5q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-66 0 -113 -47t-47 -113v-704 q0 -66 47 -113t113 -47h288h11h13t11.5 -1t11.5 -3t8 -5.5t7 -9t2 -13.5zM1568 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45z" /> +<glyph unicode="" d="M237 122h231v694h-231v-694zM483 1030q-1 52 -36 86t-93 34t-94.5 -34t-36.5 -86q0 -51 35.5 -85.5t92.5 -34.5h1q59 0 95 34.5t36 85.5zM1068 122h231v398q0 154 -73 233t-193 79q-136 0 -209 -117h2v101h-231q3 -66 0 -694h231v388q0 38 7 56q15 35 45 59.5t74 24.5 q116 0 116 -157v-371zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1152" d="M480 672v448q0 14 -9 23t-23 9t-23 -9t-9 -23v-448q0 -14 9 -23t23 -9t23 9t9 23zM1152 320q0 -26 -19 -45t-45 -19h-429l-51 -483q-2 -12 -10.5 -20.5t-20.5 -8.5h-1q-27 0 -32 27l-76 485h-404q-26 0 -45 19t-19 45q0 123 78.5 221.5t177.5 98.5v512q-52 0 -90 38 t-38 90t38 90t90 38h640q52 0 90 -38t38 -90t-38 -90t-90 -38v-512q99 0 177.5 -98.5t78.5 -221.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1408 608v-320q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h704q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v320 q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1792 1472v-512q0 -26 -19 -45t-45 -19t-45 19l-176 176l-652 -652q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l652 652l-176 176q-19 19 -19 45t19 45t45 19h512q26 0 45 -19t19 -45z" /> +<glyph unicode="" d="M1184 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45zM1536 992v-704q0 -119 -84.5 -203.5t-203.5 -84.5h-320q-13 0 -22.5 9.5t-9.5 22.5 q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q66 0 113 47t47 113v704q0 66 -47 113t-113 47h-288h-11h-13t-11.5 1t-11.5 3t-8 5.5t-7 9t-2 13.5q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1664" d="M458 653q-74 162 -74 371h-256v-96q0 -78 94.5 -162t235.5 -113zM1536 928v96h-256q0 -209 -74 -371q141 29 235.5 113t94.5 162zM1664 1056v-128q0 -71 -41.5 -143t-112 -130t-173 -97.5t-215.5 -44.5q-42 -54 -95 -95q-38 -34 -52.5 -72.5t-14.5 -89.5q0 -54 30.5 -91 t97.5 -37q75 0 133.5 -45.5t58.5 -114.5v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 69 58.5 114.5t133.5 45.5q67 0 97.5 37t30.5 91q0 51 -14.5 89.5t-52.5 72.5q-53 41 -95 95q-113 5 -215.5 44.5t-173 97.5t-112 130t-41.5 143v128q0 40 28 68t68 28h288v96 q0 66 47 113t113 47h576q66 0 113 -47t47 -113v-96h288q40 0 68 -28t28 -68z" /> +<glyph unicode="" d="M519 336q4 6 -3 13q-9 7 -14 2q-4 -6 3 -13q9 -7 14 -2zM491 377q-5 7 -12 4q-6 -4 0 -12q7 -8 12 -5q6 4 0 13zM450 417q2 4 -5 8q-7 2 -8 -2q-3 -5 4 -8q8 -2 9 2zM471 394q2 1 1.5 4.5t-3.5 5.5q-6 7 -10 3t1 -11q6 -6 11 -2zM557 319q2 7 -9 11q-9 3 -13 -4 q-2 -7 9 -11q9 -3 13 4zM599 316q0 8 -12 8q-10 0 -10 -8t11 -8t11 8zM638 323q-2 7 -13 5t-9 -9q2 -8 12 -6t10 10zM1280 640q0 212 -150 362t-362 150t-362 -150t-150 -362q0 -167 98 -300.5t252 -185.5q18 -3 26.5 5t8.5 20q0 52 -1 95q-6 -1 -15.5 -2.5t-35.5 -2t-48 4 t-43.5 20t-29.5 41.5q-23 59 -57 74q-2 1 -4.5 3.5l-8 8t-7 9.5t4 7.5t19.5 3.5q6 0 15 -2t30 -15.5t33 -35.5q16 -28 37.5 -42t43.5 -14t38 3.5t30 9.5q7 47 33 69q-49 6 -86 18.5t-73 39t-55.5 76t-19.5 119.5q0 79 53 137q-24 62 5 136q19 6 54.5 -7.5t60.5 -29.5l26 -16 q58 17 128 17t128 -17q11 7 28.5 18t55.5 26t57 9q29 -74 5 -136q53 -58 53 -137q0 -57 -14 -100.5t-35.5 -70t-53.5 -44.5t-62.5 -26t-68.5 -12q35 -31 35 -95q0 -40 -0.5 -89t-0.5 -51q0 -12 8.5 -20t26.5 -5q154 52 252 185.5t98 300.5zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1280 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 288v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h427q21 -56 70.5 -92 t110.5 -36h256q61 0 110.5 36t70.5 92h427q40 0 68 -28t28 -68zM1339 936q-17 -40 -59 -40h-256v-448q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v448h-256q-42 0 -59 40q-17 39 14 69l448 448q18 19 45 19t45 -19l448 -448q31 -30 14 -69z" /> +<glyph unicode="" d="M1407 710q0 44 -7 113.5t-18 96.5q-12 30 -17 44t-9 36.5t-4 48.5q0 23 5 68.5t5 67.5q0 37 -10 55q-4 1 -13 1q-19 0 -58 -4.5t-59 -4.5q-60 0 -176 24t-175 24q-43 0 -94.5 -11.5t-85 -23.5t-89.5 -34q-137 -54 -202 -103q-96 -73 -159.5 -189.5t-88 -236t-24.5 -248.5 q0 -40 12.5 -120t12.5 -121q0 -23 -11 -66.5t-11 -65.5t12 -36.5t34 -14.5q24 0 72.5 11t73.5 11q57 0 169.5 -15.5t169.5 -15.5q181 0 284 36q129 45 235.5 152.5t166 245.5t59.5 275zM1535 712q0 -165 -70 -327.5t-196 -288t-281 -180.5q-124 -44 -326 -44 q-57 0 -170 14.5t-169 14.5q-24 0 -72.5 -14.5t-73.5 -14.5q-73 0 -123.5 55.5t-50.5 128.5q0 24 11 68t11 67q0 40 -12.5 120.5t-12.5 121.5q0 111 18 217.5t54.5 209.5t100.5 194t150 156q78 59 232 120q194 78 316 78q60 0 175.5 -24t173.5 -24q19 0 57 5t58 5 q81 0 118 -50.5t37 -134.5q0 -23 -5 -68t-5 -68q0 -10 1 -18.5t3 -17t4 -13.5t6.5 -16t6.5 -17q16 -40 25 -118.5t9 -136.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1408 296q0 -27 -10 -70.5t-21 -68.5q-21 -50 -122 -106q-94 -51 -186 -51q-27 0 -52.5 3.5t-57.5 12.5t-47.5 14.5t-55.5 20.5t-49 18q-98 35 -175 83q-128 79 -264.5 215.5t-215.5 264.5q-48 77 -83 175q-3 9 -18 49t-20.5 55.5t-14.5 47.5t-12.5 57.5t-3.5 52.5 q0 92 51 186q56 101 106 122q25 11 68.5 21t70.5 10q14 0 21 -3q18 -6 53 -76q11 -19 30 -54t35 -63.5t31 -53.5q3 -4 17.5 -25t21.5 -35.5t7 -28.5q0 -20 -28.5 -50t-62 -55t-62 -53t-28.5 -46q0 -9 5 -22.5t8.5 -20.5t14 -24t11.5 -19q76 -137 174 -235t235 -174 q2 -1 19 -11.5t24 -14t20.5 -8.5t22.5 -5q18 0 46 28.5t53 62t55 62t50 28.5q14 0 28.5 -7t35.5 -21.5t25 -17.5q25 -15 53.5 -31t63.5 -35t54 -30q70 -35 76 -53q3 -7 3 -21z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1120 1280h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v832q0 66 -47 113t-113 47zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832 q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1152 1280h-1024v-1242l423 406l89 85l89 -85l423 -406v1242zM1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289 q0 34 19.5 62t52.5 41q21 9 44 9h1048z" /> +<glyph unicode="" d="M1280 343q0 11 -2 16q-3 8 -38.5 29.5t-88.5 49.5l-53 29q-5 3 -19 13t-25 15t-21 5q-18 0 -47 -32.5t-57 -65.5t-44 -33q-7 0 -16.5 3.5t-15.5 6.5t-17 9.5t-14 8.5q-99 55 -170.5 126.5t-126.5 170.5q-2 3 -8.5 14t-9.5 17t-6.5 15.5t-3.5 16.5q0 13 20.5 33.5t45 38.5 t45 39.5t20.5 36.5q0 10 -5 21t-15 25t-13 19q-3 6 -15 28.5t-25 45.5t-26.5 47.5t-25 40.5t-16.5 18t-16 2q-48 0 -101 -22q-46 -21 -80 -94.5t-34 -130.5q0 -16 2.5 -34t5 -30.5t9 -33t10 -29.5t12.5 -33t11 -30q60 -164 216.5 -320.5t320.5 -216.5q6 -2 30 -11t33 -12.5 t29.5 -10t33 -9t30.5 -5t34 -2.5q57 0 130.5 34t94.5 80q22 53 22 101zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1620 1128q-67 -98 -162 -167q1 -14 1 -42q0 -130 -38 -259.5t-115.5 -248.5t-184.5 -210.5t-258 -146t-323 -54.5q-271 0 -496 145q35 -4 78 -4q225 0 401 138q-105 2 -188 64.5t-114 159.5q33 -5 61 -5q43 0 85 11q-112 23 -185.5 111.5t-73.5 205.5v4q68 -38 146 -41 q-66 44 -105 115t-39 154q0 88 44 163q121 -149 294.5 -238.5t371.5 -99.5q-8 38 -8 74q0 134 94.5 228.5t228.5 94.5q140 0 236 -102q109 21 205 78q-37 -115 -142 -178q93 10 186 50z" /> +<glyph unicode="" horiz-adv-x="1024" d="M959 1524v-264h-157q-86 0 -116 -36t-30 -108v-189h293l-39 -296h-254v-759h-306v759h-255v296h255v218q0 186 104 288.5t277 102.5q147 0 228 -12z" /> +<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5q0 -251 -146.5 -451.5t-378.5 -277.5q-27 -5 -40 7t-13 30q0 3 0.5 76.5t0.5 134.5q0 97 -52 142q57 6 102.5 18t94 39t81 66.5t53 105t20.5 150.5q0 119 -79 206q37 91 -8 204q-28 9 -81 -11t-92 -44l-38 -24 q-93 26 -192 26t-192 -26q-16 11 -42.5 27t-83.5 38.5t-85 13.5q-45 -113 -8 -204q-79 -87 -79 -206q0 -85 20.5 -150t52.5 -105t80.5 -67t94 -39t102.5 -18q-39 -36 -49 -103q-21 -10 -45 -15t-57 -5t-65.5 21.5t-55.5 62.5q-19 32 -48.5 52t-49.5 24l-20 3q-21 0 -29 -4.5 t-5 -11.5t9 -14t13 -12l7 -5q22 -10 43.5 -38t31.5 -51l10 -23q13 -38 44 -61.5t67 -30t69.5 -7t55.5 3.5l23 4q0 -38 0.5 -88.5t0.5 -54.5q0 -18 -13 -30t-40 -7q-232 77 -378.5 277.5t-146.5 451.5q0 209 103 385.5t279.5 279.5t385.5 103zM291 305q3 7 -7 12 q-10 3 -13 -2q-3 -7 7 -12q9 -6 13 2zM322 271q7 5 -2 16q-10 9 -16 3q-7 -5 2 -16q10 -10 16 -3zM352 226q9 7 0 19q-8 13 -17 6q-9 -5 0 -18t17 -7zM394 184q8 8 -4 19q-12 12 -20 3q-9 -8 4 -19q12 -12 20 -3zM451 159q3 11 -13 16q-15 4 -19 -7t13 -15q15 -6 19 6z M514 154q0 13 -17 11q-16 0 -16 -11q0 -13 17 -11q16 0 16 11zM572 164q-2 11 -18 9q-16 -3 -14 -15t18 -8t14 14z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1664 960v-256q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45v256q0 106 -75 181t-181 75t-181 -75t-75 -181v-192h96q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h672v192q0 185 131.5 316.5t316.5 131.5 t316.5 -131.5t131.5 -316.5z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1760 1408q66 0 113 -47t47 -113v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600zM160 1280q-13 0 -22.5 -9.5t-9.5 -22.5v-224h1664v224q0 13 -9.5 22.5t-22.5 9.5h-1600zM1760 0q13 0 22.5 9.5t9.5 22.5v608h-1664v-608 q0 -13 9.5 -22.5t22.5 -9.5h1600zM256 128v128h256v-128h-256zM640 128v128h384v-128h-384z" /> +<glyph unicode="" horiz-adv-x="1408" d="M384 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 69q2 -28 -17 -48q-18 -21 -47 -21h-135q-25 0 -43 16.5t-20 41.5q-22 229 -184.5 391.5t-391.5 184.5q-25 2 -41.5 20t-16.5 43v135q0 29 21 47q17 17 43 17h5q160 -13 306 -80.5 t259 -181.5q114 -113 181.5 -259t80.5 -306zM1408 67q2 -27 -18 -47q-18 -20 -46 -20h-143q-26 0 -44.5 17.5t-19.5 42.5q-12 215 -101 408.5t-231.5 336t-336 231.5t-408.5 102q-25 1 -42.5 19.5t-17.5 43.5v143q0 28 20 46q18 18 44 18h3q262 -13 501.5 -120t425.5 -294 q187 -186 294 -425.5t120 -501.5z" /> +<glyph unicode="" d="M1040 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1296 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1408 160v320q0 13 -9.5 22.5t-22.5 9.5 h-1216q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h1216q13 0 22.5 9.5t9.5 22.5zM178 640h1180l-157 482q-4 13 -16 21.5t-26 8.5h-782q-14 0 -26 -8.5t-16 -21.5zM1536 480v-320q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v320q0 25 16 75 l197 606q17 53 63 86t101 33h782q55 0 101 -33t63 -86l197 -606q16 -50 16 -75z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1664 896q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5v-384q0 -52 -38 -90t-90 -38q-417 347 -812 380q-58 -19 -91 -66t-31 -100.5t40 -92.5q-20 -33 -23 -65.5t6 -58t33.5 -55t48 -50t61.5 -50.5q-29 -58 -111.5 -83t-168.5 -11.5t-132 55.5q-7 23 -29.5 87.5 t-32 94.5t-23 89t-15 101t3.5 98.5t22 110.5h-122q-66 0 -113 47t-47 113v192q0 66 47 113t113 47h480q435 0 896 384q52 0 90 -38t38 -90v-384zM1536 292v954q-394 -302 -768 -343v-270q377 -42 768 -341z" /> +<glyph unicode="" horiz-adv-x="1792" d="M912 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM246 128h1300q-266 300 -266 832q0 51 -24 105t-69 103t-121.5 80.5t-169.5 31.5t-169.5 -31.5t-121.5 -80.5t-69 -103t-24 -105q0 -532 -266 -832z M1728 128q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q50 42 91 88t85 119.5t74.5 158.5t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q190 -28 307 -158.5 t117 -282.5q0 -139 19.5 -260t50 -206t74.5 -158.5t85 -119.5t91 -88z" /> +<glyph unicode="" d="M1376 640l138 -135q30 -28 20 -70q-12 -41 -52 -51l-188 -48l53 -186q12 -41 -19 -70q-29 -31 -70 -19l-186 53l-48 -188q-10 -40 -51 -52q-12 -2 -19 -2q-31 0 -51 22l-135 138l-135 -138q-28 -30 -70 -20q-41 11 -51 52l-48 188l-186 -53q-41 -12 -70 19q-31 29 -19 70 l53 186l-188 48q-40 10 -52 51q-10 42 20 70l138 135l-138 135q-30 28 -20 70q12 41 52 51l188 48l-53 186q-12 41 19 70q29 31 70 19l186 -53l48 188q10 41 51 51q41 12 70 -19l135 -139l135 139q29 30 70 19q41 -10 51 -51l48 -188l186 53q41 12 70 -19q31 -29 19 -70 l-53 -186l188 -48q40 -10 52 -51q10 -42 -20 -70z" /> +<glyph unicode="" horiz-adv-x="1792" d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 768q0 51 -39 89.5t-89 38.5h-576q0 20 15 48.5t33 55t33 68t15 84.5q0 67 -44.5 97.5t-115.5 30.5q-24 0 -90 -139q-24 -44 -37 -65q-40 -64 -112 -145q-71 -81 -101 -106 q-69 -57 -140 -57h-32v-640h32q72 0 167 -32t193.5 -64t179.5 -32q189 0 189 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5h331q52 0 90 38t38 90zM1792 769q0 -105 -75.5 -181t-180.5 -76h-169q-4 -62 -37 -119q3 -21 3 -43 q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5q-133 0 -322 69q-164 59 -223 59h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h288q10 0 21.5 4.5t23.5 14t22.5 18t24 22.5t20.5 21.5t19 21.5t14 17q65 74 100 129q13 21 33 62t37 72t40.5 63t55 49.5 t69.5 17.5q125 0 206.5 -67t81.5 -189q0 -68 -22 -128h374q104 0 180 -76t76 -179z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1376 128h32v640h-32q-35 0 -67.5 12t-62.5 37t-50 46t-49 54q-2 3 -3.5 4.5t-4 4.5t-4.5 5q-72 81 -112 145q-14 22 -38 68q-1 3 -10.5 22.5t-18.5 36t-20 35.5t-21.5 30.5t-18.5 11.5q-71 0 -115.5 -30.5t-44.5 -97.5q0 -43 15 -84.5t33 -68t33 -55t15 -48.5h-576 q-50 0 -89 -38.5t-39 -89.5q0 -52 38 -90t90 -38h331q-15 -17 -25 -47.5t-10 -55.5q0 -69 53 -119q-18 -32 -18 -69t17.5 -73.5t47.5 -52.5q-4 -24 -4 -56q0 -85 48.5 -126t135.5 -41q84 0 183 32t194 64t167 32zM1664 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45 t45 -19t45 19t19 45zM1792 768v-640q0 -53 -37.5 -90.5t-90.5 -37.5h-288q-59 0 -223 -59q-190 -69 -317 -69q-142 0 -230 77.5t-87 217.5l1 5q-61 76 -61 178q0 22 3 43q-33 57 -37 119h-169q-105 0 -180.5 76t-75.5 181q0 103 76 179t180 76h374q-22 60 -22 128 q0 122 81.5 189t206.5 67q38 0 69.5 -17.5t55 -49.5t40.5 -63t37 -72t33 -62q35 -55 100 -129q2 -3 14 -17t19 -21.5t20.5 -21.5t24 -22.5t22.5 -18t23.5 -14t21.5 -4.5h288q53 0 90.5 -37.5t37.5 -90.5z" /> +<glyph unicode="" d="M1280 -64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 700q0 189 -167 189q-26 0 -56 -5q-16 30 -52.5 47.5t-73.5 17.5t-69 -18q-50 53 -119 53q-25 0 -55.5 -10t-47.5 -25v331q0 52 -38 90t-90 38q-51 0 -89.5 -39t-38.5 -89v-576 q-20 0 -48.5 15t-55 33t-68 33t-84.5 15q-67 0 -97.5 -44.5t-30.5 -115.5q0 -24 139 -90q44 -24 65 -37q64 -40 145 -112q81 -71 106 -101q57 -69 57 -140v-32h640v32q0 72 32 167t64 193.5t32 179.5zM1536 705q0 -133 -69 -322q-59 -164 -59 -223v-288q0 -53 -37.5 -90.5 t-90.5 -37.5h-640q-53 0 -90.5 37.5t-37.5 90.5v288q0 10 -4.5 21.5t-14 23.5t-18 22.5t-22.5 24t-21.5 20.5t-21.5 19t-17 14q-74 65 -129 100q-21 13 -62 33t-72 37t-63 40.5t-49.5 55t-17.5 69.5q0 125 67 206.5t189 81.5q68 0 128 -22v374q0 104 76 180t179 76 q105 0 181 -75.5t76 -180.5v-169q62 -4 119 -37q21 3 43 3q101 0 178 -60q139 1 219.5 -85t80.5 -227z" /> +<glyph unicode="" d="M1408 576q0 84 -32 183t-64 194t-32 167v32h-640v-32q0 -35 -12 -67.5t-37 -62.5t-46 -50t-54 -49q-9 -8 -14 -12q-81 -72 -145 -112q-22 -14 -68 -38q-3 -1 -22.5 -10.5t-36 -18.5t-35.5 -20t-30.5 -21.5t-11.5 -18.5q0 -71 30.5 -115.5t97.5 -44.5q43 0 84.5 15t68 33 t55 33t48.5 15v-576q0 -50 38.5 -89t89.5 -39q52 0 90 38t38 90v331q46 -35 103 -35q69 0 119 53q32 -18 69 -18t73.5 17.5t52.5 47.5q24 -4 56 -4q85 0 126 48.5t41 135.5zM1280 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 580 q0 -142 -77.5 -230t-217.5 -87l-5 1q-76 -61 -178 -61q-22 0 -43 3q-54 -30 -119 -37v-169q0 -105 -76 -180.5t-181 -75.5q-103 0 -179 76t-76 180v374q-54 -22 -128 -22q-121 0 -188.5 81.5t-67.5 206.5q0 38 17.5 69.5t49.5 55t63 40.5t72 37t62 33q55 35 129 100 q3 2 17 14t21.5 19t21.5 20.5t22.5 24t18 22.5t14 23.5t4.5 21.5v288q0 53 37.5 90.5t90.5 37.5h640q53 0 90.5 -37.5t37.5 -90.5v-288q0 -59 59 -223q69 -190 69 -317z" /> +<glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-502l189 189q19 19 19 45t-19 45l-91 91q-18 18 -45 18t-45 -18l-362 -362l-91 -91q-18 -18 -18 -45t18 -45l91 -91l362 -362q18 -18 45 -18t45 18l91 91q18 18 18 45t-18 45l-189 189h502q26 0 45 19t19 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1285 640q0 27 -18 45l-91 91l-362 362q-18 18 -45 18t-45 -18l-91 -91q-18 -18 -18 -45t18 -45l189 -189h-502q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h502l-189 -189q-19 -19 -19 -45t19 -45l91 -91q18 -18 45 -18t45 18l362 362l91 91q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1284 641q0 27 -18 45l-362 362l-91 91q-18 18 -45 18t-45 -18l-91 -91l-362 -362q-18 -18 -18 -45t18 -45l91 -91q18 -18 45 -18t45 18l189 189v-502q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v502l189 -189q19 -19 45 -19t45 19l91 91q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1284 639q0 27 -18 45l-91 91q-18 18 -45 18t-45 -18l-189 -189v502q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-502l-189 189q-19 19 -45 19t-45 -19l-91 -91q-18 -18 -18 -45t18 -45l362 -362l91 -91q18 -18 45 -18t45 18l91 91l362 362q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1042 887q-2 -1 -9.5 -9.5t-13.5 -9.5q2 0 4.5 5t5 11t3.5 7q6 7 22 15q14 6 52 12q34 8 51 -11 q-2 2 9.5 13t14.5 12q3 2 15 4.5t15 7.5l2 22q-12 -1 -17.5 7t-6.5 21q0 -2 -6 -8q0 7 -4.5 8t-11.5 -1t-9 -1q-10 3 -15 7.5t-8 16.5t-4 15q-2 5 -9.5 10.5t-9.5 10.5q-1 2 -2.5 5.5t-3 6.5t-4 5.5t-5.5 2.5t-7 -5t-7.5 -10t-4.5 -5q-3 2 -6 1.5t-4.5 -1t-4.5 -3t-5 -3.5 q-3 -2 -8.5 -3t-8.5 -2q15 5 -1 11q-10 4 -16 3q9 4 7.5 12t-8.5 14h5q-1 4 -8.5 8.5t-17.5 8.5t-13 6q-8 5 -34 9.5t-33 0.5q-5 -6 -4.5 -10.5t4 -14t3.5 -12.5q1 -6 -5.5 -13t-6.5 -12q0 -7 14 -15.5t10 -21.5q-3 -8 -16 -16t-16 -12q-5 -8 -1.5 -18.5t10.5 -16.5 q2 -2 1.5 -4t-3.5 -4.5t-5.5 -4t-6.5 -3.5l-3 -2q-11 -5 -20.5 6t-13.5 26q-7 25 -16 30q-23 8 -29 -1q-5 13 -41 26q-25 9 -58 4q6 1 0 15q-7 15 -19 12q3 6 4 17.5t1 13.5q3 13 12 23q1 1 7 8.5t9.5 13.5t0.5 6q35 -4 50 11q5 5 11.5 17t10.5 17q9 6 14 5.5t14.5 -5.5 t14.5 -5q14 -1 15.5 11t-7.5 20q12 -1 3 17q-5 7 -8 9q-12 4 -27 -5q-8 -4 2 -8q-1 1 -9.5 -10.5t-16.5 -17.5t-16 5q-1 1 -5.5 13.5t-9.5 13.5q-8 0 -16 -15q3 8 -11 15t-24 8q19 12 -8 27q-7 4 -20.5 5t-19.5 -4q-5 -7 -5.5 -11.5t5 -8t10.5 -5.5t11.5 -4t8.5 -3 q14 -10 8 -14q-2 -1 -8.5 -3.5t-11.5 -4.5t-6 -4q-3 -4 0 -14t-2 -14q-5 5 -9 17.5t-7 16.5q7 -9 -25 -6l-10 1q-4 0 -16 -2t-20.5 -1t-13.5 8q-4 8 0 20q1 4 4 2q-4 3 -11 9.5t-10 8.5q-46 -15 -94 -41q6 -1 12 1q5 2 13 6.5t10 5.5q34 14 42 7l5 5q14 -16 20 -25 q-7 4 -30 1q-20 -6 -22 -12q7 -12 5 -18q-4 3 -11.5 10t-14.5 11t-15 5q-16 0 -22 -1q-146 -80 -235 -222q7 -7 12 -8q4 -1 5 -9t2.5 -11t11.5 3q9 -8 3 -19q1 1 44 -27q19 -17 21 -21q3 -11 -10 -18q-1 2 -9 9t-9 4q-3 -5 0.5 -18.5t10.5 -12.5q-7 0 -9.5 -16t-2.5 -35.5 t-1 -23.5l2 -1q-3 -12 5.5 -34.5t21.5 -19.5q-13 -3 20 -43q6 -8 8 -9q3 -2 12 -7.5t15 -10t10 -10.5q4 -5 10 -22.5t14 -23.5q-2 -6 9.5 -20t10.5 -23q-1 0 -2.5 -1t-2.5 -1q3 -7 15.5 -14t15.5 -13q1 -3 2 -10t3 -11t8 -2q2 20 -24 62q-15 25 -17 29q-3 5 -5.5 15.5 t-4.5 14.5q2 0 6 -1.5t8.5 -3.5t7.5 -4t2 -3q-3 -7 2 -17.5t12 -18.5t17 -19t12 -13q6 -6 14 -19.5t0 -13.5q9 0 20 -10t17 -20q5 -8 8 -26t5 -24q2 -7 8.5 -13.5t12.5 -9.5l16 -8t13 -7q5 -2 18.5 -10.5t21.5 -11.5q10 -4 16 -4t14.5 2.5t13.5 3.5q15 2 29 -15t21 -21 q36 -19 55 -11q-2 -1 0.5 -7.5t8 -15.5t9 -14.5t5.5 -8.5q5 -6 18 -15t18 -15q6 4 7 9q-3 -8 7 -20t18 -10q14 3 14 32q-31 -15 -49 18q0 1 -2.5 5.5t-4 8.5t-2.5 8.5t0 7.5t5 3q9 0 10 3.5t-2 12.5t-4 13q-1 8 -11 20t-12 15q-5 -9 -16 -8t-16 9q0 -1 -1.5 -5.5t-1.5 -6.5 q-13 0 -15 1q1 3 2.5 17.5t3.5 22.5q1 4 5.5 12t7.5 14.5t4 12.5t-4.5 9.5t-17.5 2.5q-19 -1 -26 -20q-1 -3 -3 -10.5t-5 -11.5t-9 -7q-7 -3 -24 -2t-24 5q-13 8 -22.5 29t-9.5 37q0 10 2.5 26.5t3 25t-5.5 24.5q3 2 9 9.5t10 10.5q2 1 4.5 1.5t4.5 0t4 1.5t3 6q-1 1 -4 3 q-3 3 -4 3q7 -3 28.5 1.5t27.5 -1.5q15 -11 22 2q0 1 -2.5 9.5t-0.5 13.5q5 -27 29 -9q3 -3 15.5 -5t17.5 -5q3 -2 7 -5.5t5.5 -4.5t5 0.5t8.5 6.5q10 -14 12 -24q11 -40 19 -44q7 -3 11 -2t4.5 9.5t0 14t-1.5 12.5l-1 8v18l-1 8q-15 3 -18.5 12t1.5 18.5t15 18.5q1 1 8 3.5 t15.5 6.5t12.5 8q21 19 15 35q7 0 11 9q-1 0 -5 3t-7.5 5t-4.5 2q9 5 2 16q5 3 7.5 11t7.5 10q9 -12 21 -2q7 8 1 16q5 7 20.5 10.5t18.5 9.5q7 -2 8 2t1 12t3 12q4 5 15 9t13 5l17 11q3 4 0 4q18 -2 31 11q10 11 -6 20q3 6 -3 9.5t-15 5.5q3 1 11.5 0.5t10.5 1.5 q15 10 -7 16q-17 5 -43 -12zM879 10q206 36 351 189q-3 3 -12.5 4.5t-12.5 3.5q-18 7 -24 8q1 7 -2.5 13t-8 9t-12.5 8t-11 7q-2 2 -7 6t-7 5.5t-7.5 4.5t-8.5 2t-10 -1l-3 -1q-3 -1 -5.5 -2.5t-5.5 -3t-4 -3t0 -2.5q-21 17 -36 22q-5 1 -11 5.5t-10.5 7t-10 1.5t-11.5 -7 q-5 -5 -6 -15t-2 -13q-7 5 0 17.5t2 18.5q-3 6 -10.5 4.5t-12 -4.5t-11.5 -8.5t-9 -6.5t-8.5 -5.5t-8.5 -7.5q-3 -4 -6 -12t-5 -11q-2 4 -11.5 6.5t-9.5 5.5q2 -10 4 -35t5 -38q7 -31 -12 -48q-27 -25 -29 -40q-4 -22 12 -26q0 -7 -8 -20.5t-7 -21.5q0 -6 2 -16z" /> +<glyph unicode="" horiz-adv-x="1664" d="M384 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1028 484l-682 -682q-37 -37 -90 -37q-52 0 -91 37l-106 108q-38 36 -38 90q0 53 38 91l681 681q39 -98 114.5 -173.5t173.5 -114.5zM1662 919q0 -39 -23 -106q-47 -134 -164.5 -217.5 t-258.5 -83.5q-185 0 -316.5 131.5t-131.5 316.5t131.5 316.5t316.5 131.5q58 0 121.5 -16.5t107.5 -46.5q16 -11 16 -28t-16 -28l-293 -169v-224l193 -107q5 3 79 48.5t135.5 81t70.5 35.5q15 0 23.5 -10t8.5 -25z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1024 128h640v128h-640v-128zM640 640h1024v128h-1024v-128zM1280 1152h384v128h-384v-128zM1792 320v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 832v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19 t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1403 1241q17 -41 -14 -70l-493 -493v-742q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-256 256q-19 19 -19 45v486l-493 493q-31 29 -14 70q17 39 59 39h1280q42 0 59 -39z" /> +<glyph unicode="" horiz-adv-x="1792" d="M640 1280h512v128h-512v-128zM1792 640v-480q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v480h672v-160q0 -26 19 -45t45 -19h320q26 0 45 19t19 45v160h672zM1024 640v-128h-256v128h256zM1792 1120v-384h-1792v384q0 66 47 113t113 47h352v160q0 40 28 68 t68 28h576q40 0 68 -28t28 -68v-160h352q66 0 113 -47t47 -113z" /> +<glyph unicode="" d="M1283 995l-355 -355l355 -355l144 144q29 31 70 14q39 -17 39 -59v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l144 144l-355 355l-355 -355l144 -144q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l144 -144 l355 355l-355 355l-144 -144q-19 -19 -45 -19q-12 0 -24 5q-40 17 -40 59v448q0 26 19 45t45 19h448q42 0 59 -40q17 -39 -14 -69l-144 -144l355 -355l355 355l-144 144q-31 30 -14 69q17 40 59 40h448q26 0 45 -19t19 -45v-448q0 -42 -39 -59q-13 -5 -25 -5q-26 0 -45 19z " /> +<glyph unicode="" horiz-adv-x="1920" d="M593 640q-162 -5 -265 -128h-134q-82 0 -138 40.5t-56 118.5q0 353 124 353q6 0 43.5 -21t97.5 -42.5t119 -21.5q67 0 133 23q-5 -37 -5 -66q0 -139 81 -256zM1664 3q0 -120 -73 -189.5t-194 -69.5h-874q-121 0 -194 69.5t-73 189.5q0 53 3.5 103.5t14 109t26.5 108.5 t43 97.5t62 81t85.5 53.5t111.5 20q10 0 43 -21.5t73 -48t107 -48t135 -21.5t135 21.5t107 48t73 48t43 21.5q61 0 111.5 -20t85.5 -53.5t62 -81t43 -97.5t26.5 -108.5t14 -109t3.5 -103.5zM640 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75 t75 -181zM1344 896q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5zM1920 671q0 -78 -56 -118.5t-138 -40.5h-134q-103 123 -265 128q81 117 81 256q0 29 -5 66q66 -23 133 -23q59 0 119 21.5t97.5 42.5 t43.5 21q124 0 124 -353zM1792 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1456 320q0 40 -28 68l-208 208q-28 28 -68 28q-42 0 -72 -32q3 -3 19 -18.5t21.5 -21.5t15 -19t13 -25.5t3.5 -27.5q0 -40 -28 -68t-68 -28q-15 0 -27.5 3.5t-25.5 13t-19 15t-21.5 21.5t-18.5 19q-33 -31 -33 -73q0 -40 28 -68l206 -207q27 -27 68 -27q40 0 68 26 l147 146q28 28 28 67zM753 1025q0 40 -28 68l-206 207q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l208 -208q27 -27 68 -27q42 0 72 31q-3 3 -19 18.5t-21.5 21.5t-15 19t-13 25.5t-3.5 27.5q0 40 28 68t68 28q15 0 27.5 -3.5t25.5 -13t19 -15 t21.5 -21.5t18.5 -19q33 31 33 73zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-206 207q-83 83 -83 203q0 123 88 209l-88 88q-86 -88 -208 -88q-120 0 -204 84l-208 208q-84 84 -84 204t85 203l147 146q83 83 203 83q121 0 204 -85l206 -207 q83 -83 83 -203q0 -123 -88 -209l88 -88q86 88 208 88q120 0 204 -84l208 -208q84 -84 84 -204z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088q-185 0 -316.5 131.5t-131.5 316.5q0 132 71 241.5t187 163.5q-2 28 -2 43q0 212 150 362t362 150q158 0 286.5 -88t187.5 -230q70 62 166 62q106 0 181 -75t75 -181q0 -75 -41 -138q129 -30 213 -134.5t84 -239.5z " /> +<glyph unicode="" horiz-adv-x="1664" d="M1527 88q56 -89 21.5 -152.5t-140.5 -63.5h-1152q-106 0 -140.5 63.5t21.5 152.5l503 793v399h-64q-26 0 -45 19t-19 45t19 45t45 19h512q26 0 45 -19t19 -45t-19 -45t-45 -19h-64v-399zM748 813l-272 -429h712l-272 429l-20 31v37v399h-128v-399v-37z" /> +<glyph unicode="" horiz-adv-x="1792" d="M960 640q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1260 576l507 -398q28 -20 25 -56q-5 -35 -35 -51l-128 -64q-13 -7 -29 -7q-17 0 -31 8l-690 387l-110 -66q-8 -4 -12 -5q14 -49 10 -97q-7 -77 -56 -147.5t-132 -123.5q-132 -84 -277 -84 q-136 0 -222 78q-90 84 -79 207q7 76 56 147t131 124q132 84 278 84q83 0 151 -31q9 13 22 22l122 73l-122 73q-13 9 -22 22q-68 -31 -151 -31q-146 0 -278 84q-82 53 -131 124t-56 147q-5 59 15.5 113t63.5 93q85 79 222 79q145 0 277 -84q83 -52 132 -123t56 -148 q4 -48 -10 -97q4 -1 12 -5l110 -66l690 387q14 8 31 8q16 0 29 -7l128 -64q30 -16 35 -51q3 -36 -25 -56zM579 836q46 42 21 108t-106 117q-92 59 -192 59q-74 0 -113 -36q-46 -42 -21 -108t106 -117q92 -59 192 -59q74 0 113 36zM494 91q81 51 106 117t-21 108 q-39 36 -113 36q-100 0 -192 -59q-81 -51 -106 -117t21 -108q39 -36 113 -36q100 0 192 59zM672 704l96 -58v11q0 36 33 56l14 8l-79 47l-26 -26q-3 -3 -10 -11t-12 -12q-2 -2 -4 -3.5t-3 -2.5zM896 480l96 -32l736 576l-128 64l-768 -431v-113l-160 -96l9 -8q2 -2 7 -6 q4 -4 11 -12t11 -12l26 -26zM1600 64l128 64l-520 408l-177 -138q-2 -3 -13 -7z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1696 1152q40 0 68 -28t28 -68v-1216q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v288h-544q-40 0 -68 28t-28 68v672q0 40 20 88t48 76l408 408q28 28 76 48t88 20h416q40 0 68 -28t28 -68v-328q68 40 128 40h416zM1152 939l-299 -299h299v299zM512 1323l-299 -299 h299v299zM708 676l316 316v416h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h512v256q0 40 20 88t48 76zM1664 -128v1152h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h896z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1404 151q0 -117 -79 -196t-196 -79q-135 0 -235 100l-777 776q-113 115 -113 271q0 159 110 270t269 111q158 0 273 -113l605 -606q10 -10 10 -22q0 -16 -30.5 -46.5t-46.5 -30.5q-13 0 -23 10l-606 607q-79 77 -181 77q-106 0 -179 -75t-73 -181q0 -105 76 -181 l776 -777q63 -63 145 -63q64 0 106 42t42 106q0 82 -63 145l-581 581q-26 24 -60 24q-29 0 -48 -19t-19 -48q0 -32 25 -59l410 -410q10 -10 10 -22q0 -16 -31 -47t-47 -31q-12 0 -22 10l-410 410q-63 61 -63 149q0 82 57 139t139 57q88 0 149 -63l581 -581q100 -98 100 -235 z" /> +<glyph unicode="" d="M384 0h768v384h-768v-384zM1280 0h128v896q0 14 -10 38.5t-20 34.5l-281 281q-10 10 -34 20t-39 10v-416q0 -40 -28 -68t-68 -28h-576q-40 0 -68 28t-28 68v416h-128v-1280h128v416q0 40 28 68t68 28h832q40 0 68 -28t28 -68v-416zM896 928v320q0 13 -9.5 22.5t-22.5 9.5 h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5zM1536 896v-928q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h928q40 0 88 -20t76 -48l280 -280q28 -28 48 -76t20 -88z" /> +<glyph unicode="" d="M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" d="M1536 192v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 704v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 1216v-128q0 -26 -19 -45 t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1792" d="M384 128q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 640q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5 t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1152q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z M1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M381 -84q0 -80 -54.5 -126t-135.5 -46q-106 0 -172 66l57 88q49 -45 106 -45q29 0 50.5 14.5t21.5 42.5q0 64 -105 56l-26 56q8 10 32.5 43.5t42.5 54t37 38.5v1q-16 0 -48.5 -1t-48.5 -1v-53h-106v152h333v-88l-95 -115q51 -12 81 -49t30 -88zM383 543v-159h-362 q-6 36 -6 54q0 51 23.5 93t56.5 68t66 47.5t56.5 43.5t23.5 45q0 25 -14.5 38.5t-39.5 13.5q-46 0 -81 -58l-85 59q24 51 71.5 79.5t105.5 28.5q73 0 123 -41.5t50 -112.5q0 -50 -34 -91.5t-75 -64.5t-75.5 -50.5t-35.5 -52.5h127v60h105zM1792 224v-192q0 -13 -9.5 -22.5 t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1123v-99h-335v99h107q0 41 0.5 122t0.5 121v12h-2q-8 -17 -50 -54l-71 76l136 127h106v-404h108zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5 t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1760 640q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1728q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h1728zM483 704q-28 35 -51 80q-48 97 -48 188q0 181 134 309q133 127 393 127q50 0 167 -19q66 -12 177 -48q10 -38 21 -118q14 -123 14 -183q0 -18 -5 -45l-12 -3l-84 6 l-14 2q-50 149 -103 205q-88 91 -210 91q-114 0 -182 -59q-67 -58 -67 -146q0 -73 66 -140t279 -129q69 -20 173 -66q58 -28 95 -52h-743zM990 448h411q7 -39 7 -92q0 -111 -41 -212q-23 -55 -71 -104q-37 -35 -109 -81q-80 -48 -153 -66q-80 -21 -203 -21q-114 0 -195 23 l-140 40q-57 16 -72 28q-8 8 -8 22v13q0 108 -2 156q-1 30 0 68l2 37v44l102 2q15 -34 30 -71t22.5 -56t12.5 -27q35 -57 80 -94q43 -36 105 -57q59 -22 132 -22q64 0 139 27q77 26 122 86q47 61 47 129q0 84 -81 157q-34 29 -137 71z" /> +<glyph unicode="" d="M48 1313q-37 2 -45 4l-3 88q13 1 40 1q60 0 112 -4q132 -7 166 -7q86 0 168 3q116 4 146 5q56 0 86 2l-1 -14l2 -64v-9q-60 -9 -124 -9q-60 0 -79 -25q-13 -14 -13 -132q0 -13 0.5 -32.5t0.5 -25.5l1 -229l14 -280q6 -124 51 -202q35 -59 96 -92q88 -47 177 -47 q104 0 191 28q56 18 99 51q48 36 65 64q36 56 53 114q21 73 21 229q0 79 -3.5 128t-11 122.5t-13.5 159.5l-4 59q-5 67 -24 88q-34 35 -77 34l-100 -2l-14 3l2 86h84l205 -10q76 -3 196 10l18 -2q6 -38 6 -51q0 -7 -4 -31q-45 -12 -84 -13q-73 -11 -79 -17q-15 -15 -15 -41 q0 -7 1.5 -27t1.5 -31q8 -19 22 -396q6 -195 -15 -304q-15 -76 -41 -122q-38 -65 -112 -123q-75 -57 -182 -89q-109 -33 -255 -33q-167 0 -284 46q-119 47 -179 122q-61 76 -83 195q-16 80 -16 237v333q0 188 -17 213q-25 36 -147 39zM1536 -96v64q0 14 -9 23t-23 9h-1472 q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h1472q14 0 23 9t9 23z" /> +<glyph unicode="" horiz-adv-x="1664" d="M512 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23 v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 160v192 q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192 q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1664 1248v-1088q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1344q66 0 113 -47t47 -113 z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1190 955l293 293l-107 107l-293 -293zM1637 1248q0 -27 -18 -45l-1286 -1286q-18 -18 -45 -18t-45 18l-198 198q-18 18 -18 45t18 45l1286 1286q18 18 45 18t45 -18l198 -198q18 -18 18 -45zM286 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM636 1276 l196 -60l-196 -60l-60 -196l-60 196l-196 60l196 60l60 196zM1566 798l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM926 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98z" /> +<glyph unicode="" horiz-adv-x="1792" d="M640 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM256 640h384v256h-158q-13 0 -22 -9l-195 -195q-9 -9 -9 -22v-30zM1536 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM1792 1216v-1024q0 -15 -4 -26.5t-13.5 -18.5 t-16.5 -11.5t-23.5 -6t-22.5 -2t-25.5 0t-22.5 0.5q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-64q-3 0 -22.5 -0.5t-25.5 0t-22.5 2t-23.5 6t-16.5 11.5t-13.5 18.5t-4 26.5q0 26 19 45t45 19v320q0 8 -0.5 35t0 38 t2.5 34.5t6.5 37t14 30.5t22.5 30l198 198q19 19 50.5 32t58.5 13h160v192q0 26 19 45t45 19h1024q26 0 45 -19t19 -45z" /> +<glyph unicode="" d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103q-111 0 -218 32q59 93 78 164q9 34 54 211q20 -39 73 -67.5t114 -28.5q121 0 216 68.5t147 188.5t52 270q0 114 -59.5 214t-172.5 163t-255 63q-105 0 -196 -29t-154.5 -77t-109 -110.5t-67 -129.5t-21.5 -134 q0 -104 40 -183t117 -111q30 -12 38 20q2 7 8 31t8 30q6 23 -11 43q-51 61 -51 151q0 151 104.5 259.5t273.5 108.5q151 0 235.5 -82t84.5 -213q0 -170 -68.5 -289t-175.5 -119q-61 0 -98 43.5t-23 104.5q8 35 26.5 93.5t30 103t11.5 75.5q0 50 -27 83t-77 33 q-62 0 -105 -57t-43 -142q0 -73 25 -122l-99 -418q-17 -70 -13 -177q-206 91 -333 281t-127 423q0 209 103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-725q85 122 108 210q9 34 53 209q21 -39 73.5 -67t112.5 -28q181 0 295.5 147.5t114.5 373.5q0 84 -35 162.5t-96.5 139t-152.5 97t-197 36.5q-104 0 -194.5 -28.5t-153 -76.5 t-107.5 -109.5t-66.5 -128t-21.5 -132.5q0 -102 39.5 -180t116.5 -110q13 -5 23.5 0t14.5 19q10 44 15 61q6 23 -11 42q-50 62 -50 150q0 150 103.5 256.5t270.5 106.5q149 0 232.5 -81t83.5 -210q0 -168 -67.5 -286t-173.5 -118q-60 0 -97 43.5t-23 103.5q8 34 26.5 92.5 t29.5 102t11 74.5q0 49 -26.5 81.5t-75.5 32.5q-61 0 -103.5 -56.5t-42.5 -139.5q0 -72 24 -121l-98 -414q-24 -100 -7 -254h-183q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960z" /> +<glyph unicode="" d="M917 631q0 26 -6 64h-362v-132h217q-3 -24 -16.5 -50t-37.5 -53t-66.5 -44.5t-96.5 -17.5q-99 0 -169 71t-70 171t70 171t169 71q92 0 153 -59l104 101q-108 100 -257 100q-160 0 -272 -112.5t-112 -271.5t112 -271.5t272 -112.5q165 0 266.5 105t101.5 270zM1262 585 h109v110h-109v110h-110v-110h-110v-110h110v-110h110v110zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="2304" d="M1437 623q0 -208 -87 -370.5t-248 -254t-369 -91.5q-149 0 -285 58t-234 156t-156 234t-58 285t58 285t156 234t234 156t285 58q286 0 491 -192l-199 -191q-117 113 -292 113q-123 0 -227.5 -62t-165.5 -168.5t-61 -232.5t61 -232.5t165.5 -168.5t227.5 -62 q83 0 152.5 23t114.5 57.5t78.5 78.5t49 83t21.5 74h-416v252h692q12 -63 12 -122zM2304 745v-210h-209v-209h-210v209h-209v210h209v209h210v-209h209z" /> +<glyph unicode="" horiz-adv-x="1920" d="M768 384h384v96h-128v448h-114l-148 -137l77 -80q42 37 55 57h2v-288h-128v-96zM1280 640q0 -70 -21 -142t-59.5 -134t-101.5 -101t-138 -39t-138 39t-101.5 101t-59.5 134t-21 142t21 142t59.5 134t101.5 101t138 39t138 -39t101.5 -101t59.5 -134t21 -142zM1792 384 v512q-106 0 -181 75t-75 181h-1152q0 -106 -75 -181t-181 -75v-512q106 0 181 -75t75 -181h1152q0 106 75 181t181 75zM1920 1216v-1152q0 -26 -19 -45t-45 -19h-1792q-26 0 -45 19t-19 45v1152q0 26 19 45t45 19h1792q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1024" d="M1024 832q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1024" d="M1024 320q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" /> +<glyph unicode="" horiz-adv-x="640" d="M640 1088v-896q0 -26 -19 -45t-45 -19t-45 19l-448 448q-19 19 -19 45t19 45l448 448q19 19 45 19t45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="640" d="M576 640q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19t-19 45v896q0 26 19 45t45 19t45 -19l448 -448q19 -19 19 -45z" /> +<glyph unicode="" horiz-adv-x="1664" d="M160 0h608v1152h-640v-1120q0 -13 9.5 -22.5t22.5 -9.5zM1536 32v1120h-640v-1152h608q13 0 22.5 9.5t9.5 22.5zM1664 1248v-1216q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1344q66 0 113 -47t47 -113z" /> +<glyph unicode="" horiz-adv-x="1024" d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45zM1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" /> +<glyph unicode="" horiz-adv-x="1024" d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1024" d="M1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 826v-794q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v794q44 -49 101 -87q362 -246 497 -345q57 -42 92.5 -65.5t94.5 -48t110 -24.5h1h1q51 0 110 24.5t94.5 48t92.5 65.5q170 123 498 345q57 39 100 87zM1792 1120q0 -79 -49 -151t-122 -123 q-376 -261 -468 -325q-10 -7 -42.5 -30.5t-54 -38t-52 -32.5t-57.5 -27t-50 -9h-1h-1q-23 0 -50 9t-57.5 27t-52 32.5t-54 38t-42.5 30.5q-91 64 -262 182.5t-205 142.5q-62 42 -117 115.5t-55 136.5q0 78 41.5 130t118.5 52h1472q65 0 112.5 -47t47.5 -113z" /> +<glyph unicode="" d="M349 911v-991h-330v991h330zM370 1217q1 -73 -50.5 -122t-135.5 -49h-2q-82 0 -132 49t-50 122q0 74 51.5 122.5t134.5 48.5t133 -48.5t51 -122.5zM1536 488v-568h-329v530q0 105 -40.5 164.5t-126.5 59.5q-63 0 -105.5 -34.5t-63.5 -85.5q-11 -30 -11 -81v-553h-329 q2 399 2 647t-1 296l-1 48h329v-144h-2q20 32 41 56t56.5 52t87 43.5t114.5 15.5q171 0 275 -113.5t104 -332.5z" /> +<glyph unicode="" d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61q-172 0 -327 72.5t-264 204.5q-7 10 -6.5 22.5t8.5 20.5l137 138q10 9 25 9q16 -2 23 -12q73 -95 179 -147t225 -52q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5 t-163.5 109.5t-198.5 40.5q-98 0 -188 -35.5t-160 -101.5l137 -138q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l130 -129q107 101 244.5 156.5t284.5 55.5q156 0 298 -61t245 -164t164 -245t61 -298z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1771 0q0 -53 -37 -90l-107 -108q-39 -37 -91 -37q-53 0 -90 37l-363 364q-38 36 -38 90q0 53 43 96l-256 256l-126 -126q-14 -14 -34 -14t-34 14q2 -2 12.5 -12t12.5 -13t10 -11.5t10 -13.5t6 -13.5t5.5 -16.5t1.5 -18q0 -38 -28 -68q-3 -3 -16.5 -18t-19 -20.5 t-18.5 -16.5t-22 -15.5t-22 -9t-26 -4.5q-40 0 -68 28l-408 408q-28 28 -28 68q0 13 4.5 26t9 22t15.5 22t16.5 18.5t20.5 19t18 16.5q30 28 68 28q10 0 18 -1.5t16.5 -5.5t13.5 -6t13.5 -10t11.5 -10t13 -12.5t12 -12.5q-14 14 -14 34t14 34l348 348q14 14 34 14t34 -14 q-2 2 -12.5 12t-12.5 13t-10 11.5t-10 13.5t-6 13.5t-5.5 16.5t-1.5 18q0 38 28 68q3 3 16.5 18t19 20.5t18.5 16.5t22 15.5t22 9t26 4.5q40 0 68 -28l408 -408q28 -28 28 -68q0 -13 -4.5 -26t-9 -22t-15.5 -22t-16.5 -18.5t-20.5 -19t-18 -16.5q-30 -28 -68 -28 q-10 0 -18 1.5t-16.5 5.5t-13.5 6t-13.5 10t-11.5 10t-13 12.5t-12 12.5q14 -14 14 -34t-14 -34l-126 -126l256 -256q43 43 96 43q52 0 91 -37l363 -363q37 -39 37 -91z" /> +<glyph unicode="" horiz-adv-x="1792" d="M384 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM576 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1004 351l101 382q6 26 -7.5 48.5t-38.5 29.5 t-48 -6.5t-30 -39.5l-101 -382q-60 -5 -107 -43.5t-63 -98.5q-20 -77 20 -146t117 -89t146 20t89 117q16 60 -6 117t-72 91zM1664 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 1024q0 53 -37.5 90.5 t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1472 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1792 384q0 -261 -141 -483q-19 -29 -54 -29h-1402q-35 0 -54 29 q-141 221 -141 483q0 182 71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> +<glyph unicode="" horiz-adv-x="1792" d="M896 1152q-204 0 -381.5 -69.5t-282 -187.5t-104.5 -255q0 -112 71.5 -213.5t201.5 -175.5l87 -50l-27 -96q-24 -91 -70 -172q152 63 275 171l43 38l57 -6q69 -8 130 -8q204 0 381.5 69.5t282 187.5t104.5 255t-104.5 255t-282 187.5t-381.5 69.5zM1792 640 q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22h-5q-15 0 -27 10.5t-16 27.5v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281q0 174 120 321.5 t326 233t450 85.5t450 -85.5t326 -233t120 -321.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M704 1152q-153 0 -286 -52t-211.5 -141t-78.5 -191q0 -82 53 -158t149 -132l97 -56l-35 -84q34 20 62 39l44 31l53 -10q78 -14 153 -14q153 0 286 52t211.5 141t78.5 191t-78.5 191t-211.5 141t-286 52zM704 1280q191 0 353.5 -68.5t256.5 -186.5t94 -257t-94 -257 t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224q0 139 94 257t256.5 186.5 t353.5 68.5zM1526 111q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129 q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230q0 -120 -71 -224.5t-195 -176.5z" /> +<glyph unicode="" horiz-adv-x="896" d="M885 970q18 -20 7 -44l-540 -1157q-13 -25 -42 -25q-4 0 -14 2q-17 5 -25.5 19t-4.5 30l197 808l-406 -101q-4 -1 -12 -1q-18 0 -31 11q-18 15 -13 39l201 825q4 14 16 23t28 9h328q19 0 32 -12.5t13 -29.5q0 -8 -5 -18l-171 -463l396 98q8 2 12 2q19 0 34 -15z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 288v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320 q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192q0 52 38 90t90 38h512v192h-96q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h320q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-96v-192h512q52 0 90 -38t38 -90v-192h96q40 0 68 -28t28 -68 z" /> +<glyph unicode="" horiz-adv-x="1664" d="M896 708v-580q0 -104 -76 -180t-180 -76t-180 76t-76 180q0 26 19 45t45 19t45 -19t19 -45q0 -50 39 -89t89 -39t89 39t39 89v580q33 11 64 11t64 -11zM1664 681q0 -13 -9.5 -22.5t-22.5 -9.5q-11 0 -23 10q-49 46 -93 69t-102 23q-68 0 -128 -37t-103 -97 q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -28 -17q-18 0 -29 17q-4 6 -14.5 24t-17.5 28q-43 60 -102.5 97t-127.5 37t-127.5 -37t-102.5 -97q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -29 -17q-17 0 -28 17q-4 6 -14.5 24t-17.5 28q-43 60 -103 97t-128 37q-58 0 -102 -23t-93 -69 q-12 -10 -23 -10q-13 0 -22.5 9.5t-9.5 22.5q0 5 1 7q45 183 172.5 319.5t298 204.5t360.5 68q140 0 274.5 -40t246.5 -113.5t194.5 -187t115.5 -251.5q1 -2 1 -7zM896 1408v-98q-42 2 -64 2t-64 -2v98q0 26 19 45t45 19t45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1792" d="M768 -128h896v640h-416q-40 0 -68 28t-28 68v416h-384v-1152zM1024 1312v64q0 13 -9.5 22.5t-22.5 9.5h-704q-13 0 -22.5 -9.5t-9.5 -22.5v-64q0 -13 9.5 -22.5t22.5 -9.5h704q13 0 22.5 9.5t9.5 22.5zM1280 640h299l-299 299v-299zM1792 512v-672q0 -40 -28 -68t-68 -28 h-960q-40 0 -68 28t-28 68v160h-544q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1088q40 0 68 -28t28 -68v-328q21 -13 36 -28l408 -408q28 -28 48 -76t20 -88z" /> +<glyph unicode="" horiz-adv-x="1024" d="M736 960q0 -13 -9.5 -22.5t-22.5 -9.5t-22.5 9.5t-9.5 22.5q0 46 -54 71t-106 25q-13 0 -22.5 9.5t-9.5 22.5t9.5 22.5t22.5 9.5q50 0 99.5 -16t87 -54t37.5 -90zM896 960q0 72 -34.5 134t-90 101.5t-123 62t-136.5 22.5t-136.5 -22.5t-123 -62t-90 -101.5t-34.5 -134 q0 -101 68 -180q10 -11 30.5 -33t30.5 -33q128 -153 141 -298h228q13 145 141 298q10 11 30.5 33t30.5 33q68 79 68 180zM1024 960q0 -155 -103 -268q-45 -49 -74.5 -87t-59.5 -95.5t-34 -107.5q47 -28 47 -82q0 -37 -25 -64q25 -27 25 -64q0 -52 -45 -81q13 -23 13 -47 q0 -46 -31.5 -71t-77.5 -25q-20 -44 -60 -70t-87 -26t-87 26t-60 70q-46 0 -77.5 25t-31.5 71q0 24 13 47q-45 29 -45 81q0 37 25 64q-25 27 -25 64q0 54 47 82q-4 50 -34 107.5t-59.5 95.5t-74.5 87q-103 113 -103 268q0 99 44.5 184.5t117 142t164 89t186.5 32.5 t186.5 -32.5t164 -89t117 -142t44.5 -184.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 352v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5q-12 0 -24 10l-319 320q-9 9 -9 22q0 14 9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h1376q13 0 22.5 -9.5t9.5 -22.5zM1792 896q0 -14 -9 -23l-320 -320q-9 -9 -23 -9 q-13 0 -22.5 9.5t-9.5 22.5v192h-1376q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1376v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1280 608q0 14 -9 23t-23 9h-224v352q0 13 -9.5 22.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-352h-224q-13 0 -22.5 -9.5t-9.5 -22.5q0 -14 9 -23l352 -352q9 -9 23 -9t23 9l351 351q10 12 10 24zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088 q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1280 672q0 14 -9 23l-352 352q-9 9 -23 9t-23 -9l-351 -351q-10 -12 -10 -24q0 -14 9 -23t23 -9h224v-352q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5v352h224q13 0 22.5 9.5t9.5 22.5zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088 q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M384 192q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM1408 131q0 -121 -73 -190t-194 -69h-874q-121 0 -194 69t-73 190q0 68 5.5 131t24 138t47.5 132.5t81 103t120 60.5q-22 -52 -22 -120v-203q-58 -20 -93 -70t-35 -111q0 -80 56 -136t136 -56 t136 56t56 136q0 61 -35.5 111t-92.5 70v203q0 62 25 93q132 -104 295 -104t295 104q25 -31 25 -93v-64q-106 0 -181 -75t-75 -181v-89q-32 -29 -32 -71q0 -40 28 -68t68 -28t68 28t28 68q0 42 -32 71v89q0 52 38 90t90 38t90 -38t38 -90v-89q-32 -29 -32 -71q0 -40 28 -68 t68 -28t68 28t28 68q0 42 -32 71v89q0 68 -34.5 127.5t-93.5 93.5q0 10 0.5 42.5t0 48t-2.5 41.5t-7 47t-13 40q68 -15 120 -60.5t81 -103t47.5 -132.5t24 -138t5.5 -131zM1088 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5 t271.5 -112.5t112.5 -271.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1280 832q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 832q0 -62 -35.5 -111t-92.5 -70v-395q0 -159 -131.5 -271.5t-316.5 -112.5t-316.5 112.5t-131.5 271.5v132q-164 20 -274 128t-110 252v512q0 26 19 45t45 19q6 0 16 -2q17 30 47 48 t65 18q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5q-33 0 -64 18v-402q0 -106 94 -181t226 -75t226 75t94 181v402q-31 -18 -64 -18q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5q35 0 65 -18t47 -48q10 2 16 2q26 0 45 -19t19 -45v-512q0 -144 -110 -252 t-274 -128v-132q0 -106 94 -181t226 -75t226 75t94 181v395q-57 21 -92.5 70t-35.5 111q0 80 56 136t136 56t136 -56t56 -136z" /> +<glyph unicode="" horiz-adv-x="1792" d="M640 1152h512v128h-512v-128zM288 1152v-1280h-64q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h64zM1408 1152v-1280h-1024v1280h128v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h128zM1792 928v-832q0 -92 -66 -158t-158 -66h-64v1280h64q92 0 158 -66 t66 -158z" /> +<glyph unicode="" horiz-adv-x="1792" d="M912 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM1728 128q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q50 42 91 88t85 119.5t74.5 158.5 t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q190 -28 307 -158.5t117 -282.5q0 -139 19.5 -260t50 -206t74.5 -158.5t85 -119.5t91 -88z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1664 896q0 80 -56 136t-136 56h-64v-384h64q80 0 136 56t56 136zM0 128h1792q0 -106 -75 -181t-181 -75h-1280q-106 0 -181 75t-75 181zM1856 896q0 -159 -112.5 -271.5t-271.5 -112.5h-64v-32q0 -92 -66 -158t-158 -66h-704q-92 0 -158 66t-66 158v736q0 26 19 45 t45 19h1152q159 0 271.5 -112.5t112.5 -271.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M640 1472v-640q0 -61 -35.5 -111t-92.5 -70v-779q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v779q-57 20 -92.5 70t-35.5 111v640q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45 t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45zM1408 1472v-1600q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v512h-224q-13 0 -22.5 9.5t-9.5 22.5v800q0 132 94 226t226 94h256q26 0 45 -19t19 -45z" /> +<glyph unicode="" d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z M384 736q0 14 9 23t23 9h704q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64zM1120 512q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704zM1120 256q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704 q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704z" /> +<glyph unicode="" horiz-adv-x="1408" d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 -128h384v1536h-1152v-1536h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM1408 1472v-1664q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h1280q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1408" d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 -128h384v1152h-256v-32q0 -40 -28 -68t-68 -28h-448q-40 0 -68 28t-28 68v32h-256v-1152h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM896 1056v320q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-96h-128v96q0 13 -9.5 22.5 t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5v96h128v-96q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1408 1088v-1280q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1280q0 26 19 45t45 19h320 v288q0 40 28 68t68 28h448q40 0 68 -28t28 -68v-288h320q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1920" d="M640 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM256 640h384v256h-158q-14 -2 -22 -9l-195 -195q-7 -12 -9 -22v-30zM1536 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5 t90.5 37.5t37.5 90.5zM1664 800v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM1920 1344v-1152 q0 -26 -19 -45t-45 -19h-192q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-128q-26 0 -45 19t-19 45t19 45t45 19v416q0 26 13 58t32 51l198 198q19 19 51 32t58 13h160v320q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1280 416v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM640 1152h512v128h-512v-128zM256 1152v-1280h-32 q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h32zM1440 1152v-1280h-1088v1280h160v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h160zM1792 928v-832q0 -92 -66 -158t-158 -66h-32v1280h32q92 0 158 -66t66 -158z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1920 576q-1 -32 -288 -96l-352 -32l-224 -64h-64l-293 -352h69q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-96h-160h-64v32h64v416h-160l-192 -224h-96l-32 32v192h32v32h128v8l-192 24v128l192 24v8h-128v32h-32v192l32 32h96l192 -224h160v416h-64v32h64h160h96 q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-69l293 -352h64l224 -64l352 -32q261 -58 287 -93z" /> +<glyph unicode="" horiz-adv-x="1664" d="M640 640v384h-256v-256q0 -53 37.5 -90.5t90.5 -37.5h128zM1664 192v-192h-1152v192l128 192h-128q-159 0 -271.5 112.5t-112.5 271.5v320l-64 64l32 128h480l32 128h960l32 -192l-64 -32v-800z" /> +<glyph unicode="" d="M1280 192v896q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-512v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-896q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h512v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-320v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-320q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h320v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h320q26 0 45 19t19 45zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1024" d="M627 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23zM1011 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23 t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23z" /> +<glyph unicode="" horiz-adv-x="1024" d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM979 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23 l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" /> +<glyph unicode="" horiz-adv-x="1152" d="M1075 224q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM1075 608q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393 q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" /> +<glyph unicode="" horiz-adv-x="1152" d="M1075 672q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23zM1075 1056q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23 t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" /> +<glyph unicode="" horiz-adv-x="640" d="M627 992q0 -13 -10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" /> +<glyph unicode="" horiz-adv-x="640" d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" /> +<glyph unicode="" horiz-adv-x="1152" d="M1075 352q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" /> +<glyph unicode="" horiz-adv-x="1152" d="M1075 800q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1792 544v832q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5zM1920 1376v-1088q0 -66 -47 -113t-113 -47h-544q0 -37 16 -77.5t32 -71t16 -43.5q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19 t-19 45q0 14 16 44t32 70t16 78h-544q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" /> +<glyph unicode="" horiz-adv-x="1920" d="M416 256q-66 0 -113 47t-47 113v704q0 66 47 113t113 47h1088q66 0 113 -47t47 -113v-704q0 -66 -47 -113t-113 -47h-1088zM384 1120v-704q0 -13 9.5 -22.5t22.5 -9.5h1088q13 0 22.5 9.5t9.5 22.5v704q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5z M1760 192h160v-96q0 -40 -47 -68t-113 -28h-1600q-66 0 -113 28t-47 68v96h160h1600zM1040 96q16 0 16 16t-16 16h-160q-16 0 -16 -16t16 -16h160z" /> +<glyph unicode="" horiz-adv-x="1152" d="M640 128q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1024 288v960q0 13 -9.5 22.5t-22.5 9.5h-832q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h832q13 0 22.5 9.5t9.5 22.5zM1152 1248v-1088q0 -66 -47 -113t-113 -47h-832 q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h832q66 0 113 -47t47 -113z" /> +<glyph unicode="" horiz-adv-x="768" d="M464 128q0 33 -23.5 56.5t-56.5 23.5t-56.5 -23.5t-23.5 -56.5t23.5 -56.5t56.5 -23.5t56.5 23.5t23.5 56.5zM672 288v704q0 13 -9.5 22.5t-22.5 9.5h-512q-13 0 -22.5 -9.5t-9.5 -22.5v-704q0 -13 9.5 -22.5t22.5 -9.5h512q13 0 22.5 9.5t9.5 22.5zM480 1136 q0 16 -16 16h-160q-16 0 -16 -16t16 -16h160q16 0 16 16zM768 1152v-1024q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v1024q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" /> +<glyph unicode="" d="M768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103 t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1664" d="M768 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z M1664 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z" /> +<glyph unicode="" horiz-adv-x="1664" d="M768 1216v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136zM1664 1216 v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136z" /> +<glyph unicode="" horiz-adv-x="1792" d="M526 142q0 -53 -37.5 -90.5t-90.5 -37.5q-52 0 -90 38t-38 90q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1024 -64q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM320 640q0 -53 -37.5 -90.5t-90.5 -37.5 t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1522 142q0 -52 -38 -90t-90 -38q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM558 1138q0 -66 -47 -113t-113 -47t-113 47t-47 113t47 113t113 47t113 -47t47 -113z M1728 640q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1088 1344q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1618 1138q0 -93 -66 -158.5t-158 -65.5q-93 0 -158.5 65.5t-65.5 158.5 q0 92 65.5 158t158.5 66q92 0 158 -66t66 -158z" /> +<glyph unicode="" d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 416q0 -166 -127 -451q-3 -7 -10.5 -24t-13.5 -30t-13 -22q-12 -17 -28 -17q-15 0 -23.5 10t-8.5 25q0 9 2.5 26.5t2.5 23.5q5 68 5 123q0 101 -17.5 181t-48.5 138.5t-80 101t-105.5 69.5t-133 42.5t-154 21.5t-175.5 6h-224v-256q0 -26 -19 -45t-45 -19t-45 19 l-512 512q-19 19 -19 45t19 45l512 512q19 19 45 19t45 -19t19 -45v-256h224q713 0 875 -403q53 -134 53 -333z" /> +<glyph unicode="" horiz-adv-x="1664" d="M640 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1280 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1440 320 q0 120 -69 204t-187 84q-41 0 -195 -21q-71 -11 -157 -11t-157 11q-152 21 -195 21q-118 0 -187 -84t-69 -204q0 -88 32 -153.5t81 -103t122 -60t140 -29.5t149 -7h168q82 0 149 7t140 29.5t122 60t81 103t32 153.5zM1664 496q0 -207 -61 -331q-38 -77 -105.5 -133t-141 -86 t-170 -47.5t-171.5 -22t-167 -4.5q-78 0 -142 3t-147.5 12.5t-152.5 30t-137 51.5t-121 81t-86 115q-62 123 -62 331q0 237 136 396q-27 82 -27 170q0 116 51 218q108 0 190 -39.5t189 -123.5q147 35 309 35q148 0 280 -32q105 82 187 121t189 39q51 -102 51 -218 q0 -87 -27 -168q136 -160 136 -398z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1536 224v704q0 40 -28 68t-68 28h-704q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68v-960q0 -40 28 -68t68 -28h1216q40 0 68 28t28 68zM1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320 q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1781 605q0 35 -53 35h-1088q-40 0 -85.5 -21.5t-71.5 -52.5l-294 -363q-18 -24 -18 -40q0 -35 53 -35h1088q40 0 86 22t71 53l294 363q18 22 18 39zM640 768h768v160q0 40 -28 68t-68 28h-576q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68 v-853l256 315q44 53 116 87.5t140 34.5zM1909 605q0 -62 -46 -120l-295 -363q-43 -53 -116 -87.5t-140 -34.5h-1088q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158v-160h192q54 0 99 -24.5t67 -70.5q15 -32 15 -68z " /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" d="M1134 461q-37 -121 -138 -195t-228 -74t-228 74t-138 195q-8 25 4 48.5t38 31.5q25 8 48.5 -4t31.5 -38q25 -80 92.5 -129.5t151.5 -49.5t151.5 49.5t92.5 129.5q8 26 32 38t49 4t37 -31.5t4 -48.5zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5 t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5 t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1134 307q8 -25 -4 -48.5t-37 -31.5t-49 4t-32 38q-25 80 -92.5 129.5t-151.5 49.5t-151.5 -49.5t-92.5 -129.5q-8 -26 -31.5 -38t-48.5 -4q-26 8 -38 31.5t-4 48.5q37 121 138 195t228 74t228 -74t138 -195zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204 t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1152 448q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h640q26 0 45 -19t19 -45zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1920" d="M832 448v128q0 14 -9 23t-23 9h-192v192q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-192h-192q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h192v-192q0 -14 9 -23t23 -9h128q14 0 23 9t9 23v192h192q14 0 23 9t9 23zM1408 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5 t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1920 512q0 -212 -150 -362t-362 -150q-192 0 -338 128h-220q-146 -128 -338 -128q-212 0 -362 150 t-150 362t150 362t362 150h896q212 0 362 -150t150 -362z" /> +<glyph unicode="" horiz-adv-x="1920" d="M384 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM512 624v-96q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h224q16 0 16 -16zM384 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 368v-96q0 -16 -16 -16 h-864q-16 0 -16 16v96q0 16 16 16h864q16 0 16 -16zM768 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM640 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1024 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16 h96q16 0 16 -16zM896 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1280 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1152 880v-96 q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 880v-352q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h112v240q0 16 16 16h96q16 0 16 -16zM1792 128v896h-1664v-896 h1664zM1920 1024v-896q0 -53 -37.5 -90.5t-90.5 -37.5h-1664q-53 0 -90.5 37.5t-37.5 90.5v896q0 53 37.5 90.5t90.5 37.5h1664q53 0 90.5 -37.5t37.5 -90.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1664 491v616q-169 -91 -306 -91q-82 0 -145 32q-100 49 -184 76.5t-178 27.5q-173 0 -403 -127v-599q245 113 433 113q55 0 103.5 -7.5t98 -26t77 -31t82.5 -39.5l28 -14q44 -22 101 -22q120 0 293 92zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9 h-64q-14 0 -23 9t-9 23v1266q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102 q-15 -9 -33 -9q-16 0 -32 8q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" /> +<glyph unicode="" horiz-adv-x="1792" d="M832 536v192q-181 -16 -384 -117v-185q205 96 384 110zM832 954v197q-172 -8 -384 -126v-189q215 111 384 118zM1664 491v184q-235 -116 -384 -71v224q-20 6 -39 15q-5 3 -33 17t-34.5 17t-31.5 15t-34.5 15.5t-32.5 13t-36 12.5t-35 8.5t-39.5 7.5t-39.5 4t-44 2 q-23 0 -49 -3v-222h19q102 0 192.5 -29t197.5 -82q19 -9 39 -15v-188q42 -17 91 -17q120 0 293 92zM1664 918v189q-169 -91 -306 -91q-45 0 -78 8v-196q148 -42 384 90zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v1266 q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102q-15 -9 -33 -9q-16 0 -32 8 q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" /> +<glyph unicode="" horiz-adv-x="1664" d="M585 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23zM1664 96v-64q0 -14 -9 -23t-23 -9h-960q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h960q14 0 23 -9 t9 -23z" /> +<glyph unicode="" horiz-adv-x="1920" d="M617 137l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23zM1208 1204l-373 -1291q-4 -13 -15.5 -19.5t-23.5 -2.5l-62 17q-13 4 -19.5 15.5t-2.5 24.5 l373 1291q4 13 15.5 19.5t23.5 2.5l62 -17q13 -4 19.5 -15.5t2.5 -24.5zM1865 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23z" /> +<glyph unicode="" horiz-adv-x="1792" d="M640 454v-70q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-69l-397 -398q-19 -19 -19 -45t19 -45zM1792 416q0 -58 -17 -133.5t-38.5 -138t-48 -125t-40.5 -90.5l-20 -40q-8 -17 -28 -17q-6 0 -9 1 q-25 8 -23 34q43 400 -106 565q-64 71 -170.5 110.5t-267.5 52.5v-251q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-262q411 -28 599 -221q169 -173 169 -509z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1186 579l257 250l-356 52l-66 10l-30 60l-159 322v-963l59 -31l318 -168l-60 355l-12 66zM1638 841l-363 -354l86 -500q5 -33 -6 -51.5t-34 -18.5q-17 0 -40 12l-449 236l-449 -236q-23 -12 -40 -12q-23 0 -34 18.5t-6 51.5l86 500l-364 354q-32 32 -23 59.5t54 34.5 l502 73l225 455q20 41 49 41q28 0 49 -41l225 -455l502 -73q45 -7 54 -34.5t-24 -59.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1401 1187l-640 -1280q-17 -35 -57 -35q-5 0 -15 2q-22 5 -35.5 22.5t-13.5 39.5v576h-576q-22 0 -39.5 13.5t-22.5 35.5t4 42t29 30l1280 640q13 7 29 7q27 0 45 -19q15 -14 18.5 -34.5t-6.5 -39.5z" /> +<glyph unicode="" horiz-adv-x="1664" d="M557 256h595v595zM512 301l595 595h-595v-595zM1664 224v-192q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v224h-864q-14 0 -23 9t-9 23v864h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224v224q0 14 9 23t23 9h192q14 0 23 -9t9 -23 v-224h851l246 247q10 9 23 9t23 -9q9 -10 9 -23t-9 -23l-247 -246v-851h224q14 0 23 -9t9 -23z" /> +<glyph unicode="" horiz-adv-x="1024" d="M288 64q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM288 1216q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM928 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1024 1088q0 -52 -26 -96.5t-70 -69.5 q-2 -287 -226 -414q-68 -38 -203 -81q-128 -40 -169.5 -71t-41.5 -100v-26q44 -25 70 -69.5t26 -96.5q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 52 26 96.5t70 69.5v820q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136q0 -52 -26 -96.5t-70 -69.5v-497 q54 26 154 57q55 17 87.5 29.5t70.5 31t59 39.5t40.5 51t28 69.5t8.5 91.5q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136z" /> +<glyph unicode="" horiz-adv-x="1664" d="M439 265l-256 -256q-10 -9 -23 -9q-12 0 -23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23zM608 224v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM384 448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23t9 23t23 9h320 q14 0 23 -9t9 -23zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-334 335q-21 21 -42 56l239 18l273 -274q27 -27 68 -27.5t68 26.5l147 146q28 28 28 67q0 40 -28 68l-274 275l18 239q35 -21 56 -42l336 -336q84 -86 84 -204zM1031 1044l-239 -18 l-273 274q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l274 -274l-18 -240q-35 21 -56 42l-336 336q-84 86 -84 204q0 120 85 203l147 146q83 83 203 83q121 0 204 -85l334 -335q21 -21 42 -56zM1664 960q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9 t-9 23t9 23t23 9h320q14 0 23 -9t9 -23zM1120 1504v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM1527 1353l-256 -256q-11 -9 -23 -9t-23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23z" /> +<glyph unicode="" horiz-adv-x="1024" d="M704 280v-240q0 -16 -12 -28t-28 -12h-240q-16 0 -28 12t-12 28v240q0 16 12 28t28 12h240q16 0 28 -12t12 -28zM1020 880q0 -54 -15.5 -101t-35 -76.5t-55 -59.5t-57.5 -43.5t-61 -35.5q-41 -23 -68.5 -65t-27.5 -67q0 -17 -12 -32.5t-28 -15.5h-240q-15 0 -25.5 18.5 t-10.5 37.5v45q0 83 65 156.5t143 108.5q59 27 84 56t25 76q0 42 -46.5 74t-107.5 32q-65 0 -108 -29q-35 -25 -107 -115q-13 -16 -31 -16q-12 0 -25 8l-164 125q-13 10 -15.5 25t5.5 28q160 266 464 266q80 0 161 -31t146 -83t106 -127.5t41 -158.5z" /> +<glyph unicode="" horiz-adv-x="640" d="M640 192v-128q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64v384h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-576h64q26 0 45 -19t19 -45zM512 1344v-192q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v192 q0 26 19 45t45 19h256q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="640" d="M512 288v-224q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v224q0 26 19 45t45 19h256q26 0 45 -19t19 -45zM542 1344l-28 -768q-1 -26 -20.5 -45t-45.5 -19h-256q-26 0 -45.5 19t-20.5 45l-28 768q-1 26 17.5 45t44.5 19h320q26 0 44.5 -19t17.5 -45z" /> +<glyph unicode="" d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3l-9 -21q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109zM1534 846v-206h-514l-3 27 q-4 28 -4 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q83 65 188 65q110 0 178 -59.5t68 -158.5q0 -56 -24.5 -103t-62 -76.5t-81.5 -58.5t-82 -50.5t-65.5 -51.5t-30.5 -63h232v80 h126z" /> +<glyph unicode="" d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3l-9 -21q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109zM1536 -50v-206h-514l-4 27 q-3 45 -3 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q80 65 188 65q110 0 178 -59.5t68 -158.5q0 -66 -34.5 -118.5t-84 -86t-99.5 -62.5t-87 -63t-41 -73h232v80h126z" /> +<glyph unicode="" horiz-adv-x="1920" d="M896 128l336 384h-768l-336 -384h768zM1909 1205q15 -34 9.5 -71.5t-30.5 -65.5l-896 -1024q-38 -44 -96 -44h-768q-38 0 -69.5 20.5t-47.5 54.5q-15 34 -9.5 71.5t30.5 65.5l896 1024q38 44 96 44h768q38 0 69.5 -20.5t47.5 -54.5z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1664 438q0 -81 -44.5 -135t-123.5 -54q-41 0 -77.5 17.5t-59 38t-56.5 38t-71 17.5q-110 0 -110 -124q0 -39 16 -115t15 -115v-5q-22 0 -33 -1q-34 -3 -97.5 -11.5t-115.5 -13.5t-98 -5q-61 0 -103 26.5t-42 83.5q0 37 17.5 71t38 56.5t38 59t17.5 77.5q0 79 -54 123.5 t-135 44.5q-84 0 -143 -45.5t-59 -127.5q0 -43 15 -83t33.5 -64.5t33.5 -53t15 -50.5q0 -45 -46 -89q-37 -35 -117 -35q-95 0 -245 24q-9 2 -27.5 4t-27.5 4l-13 2q-1 0 -3 1q-2 0 -2 1v1024q2 -1 17.5 -3.5t34 -5t21.5 -3.5q150 -24 245 -24q80 0 117 35q46 44 46 89 q0 22 -15 50.5t-33.5 53t-33.5 64.5t-15 83q0 82 59 127.5t144 45.5q80 0 134 -44.5t54 -123.5q0 -41 -17.5 -77.5t-38 -59t-38 -56.5t-17.5 -71q0 -57 42 -83.5t103 -26.5q64 0 180 15t163 17v-2q-1 -2 -3.5 -17.5t-5 -34t-3.5 -21.5q-24 -150 -24 -245q0 -80 35 -117 q44 -46 89 -46q22 0 50.5 15t53 33.5t64.5 33.5t83 15q82 0 127.5 -59t45.5 -143z" /> +<glyph unicode="" horiz-adv-x="1152" d="M1152 832v-128q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-217 24 -364.5 187.5t-147.5 384.5v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -185 131.5 -316.5t316.5 -131.5 t316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45zM896 1216v-512q0 -132 -94 -226t-226 -94t-226 94t-94 226v512q0 132 94 226t226 94t226 -94t94 -226z" /> +<glyph unicode="" horiz-adv-x="1408" d="M271 591l-101 -101q-42 103 -42 214v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -53 15 -113zM1385 1193l-361 -361v-128q0 -132 -94 -226t-226 -94q-55 0 -109 19l-96 -96q97 -51 205 -51q185 0 316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45v-128 q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-125 13 -235 81l-254 -254q-10 -10 -23 -10t-23 10l-82 82q-10 10 -10 23t10 23l1234 1234q10 10 23 10t23 -10l82 -82q10 -10 10 -23 t-10 -23zM1005 1325l-621 -621v512q0 132 94 226t226 94q102 0 184.5 -59t116.5 -152z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1088 576v640h-448v-1137q119 63 213 137q235 184 235 360zM1280 1344v-768q0 -86 -33.5 -170.5t-83 -150t-118 -127.5t-126.5 -103t-121 -77.5t-89.5 -49.5t-42.5 -20q-12 -6 -26 -6t-26 6q-16 7 -42.5 20t-89.5 49.5t-121 77.5t-126.5 103t-118 127.5t-83 150 t-33.5 170.5v768q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1664" d="M128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280 q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" /> +<glyph unicode="" horiz-adv-x="1408" d="M512 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 1376v-320q0 -16 -12 -25q-8 -7 -20 -7q-4 0 -7 1l-448 96q-11 2 -18 11t-7 20h-256v-102q111 -23 183.5 -111t72.5 -203v-800q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v800 q0 106 62.5 190.5t161.5 114.5v111h-32q-59 0 -115 -23.5t-91.5 -53t-66 -66.5t-40.5 -53.5t-14 -24.5q-17 -35 -57 -35q-16 0 -29 7q-23 12 -31.5 37t3.5 49q5 10 14.5 26t37.5 53.5t60.5 70t85 67t108.5 52.5q-25 42 -25 86q0 66 47 113t113 47t113 -47t47 -113 q0 -33 -14 -64h302q0 11 7 20t18 11l448 96q3 1 7 1q12 0 20 -7q12 -9 12 -25z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1440 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1664 1376q0 -249 -75.5 -430.5t-253.5 -360.5q-81 -80 -195 -176l-20 -379q-2 -16 -16 -26l-384 -224q-7 -4 -16 -4q-12 0 -23 9l-64 64q-13 14 -8 32l85 276l-281 281l-276 -85q-3 -1 -9 -1 q-14 0 -23 9l-64 64q-17 19 -5 39l224 384q10 14 26 16l379 20q96 114 176 195q188 187 358 258t431 71q14 0 24 -9.5t10 -22.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1745 763l-164 -763h-334l178 832q13 56 -15 88q-27 33 -83 33h-169l-204 -953h-334l204 953h-286l-204 -953h-334l204 953l-153 327h1276q101 0 189.5 -40.5t147.5 -113.5q60 -73 81 -168.5t0 -194.5z" /> +<glyph unicode="" d="M909 141l102 102q19 19 19 45t-19 45l-307 307l307 307q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M717 141l454 454q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l307 -307l-307 -307q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1165 397l102 102q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l307 307l307 -307q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M813 237l454 454q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-307 -307l-307 307q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1130 939l16 175h-884l47 -534h612l-22 -228l-197 -53l-196 53l-13 140h-175l22 -278l362 -100h4v1l359 99l50 544h-644l-15 181h674zM0 1408h1408l-128 -1438l-578 -162l-574 162z" /> +<glyph unicode="" horiz-adv-x="1792" d="M275 1408h1505l-266 -1333l-804 -267l-698 267l71 356h297l-29 -147l422 -161l486 161l68 339h-1208l58 297h1209l38 191h-1208z" /> +<glyph unicode="" horiz-adv-x="1792" d="M960 1280q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1792 352v-352q0 -22 -20 -30q-8 -2 -12 -2q-13 0 -23 9l-93 93q-119 -143 -318.5 -226.5t-429.5 -83.5t-429.5 83.5t-318.5 226.5l-93 -93q-9 -9 -23 -9q-4 0 -12 2q-20 8 -20 30v352 q0 14 9 23t23 9h352q22 0 30 -20q8 -19 -7 -35l-100 -100q67 -91 189.5 -153.5t271.5 -82.5v647h-192q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h192v163q-58 34 -93 92.5t-35 128.5q0 106 75 181t181 75t181 -75t75 -181q0 -70 -35 -128.5t-93 -92.5v-163h192q26 0 45 -19 t19 -45v-128q0 -26 -19 -45t-45 -19h-192v-647q149 20 271.5 82.5t189.5 153.5l-100 100q-15 16 -7 35q8 20 30 20h352q14 0 23 -9t9 -23z" /> +<glyph unicode="" horiz-adv-x="1152" d="M1056 768q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v320q0 185 131.5 316.5t316.5 131.5t316.5 -131.5t131.5 -316.5q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45q0 106 -75 181t-181 75t-181 -75t-75 -181 v-320h736z" /> +<glyph unicode="" d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM1152 640q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM1280 640q0 -212 -150 -362t-362 -150t-362 150 t-150 362t150 362t362 150t362 -150t150 -362zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM896 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM1408 800v-192q0 -40 -28 -68t-68 -28h-192 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" /> +<glyph unicode="" horiz-adv-x="384" d="M384 288v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 1312v-192q0 -40 -28 -68t-68 -28h-192 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" /> +<glyph unicode="" d="M512 256q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM863 162q-13 232 -177 396t-396 177q-14 1 -24 -9t-10 -23v-128q0 -13 8.5 -22t21.5 -10q154 -11 264 -121t121 -264q1 -13 10 -21.5t22 -8.5h128q13 0 23 10 t9 24zM1247 161q-5 154 -56 297.5t-139.5 260t-205 205t-260 139.5t-297.5 56q-14 1 -23 -9q-10 -10 -10 -23v-128q0 -13 9 -22t22 -10q204 -7 378 -111.5t278.5 -278.5t111.5 -378q1 -13 10 -22t22 -9h128q13 0 23 10q11 9 9 23zM1536 1120v-960q0 -119 -84.5 -203.5 t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1152 585q32 18 32 55t-32 55l-544 320q-31 19 -64 1q-32 -19 -32 -56v-640q0 -37 32 -56 q16 -8 32 -8q17 0 32 9z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1024 1084l316 -316l-572 -572l-316 316zM813 105l618 618q19 19 19 45t-19 45l-362 362q-18 18 -45 18t-45 -18l-618 -618q-19 -19 -19 -45t19 -45l362 -362q18 -18 45 -18t45 18zM1702 742l-907 -908q-37 -37 -90.5 -37t-90.5 37l-126 126q56 56 56 136t-56 136 t-136 56t-136 -56l-125 126q-37 37 -37 90.5t37 90.5l907 906q37 37 90.5 37t90.5 -37l125 -125q-56 -56 -56 -136t56 -136t136 -56t136 56l126 -125q37 -37 37 -90.5t-37 -90.5z" /> +<glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-896q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h896q26 0 45 19t19 45zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5 t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1152 736v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h832q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5 t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1024" d="M1018 933q-18 -37 -58 -37h-192v-864q0 -14 -9 -23t-23 -9h-704q-21 0 -29 18q-8 20 4 35l160 192q9 11 25 11h320v640h-192q-40 0 -58 37q-17 37 9 68l320 384q18 22 49 22t49 -22l320 -384q27 -32 9 -68z" /> +<glyph unicode="" horiz-adv-x="1024" d="M32 1280h704q13 0 22.5 -9.5t9.5 -23.5v-863h192q40 0 58 -37t-9 -69l-320 -384q-18 -22 -49 -22t-49 22l-320 384q-26 31 -9 69q18 37 58 37h192v640h-320q-14 0 -25 11l-160 192q-13 14 -4 34q9 19 29 19z" /> +<glyph unicode="" d="M685 237l614 614q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-467 -467l-211 211q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l358 -358q19 -19 45 -19t45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5 t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" d="M404 428l152 -152l-52 -52h-56v96h-96v56zM818 818q14 -13 -3 -30l-291 -291q-17 -17 -30 -3q-14 13 3 30l291 291q17 17 30 3zM544 128l544 544l-288 288l-544 -544v-288h288zM1152 736l92 92q28 28 28 68t-28 68l-152 152q-28 28 -68 28t-68 -28l-92 -92zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" d="M1280 608v480q0 26 -19 45t-45 19h-480q-42 0 -59 -39q-17 -41 14 -70l144 -144l-534 -534q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l534 534l144 -144q18 -19 45 -19q12 0 25 5q39 17 39 59zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960 q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" d="M1005 435l352 352q19 19 19 45t-19 45l-352 352q-30 31 -69 14q-40 -17 -40 -59v-160q-119 0 -216 -19.5t-162.5 -51t-114 -79t-76.5 -95.5t-44.5 -109t-21.5 -111.5t-5 -110.5q0 -181 167 -404q10 -12 25 -12q7 0 13 3q22 9 19 33q-44 354 62 473q46 52 130 75.5 t224 23.5v-160q0 -42 40 -59q12 -5 24 -5q26 0 45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" d="M640 448l256 128l-256 128v-256zM1024 1039v-542l-512 -256v542zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1145 861q18 -35 -5 -66l-320 -448q-19 -27 -52 -27t-52 27l-320 448q-23 31 -5 66q17 35 57 35h640q40 0 57 -35zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" d="M1145 419q-17 -35 -57 -35h-640q-40 0 -57 35q-18 35 5 66l320 448q19 27 52 27t52 -27l320 -448q23 -31 5 -66zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" d="M1088 640q0 -33 -27 -52l-448 -320q-31 -23 -66 -5q-35 17 -35 57v640q0 40 35 57q35 18 66 -5l448 -320q27 -19 27 -52zM1280 160v960q0 14 -9 23t-23 9h-960q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h960q14 0 23 9t9 23zM1536 1120v-960q0 -119 -84.5 -203.5 t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1024" d="M976 229l35 -159q3 -12 -3 -22.5t-17 -14.5l-5 -1q-4 -2 -10.5 -3.5t-16 -4.5t-21.5 -5.5t-25.5 -5t-30 -5t-33.5 -4.5t-36.5 -3t-38.5 -1q-234 0 -409 130.5t-238 351.5h-95q-13 0 -22.5 9.5t-9.5 22.5v113q0 13 9.5 22.5t22.5 9.5h66q-2 57 1 105h-67q-14 0 -23 9 t-9 23v114q0 14 9 23t23 9h98q67 210 243.5 338t400.5 128q102 0 194 -23q11 -3 20 -15q6 -11 3 -24l-43 -159q-3 -13 -14 -19.5t-24 -2.5l-4 1q-4 1 -11.5 2.5l-17.5 3.5t-22.5 3.5t-26 3t-29 2.5t-29.5 1q-126 0 -226 -64t-150 -176h468q16 0 25 -12q10 -12 7 -26 l-24 -114q-5 -26 -32 -26h-488q-3 -37 0 -105h459q15 0 25 -12q9 -12 6 -27l-24 -112q-2 -11 -11 -18.5t-20 -7.5h-387q48 -117 149.5 -185.5t228.5 -68.5q18 0 36 1.5t33.5 3.5t29.5 4.5t24.5 5t18.5 4.5l12 3l5 2q13 5 26 -2q12 -7 15 -21z" /> +<glyph unicode="" horiz-adv-x="1024" d="M1020 399v-367q0 -14 -9 -23t-23 -9h-956q-14 0 -23 9t-9 23v150q0 13 9.5 22.5t22.5 9.5h97v383h-95q-14 0 -23 9.5t-9 22.5v131q0 14 9 23t23 9h95v223q0 171 123.5 282t314.5 111q185 0 335 -125q9 -8 10 -20.5t-7 -22.5l-103 -127q-9 -11 -22 -12q-13 -2 -23 7 q-5 5 -26 19t-69 32t-93 18q-85 0 -137 -47t-52 -123v-215h305q13 0 22.5 -9t9.5 -23v-131q0 -13 -9.5 -22.5t-22.5 -9.5h-305v-379h414v181q0 13 9 22.5t23 9.5h162q14 0 23 -9.5t9 -22.5z" /> +<glyph unicode="" horiz-adv-x="1024" d="M978 351q0 -153 -99.5 -263.5t-258.5 -136.5v-175q0 -14 -9 -23t-23 -9h-135q-13 0 -22.5 9.5t-9.5 22.5v175q-66 9 -127.5 31t-101.5 44.5t-74 48t-46.5 37.5t-17.5 18q-17 21 -2 41l103 135q7 10 23 12q15 2 24 -9l2 -2q113 -99 243 -125q37 -8 74 -8q81 0 142.5 43 t61.5 122q0 28 -15 53t-33.5 42t-58.5 37.5t-66 32t-80 32.5q-39 16 -61.5 25t-61.5 26.5t-62.5 31t-56.5 35.5t-53.5 42.5t-43.5 49t-35.5 58t-21 66.5t-8.5 78q0 138 98 242t255 134v180q0 13 9.5 22.5t22.5 9.5h135q14 0 23 -9t9 -23v-176q57 -6 110.5 -23t87 -33.5 t63.5 -37.5t39 -29t15 -14q17 -18 5 -38l-81 -146q-8 -15 -23 -16q-14 -3 -27 7q-3 3 -14.5 12t-39 26.5t-58.5 32t-74.5 26t-85.5 11.5q-95 0 -155 -43t-60 -111q0 -26 8.5 -48t29.5 -41.5t39.5 -33t56 -31t60.5 -27t70 -27.5q53 -20 81 -31.5t76 -35t75.5 -42.5t62 -50 t53 -63.5t31.5 -76.5t13 -94z" /> +<glyph unicode="" horiz-adv-x="898" d="M898 1066v-102q0 -14 -9 -23t-23 -9h-168q-23 -144 -129 -234t-276 -110q167 -178 459 -536q14 -16 4 -34q-8 -18 -29 -18h-195q-16 0 -25 12q-306 367 -498 571q-9 9 -9 22v127q0 13 9.5 22.5t22.5 9.5h112q132 0 212.5 43t102.5 125h-427q-14 0 -23 9t-9 23v102 q0 14 9 23t23 9h413q-57 113 -268 113h-145q-13 0 -22.5 9.5t-9.5 22.5v133q0 14 9 23t23 9h832q14 0 23 -9t9 -23v-102q0 -14 -9 -23t-23 -9h-233q47 -61 64 -144h171q14 0 23 -9t9 -23z" /> +<glyph unicode="" horiz-adv-x="1027" d="M603 0h-172q-13 0 -22.5 9t-9.5 23v330h-288q-13 0 -22.5 9t-9.5 23v103q0 13 9.5 22.5t22.5 9.5h288v85h-288q-13 0 -22.5 9t-9.5 23v104q0 13 9.5 22.5t22.5 9.5h214l-321 578q-8 16 0 32q10 16 28 16h194q19 0 29 -18l215 -425q19 -38 56 -125q10 24 30.5 68t27.5 61 l191 420q8 19 29 19h191q17 0 27 -16q9 -14 1 -31l-313 -579h215q13 0 22.5 -9.5t9.5 -22.5v-104q0 -14 -9.5 -23t-22.5 -9h-290v-85h290q13 0 22.5 -9.5t9.5 -22.5v-103q0 -14 -9.5 -23t-22.5 -9h-290v-330q0 -13 -9.5 -22.5t-22.5 -9.5z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1043 971q0 100 -65 162t-171 62h-320v-448h320q106 0 171 62t65 162zM1280 971q0 -193 -126.5 -315t-326.5 -122h-340v-118h505q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9h-505v-192q0 -14 -9.5 -23t-22.5 -9h-167q-14 0 -23 9t-9 23v192h-224q-14 0 -23 9t-9 23v128 q0 14 9 23t23 9h224v118h-224q-14 0 -23 9t-9 23v149q0 13 9 22.5t23 9.5h224v629q0 14 9 23t23 9h539q200 0 326.5 -122t126.5 -315z" /> +<glyph unicode="" horiz-adv-x="1792" d="M514 341l81 299h-159l75 -300q1 -1 1 -3t1 -3q0 1 0.5 3.5t0.5 3.5zM630 768l35 128h-292l32 -128h225zM822 768h139l-35 128h-70zM1271 340l78 300h-162l81 -299q0 -1 0.5 -3.5t1.5 -3.5q0 1 0.5 3t0.5 3zM1382 768l33 128h-297l34 -128h230zM1792 736v-64q0 -14 -9 -23 t-23 -9h-213l-164 -616q-7 -24 -31 -24h-159q-24 0 -31 24l-166 616h-209l-167 -616q-7 -24 -31 -24h-159q-11 0 -19.5 7t-10.5 17l-160 616h-208q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h175l-33 128h-142q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h109l-89 344q-5 15 5 28 q10 12 26 12h137q26 0 31 -24l90 -360h359l97 360q7 24 31 24h126q24 0 31 -24l98 -360h365l93 360q5 24 31 24h137q16 0 26 -12q10 -13 5 -28l-91 -344h111q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-145l-34 -128h179q14 0 23 -9t9 -23z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1167 896q18 -182 -131 -258q117 -28 175 -103t45 -214q-7 -71 -32.5 -125t-64.5 -89t-97 -58.5t-121.5 -34.5t-145.5 -15v-255h-154v251q-80 0 -122 1v-252h-154v255q-18 0 -54 0.5t-55 0.5h-200l31 183h111q50 0 58 51v402h16q-6 1 -16 1v287q-13 68 -89 68h-111v164 l212 -1q64 0 97 1v252h154v-247q82 2 122 2v245h154v-252q79 -7 140 -22.5t113 -45t82.5 -78t36.5 -114.5zM952 351q0 36 -15 64t-37 46t-57.5 30.5t-65.5 18.5t-74 9t-69 3t-64.5 -1t-47.5 -1v-338q8 0 37 -0.5t48 -0.5t53 1.5t58.5 4t57 8.5t55.5 14t47.5 21t39.5 30 t24.5 40t9.5 51zM881 827q0 33 -12.5 58.5t-30.5 42t-48 28t-55 16.5t-61.5 8t-58 2.5t-54 -1t-39.5 -0.5v-307q5 0 34.5 -0.5t46.5 0t50 2t55 5.5t51.5 11t48.5 18.5t37 27t27 38.5t9 51z" /> +<glyph unicode="" d="M1024 1024v472q22 -14 36 -28l408 -408q14 -14 28 -36h-472zM896 992q0 -40 28 -68t68 -28h544v-1056q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h800v-544z" /> +<glyph unicode="" d="M1468 1060q14 -14 28 -36h-472v472q22 -14 36 -28zM992 896h544v-1056q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h800v-544q0 -40 28 -68t68 -28zM1152 160v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704 q14 0 23 9t9 23zM1152 416v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1152 672v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1191 1128h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1572 -23 v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -11v-2l14 2q9 2 30 2h248v119h121zM1661 874v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162 l230 -662h70z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1191 104h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1661 -150 v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162l230 -662h70zM1572 1001v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -10v-3l14 3q9 1 30 1h248 v119h121z" /> +<glyph unicode="" horiz-adv-x="1792" d="M736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1792 -32v-192q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832 q14 0 23 -9t9 -23zM1600 480v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1408 992v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1216 1504v-192q0 -14 -9 -23t-23 -9h-256 q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1216 -32v-192q0 -14 -9 -23t-23 -9h-256q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192 q14 0 23 -9t9 -23zM1408 480v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1600 992v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1792 1504v-192q0 -14 -9 -23t-23 -9h-832 q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832q14 0 23 -9t9 -23z" /> +<glyph unicode="" d="M1346 223q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23 zM1486 165q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5 t82 -252.5zM1456 882v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165z" /> +<glyph unicode="" d="M1346 1247q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9 t9 -23zM1456 -142v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165zM1486 1189q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13 q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5t82 -252.5z" /> +<glyph unicode="" horiz-adv-x="1664" d="M256 192q0 26 -19 45t-45 19q-27 0 -45.5 -19t-18.5 -45q0 -27 18.5 -45.5t45.5 -18.5q26 0 45 18.5t19 45.5zM416 704v-640q0 -26 -19 -45t-45 -19h-288q-26 0 -45 19t-19 45v640q0 26 19 45t45 19h288q26 0 45 -19t19 -45zM1600 704q0 -86 -55 -149q15 -44 15 -76 q3 -76 -43 -137q17 -56 0 -117q-15 -57 -54 -94q9 -112 -49 -181q-64 -76 -197 -78h-36h-76h-17q-66 0 -144 15.5t-121.5 29t-120.5 39.5q-123 43 -158 44q-26 1 -45 19.5t-19 44.5v641q0 25 18 43.5t43 20.5q24 2 76 59t101 121q68 87 101 120q18 18 31 48t17.5 48.5 t13.5 60.5q7 39 12.5 61t19.5 52t34 50q19 19 45 19q46 0 82.5 -10.5t60 -26t40 -40.5t24 -45t12 -50t5 -45t0.5 -39q0 -38 -9.5 -76t-19 -60t-27.5 -56q-3 -6 -10 -18t-11 -22t-8 -24h277q78 0 135 -57t57 -135z" /> +<glyph unicode="" horiz-adv-x="1664" d="M256 960q0 -26 -19 -45t-45 -19q-27 0 -45.5 19t-18.5 45q0 27 18.5 45.5t45.5 18.5q26 0 45 -18.5t19 -45.5zM416 448v640q0 26 -19 45t-45 19h-288q-26 0 -45 -19t-19 -45v-640q0 -26 19 -45t45 -19h288q26 0 45 19t19 45zM1545 597q55 -61 55 -149q-1 -78 -57.5 -135 t-134.5 -57h-277q4 -14 8 -24t11 -22t10 -18q18 -37 27 -57t19 -58.5t10 -76.5q0 -24 -0.5 -39t-5 -45t-12 -50t-24 -45t-40 -40.5t-60 -26t-82.5 -10.5q-26 0 -45 19q-20 20 -34 50t-19.5 52t-12.5 61q-9 42 -13.5 60.5t-17.5 48.5t-31 48q-33 33 -101 120q-49 64 -101 121 t-76 59q-25 2 -43 20.5t-18 43.5v641q0 26 19 44.5t45 19.5q35 1 158 44q77 26 120.5 39.5t121.5 29t144 15.5h17h76h36q133 -2 197 -78q58 -69 49 -181q39 -37 54 -94q17 -61 0 -117q46 -61 43 -137q0 -32 -15 -76z" /> +<glyph unicode="" d="M919 233v157q0 50 -29 50q-17 0 -33 -16v-224q16 -16 33 -16q29 0 29 49zM1103 355h66v34q0 51 -33 51t-33 -51v-34zM532 621v-70h-80v-423h-74v423h-78v70h232zM733 495v-367h-67v40q-39 -45 -76 -45q-33 0 -42 28q-6 16 -6 54v290h66v-270q0 -24 1 -26q1 -15 15 -15 q20 0 42 31v280h67zM985 384v-146q0 -52 -7 -73q-12 -42 -53 -42q-35 0 -68 41v-36h-67v493h67v-161q32 40 68 40q41 0 53 -42q7 -21 7 -74zM1236 255v-9q0 -29 -2 -43q-3 -22 -15 -40q-27 -40 -80 -40q-52 0 -81 38q-21 27 -21 86v129q0 59 20 86q29 38 80 38t78 -38 q21 -28 21 -86v-76h-133v-65q0 -51 34 -51q24 0 30 26q0 1 0.5 7t0.5 16.5v21.5h68zM785 1079v-156q0 -51 -32 -51t-32 51v156q0 52 32 52t32 -52zM1318 366q0 177 -19 260q-10 44 -43 73.5t-76 34.5q-136 15 -412 15q-275 0 -411 -15q-44 -5 -76.5 -34.5t-42.5 -73.5 q-20 -87 -20 -260q0 -176 20 -260q10 -43 42.5 -73t75.5 -35q137 -15 412 -15t412 15q43 5 75.5 35t42.5 73q20 84 20 260zM563 1017l90 296h-75l-51 -195l-53 195h-78l24 -69t23 -69q35 -103 46 -158v-201h74v201zM852 936v130q0 58 -21 87q-29 38 -78 38q-51 0 -78 -38 q-21 -29 -21 -87v-130q0 -58 21 -87q27 -38 78 -38q49 0 78 38q21 27 21 87zM1033 816h67v370h-67v-283q-22 -31 -42 -31q-15 0 -16 16q-1 2 -1 26v272h-67v-293q0 -37 6 -55q11 -27 43 -27q36 0 77 45v-40zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960 q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" d="M971 292v-211q0 -67 -39 -67q-23 0 -45 22v301q22 22 45 22q39 0 39 -67zM1309 291v-46h-90v46q0 68 45 68t45 -68zM343 509h107v94h-312v-94h105v-569h100v569zM631 -60h89v494h-89v-378q-30 -42 -57 -42q-18 0 -21 21q-1 3 -1 35v364h-89v-391q0 -49 8 -73 q12 -37 58 -37q48 0 102 61v-54zM1060 88v197q0 73 -9 99q-17 56 -71 56q-50 0 -93 -54v217h-89v-663h89v48q45 -55 93 -55q54 0 71 55q9 27 9 100zM1398 98v13h-91q0 -51 -2 -61q-7 -36 -40 -36q-46 0 -46 69v87h179v103q0 79 -27 116q-39 51 -106 51q-68 0 -107 -51 q-28 -37 -28 -116v-173q0 -79 29 -116q39 -51 108 -51q72 0 108 53q18 27 21 54q2 9 2 58zM790 1011v210q0 69 -43 69t-43 -69v-210q0 -70 43 -70t43 70zM1509 260q0 -234 -26 -350q-14 -59 -58 -99t-102 -46q-184 -21 -555 -21t-555 21q-58 6 -102.5 46t-57.5 99 q-26 112 -26 350q0 234 26 350q14 59 58 99t103 47q183 20 554 20t555 -20q58 -7 102.5 -47t57.5 -99q26 -112 26 -350zM511 1536h102l-121 -399v-271h-100v271q-14 74 -61 212q-37 103 -65 187h106l71 -263zM881 1203v-175q0 -81 -28 -118q-37 -51 -106 -51q-67 0 -105 51 q-28 38 -28 118v175q0 80 28 117q38 51 105 51q69 0 106 -51q28 -37 28 -117zM1216 1365v-499h-91v55q-53 -62 -103 -62q-46 0 -59 37q-8 24 -8 75v394h91v-367q0 -33 1 -35q3 -22 21 -22q27 0 57 43v381h91z" /> +<glyph unicode="" horiz-adv-x="1408" d="M597 869q-10 -18 -257 -456q-27 -46 -65 -46h-239q-21 0 -31 17t0 36l253 448q1 0 0 1l-161 279q-12 22 -1 37q9 15 32 15h239q40 0 66 -45zM1403 1511q11 -16 0 -37l-528 -934v-1l336 -615q11 -20 1 -37q-10 -15 -32 -15h-239q-42 0 -66 45l-339 622q18 32 531 942 q25 45 64 45h241q22 0 31 -15z" /> +<glyph unicode="" d="M685 771q0 1 -126 222q-21 34 -52 34h-184q-18 0 -26 -11q-7 -12 1 -29l125 -216v-1l-196 -346q-9 -14 0 -28q8 -13 24 -13h185q31 0 50 36zM1309 1268q-7 12 -24 12h-187q-30 0 -49 -35l-411 -729q1 -2 262 -481q20 -35 52 -35h184q18 0 25 12q8 13 -1 28l-260 476v1 l409 723q8 16 0 28zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1280 640q0 37 -30 54l-512 320q-31 20 -65 2q-33 -18 -33 -56v-640q0 -38 33 -56q16 -8 31 -8q20 0 34 10l512 320q30 17 30 54zM1792 640q0 -96 -1 -150t-8.5 -136.5t-22.5 -147.5q-16 -73 -69 -123t-124 -58q-222 -25 -671 -25t-671 25q-71 8 -124.5 58t-69.5 123 q-14 65 -21.5 147.5t-8.5 136.5t-1 150t1 150t8.5 136.5t22.5 147.5q16 73 69 123t124 58q222 25 671 25t671 -25q71 -8 124.5 -58t69.5 -123q14 -65 21.5 -147.5t8.5 -136.5t1 -150z" /> +<glyph unicode="" horiz-adv-x="1792" d="M402 829l494 -305l-342 -285l-490 319zM1388 274v-108l-490 -293v-1l-1 1l-1 -1v1l-489 293v108l147 -96l342 284v2l1 -1l1 1v-2l343 -284zM554 1418l342 -285l-494 -304l-338 270zM1390 829l338 -271l-489 -319l-343 285zM1239 1418l489 -319l-338 -270l-494 304z" /> +<glyph unicode="" d="M1289 -96h-1118v480h-160v-640h1438v640h-160v-480zM347 428l33 157l783 -165l-33 -156zM450 802l67 146l725 -339l-67 -145zM651 1158l102 123l614 -513l-102 -123zM1048 1536l477 -641l-128 -96l-477 641zM330 65v159h800v-159h-800z" /> +<glyph unicode="" d="M1024 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1162 640q0 -164 -115 -279t-279 -115t-279 115t-115 279t115 279t279 115t279 -115t115 -279zM1270 1050q0 -38 -27 -65t-65 -27t-65 27t-27 65t27 65t65 27t65 -27t27 -65zM768 1270 q-7 0 -76.5 0.5t-105.5 0t-96.5 -3t-103 -10t-71.5 -18.5q-50 -20 -88 -58t-58 -88q-11 -29 -18.5 -71.5t-10 -103t-3 -96.5t0 -105.5t0.5 -76.5t-0.5 -76.5t0 -105.5t3 -96.5t10 -103t18.5 -71.5q20 -50 58 -88t88 -58q29 -11 71.5 -18.5t103 -10t96.5 -3t105.5 0t76.5 0.5 t76.5 -0.5t105.5 0t96.5 3t103 10t71.5 18.5q50 20 88 58t58 88q11 29 18.5 71.5t10 103t3 96.5t0 105.5t-0.5 76.5t0.5 76.5t0 105.5t-3 96.5t-10 103t-18.5 71.5q-20 50 -58 88t-88 58q-29 11 -71.5 18.5t-103 10t-96.5 3t-105.5 0t-76.5 -0.5zM1536 640q0 -229 -5 -317 q-10 -208 -124 -322t-322 -124q-88 -5 -317 -5t-317 5q-208 10 -322 124t-124 322q-5 88 -5 317t5 317q10 208 124 322t322 124q88 5 317 5t317 -5q208 -10 322 -124t124 -322q5 -88 5 -317z" /> +<glyph unicode="" d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM698 640q0 88 -62 150t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150zM1262 640q0 88 -62 150 t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150z" /> +<glyph unicode="" d="M768 914l201 -306h-402zM1133 384h94l-459 691l-459 -691h94l104 160h522zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M815 677q8 -63 -50.5 -101t-111.5 -6q-39 17 -53.5 58t-0.5 82t52 58q36 18 72.5 12t64 -35.5t27.5 -67.5zM926 698q-14 107 -113 164t-197 13q-63 -28 -100.5 -88.5t-34.5 -129.5q4 -91 77.5 -155t165.5 -56q91 8 152 84t50 168zM1165 1240q-20 27 -56 44.5t-58 22 t-71 12.5q-291 47 -566 -2q-43 -7 -66 -12t-55 -22t-50 -43q30 -28 76 -45.5t73.5 -22t87.5 -11.5q228 -29 448 -1q63 8 89.5 12t72.5 21.5t75 46.5zM1222 205q-8 -26 -15.5 -76.5t-14 -84t-28.5 -70t-58 -56.5q-86 -48 -189.5 -71.5t-202 -22t-201.5 18.5q-46 8 -81.5 18 t-76.5 27t-73 43.5t-52 61.5q-25 96 -57 292l6 16l18 9q223 -148 506.5 -148t507.5 148q21 -6 24 -23t-5 -45t-8 -37zM1403 1166q-26 -167 -111 -655q-5 -30 -27 -56t-43.5 -40t-54.5 -31q-252 -126 -610 -88q-248 27 -394 139q-15 12 -25.5 26.5t-17 35t-9 34t-6 39.5 t-5.5 35q-9 50 -26.5 150t-28 161.5t-23.5 147.5t-22 158q3 26 17.5 48.5t31.5 37.5t45 30t46 22.5t48 18.5q125 46 313 64q379 37 676 -50q155 -46 215 -122q16 -20 16.5 -51t-5.5 -54z" /> +<glyph unicode="" d="M848 666q0 43 -41 66t-77 1q-43 -20 -42.5 -72.5t43.5 -70.5q39 -23 81 4t36 72zM928 682q8 -66 -36 -121t-110 -61t-119 40t-56 113q-2 49 25.5 93t72.5 64q70 31 141.5 -10t81.5 -118zM1100 1073q-20 -21 -53.5 -34t-53 -16t-63.5 -8q-155 -20 -324 0q-44 6 -63 9.5 t-52.5 16t-54.5 32.5q13 19 36 31t40 15.5t47 8.5q198 35 408 1q33 -5 51 -8.5t43 -16t39 -31.5zM1142 327q0 7 5.5 26.5t3 32t-17.5 16.5q-161 -106 -365 -106t-366 106l-12 -6l-5 -12q26 -154 41 -210q47 -81 204 -108q249 -46 428 53q34 19 49 51.5t22.5 85.5t12.5 71z M1272 1020q9 53 -8 75q-43 55 -155 88q-216 63 -487 36q-132 -12 -226 -46q-38 -15 -59.5 -25t-47 -34t-29.5 -54q8 -68 19 -138t29 -171t24 -137q1 -5 5 -31t7 -36t12 -27t22 -28q105 -80 284 -100q259 -28 440 63q24 13 39.5 23t31 29t19.5 40q48 267 80 473zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1024" d="M944 207l80 -237q-23 -35 -111 -66t-177 -32q-104 -2 -190.5 26t-142.5 74t-95 106t-55.5 120t-16.5 118v544h-168v215q72 26 129 69.5t91 90t58 102t34 99t15 88.5q1 5 4.5 8.5t7.5 3.5h244v-424h333v-252h-334v-518q0 -30 6.5 -56t22.5 -52.5t49.5 -41.5t81.5 -14 q78 2 134 29z" /> +<glyph unicode="" d="M1136 75l-62 183q-44 -22 -103 -22q-36 -1 -62 10.5t-38.5 31.5t-17.5 40.5t-5 43.5v398h257v194h-256v326h-188q-8 0 -9 -10q-5 -44 -17.5 -87t-39 -95t-77 -95t-118.5 -68v-165h130v-418q0 -57 21.5 -115t65 -111t121 -85.5t176.5 -30.5q69 1 136.5 25t85.5 50z M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="768" d="M765 237q8 -19 -5 -35l-350 -384q-10 -10 -23 -10q-14 0 -24 10l-355 384q-13 16 -5 35q9 19 29 19h224v1248q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1248h224q21 0 29 -19z" /> +<glyph unicode="" horiz-adv-x="768" d="M765 1043q-9 -19 -29 -19h-224v-1248q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1248h-224q-21 0 -29 19t5 35l350 384q10 10 23 10q14 0 24 -10l355 -384q13 -16 5 -35z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 736v-192q0 -14 -9 -23t-23 -9h-1248v-224q0 -21 -19 -29t-35 5l-384 350q-10 10 -10 23q0 14 10 24l384 354q16 14 35 6q19 -9 19 -29v-224h1248q14 0 23 -9t9 -23z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1728 643q0 -14 -10 -24l-384 -354q-16 -14 -35 -6q-19 9 -19 29v224h-1248q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h1248v224q0 21 19 29t35 -5l384 -350q10 -10 10 -23z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1393 321q-39 -125 -123 -250q-129 -196 -257 -196q-49 0 -140 32q-86 32 -151 32q-61 0 -142 -33q-81 -34 -132 -34q-152 0 -301 259q-147 261 -147 503q0 228 113 374q112 144 284 144q72 0 177 -30q104 -30 138 -30q45 0 143 34q102 34 173 34q119 0 213 -65 q52 -36 104 -100q-79 -67 -114 -118q-65 -94 -65 -207q0 -124 69 -223t158 -126zM1017 1494q0 -61 -29 -136q-30 -75 -93 -138q-54 -54 -108 -72q-37 -11 -104 -17q3 149 78 257q74 107 250 148q1 -3 2.5 -11t2.5 -11q0 -4 0.5 -10t0.5 -10z" /> +<glyph unicode="" horiz-adv-x="1664" d="M682 530v-651l-682 94v557h682zM682 1273v-659h-682v565zM1664 530v-786l-907 125v661h907zM1664 1408v-794h-907v669z" /> +<glyph unicode="" horiz-adv-x="1408" d="M493 1053q16 0 27.5 11.5t11.5 27.5t-11.5 27.5t-27.5 11.5t-27 -11.5t-11 -27.5t11 -27.5t27 -11.5zM915 1053q16 0 27 11.5t11 27.5t-11 27.5t-27 11.5t-27.5 -11.5t-11.5 -27.5t11.5 -27.5t27.5 -11.5zM103 869q42 0 72 -30t30 -72v-430q0 -43 -29.5 -73t-72.5 -30 t-73 30t-30 73v430q0 42 30 72t73 30zM1163 850v-666q0 -46 -32 -78t-77 -32h-75v-227q0 -43 -30 -73t-73 -30t-73 30t-30 73v227h-138v-227q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73l-1 227h-74q-46 0 -78 32t-32 78v666h918zM931 1255q107 -55 171 -153.5t64 -215.5 h-925q0 117 64 215.5t172 153.5l-71 131q-7 13 5 20q13 6 20 -6l72 -132q95 42 201 42t201 -42l72 132q7 12 20 6q12 -7 5 -20zM1408 767v-430q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73v430q0 43 30 72.5t72 29.5q43 0 73 -29.5t30 -72.5z" /> +<glyph unicode="" d="M663 1125q-11 -1 -15.5 -10.5t-8.5 -9.5q-5 -1 -5 5q0 12 19 15h10zM750 1111q-4 -1 -11.5 6.5t-17.5 4.5q24 11 32 -2q3 -6 -3 -9zM399 684q-4 1 -6 -3t-4.5 -12.5t-5.5 -13.5t-10 -13q-7 -10 -1 -12q4 -1 12.5 7t12.5 18q1 3 2 7t2 6t1.5 4.5t0.5 4v3t-1 2.5t-3 2z M1254 325q0 18 -55 42q4 15 7.5 27.5t5 26t3 21.5t0.5 22.5t-1 19.5t-3.5 22t-4 20.5t-5 25t-5.5 26.5q-10 48 -47 103t-72 75q24 -20 57 -83q87 -162 54 -278q-11 -40 -50 -42q-31 -4 -38.5 18.5t-8 83.5t-11.5 107q-9 39 -19.5 69t-19.5 45.5t-15.5 24.5t-13 15t-7.5 7 q-14 62 -31 103t-29.5 56t-23.5 33t-15 40q-4 21 6 53.5t4.5 49.5t-44.5 25q-15 3 -44.5 18t-35.5 16q-8 1 -11 26t8 51t36 27q37 3 51 -30t4 -58q-11 -19 -2 -26.5t30 -0.5q13 4 13 36v37q-5 30 -13.5 50t-21 30.5t-23.5 15t-27 7.5q-107 -8 -89 -134q0 -15 -1 -15 q-9 9 -29.5 10.5t-33 -0.5t-15.5 5q1 57 -16 90t-45 34q-27 1 -41.5 -27.5t-16.5 -59.5q-1 -15 3.5 -37t13 -37.5t15.5 -13.5q10 3 16 14q4 9 -7 8q-7 0 -15.5 14.5t-9.5 33.5q-1 22 9 37t34 14q17 0 27 -21t9.5 -39t-1.5 -22q-22 -15 -31 -29q-8 -12 -27.5 -23.5 t-20.5 -12.5q-13 -14 -15.5 -27t7.5 -18q14 -8 25 -19.5t16 -19t18.5 -13t35.5 -6.5q47 -2 102 15q2 1 23 7t34.5 10.5t29.5 13t21 17.5q9 14 20 8q5 -3 6.5 -8.5t-3 -12t-16.5 -9.5q-20 -6 -56.5 -21.5t-45.5 -19.5q-44 -19 -70 -23q-25 -5 -79 2q-10 2 -9 -2t17 -19 q25 -23 67 -22q17 1 36 7t36 14t33.5 17.5t30 17t24.5 12t17.5 2.5t8.5 -11q0 -2 -1 -4.5t-4 -5t-6 -4.5t-8.5 -5t-9 -4.5t-10 -5t-9.5 -4.5q-28 -14 -67.5 -44t-66.5 -43t-49 -1q-21 11 -63 73q-22 31 -25 22q-1 -3 -1 -10q0 -25 -15 -56.5t-29.5 -55.5t-21 -58t11.5 -63 q-23 -6 -62.5 -90t-47.5 -141q-2 -18 -1.5 -69t-5.5 -59q-8 -24 -29 -3q-32 31 -36 94q-2 28 4 56q4 19 -1 18l-4 -5q-36 -65 10 -166q5 -12 25 -28t24 -20q20 -23 104 -90.5t93 -76.5q16 -15 17.5 -38t-14 -43t-45.5 -23q8 -15 29 -44.5t28 -54t7 -70.5q46 24 7 92 q-4 8 -10.5 16t-9.5 12t-2 6q3 5 13 9.5t20 -2.5q46 -52 166 -36q133 15 177 87q23 38 34 30q12 -6 10 -52q-1 -25 -23 -92q-9 -23 -6 -37.5t24 -15.5q3 19 14.5 77t13.5 90q2 21 -6.5 73.5t-7.5 97t23 70.5q15 18 51 18q1 37 34.5 53t72.5 10.5t60 -22.5zM626 1152 q3 17 -2.5 30t-11.5 15q-9 2 -9 -7q2 -5 5 -6q10 0 7 -15q-3 -20 8 -20q3 0 3 3zM1045 955q-2 8 -6.5 11.5t-13 5t-14.5 5.5q-5 3 -9.5 8t-7 8t-5.5 6.5t-4 4t-4 -1.5q-14 -16 7 -43.5t39 -31.5q9 -1 14.5 8t3.5 20zM867 1168q0 11 -5 19.5t-11 12.5t-9 3q-14 -1 -7 -7l4 -2 q14 -4 18 -31q0 -3 8 2zM921 1401q0 2 -2.5 5t-9 7t-9.5 6q-15 15 -24 15q-9 -1 -11.5 -7.5t-1 -13t-0.5 -12.5q-1 -4 -6 -10.5t-6 -9t3 -8.5q4 -3 8 0t11 9t15 9q1 1 9 1t15 2t9 7zM1486 60q20 -12 31 -24.5t12 -24t-2.5 -22.5t-15.5 -22t-23.5 -19.5t-30 -18.5 t-31.5 -16.5t-32 -15.5t-27 -13q-38 -19 -85.5 -56t-75.5 -64q-17 -16 -68 -19.5t-89 14.5q-18 9 -29.5 23.5t-16.5 25.5t-22 19.5t-47 9.5q-44 1 -130 1q-19 0 -57 -1.5t-58 -2.5q-44 -1 -79.5 -15t-53.5 -30t-43.5 -28.5t-53.5 -11.5q-29 1 -111 31t-146 43q-19 4 -51 9.5 t-50 9t-39.5 9.5t-33.5 14.5t-17 19.5q-10 23 7 66.5t18 54.5q1 16 -4 40t-10 42.5t-4.5 36.5t10.5 27q14 12 57 14t60 12q30 18 42 35t12 51q21 -73 -32 -106q-32 -20 -83 -15q-34 3 -43 -10q-13 -15 5 -57q2 -6 8 -18t8.5 -18t4.5 -17t1 -22q0 -15 -17 -49t-14 -48 q3 -17 37 -26q20 -6 84.5 -18.5t99.5 -20.5q24 -6 74 -22t82.5 -23t55.5 -4q43 6 64.5 28t23 48t-7.5 58.5t-19 52t-20 36.5q-121 190 -169 242q-68 74 -113 40q-11 -9 -15 15q-3 16 -2 38q1 29 10 52t24 47t22 42q8 21 26.5 72t29.5 78t30 61t39 54q110 143 124 195 q-12 112 -16 310q-2 90 24 151.5t106 104.5q39 21 104 21q53 1 106 -13.5t89 -41.5q57 -42 91.5 -121.5t29.5 -147.5q-5 -95 30 -214q34 -113 133 -218q55 -59 99.5 -163t59.5 -191q8 -49 5 -84.5t-12 -55.5t-20 -22q-10 -2 -23.5 -19t-27 -35.5t-40.5 -33.5t-61 -14 q-18 1 -31.5 5t-22.5 13.5t-13.5 15.5t-11.5 20.5t-9 19.5q-22 37 -41 30t-28 -49t7 -97q20 -70 1 -195q-10 -65 18 -100.5t73 -33t85 35.5q59 49 89.5 66.5t103.5 42.5q53 18 77 36.5t18.5 34.5t-25 28.5t-51.5 23.5q-33 11 -49.5 48t-15 72.5t15.5 47.5q1 -31 8 -56.5 t14.5 -40.5t20.5 -28.5t21 -19t21.5 -13t16.5 -9.5z" /> +<glyph unicode="" d="M1024 36q-42 241 -140 498h-2l-2 -1q-16 -6 -43 -16.5t-101 -49t-137 -82t-131 -114.5t-103 -148l-15 11q184 -150 418 -150q132 0 256 52zM839 643q-21 49 -53 111q-311 -93 -673 -93q-1 -7 -1 -21q0 -124 44 -236.5t124 -201.5q50 89 123.5 166.5t142.5 124.5t130.5 81 t99.5 48l37 13q4 1 13 3.5t13 4.5zM732 855q-120 213 -244 378q-138 -65 -234 -186t-128 -272q302 0 606 80zM1416 536q-210 60 -409 29q87 -239 128 -469q111 75 185 189.5t96 250.5zM611 1277q-1 0 -2 -1q1 1 2 1zM1201 1132q-185 164 -433 164q-76 0 -155 -19 q131 -170 246 -382q69 26 130 60.5t96.5 61.5t65.5 57t37.5 40.5zM1424 647q-3 232 -149 410l-1 -1q-9 -12 -19 -24.5t-43.5 -44.5t-71 -60.5t-100 -65t-131.5 -64.5q25 -53 44 -95q2 -6 6.5 -17.5t7.5 -16.5q36 5 74.5 7t73.5 2t69 -1.5t64 -4t56.5 -5.5t48 -6.5t36.5 -6 t25 -4.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1173 473q0 50 -19.5 91.5t-48.5 68.5t-73 49t-82.5 34t-87.5 23l-104 24q-30 7 -44 10.5t-35 11.5t-30 16t-16.5 21t-7.5 30q0 77 144 77q43 0 77 -12t54 -28.5t38 -33.5t40 -29t48 -12q47 0 75.5 32t28.5 77q0 55 -56 99.5t-142 67.5t-182 23q-68 0 -132 -15.5 t-119.5 -47t-89 -87t-33.5 -128.5q0 -61 19 -106.5t56 -75.5t80 -48.5t103 -32.5l146 -36q90 -22 112 -36q32 -20 32 -60q0 -39 -40 -64.5t-105 -25.5q-51 0 -91.5 16t-65 38.5t-45.5 45t-46 38.5t-54 16q-50 0 -75.5 -30t-25.5 -75q0 -92 122 -157.5t291 -65.5 q73 0 140 18.5t122.5 53.5t88.5 93.5t33 131.5zM1536 256q0 -159 -112.5 -271.5t-271.5 -112.5q-130 0 -234 80q-77 -16 -150 -16q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5q0 73 16 150q-80 104 -80 234q0 159 112.5 271.5t271.5 112.5q130 0 234 -80 q77 16 150 16q143 0 273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -73 -16 -150q80 -104 80 -234z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1000 1102l37 194q5 23 -9 40t-35 17h-712q-23 0 -38.5 -17t-15.5 -37v-1101q0 -7 6 -1l291 352q23 26 38 33.5t48 7.5h239q22 0 37 14.5t18 29.5q24 130 37 191q4 21 -11.5 40t-36.5 19h-294q-29 0 -48 19t-19 48v42q0 29 19 47.5t48 18.5h346q18 0 35 13.5t20 29.5z M1227 1324q-15 -73 -53.5 -266.5t-69.5 -350t-35 -173.5q-6 -22 -9 -32.5t-14 -32.5t-24.5 -33t-38.5 -21t-58 -10h-271q-13 0 -22 -10q-8 -9 -426 -494q-22 -25 -58.5 -28.5t-48.5 5.5q-55 22 -55 98v1410q0 55 38 102.5t120 47.5h888q95 0 127 -53t10 -159zM1227 1324 l-158 -790q4 17 35 173.5t69.5 350t53.5 266.5z" /> +<glyph unicode="" d="M704 192v1024q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-1024q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1376 576v640q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-640q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408 q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1280 480q0 -40 -28 -68t-68 -28q-51 0 -80 43l-227 341h-45v-132l247 -411q9 -15 9 -33q0 -26 -19 -45t-45 -19h-192v-272q0 -46 -33 -79t-79 -33h-160q-46 0 -79 33t-33 79v272h-192q-26 0 -45 19t-19 45q0 18 9 33l247 411v132h-45l-227 -341q-29 -43 -80 -43 q-40 0 -68 28t-28 68q0 29 16 53l256 384q73 107 176 107h384q103 0 176 -107l256 -384q16 -24 16 -53zM864 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" /> +<glyph unicode="" horiz-adv-x="1024" d="M1024 832v-416q0 -40 -28 -68t-68 -28t-68 28t-28 68v352h-64v-912q0 -46 -33 -79t-79 -33t-79 33t-33 79v464h-64v-464q0 -46 -33 -79t-79 -33t-79 33t-33 79v912h-64v-352q0 -40 -28 -68t-68 -28t-68 28t-28 68v416q0 80 56 136t136 56h640q80 0 136 -56t56 -136z M736 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" /> +<glyph unicode="" d="M773 234l350 473q16 22 24.5 59t-6 85t-61.5 79q-40 26 -83 25.5t-73.5 -17.5t-54.5 -45q-36 -40 -96 -40q-59 0 -95 40q-24 28 -54.5 45t-73.5 17.5t-84 -25.5q-46 -31 -60.5 -79t-6 -85t24.5 -59zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1472 640q0 117 -45.5 223.5t-123 184t-184 123t-223.5 45.5t-223.5 -45.5t-184 -123t-123 -184t-45.5 -223.5t45.5 -223.5t123 -184t184 -123t223.5 -45.5t223.5 45.5t184 123t123 184t45.5 223.5zM1748 363q-4 -15 -20 -20l-292 -96v-306q0 -16 -13 -26q-15 -10 -29 -4 l-292 94l-180 -248q-10 -13 -26 -13t-26 13l-180 248l-292 -94q-14 -6 -29 4q-13 10 -13 26v306l-292 96q-16 5 -20 20q-5 17 4 29l180 248l-180 248q-9 13 -4 29q4 15 20 20l292 96v306q0 16 13 26q15 10 29 4l292 -94l180 248q9 12 26 12t26 -12l180 -248l292 94 q14 6 29 -4q13 -10 13 -26v-306l292 -96q16 -5 20 -20q5 -16 -4 -29l-180 -248l180 -248q9 -12 4 -29z" /> +<glyph unicode="" d="M1262 233q-54 -9 -110 -9q-182 0 -337 90t-245 245t-90 337q0 192 104 357q-201 -60 -328.5 -229t-127.5 -384q0 -130 51 -248.5t136.5 -204t204 -136.5t248.5 -51q144 0 273.5 61.5t220.5 171.5zM1465 318q-94 -203 -283.5 -324.5t-413.5 -121.5q-156 0 -298 61 t-245 164t-164 245t-61 298q0 153 57.5 292.5t156 241.5t235.5 164.5t290 68.5q44 2 61 -39q18 -41 -15 -72q-86 -78 -131.5 -181.5t-45.5 -218.5q0 -148 73 -273t198 -198t273 -73q118 0 228 51q41 18 72 -13q14 -14 17.5 -34t-4.5 -38z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1088 704q0 26 -19 45t-45 19h-256q-26 0 -45 -19t-19 -45t19 -45t45 -19h256q26 0 45 19t19 45zM1664 896v-960q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v960q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1728 1344v-256q0 -26 -19 -45t-45 -19h-1536 q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1536q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1632 576q0 -26 -19 -45t-45 -19h-224q0 -171 -67 -290l208 -209q19 -19 19 -45t-19 -45q-18 -19 -45 -19t-45 19l-198 197q-5 -5 -15 -13t-42 -28.5t-65 -36.5t-82 -29t-97 -13v896h-128v-896q-51 0 -101.5 13.5t-87 33t-66 39t-43.5 32.5l-15 14l-183 -207 q-20 -21 -48 -21q-24 0 -43 16q-19 18 -20.5 44.5t15.5 46.5l202 227q-58 114 -58 274h-224q-26 0 -45 19t-19 45t19 45t45 19h224v294l-173 173q-19 19 -19 45t19 45t45 19t45 -19l173 -173h844l173 173q19 19 45 19t45 -19t19 -45t-19 -45l-173 -173v-294h224q26 0 45 -19 t19 -45zM1152 1152h-640q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1917 1016q23 -64 -150 -294q-24 -32 -65 -85q-78 -100 -90 -131q-17 -41 14 -81q17 -21 81 -82h1l1 -1l1 -1l2 -2q141 -131 191 -221q3 -5 6.5 -12.5t7 -26.5t-0.5 -34t-25 -27.5t-59 -12.5l-256 -4q-24 -5 -56 5t-52 22l-20 12q-30 21 -70 64t-68.5 77.5t-61 58 t-56.5 15.5q-3 -1 -8 -3.5t-17 -14.5t-21.5 -29.5t-17 -52t-6.5 -77.5q0 -15 -3.5 -27.5t-7.5 -18.5l-4 -5q-18 -19 -53 -22h-115q-71 -4 -146 16.5t-131.5 53t-103 66t-70.5 57.5l-25 24q-10 10 -27.5 30t-71.5 91t-106 151t-122.5 211t-130.5 272q-6 16 -6 27t3 16l4 6 q15 19 57 19l274 2q12 -2 23 -6.5t16 -8.5l5 -3q16 -11 24 -32q20 -50 46 -103.5t41 -81.5l16 -29q29 -60 56 -104t48.5 -68.5t41.5 -38.5t34 -14t27 5q2 1 5 5t12 22t13.5 47t9.5 81t0 125q-2 40 -9 73t-14 46l-6 12q-25 34 -85 43q-13 2 5 24q17 19 38 30q53 26 239 24 q82 -1 135 -13q20 -5 33.5 -13.5t20.5 -24t10.5 -32t3.5 -45.5t-1 -55t-2.5 -70.5t-1.5 -82.5q0 -11 -1 -42t-0.5 -48t3.5 -40.5t11.5 -39t22.5 -24.5q8 -2 17 -4t26 11t38 34.5t52 67t68 107.5q60 104 107 225q4 10 10 17.5t11 10.5l4 3l5 2.5t13 3t20 0.5l288 2 q39 5 64 -2.5t31 -16.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M675 252q21 34 11 69t-45 50q-34 14 -73 1t-60 -46q-22 -34 -13 -68.5t43 -50.5t74.5 -2.5t62.5 47.5zM769 373q8 13 3.5 26.5t-17.5 18.5q-14 5 -28.5 -0.5t-21.5 -18.5q-17 -31 13 -45q14 -5 29 0.5t22 18.5zM943 266q-45 -102 -158 -150t-224 -12 q-107 34 -147.5 126.5t6.5 187.5q47 93 151.5 139t210.5 19q111 -29 158.5 -119.5t2.5 -190.5zM1255 426q-9 96 -89 170t-208.5 109t-274.5 21q-223 -23 -369.5 -141.5t-132.5 -264.5q9 -96 89 -170t208.5 -109t274.5 -21q223 23 369.5 141.5t132.5 264.5zM1563 422 q0 -68 -37 -139.5t-109 -137t-168.5 -117.5t-226 -83t-270.5 -31t-275 33.5t-240.5 93t-171.5 151t-65 199.5q0 115 69.5 245t197.5 258q169 169 341.5 236t246.5 -7q65 -64 20 -209q-4 -14 -1 -20t10 -7t14.5 0.5t13.5 3.5l6 2q139 59 246 59t153 -61q45 -63 0 -178 q-2 -13 -4.5 -20t4.5 -12.5t12 -7.5t17 -6q57 -18 103 -47t80 -81.5t34 -116.5zM1489 1046q42 -47 54.5 -108.5t-6.5 -117.5q-8 -23 -29.5 -34t-44.5 -4q-23 8 -34 29.5t-4 44.5q20 63 -24 111t-107 35q-24 -5 -45 8t-25 37q-5 24 8 44.5t37 25.5q60 13 119 -5.5t101 -65.5z M1670 1209q87 -96 112.5 -222.5t-13.5 -241.5q-9 -27 -34 -40t-52 -4t-40 34t-5 52q28 82 10 172t-80 158q-62 69 -148 95.5t-173 8.5q-28 -6 -52 9.5t-30 43.5t9.5 51.5t43.5 29.5q123 26 244 -11.5t208 -134.5z" /> +<glyph unicode="" d="M1133 -34q-171 -94 -368 -94q-196 0 -367 94q138 87 235.5 211t131.5 268q35 -144 132.5 -268t235.5 -211zM638 1394v-485q0 -252 -126.5 -459.5t-330.5 -306.5q-181 215 -181 495q0 187 83.5 349.5t229.5 269.5t325 137zM1536 638q0 -280 -181 -495 q-204 99 -330.5 306.5t-126.5 459.5v485q179 -30 325 -137t229.5 -269.5t83.5 -349.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1402 433q-32 -80 -76 -138t-91 -88.5t-99 -46.5t-101.5 -14.5t-96.5 8.5t-86.5 22t-69.5 27.5t-46 22.5l-17 10q-113 -228 -289.5 -359.5t-384.5 -132.5q-19 0 -32 13t-13 32t13 31.5t32 12.5q173 1 322.5 107.5t251.5 294.5q-36 -14 -72 -23t-83 -13t-91 2.5t-93 28.5 t-92 59t-84.5 100t-74.5 146q114 47 214 57t167.5 -7.5t124.5 -56.5t88.5 -77t56.5 -82q53 131 79 291q-7 -1 -18 -2.5t-46.5 -2.5t-69.5 0.5t-81.5 10t-88.5 23t-84 42.5t-75 65t-54.5 94.5t-28.5 127.5q70 28 133.5 36.5t112.5 -1t92 -30t73.5 -50t56 -61t42 -63t27.5 -56 t16 -39.5l4 -16q12 122 12 195q-8 6 -21.5 16t-49 44.5t-63.5 71.5t-54 93t-33 112.5t12 127t70 138.5q73 -25 127.5 -61.5t84.5 -76.5t48 -85t20.5 -89t-0.5 -85.5t-13 -76.5t-19 -62t-17 -42l-7 -15q1 -5 1 -50.5t-1 -71.5q3 7 10 18.5t30.5 43t50.5 58t71 55.5t91.5 44.5 t112 14.5t132.5 -24q-2 -78 -21.5 -141.5t-50 -104.5t-69.5 -71.5t-81.5 -45.5t-84.5 -24t-80 -9.5t-67.5 1t-46.5 4.5l-17 3q-23 -147 -73 -283q6 7 18 18.5t49.5 41t77.5 52.5t99.5 42t117.5 20t129 -23.5t137 -77.5z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1259 283v-66q0 -85 -57.5 -144.5t-138.5 -59.5h-57l-260 -269v269h-529q-81 0 -138.5 59.5t-57.5 144.5v66h1238zM1259 609v-255h-1238v255h1238zM1259 937v-255h-1238v255h1238zM1259 1077v-67h-1238v67q0 84 57.5 143.5t138.5 59.5h846q81 0 138.5 -59.5t57.5 -143.5z " /> +<glyph unicode="" d="M1152 640q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192h-352q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h352v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198 t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1152 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-352v-192q0 -14 -9 -23t-23 -9q-12 0 -24 10l-319 319q-9 9 -9 23t9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h352q13 0 22.5 -9.5t9.5 -22.5zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198 t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1024 960v-640q0 -26 -19 -45t-45 -19q-20 0 -37 12l-448 320q-27 19 -27 52t27 52l448 320q17 12 37 12q26 0 45 -19t19 -45zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5z M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5 t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1023 349l102 -204q-58 -179 -210 -290t-339 -111q-156 0 -288.5 77.5t-210 210t-77.5 288.5q0 181 104.5 330t274.5 211l17 -131q-122 -54 -195 -165.5t-73 -244.5q0 -185 131.5 -316.5t316.5 -131.5q126 0 232.5 65t165 175.5t49.5 236.5zM1571 249l58 -114l-256 -128 q-13 -7 -29 -7q-40 0 -57 35l-239 477h-472q-24 0 -42.5 16.5t-21.5 40.5l-96 779q-2 16 6 42q14 51 57 82.5t97 31.5q66 0 113 -47t47 -113q0 -69 -52 -117.5t-120 -41.5l37 -289h423v-128h-407l16 -128h455q40 0 57 -35l228 -455z" /> +<glyph unicode="" d="M1292 898q10 216 -161 222q-231 8 -312 -261q44 19 82 19q85 0 74 -96q-4 -57 -74 -167t-105 -110q-43 0 -82 169q-13 54 -45 255q-30 189 -160 177q-59 -7 -164 -100l-81 -72l-81 -72l52 -67q76 52 87 52q57 0 107 -179q15 -55 45 -164.5t45 -164.5q68 -179 164 -179 q157 0 383 294q220 283 226 444zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1152" d="M1152 704q0 -191 -94.5 -353t-256.5 -256.5t-353 -94.5h-160q-14 0 -23 9t-9 23v611l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v93l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v250q0 14 9 23t23 9h160 q14 0 23 -9t9 -23v-181l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-93l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-487q188 13 318 151t130 328q0 14 9 23t23 9h160q14 0 23 -9t9 -23z" /> +<glyph unicode="" horiz-adv-x="1408" d="M1152 736v-64q0 -14 -9 -23t-23 -9h-352v-352q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v352h-352q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h352v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-352h352q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832 q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="2176" d="M620 416q-110 -64 -268 -64h-128v64h-64q-13 0 -22.5 23.5t-9.5 56.5q0 24 7 49q-58 2 -96.5 10.5t-38.5 20.5t38.5 20.5t96.5 10.5q-7 25 -7 49q0 33 9.5 56.5t22.5 23.5h64v64h128q158 0 268 -64h1113q42 -7 106.5 -18t80.5 -14q89 -15 150 -40.5t83.5 -47.5t22.5 -40 t-22.5 -40t-83.5 -47.5t-150 -40.5q-16 -3 -80.5 -14t-106.5 -18h-1113zM1739 668q53 -36 53 -92t-53 -92l81 -30q68 48 68 122t-68 122zM625 400h1015q-217 -38 -456 -80q-57 0 -113 -24t-83 -48l-28 -24l-288 -288q-26 -26 -70.5 -45t-89.5 -19h-96l-93 464h29 q157 0 273 64zM352 816h-29l93 464h96q46 0 90 -19t70 -45l288 -288q4 -4 11 -10.5t30.5 -23t48.5 -29t61.5 -23t72.5 -10.5l456 -80h-1015q-116 64 -273 64z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1519 760q62 0 103.5 -40.5t41.5 -101.5q0 -97 -93 -130l-172 -59l56 -167q7 -21 7 -47q0 -59 -42 -102t-101 -43q-47 0 -85.5 27t-53.5 72l-55 165l-310 -106l55 -164q8 -24 8 -47q0 -59 -42 -102t-102 -43q-47 0 -85 27t-53 72l-55 163l-153 -53q-29 -9 -50 -9 q-61 0 -101.5 40t-40.5 101q0 47 27.5 85t71.5 53l156 53l-105 313l-156 -54q-26 -8 -48 -8q-60 0 -101 40.5t-41 100.5q0 47 27.5 85t71.5 53l157 53l-53 159q-8 24 -8 47q0 60 42 102.5t102 42.5q47 0 85 -27t53 -72l54 -160l310 105l-54 160q-8 24 -8 47q0 59 42.5 102 t101.5 43q47 0 85.5 -27.5t53.5 -71.5l53 -161l162 55q21 6 43 6q60 0 102.5 -39.5t42.5 -98.5q0 -45 -30 -81.5t-74 -51.5l-157 -54l105 -316l164 56q24 8 46 8zM725 498l310 105l-105 315l-310 -107z" /> +<glyph unicode="" d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM1280 352v436q-31 -35 -64 -55q-34 -22 -132.5 -85t-151.5 -99q-98 -69 -164 -69v0v0q-66 0 -164 69 q-46 32 -141.5 92.5t-142.5 92.5q-12 8 -33 27t-31 27v-436q0 -40 28 -68t68 -28h832q40 0 68 28t28 68zM1280 925q0 41 -27.5 70t-68.5 29h-832q-40 0 -68 -28t-28 -68q0 -37 30.5 -76.5t67.5 -64.5q47 -32 137.5 -89t129.5 -83q3 -2 17 -11.5t21 -14t21 -13t23.5 -13 t21.5 -9.5t22.5 -7.5t20.5 -2.5t20.5 2.5t22.5 7.5t21.5 9.5t23.5 13t21 13t21 14t17 11.5l267 174q35 23 66.5 62.5t31.5 73.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M127 640q0 163 67 313l367 -1005q-196 95 -315 281t-119 411zM1415 679q0 -19 -2.5 -38.5t-10 -49.5t-11.5 -44t-17.5 -59t-17.5 -58l-76 -256l-278 826q46 3 88 8q19 2 26 18.5t-2.5 31t-28.5 13.5l-205 -10q-75 1 -202 10q-12 1 -20.5 -5t-11.5 -15t-1.5 -18.5t9 -16.5 t19.5 -8l80 -8l120 -328l-168 -504l-280 832q46 3 88 8q19 2 26 18.5t-2.5 31t-28.5 13.5l-205 -10q-7 0 -23 0.5t-26 0.5q105 160 274.5 253.5t367.5 93.5q147 0 280.5 -53t238.5 -149h-10q-55 0 -92 -40.5t-37 -95.5q0 -12 2 -24t4 -21.5t8 -23t9 -21t12 -22.5t12.5 -21 t14.5 -24t14 -23q63 -107 63 -212zM909 573l237 -647q1 -6 5 -11q-126 -44 -255 -44q-112 0 -217 32zM1570 1009q95 -174 95 -369q0 -209 -104 -385.5t-279 -278.5l235 678q59 169 59 276q0 42 -6 79zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286 t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM896 -215q173 0 331.5 68t273 182.5t182.5 273t68 331.5t-68 331.5t-182.5 273t-273 182.5t-331.5 68t-331.5 -68t-273 -182.5t-182.5 -273t-68 -331.5t68 -331.5t182.5 -273 t273 -182.5t331.5 -68z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1086 1536v-1536l-272 -128q-228 20 -414 102t-293 208.5t-107 272.5q0 140 100.5 263.5t275 205.5t391.5 108v-172q-217 -38 -356.5 -150t-139.5 -255q0 -152 154.5 -267t388.5 -145v1360zM1755 954l37 -390l-525 114l147 83q-119 70 -280 99v172q277 -33 481 -157z" /> +<glyph unicode="" horiz-adv-x="2048" d="M960 1536l960 -384v-128h-128q0 -26 -20.5 -45t-48.5 -19h-1526q-28 0 -48.5 19t-20.5 45h-128v128zM256 896h256v-768h128v768h256v-768h128v768h256v-768h128v768h256v-768h59q28 0 48.5 -19t20.5 -45v-64h-1664v64q0 26 20.5 45t48.5 19h59v768zM1851 -64 q28 0 48.5 -19t20.5 -45v-128h-1920v128q0 26 20.5 45t48.5 19h1782z" /> +<glyph unicode="" horiz-adv-x="2304" d="M1774 700l18 -316q4 -69 -82 -128t-235 -93.5t-323 -34.5t-323 34.5t-235 93.5t-82 128l18 316l574 -181q22 -7 48 -7t48 7zM2304 1024q0 -23 -22 -31l-1120 -352q-4 -1 -10 -1t-10 1l-652 206q-43 -34 -71 -111.5t-34 -178.5q63 -36 63 -109q0 -69 -58 -107l58 -433 q2 -14 -8 -25q-9 -11 -24 -11h-192q-15 0 -24 11q-10 11 -8 25l58 433q-58 38 -58 107q0 73 65 111q11 207 98 330l-333 104q-22 8 -22 31t22 31l1120 352q4 1 10 1t10 -1l1120 -352q22 -8 22 -31z" /> +<glyph unicode="" d="M859 579l13 -707q-62 11 -105 11q-41 0 -105 -11l13 707q-40 69 -168.5 295.5t-216.5 374.5t-181 287q58 -15 108 -15q43 0 111 15q63 -111 133.5 -229.5t167 -276.5t138.5 -227q37 61 109.5 177.5t117.5 190t105 176t107 189.5q54 -14 107 -14q56 0 114 14v0 q-28 -39 -60 -88.5t-49.5 -78.5t-56.5 -96t-49 -84q-146 -248 -353 -610z" /> +<glyph unicode="" d="M768 750h725q12 -67 12 -128q0 -217 -91 -387.5t-259.5 -266.5t-386.5 -96q-157 0 -299 60.5t-245 163.5t-163.5 245t-60.5 299t60.5 299t163.5 245t245 163.5t299 60.5q300 0 515 -201l-209 -201q-123 119 -306 119q-129 0 -238.5 -65t-173.5 -176.5t-64 -243.5 t64 -243.5t173.5 -176.5t238.5 -65q87 0 160 24t120 60t82 82t51.5 87t22.5 78h-436v264z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1095 369q16 -16 0 -31q-62 -62 -199 -62t-199 62q-16 15 0 31q6 6 15 6t15 -6q48 -49 169 -49q120 0 169 49q6 6 15 6t15 -6zM788 550q0 -37 -26 -63t-63 -26t-63.5 26t-26.5 63q0 38 26.5 64t63.5 26t63 -26.5t26 -63.5zM1183 550q0 -37 -26.5 -63t-63.5 -26t-63 26 t-26 63t26 63.5t63 26.5t63.5 -26t26.5 -64zM1434 670q0 49 -35 84t-85 35t-86 -36q-130 90 -311 96l63 283l200 -45q0 -37 26 -63t63 -26t63.5 26.5t26.5 63.5t-26.5 63.5t-63.5 26.5q-54 0 -80 -50l-221 49q-19 5 -25 -16l-69 -312q-180 -7 -309 -97q-35 37 -87 37 q-50 0 -85 -35t-35 -84q0 -35 18.5 -64t49.5 -44q-6 -27 -6 -56q0 -142 140 -243t337 -101q198 0 338 101t140 243q0 32 -7 57q30 15 48 43.5t18 63.5zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191 t348 71t348 -71t286 -191t191 -286t71 -348z" /> +<glyph unicode="" d="M939 407q13 -13 0 -26q-53 -53 -171 -53t-171 53q-13 13 0 26q5 6 13 6t13 -6q42 -42 145 -42t145 42q5 6 13 6t13 -6zM676 563q0 -31 -23 -54t-54 -23t-54 23t-23 54q0 32 22.5 54.5t54.5 22.5t54.5 -22.5t22.5 -54.5zM1014 563q0 -31 -23 -54t-54 -23t-54 23t-23 54 q0 32 22.5 54.5t54.5 22.5t54.5 -22.5t22.5 -54.5zM1229 666q0 42 -30 72t-73 30q-42 0 -73 -31q-113 78 -267 82l54 243l171 -39q1 -32 23.5 -54t53.5 -22q32 0 54.5 22.5t22.5 54.5t-22.5 54.5t-54.5 22.5q-48 0 -69 -43l-189 42q-17 5 -21 -13l-60 -268q-154 -6 -265 -83 q-30 32 -74 32q-43 0 -73 -30t-30 -72q0 -30 16 -55t42 -38q-5 -25 -5 -48q0 -122 120 -208.5t289 -86.5q170 0 290 86.5t120 208.5q0 25 -6 49q25 13 40.5 37.5t15.5 54.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960 q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" d="M866 697l90 27v62q0 79 -58 135t-138 56t-138 -55.5t-58 -134.5v-283q0 -20 -14 -33.5t-33 -13.5t-32.5 13.5t-13.5 33.5v120h-151v-122q0 -82 57.5 -139t139.5 -57q81 0 138.5 56.5t57.5 136.5v280q0 19 13.5 33t33.5 14q19 0 32.5 -14t13.5 -33v-54zM1199 502v122h-150 v-126q0 -20 -13.5 -33.5t-33.5 -13.5q-19 0 -32.5 14t-13.5 33v123l-90 -26l-60 28v-123q0 -80 58 -137t139 -57t138.5 57t57.5 139zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103 t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1062 824v118q0 42 -30 72t-72 30t-72 -30t-30 -72v-612q0 -175 -126 -299t-303 -124q-178 0 -303.5 125.5t-125.5 303.5v266h328v-262q0 -43 30 -72.5t72 -29.5t72 29.5t30 72.5v620q0 171 126.5 292t301.5 121q176 0 302 -122t126 -294v-136l-195 -58zM1592 602h328 v-266q0 -178 -125.5 -303.5t-303.5 -125.5q-177 0 -303 124.5t-126 300.5v268l131 -61l195 58v-270q0 -42 30 -71.5t72 -29.5t72 29.5t30 71.5v275z" /> +<glyph unicode="" d="M1472 160v480h-704v704h-480q-93 0 -158.5 -65.5t-65.5 -158.5v-480h704v-704h480q93 0 158.5 65.5t65.5 158.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5 t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="2048" d="M328 1254h204v-983h-532v697h328v286zM328 435v369h-123v-369h123zM614 968v-697h205v697h-205zM614 1254v-204h205v204h-205zM901 968h533v-942h-533v163h328v82h-328v697zM1229 435v369h-123v-369h123zM1516 968h532v-942h-532v163h327v82h-327v697zM1843 435v369h-123 v-369h123z" /> +<glyph unicode="" d="M1046 516q0 -64 -38 -109t-91 -45q-43 0 -70 15v277q28 17 70 17q53 0 91 -45.5t38 -109.5zM703 944q0 -64 -38 -109.5t-91 -45.5q-43 0 -70 15v277q28 17 70 17q53 0 91 -45t38 -109zM1265 513q0 134 -88 229t-213 95q-20 0 -39 -3q-23 -78 -78 -136q-87 -95 -211 -101 v-636l211 41v206q51 -19 117 -19q125 0 213 95t88 229zM922 940q0 134 -88.5 229t-213.5 95q-74 0 -141 -36h-186v-840l211 41v206q55 -19 116 -19q125 0 213.5 95t88.5 229zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960 q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="2038" d="M1222 607q75 3 143.5 -20.5t118 -58.5t101 -94.5t84 -108t75.5 -120.5q33 -56 78.5 -109t75.5 -80.5t99 -88.5q-48 -30 -108.5 -57.5t-138.5 -59t-114 -47.5q-44 37 -74 115t-43.5 164.5t-33 180.5t-42.5 168.5t-72.5 123t-122.5 48.5l-10 -2l-6 -4q4 -5 13 -14 q6 -5 28 -23.5t25.5 -22t19 -18t18 -20.5t11.5 -21t10.5 -27.5t4.5 -31t4 -40.5l1 -33q1 -26 -2.5 -57.5t-7.5 -52t-12.5 -58.5t-11.5 -53q-35 1 -101 -9.5t-98 -10.5q-39 0 -72 10q-2 16 -2 47q0 74 3 96q2 13 31.5 41.5t57 59t26.5 51.5q-24 2 -43 -24 q-36 -53 -111.5 -99.5t-136.5 -46.5q-25 0 -75.5 63t-106.5 139.5t-84 96.5q-6 4 -27 30q-482 -112 -513 -112q-16 0 -28 11t-12 27q0 15 8.5 26.5t22.5 14.5l486 106q-8 14 -8 25t5.5 17.5t16 11.5t20 7t23 4.5t18.5 4.5q4 1 15.5 7.5t17.5 6.5q15 0 28 -16t20 -33 q163 37 172 37q17 0 29.5 -11t12.5 -28q0 -15 -8.5 -26t-23.5 -14l-182 -40l-1 -16q-1 -26 81.5 -117.5t104.5 -91.5q47 0 119 80t72 129q0 36 -23.5 53t-51 18.5t-51 11.5t-23.5 34q0 16 10 34l-68 19q43 44 43 117q0 26 -5 58q82 16 144 16q44 0 71.5 -1.5t48.5 -8.5 t31 -13.5t20.5 -24.5t15.5 -33.5t17 -47.5t24 -60l50 25q-3 -40 -23 -60t-42.5 -21t-40 -6.5t-16.5 -20.5zM1282 842q-5 5 -13.5 15.5t-12 14.5t-10.5 11.5t-10 10.5l-8 8t-8.5 7.5t-8 5t-8.5 4.5q-7 3 -14.5 5t-20.5 2.5t-22 0.5h-32.5h-37.5q-126 0 -217 -43 q16 30 36 46.5t54 29.5t65.5 36t46 36.5t50 55t43.5 50.5q12 -9 28 -31.5t32 -36.5t38 -13l12 1v-76l22 -1q247 95 371 190q28 21 50 39t42.5 37.5t33 31t29.5 34t24 31t24.5 37t23 38t27 47.5t29.5 53l7 9q-2 -53 -43 -139q-79 -165 -205 -264t-306 -142q-14 -3 -42 -7.5 t-50 -9.5t-39 -14q3 -19 24.5 -46t21.5 -34q0 -11 -26 -30zM1061 -79q39 26 131.5 47.5t146.5 21.5q9 0 22.5 -15.5t28 -42.5t26 -50t24 -51t14.5 -33q-121 -45 -244 -45q-61 0 -125 11zM822 568l48 12l109 -177l-73 -48zM1323 51q3 -15 3 -16q0 -7 -17.5 -14.5t-46 -13 t-54 -9.5t-53.5 -7.5t-32 -4.5l-7 43q21 2 60.5 8.5t72 10t60.5 3.5h14zM866 679l-96 -20l-6 17q10 1 32.5 7t34.5 6q19 0 35 -10zM1061 45h31l10 -83l-41 -12v95zM1950 1535v1v-1zM1950 1535l-1 -5l-2 -2l1 3zM1950 1535l1 1z" /> +<glyph unicode="" d="M1167 -50q-5 19 -24 5q-30 -22 -87 -39t-131 -17q-129 0 -193 49q-5 4 -13 4q-11 0 -26 -12q-7 -6 -7.5 -16t7.5 -20q34 -32 87.5 -46t102.5 -12.5t99 4.5q41 4 84.5 20.5t65 30t28.5 20.5q12 12 7 29zM1128 65q-19 47 -39 61q-23 15 -76 15q-47 0 -71 -10 q-29 -12 -78 -56q-26 -24 -12 -44q9 -8 17.5 -4.5t31.5 23.5q3 2 10.5 8.5t10.5 8.5t10 7t11.5 7t12.5 5t15 4.5t16.5 2.5t20.5 1q27 0 44.5 -7.5t23 -14.5t13.5 -22q10 -17 12.5 -20t12.5 1q23 12 14 34zM1483 346q0 22 -5 44.5t-16.5 45t-34 36.5t-52.5 14 q-33 0 -97 -41.5t-129 -83.5t-101 -42q-27 -1 -63.5 19t-76 49t-83.5 58t-100 49t-111 19q-115 -1 -197 -78.5t-84 -178.5q-2 -112 74 -164q29 -20 62.5 -28.5t103.5 -8.5q57 0 132 32.5t134 71t120 70.5t93 31q26 -1 65 -31.5t71.5 -67t68 -67.5t55.5 -32q35 -3 58.5 14 t55.5 63q28 41 42.5 101t14.5 106zM1536 506q0 -164 -62 -304.5t-166 -236t-242.5 -149.5t-290.5 -54t-293 57.5t-247.5 157t-170.5 241.5t-64 302q0 89 19.5 172.5t49 145.5t70.5 118.5t78.5 94t78.5 69.5t64.5 46.5t42.5 24.5q14 8 51 26.5t54.5 28.5t48 30t60.5 44 q36 28 58 72.5t30 125.5q129 -155 186 -193q44 -29 130 -68t129 -66q21 -13 39 -25t60.5 -46.5t76 -70.5t75 -95t69 -122t47 -148.5t19.5 -177.5z" /> +<glyph unicode="" d="M1070 463l-160 -160l-151 -152l-30 -30q-65 -64 -151.5 -87t-171.5 -2q-16 -70 -72 -115t-129 -45q-85 0 -145 60.5t-60 145.5q0 72 44.5 128t113.5 72q-22 86 1 173t88 152l12 12l151 -152l-11 -11q-37 -37 -37 -89t37 -90q37 -37 89 -37t89 37l30 30l151 152l161 160z M729 1145l12 -12l-152 -152l-12 12q-37 37 -89 37t-89 -37t-37 -89.5t37 -89.5l29 -29l152 -152l160 -160l-151 -152l-161 160l-151 152l-30 30q-68 67 -90 159.5t5 179.5q-70 15 -115 71t-45 129q0 85 60 145.5t145 60.5q76 0 133.5 -49t69.5 -123q84 20 169.5 -3.5 t149.5 -87.5zM1536 78q0 -85 -60 -145.5t-145 -60.5q-74 0 -131 47t-71 118q-86 -28 -179.5 -6t-161.5 90l-11 12l151 152l12 -12q37 -37 89 -37t89 37t37 89t-37 89l-30 30l-152 152l-160 160l152 152l160 -160l152 -152l29 -30q64 -64 87.5 -150.5t2.5 -171.5 q76 -11 126.5 -68.5t50.5 -134.5zM1534 1202q0 -77 -51 -135t-127 -69q26 -85 3 -176.5t-90 -158.5l-12 -12l-151 152l12 12q37 37 37 89t-37 89t-89 37t-89 -37l-30 -30l-152 -152l-160 -160l-152 152l161 160l152 152l29 30q67 67 159 89.5t178 -3.5q11 75 68.5 126 t135.5 51q85 0 145 -60.5t60 -145.5z" /> +<glyph unicode="" d="M654 458q-1 -3 -12.5 0.5t-31.5 11.5l-20 9q-44 20 -87 49q-7 5 -41 31.5t-38 28.5q-67 -103 -134 -181q-81 -95 -105 -110q-4 -2 -19.5 -4t-18.5 0q6 4 82 92q21 24 85.5 115t78.5 118q17 30 51 98.5t36 77.5q-8 1 -110 -33q-8 -2 -27.5 -7.5t-34.5 -9.5t-17 -5 q-2 -2 -2 -10.5t-1 -9.5q-5 -10 -31 -15q-23 -7 -47 0q-18 4 -28 21q-4 6 -5 23q6 2 24.5 5t29.5 6q58 16 105 32q100 35 102 35q10 2 43 19.5t44 21.5q9 3 21.5 8t14.5 5.5t6 -0.5q2 -12 -1 -33q0 -2 -12.5 -27t-26.5 -53.5t-17 -33.5q-25 -50 -77 -131l64 -28 q12 -6 74.5 -32t67.5 -28q4 -1 10.5 -25.5t4.5 -30.5zM449 944q3 -15 -4 -28q-12 -23 -50 -38q-30 -12 -60 -12q-26 3 -49 26q-14 15 -18 41l1 3q3 -3 19.5 -5t26.5 0t58 16q36 12 55 14q17 0 21 -17zM1147 815l63 -227l-139 42zM39 15l694 232v1032l-694 -233v-1031z M1280 332l102 -31l-181 657l-100 31l-216 -536l102 -31l45 110l211 -65zM777 1294l573 -184v380zM1088 -29l158 -13l-54 -160l-40 66q-130 -83 -276 -108q-58 -12 -91 -12h-84q-79 0 -199.5 39t-183.5 85q-8 7 -8 16q0 8 5 13.5t13 5.5q4 0 18 -7.5t30.5 -16.5t20.5 -11 q73 -37 159.5 -61.5t157.5 -24.5q95 0 167 14.5t157 50.5q15 7 30.5 15.5t34 19t28.5 16.5zM1536 1050v-1079l-774 246q-14 -6 -375 -127.5t-368 -121.5q-13 0 -18 13q0 1 -1 3v1078q3 9 4 10q5 6 20 11q106 35 149 50v384l558 -198q2 0 160.5 55t316 108.5t161.5 53.5 q20 0 20 -21v-418z" /> +<glyph unicode="" horiz-adv-x="1792" d="M288 1152q66 0 113 -47t47 -113v-1088q0 -66 -47 -113t-113 -47h-128q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h128zM1664 989q58 -34 93 -93t35 -128v-768q0 -106 -75 -181t-181 -75h-864q-66 0 -113 47t-47 113v1536q0 40 28 68t68 28h672q40 0 88 -20t76 -48 l152 -152q28 -28 48 -76t20 -88v-163zM928 0v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM928 256v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM928 512v128q0 14 -9 23 t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1184 0v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1184 256v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128 q14 0 23 9t9 23zM1184 512v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1440 0v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1440 256v128q0 14 -9 23t-23 9h-128 q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1440 512v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1536 896v256h-160q-40 0 -68 28t-28 68v160h-640v-512h896z" /> +<glyph unicode="" d="M1344 1536q26 0 45 -19t19 -45v-1664q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h1280zM512 1248v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM512 992v-64q0 -14 9 -23t23 -9h64q14 0 23 9 t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM512 736v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM512 480v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM384 160v64 q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM384 416v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM384 672v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64 q14 0 23 9t9 23zM384 928v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM384 1184v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 -96v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9 t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM896 416v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 672v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 928v64 q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 1184v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 160v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64 q14 0 23 9t9 23zM1152 416v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 672v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 928v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9 t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 1184v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1188 988l-292 -292v-824q0 -46 -33 -79t-79 -33t-79 33t-33 79v384h-64v-384q0 -46 -33 -79t-79 -33t-79 33t-33 79v824l-292 292q-28 28 -28 68t28 68t68 28t68 -28l228 -228h368l228 228q28 28 68 28t68 -28t28 -68t-28 -68zM864 1152q0 -93 -65.5 -158.5 t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" /> +<glyph unicode="" horiz-adv-x="1664" d="M780 1064q0 -60 -19 -113.5t-63 -92.5t-105 -39q-76 0 -138 57.5t-92 135.5t-30 151q0 60 19 113.5t63 92.5t105 39q77 0 138.5 -57.5t91.5 -135t30 -151.5zM438 581q0 -80 -42 -139t-119 -59q-76 0 -141.5 55.5t-100.5 133.5t-35 152q0 80 42 139.5t119 59.5 q76 0 141.5 -55.5t100.5 -134t35 -152.5zM832 608q118 0 255 -97.5t229 -237t92 -254.5q0 -46 -17 -76.5t-48.5 -45t-64.5 -20t-76 -5.5q-68 0 -187.5 45t-182.5 45q-66 0 -192.5 -44.5t-200.5 -44.5q-183 0 -183 146q0 86 56 191.5t139.5 192.5t187.5 146t193 59zM1071 819 q-61 0 -105 39t-63 92.5t-19 113.5q0 74 30 151.5t91.5 135t138.5 57.5q61 0 105 -39t63 -92.5t19 -113.5q0 -73 -30 -151t-92 -135.5t-138 -57.5zM1503 923q77 0 119 -59.5t42 -139.5q0 -74 -35 -152t-100.5 -133.5t-141.5 -55.5q-77 0 -119 59t-42 139q0 74 35 152.5 t100.5 134t141.5 55.5z" /> +<glyph unicode="" horiz-adv-x="768" d="M704 1008q0 -145 -57 -243.5t-152 -135.5l45 -821q2 -26 -16 -45t-44 -19h-192q-26 0 -44 19t-16 45l45 821q-95 37 -152 135.5t-57 243.5q0 128 42.5 249.5t117.5 200t160 78.5t160 -78.5t117.5 -200t42.5 -249.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M896 -93l640 349v636l-640 -233v-752zM832 772l698 254l-698 254l-698 -254zM1664 1024v-768q0 -35 -18 -65t-49 -47l-704 -384q-28 -16 -61 -16t-61 16l-704 384q-31 17 -49 47t-18 65v768q0 40 23 73t61 47l704 256q22 8 44 8t44 -8l704 -256q38 -14 61 -47t23 -73z " /> +<glyph unicode="" horiz-adv-x="2304" d="M640 -96l384 192v314l-384 -164v-342zM576 358l404 173l-404 173l-404 -173zM1664 -96l384 192v314l-384 -164v-342zM1600 358l404 173l-404 173l-404 -173zM1152 651l384 165v266l-384 -164v-267zM1088 1030l441 189l-441 189l-441 -189zM2176 512v-416q0 -36 -19 -67 t-52 -47l-448 -224q-25 -14 -57 -14t-57 14l-448 224q-5 2 -7 4q-2 -2 -7 -4l-448 -224q-25 -14 -57 -14t-57 14l-448 224q-33 16 -52 47t-19 67v416q0 38 21.5 70t56.5 48l434 186v400q0 38 21.5 70t56.5 48l448 192q23 10 50 10t50 -10l448 -192q35 -16 56.5 -48t21.5 -70 v-400l434 -186q36 -16 57 -48t21 -70z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1848 1197h-511v-124h511v124zM1596 771q-90 0 -146 -52.5t-62 -142.5h408q-18 195 -200 195zM1612 186q63 0 122 32t76 87h221q-100 -307 -427 -307q-214 0 -340.5 132t-126.5 347q0 208 130.5 345.5t336.5 137.5q138 0 240.5 -68t153 -179t50.5 -248q0 -17 -2 -47h-658 q0 -111 57.5 -171.5t166.5 -60.5zM277 236h296q205 0 205 167q0 180 -199 180h-302v-347zM277 773h281q78 0 123.5 36.5t45.5 113.5q0 144 -190 144h-260v-294zM0 1282h594q87 0 155 -14t126.5 -47.5t90 -96.5t31.5 -154q0 -181 -172 -263q114 -32 172 -115t58 -204 q0 -75 -24.5 -136.5t-66 -103.5t-98.5 -71t-121 -42t-134 -13h-611v1260z" /> +<glyph unicode="" d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM499 1041h-371v-787h382q117 0 197 57.5t80 170.5q0 158 -143 200q107 52 107 164q0 57 -19.5 96.5 t-56.5 60.5t-79 29.5t-97 8.5zM477 723h-176v184h163q119 0 119 -90q0 -94 -106 -94zM486 388h-185v217h189q124 0 124 -113q0 -104 -128 -104zM1136 356q-68 0 -104 38t-36 107h411q1 10 1 30q0 132 -74.5 220.5t-203.5 88.5q-128 0 -210 -86t-82 -216q0 -135 79 -217 t213 -82q205 0 267 191h-138q-11 -34 -47.5 -54t-75.5 -20zM1126 722q113 0 124 -122h-254q4 56 39 89t91 33zM964 988h319v-77h-319v77z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1582 954q0 -101 -71.5 -172.5t-172.5 -71.5t-172.5 71.5t-71.5 172.5t71.5 172.5t172.5 71.5t172.5 -71.5t71.5 -172.5zM812 212q0 104 -73 177t-177 73q-27 0 -54 -6l104 -42q77 -31 109.5 -106.5t1.5 -151.5q-31 -77 -107 -109t-152 -1q-21 8 -62 24.5t-61 24.5 q32 -60 91 -96.5t130 -36.5q104 0 177 73t73 177zM1642 953q0 126 -89.5 215.5t-215.5 89.5q-127 0 -216.5 -89.5t-89.5 -215.5q0 -127 89.5 -216t216.5 -89q126 0 215.5 89t89.5 216zM1792 953q0 -189 -133.5 -322t-321.5 -133l-437 -319q-12 -129 -109 -218t-229 -89 q-121 0 -214 76t-118 192l-230 92v429l389 -157q79 48 173 48q13 0 35 -2l284 407q2 187 135.5 319t320.5 132q188 0 321.5 -133.5t133.5 -321.5z" /> +<glyph unicode="" d="M1242 889q0 80 -57 136.5t-137 56.5t-136.5 -57t-56.5 -136q0 -80 56.5 -136.5t136.5 -56.5t137 56.5t57 136.5zM632 301q0 -83 -58 -140.5t-140 -57.5q-56 0 -103 29t-72 77q52 -20 98 -40q60 -24 120 1.5t85 86.5q24 60 -1.5 120t-86.5 84l-82 33q22 5 42 5 q82 0 140 -57.5t58 -140.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v153l172 -69q20 -92 93.5 -152t168.5 -60q104 0 181 70t87 173l345 252q150 0 255.5 105.5t105.5 254.5q0 150 -105.5 255.5t-255.5 105.5 q-148 0 -253 -104.5t-107 -252.5l-225 -322q-9 1 -28 1q-75 0 -137 -37l-297 119v468q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5zM1289 887q0 -100 -71 -170.5t-171 -70.5t-170.5 70.5t-70.5 170.5t70.5 171t170.5 71q101 0 171.5 -70.5t70.5 -171.5z " /> +<glyph unicode="" horiz-adv-x="1792" d="M836 367l-15 -368l-2 -22l-420 29q-36 3 -67 31.5t-47 65.5q-11 27 -14.5 55t4 65t12 55t21.5 64t19 53q78 -12 509 -28zM449 953l180 -379l-147 92q-63 -72 -111.5 -144.5t-72.5 -125t-39.5 -94.5t-18.5 -63l-4 -21l-190 357q-17 26 -18 56t6 47l8 18q35 63 114 188 l-140 86zM1680 436l-188 -359q-12 -29 -36.5 -46.5t-43.5 -20.5l-18 -4q-71 -7 -219 -12l8 -164l-230 367l211 362l7 -173q170 -16 283 -5t170 33zM895 1360q-47 -63 -265 -435l-317 187l-19 12l225 356q20 31 60 45t80 10q24 -2 48.5 -12t42 -21t41.5 -33t36 -34.5 t36 -39.5t32 -35zM1550 1053l212 -363q18 -37 12.5 -76t-27.5 -74q-13 -20 -33 -37t-38 -28t-48.5 -22t-47 -16t-51.5 -14t-46 -12q-34 72 -265 436l313 195zM1407 1279l142 83l-220 -373l-419 20l151 86q-34 89 -75 166t-75.5 123.5t-64.5 80t-47 46.5l-17 13l405 -1 q31 3 58 -10.5t39 -28.5l11 -15q39 -61 112 -190z" /> +<glyph unicode="" horiz-adv-x="2048" d="M480 448q0 66 -47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47t113 47t47 113zM516 768h1016l-89 357q-2 8 -14 17.5t-21 9.5h-768q-9 0 -21 -9.5t-14 -17.5zM1888 448q0 66 -47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47t113 47t47 113zM2048 544v-384 q0 -14 -9 -23t-23 -9h-96v-128q0 -80 -56 -136t-136 -56t-136 56t-56 136v128h-1024v-128q0 -80 -56 -136t-136 -56t-136 56t-56 136v128h-96q-14 0 -23 9t-9 23v384q0 93 65.5 158.5t158.5 65.5h28l105 419q23 94 104 157.5t179 63.5h768q98 0 179 -63.5t104 -157.5 l105 -419h28q93 0 158.5 -65.5t65.5 -158.5z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1824 640q93 0 158.5 -65.5t65.5 -158.5v-384q0 -14 -9 -23t-23 -9h-96v-64q0 -80 -56 -136t-136 -56t-136 56t-56 136v64h-1024v-64q0 -80 -56 -136t-136 -56t-136 56t-56 136v64h-96q-14 0 -23 9t-9 23v384q0 93 65.5 158.5t158.5 65.5h28l105 419q23 94 104 157.5 t179 63.5h128v224q0 14 9 23t23 9h448q14 0 23 -9t9 -23v-224h128q98 0 179 -63.5t104 -157.5l105 -419h28zM320 160q66 0 113 47t47 113t-47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47zM516 640h1016l-89 357q-2 8 -14 17.5t-21 9.5h-768q-9 0 -21 -9.5t-14 -17.5z M1728 160q66 0 113 47t47 113t-47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47z" /> +<glyph unicode="" d="M1504 64q0 -26 -19 -45t-45 -19h-462q1 -17 6 -87.5t5 -108.5q0 -25 -18 -42.5t-43 -17.5h-320q-25 0 -43 17.5t-18 42.5q0 38 5 108.5t6 87.5h-462q-26 0 -45 19t-19 45t19 45l402 403h-229q-26 0 -45 19t-19 45t19 45l402 403h-197q-26 0 -45 19t-19 45t19 45l384 384 q19 19 45 19t45 -19l384 -384q19 -19 19 -45t-19 -45t-45 -19h-197l402 -403q19 -19 19 -45t-19 -45t-45 -19h-229l402 -403q19 -19 19 -45z" /> +<glyph unicode="" d="M1127 326q0 32 -30 51q-193 115 -447 115q-133 0 -287 -34q-42 -9 -42 -52q0 -20 13.5 -34.5t35.5 -14.5q5 0 37 8q132 27 243 27q226 0 397 -103q19 -11 33 -11q19 0 33 13.5t14 34.5zM1223 541q0 40 -35 61q-237 141 -548 141q-153 0 -303 -42q-48 -13 -48 -64 q0 -25 17.5 -42.5t42.5 -17.5q7 0 37 8q122 33 251 33q279 0 488 -124q24 -13 38 -13q25 0 42.5 17.5t17.5 42.5zM1331 789q0 47 -40 70q-126 73 -293 110.5t-343 37.5q-204 0 -364 -47q-23 -7 -38.5 -25.5t-15.5 -48.5q0 -31 20.5 -52t51.5 -21q11 0 40 8q133 37 307 37 q159 0 309.5 -34t253.5 -95q21 -12 40 -12q29 0 50.5 20.5t21.5 51.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1024" d="M1024 1233l-303 -582l24 -31h279v-415h-507l-44 -30l-142 -273l-30 -30h-301v303l303 583l-24 30h-279v415h507l44 30l142 273l30 30h301v-303z" /> +<glyph unicode="" horiz-adv-x="2304" d="M784 164l16 241l-16 523q-1 10 -7.5 17t-16.5 7q-9 0 -16 -7t-7 -17l-14 -523l14 -241q1 -10 7.5 -16.5t15.5 -6.5q22 0 24 23zM1080 193l11 211l-12 586q0 16 -13 24q-8 5 -16 5t-16 -5q-13 -8 -13 -24l-1 -6l-10 -579q0 -1 11 -236v-1q0 -10 6 -17q9 -11 23 -11 q11 0 20 9q9 7 9 20zM35 533l20 -128l-20 -126q-2 -9 -9 -9t-9 9l-17 126l17 128q2 9 9 9t9 -9zM121 612l26 -207l-26 -203q-2 -9 -10 -9q-9 0 -9 10l-23 202l23 207q0 9 9 9q8 0 10 -9zM401 159zM213 650l25 -245l-25 -237q0 -11 -11 -11q-10 0 -12 11l-21 237l21 245 q2 12 12 12q11 0 11 -12zM307 657l23 -252l-23 -244q-2 -13 -14 -13q-13 0 -13 13l-21 244l21 252q0 13 13 13q12 0 14 -13zM401 639l21 -234l-21 -246q-2 -16 -16 -16q-6 0 -10.5 4.5t-4.5 11.5l-20 246l20 234q0 6 4.5 10.5t10.5 4.5q14 0 16 -15zM784 164zM495 785 l21 -380l-21 -246q0 -7 -5 -12.5t-12 -5.5q-16 0 -18 18l-18 246l18 380q2 18 18 18q7 0 12 -5.5t5 -12.5zM589 871l19 -468l-19 -244q0 -8 -5.5 -13.5t-13.5 -5.5q-18 0 -20 19l-16 244l16 468q2 19 20 19q8 0 13.5 -5.5t5.5 -13.5zM687 911l18 -506l-18 -242 q-2 -21 -22 -21q-19 0 -21 21l-16 242l16 506q0 9 6.5 15.5t14.5 6.5q9 0 15 -6.5t7 -15.5zM1079 169v0v0zM881 915l15 -510l-15 -239q0 -10 -7.5 -17.5t-17.5 -7.5t-17 7t-8 18l-14 239l14 510q0 11 7.5 18t17.5 7t17.5 -7t7.5 -18zM980 896l14 -492l-14 -236q0 -11 -8 -19 t-19 -8t-19 8t-9 19l-12 236l12 492q1 12 9 20t19 8t18.5 -8t8.5 -20zM1192 404l-14 -231v0q0 -13 -9 -22t-22 -9t-22 9t-10 22l-6 114l-6 117l12 636v3q2 15 12 24q9 7 20 7q8 0 15 -5q14 -8 16 -26zM2304 423q0 -117 -83 -199.5t-200 -82.5h-786q-13 2 -22 11t-9 22v899 q0 23 28 33q85 34 181 34q195 0 338 -131.5t160 -323.5q53 22 110 22q117 0 200 -83t83 -201z" /> +<glyph unicode="" d="M768 768q237 0 443 43t325 127v-170q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5t-103 128v170q119 -84 325 -127t443 -43zM768 0q237 0 443 43t325 127v-170q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5t-103 128v170q119 -84 325 -127 t443 -43zM768 384q237 0 443 43t325 127v-170q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5t-103 128v170q119 -84 325 -127t443 -43zM768 1536q208 0 385 -34.5t280 -93.5t103 -128v-128q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5 t-103 128v128q0 69 103 128t280 93.5t385 34.5z" /> +<glyph unicode="" d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z M894 465q33 -26 84 -56q59 7 117 7q147 0 177 -49q16 -22 2 -52q0 -1 -1 -2l-2 -2v-1q-6 -38 -71 -38q-48 0 -115 20t-130 53q-221 -24 -392 -83q-153 -262 -242 -262q-15 0 -28 7l-24 12q-1 1 -6 5q-10 10 -6 36q9 40 56 91.5t132 96.5q14 9 23 -6q2 -2 2 -4q52 85 107 197 q68 136 104 262q-24 82 -30.5 159.5t6.5 127.5q11 40 42 40h21h1q23 0 35 -15q18 -21 9 -68q-2 -6 -4 -8q1 -3 1 -8v-30q-2 -123 -14 -192q55 -164 146 -238zM318 54q52 24 137 158q-51 -40 -87.5 -84t-49.5 -74zM716 974q-15 -42 -2 -132q1 7 7 44q0 3 7 43q1 4 4 8 q-1 1 -1 2t-0.5 1.5t-0.5 1.5q-1 22 -13 36q0 -1 -1 -2v-2zM592 313q135 54 284 81q-2 1 -13 9.5t-16 13.5q-76 67 -127 176q-27 -86 -83 -197q-30 -56 -45 -83zM1238 329q-24 24 -140 24q76 -28 124 -28q14 0 18 1q0 1 -2 3z" /> +<glyph unicode="" d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z M233 768v-107h70l164 -661h159l128 485q7 20 10 46q2 16 2 24h4l3 -24q1 -3 3.5 -20t5.5 -26l128 -485h159l164 661h70v107h-300v-107h90l-99 -438q-5 -20 -7 -46l-2 -21h-4l-3 21q-1 5 -4 21t-5 25l-144 545h-114l-144 -545q-2 -9 -4.5 -24.5t-3.5 -21.5l-4 -21h-4l-2 21 q-2 26 -7 46l-99 438h90v107h-300z" /> +<glyph unicode="" d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z M429 106v-106h281v106h-75l103 161q5 7 10 16.5t7.5 13.5t3.5 4h2q1 -4 5 -10q2 -4 4.5 -7.5t6 -8t6.5 -8.5l107 -161h-76v-106h291v106h-68l-192 273l195 282h67v107h-279v-107h74l-103 -159q-4 -7 -10 -16.5t-9 -13.5l-2 -3h-2q-1 4 -5 10q-6 11 -17 23l-106 159h76v107 h-290v-107h68l189 -272l-194 -283h-68z" /> +<glyph unicode="" d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z M416 106v-106h327v106h-93v167h137q76 0 118 15q67 23 106.5 87t39.5 146q0 81 -37 141t-100 87q-48 19 -130 19h-368v-107h92v-555h-92zM769 386h-119v268h120q52 0 83 -18q56 -33 56 -115q0 -89 -62 -120q-31 -15 -78 -15z" /> +<glyph unicode="" d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z M1280 320v-320h-1024v192l192 192l128 -128l384 384zM448 512q-80 0 -136 56t-56 136t56 136t136 56t136 -56t56 -136t-56 -136t-136 -56z" /> +<glyph unicode="" d="M640 1152v128h-128v-128h128zM768 1024v128h-128v-128h128zM640 896v128h-128v-128h128zM768 768v128h-128v-128h128zM1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400 v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-128v-128h-128v128h-512v-1536h1280zM781 593l107 -349q8 -27 8 -52q0 -83 -72.5 -137.5t-183.5 -54.5t-183.5 54.5t-72.5 137.5q0 25 8 52q21 63 120 396v128h128v-128h79 q22 0 39 -13t23 -34zM640 128q53 0 90.5 19t37.5 45t-37.5 45t-90.5 19t-90.5 -19t-37.5 -45t37.5 -45t90.5 -19z" /> +<glyph unicode="" d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z M620 686q20 -8 20 -30v-544q0 -22 -20 -30q-8 -2 -12 -2q-12 0 -23 9l-166 167h-131q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h131l166 167q16 15 35 7zM1037 -3q31 0 50 24q129 159 129 363t-129 363q-16 21 -43 24t-47 -14q-21 -17 -23.5 -43.5t14.5 -47.5 q100 -123 100 -282t-100 -282q-17 -21 -14.5 -47.5t23.5 -42.5q18 -15 40 -15zM826 145q27 0 47 20q87 93 87 219t-87 219q-18 19 -45 20t-46 -17t-20 -44.5t18 -46.5q52 -57 52 -131t-52 -131q-19 -20 -18 -46.5t20 -44.5q20 -17 44 -17z" /> +<glyph unicode="" d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z M768 768q52 0 90 -38t38 -90v-384q0 -52 -38 -90t-90 -38h-384q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h384zM1260 766q20 -8 20 -30v-576q0 -22 -20 -30q-8 -2 -12 -2q-14 0 -23 9l-265 266v90l265 266q9 9 23 9q4 0 12 -2z" /> +<glyph unicode="" d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z M480 768q8 11 21 12.5t24 -6.5l51 -38q11 -8 12.5 -21t-6.5 -24l-182 -243l182 -243q8 -11 6.5 -24t-12.5 -21l-51 -38q-11 -8 -24 -6.5t-21 12.5l-226 301q-14 19 0 38zM1282 467q14 -19 0 -38l-226 -301q-8 -11 -21 -12.5t-24 6.5l-51 38q-11 8 -12.5 21t6.5 24l182 243 l-182 243q-8 11 -6.5 24t12.5 21l51 38q11 8 24 6.5t21 -12.5zM662 6q-13 2 -20.5 13t-5.5 24l138 831q2 13 13 20.5t24 5.5l63 -10q13 -2 20.5 -13t5.5 -24l-138 -831q-2 -13 -13 -20.5t-24 -5.5z" /> +<glyph unicode="" d="M1497 709v-198q-101 -23 -198 -23q-65 -136 -165.5 -271t-181.5 -215.5t-128 -106.5q-80 -45 -162 3q-28 17 -60.5 43.5t-85 83.5t-102.5 128.5t-107.5 184t-105.5 244t-91.5 314.5t-70.5 390h283q26 -218 70 -398.5t104.5 -317t121.5 -235.5t140 -195q169 169 287 406 q-142 72 -223 220t-81 333q0 192 104 314.5t284 122.5q178 0 273 -105.5t95 -297.5q0 -159 -58 -286q-7 -1 -19.5 -3t-46 -2t-63 6t-62 25.5t-50.5 51.5q31 103 31 184q0 87 -29 132t-79 45q-53 0 -85 -49.5t-32 -140.5q0 -186 105 -293.5t267 -107.5q62 0 121 14z" /> +<glyph unicode="" horiz-adv-x="1792" d="M216 367l603 -402v359l-334 223zM154 511l193 129l-193 129v-258zM973 -35l603 402l-269 180l-334 -223v-359zM896 458l272 182l-272 182l-272 -182zM485 733l334 223v359l-603 -402zM1445 640l193 -129v258zM1307 733l269 180l-603 402v-359zM1792 913v-546 q0 -41 -34 -64l-819 -546q-21 -13 -43 -13t-43 13l-819 546q-34 23 -34 64v546q0 41 34 64l819 546q21 13 43 13t43 -13l819 -546q34 -23 34 -64z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1800 764q111 -46 179.5 -145.5t68.5 -221.5q0 -164 -118 -280.5t-285 -116.5q-4 0 -11.5 0.5t-10.5 0.5h-1209h-1h-2h-5q-170 10 -288 125.5t-118 280.5q0 110 55 203t147 147q-12 39 -12 82q0 115 82 196t199 81q95 0 172 -58q75 154 222.5 248t326.5 94 q166 0 306 -80.5t221.5 -218.5t81.5 -301q0 -6 -0.5 -18t-0.5 -18zM468 498q0 -122 84 -193t208 -71q137 0 240 99q-16 20 -47.5 56.5t-43.5 50.5q-67 -65 -144 -65q-55 0 -93.5 33.5t-38.5 87.5q0 53 38.5 87t91.5 34q44 0 84.5 -21t73 -55t65 -75t69 -82t77 -75t97 -55 t121.5 -21q121 0 204.5 71.5t83.5 190.5q0 121 -84 192t-207 71q-143 0 -241 -97q14 -16 29.5 -34t34.5 -40t29 -34q66 64 142 64q52 0 92 -33t40 -84q0 -57 -37 -91.5t-94 -34.5q-43 0 -82.5 21t-72 55t-65.5 75t-69.5 82t-77.5 75t-96.5 55t-118.5 21q-122 0 -207 -70.5 t-85 -189.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM896 1408q-190 0 -361 -90l194 -194q82 28 167 28t167 -28l194 194q-171 90 -361 90zM218 279l194 194 q-28 82 -28 167t28 167l-194 194q-90 -171 -90 -361t90 -361zM896 -128q190 0 361 90l-194 194q-82 -28 -167 -28t-167 28l-194 -194q171 -90 361 -90zM896 256q159 0 271.5 112.5t112.5 271.5t-112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5 t271.5 -112.5zM1380 473l194 -194q90 171 90 361t-90 361l-194 -194q28 -82 28 -167t-28 -167z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1760 640q0 -176 -68.5 -336t-184 -275.5t-275.5 -184t-336 -68.5t-336 68.5t-275.5 184t-184 275.5t-68.5 336q0 213 97 398.5t265 305.5t374 151v-228q-221 -45 -366.5 -221t-145.5 -406q0 -130 51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5 t136.5 204t51 248.5q0 230 -145.5 406t-366.5 221v228q206 -31 374 -151t265 -305.5t97 -398.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M19 662q8 217 116 406t305 318h5q0 -1 -1 -3q-8 -8 -28 -33.5t-52 -76.5t-60 -110.5t-44.5 -135.5t-14 -150.5t39 -157.5t108.5 -154q50 -50 102 -69.5t90.5 -11.5t69.5 23.5t47 32.5l16 16q39 51 53 116.5t6.5 122.5t-21 107t-26.5 80l-14 29q-10 25 -30.5 49.5t-43 41 t-43.5 29.5t-35 19l-13 6l104 115q39 -17 78 -52t59 -61l19 -27q1 48 -18.5 103.5t-40.5 87.5l-20 31l161 183l160 -181q-33 -46 -52.5 -102.5t-22.5 -90.5l-4 -33q22 37 61.5 72.5t67.5 52.5l28 17l103 -115q-44 -14 -85 -50t-60 -65l-19 -29q-31 -56 -48 -133.5t-7 -170 t57 -156.5q33 -45 77.5 -60.5t85 -5.5t76 26.5t57.5 33.5l21 16q60 53 96.5 115t48.5 121.5t10 121.5t-18 118t-37 107.5t-45.5 93t-45 72t-34.5 47.5l-13 17q-14 13 -7 13l10 -3q40 -29 62.5 -46t62 -50t64 -58t58.5 -65t55.5 -77t45.5 -88t38 -103t23.5 -117t10.5 -136 q3 -259 -108 -465t-312 -321t-456 -115q-185 0 -351 74t-283.5 198t-184 293t-60.5 353z" /> +<glyph unicode="" horiz-adv-x="1792" d="M874 -102v-66q-208 6 -385 109.5t-283 275.5l58 34q29 -49 73 -99l65 57q148 -168 368 -212l-17 -86q65 -12 121 -13zM276 428l-83 -28q22 -60 49 -112l-57 -33q-98 180 -98 385t98 385l57 -33q-30 -56 -49 -112l82 -28q-35 -100 -35 -212q0 -109 36 -212zM1528 251 l58 -34q-106 -172 -283 -275.5t-385 -109.5v66q56 1 121 13l-17 86q220 44 368 212l65 -57q44 50 73 99zM1377 805l-233 -80q14 -42 14 -85t-14 -85l232 -80q-31 -92 -98 -169l-185 162q-57 -67 -147 -85l48 -241q-52 -10 -98 -10t-98 10l48 241q-90 18 -147 85l-185 -162 q-67 77 -98 169l232 80q-14 42 -14 85t14 85l-233 80q33 93 99 169l185 -162q59 68 147 86l-48 240q44 10 98 10t98 -10l-48 -240q88 -18 147 -86l185 162q66 -76 99 -169zM874 1448v-66q-65 -2 -121 -13l17 -86q-220 -42 -368 -211l-65 56q-38 -42 -73 -98l-57 33 q106 172 282 275.5t385 109.5zM1705 640q0 -205 -98 -385l-57 33q27 52 49 112l-83 28q36 103 36 212q0 112 -35 212l82 28q-19 56 -49 112l57 33q98 -180 98 -385zM1585 1063l-57 -33q-35 56 -73 98l-65 -56q-148 169 -368 211l17 86q-56 11 -121 13v66q209 -6 385 -109.5 t282 -275.5zM1748 640q0 173 -67.5 331t-181.5 272t-272 181.5t-331 67.5t-331 -67.5t-272 -181.5t-181.5 -272t-67.5 -331t67.5 -331t181.5 -272t272 -181.5t331 -67.5t331 67.5t272 181.5t181.5 272t67.5 331zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71 t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> +<glyph unicode="" d="M582 228q0 -66 -93 -66q-107 0 -107 63q0 64 98 64q102 0 102 -61zM546 694q0 -85 -74 -85q-77 0 -77 84q0 90 77 90q36 0 55 -25.5t19 -63.5zM712 769v125q-78 -29 -135 -29q-50 29 -110 29q-86 0 -145 -57t-59 -143q0 -50 29.5 -102t73.5 -67v-3q-38 -17 -38 -85 q0 -53 41 -77v-3q-113 -37 -113 -139q0 -45 20 -78.5t54 -51t72 -25.5t81 -8q224 0 224 188q0 67 -48 99t-126 46q-27 5 -51.5 20.5t-24.5 39.5q0 44 49 52q77 15 122 70t45 134q0 24 -10 52q37 9 49 13zM771 350h137q-2 27 -2 82v387q0 46 2 69h-137q3 -23 3 -71v-392 q0 -50 -3 -75zM1280 366v121q-30 -21 -68 -21q-53 0 -53 82v225h52q9 0 26.5 -1t26.5 -1v117h-105q0 82 3 102h-140q4 -24 4 -55v-47h-60v-117q36 3 37 3q3 0 11 -0.5t12 -0.5v-2h-2v-217q0 -37 2.5 -64t11.5 -56.5t24.5 -48.5t43.5 -31t66 -12q64 0 108 24zM924 1072 q0 36 -24 63.5t-60 27.5t-60.5 -27t-24.5 -64q0 -36 25 -62.5t60 -26.5t59.5 27t24.5 62zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M595 22q0 100 -165 100q-158 0 -158 -104q0 -101 172 -101q151 0 151 105zM536 777q0 61 -30 102t-89 41q-124 0 -124 -145q0 -135 124 -135q119 0 119 137zM805 1101v-202q-36 -12 -79 -22q16 -43 16 -84q0 -127 -73 -216.5t-197 -112.5q-40 -8 -59.5 -27t-19.5 -58 q0 -31 22.5 -51.5t58 -32t78.5 -22t86 -25.5t78.5 -37.5t58 -64t22.5 -98.5q0 -304 -363 -304q-69 0 -130 12.5t-116 41t-87.5 82t-32.5 127.5q0 165 182 225v4q-67 41 -67 126q0 109 63 137v4q-72 24 -119.5 108.5t-47.5 165.5q0 139 95 231.5t235 92.5q96 0 178 -47 q98 0 218 47zM1123 220h-222q4 45 4 134v609q0 94 -4 128h222q-4 -33 -4 -124v-613q0 -89 4 -134zM1724 442v-196q-71 -39 -174 -39q-62 0 -107 20t-70 50t-39.5 78t-18.5 92t-4 103v351h2v4q-7 0 -19 1t-18 1q-21 0 -59 -6v190h96v76q0 54 -6 89h227q-6 -41 -6 -165h171 v-190q-15 0 -43.5 2t-42.5 2h-85v-365q0 -131 87 -131q61 0 109 33zM1148 1389q0 -58 -39 -101.5t-96 -43.5q-58 0 -98 43.5t-40 101.5q0 59 39.5 103t98.5 44q58 0 96.5 -44.5t38.5 -102.5z" /> +<glyph unicode="" d="M809 532l266 499h-112l-157 -312q-24 -48 -44 -92l-42 92l-155 312h-120l263 -493v-324h101v318zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1280" d="M842 964q0 -80 -57 -136.5t-136 -56.5q-60 0 -111 35q-62 -67 -115 -146q-247 -371 -202 -859q1 -22 -12.5 -38.5t-34.5 -18.5h-5q-20 0 -35 13.5t-17 33.5q-14 126 -3.5 247.5t29.5 217t54 186t69 155.5t74 125q61 90 132 165q-16 35 -16 77q0 80 56.5 136.5t136.5 56.5 t136.5 -56.5t56.5 -136.5zM1223 953q0 -158 -78 -292t-212.5 -212t-292.5 -78q-64 0 -131 14q-21 5 -32.5 23.5t-6.5 39.5q5 20 23 31.5t39 7.5q51 -13 108 -13q97 0 186 38t153 102t102 153t38 186t-38 186t-102 153t-153 102t-186 38t-186 -38t-153 -102t-102 -153 t-38 -186q0 -114 52 -218q10 -20 3.5 -40t-25.5 -30t-39.5 -3t-30.5 26q-64 123 -64 265q0 119 46.5 227t124.5 186t186 124t226 46q158 0 292.5 -78t212.5 -212.5t78 -292.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M270 730q-8 19 -8 52q0 20 11 49t24 45q-1 22 7.5 53t22.5 43q0 139 92.5 288.5t217.5 209.5q139 66 324 66q133 0 266 -55q49 -21 90 -48t71 -56t55 -68t42 -74t32.5 -84.5t25.5 -89.5t22 -98l1 -5q55 -83 55 -150q0 -14 -9 -40t-9 -38q0 -1 1.5 -3.5t3.5 -5t2 -3.5 q77 -114 120.5 -214.5t43.5 -208.5q0 -43 -19.5 -100t-55.5 -57q-9 0 -19.5 7.5t-19 17.5t-19 26t-16 26.5t-13.5 26t-9 17.5q-1 1 -3 1l-5 -4q-59 -154 -132 -223q20 -20 61.5 -38.5t69 -41.5t35.5 -65q-2 -4 -4 -16t-7 -18q-64 -97 -302 -97q-53 0 -110.5 9t-98 20 t-104.5 30q-15 5 -23 7q-14 4 -46 4.5t-40 1.5q-41 -45 -127.5 -65t-168.5 -20q-35 0 -69 1.5t-93 9t-101 20.5t-74.5 40t-32.5 64q0 40 10 59.5t41 48.5q11 2 40.5 13t49.5 12q4 0 14 2q2 2 2 4l-2 3q-48 11 -108 105.5t-73 156.5l-5 3q-4 0 -12 -20q-18 -41 -54.5 -74.5 t-77.5 -37.5h-1q-4 0 -6 4.5t-5 5.5q-23 54 -23 100q0 275 252 466z" /> +<glyph unicode="" horiz-adv-x="2048" d="M580 1075q0 41 -25 66t-66 25q-43 0 -76 -25.5t-33 -65.5q0 -39 33 -64.5t76 -25.5q41 0 66 24.5t25 65.5zM1323 568q0 28 -25.5 50t-65.5 22q-27 0 -49.5 -22.5t-22.5 -49.5q0 -28 22.5 -50.5t49.5 -22.5q40 0 65.5 22t25.5 51zM1087 1075q0 41 -24.5 66t-65.5 25 q-43 0 -76 -25.5t-33 -65.5q0 -39 33 -64.5t76 -25.5q41 0 65.5 24.5t24.5 65.5zM1722 568q0 28 -26 50t-65 22q-27 0 -49.5 -22.5t-22.5 -49.5q0 -28 22.5 -50.5t49.5 -22.5q39 0 65 22t26 51zM1456 965q-31 4 -70 4q-169 0 -311 -77t-223.5 -208.5t-81.5 -287.5 q0 -78 23 -152q-35 -3 -68 -3q-26 0 -50 1.5t-55 6.5t-44.5 7t-54.5 10.5t-50 10.5l-253 -127l72 218q-290 203 -290 490q0 169 97.5 311t264 223.5t363.5 81.5q176 0 332.5 -66t262 -182.5t136.5 -260.5zM2048 404q0 -117 -68.5 -223.5t-185.5 -193.5l55 -181l-199 109 q-150 -37 -218 -37q-169 0 -311 70.5t-223.5 191.5t-81.5 264t81.5 264t223.5 191.5t311 70.5q161 0 303 -70.5t227.5 -192t85.5 -263.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1764 1525q33 -24 27 -64l-256 -1536q-5 -29 -32 -45q-14 -8 -31 -8q-11 0 -24 5l-453 185l-242 -295q-18 -23 -49 -23q-13 0 -22 4q-19 7 -30.5 23.5t-11.5 36.5v349l864 1059l-1069 -925l-395 162q-37 14 -40 55q-2 40 32 59l1664 960q15 9 32 9q20 0 36 -11z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1764 1525q33 -24 27 -64l-256 -1536q-5 -29 -32 -45q-14 -8 -31 -8q-11 0 -24 5l-527 215l-298 -327q-18 -21 -47 -21q-14 0 -23 4q-19 7 -30 23.5t-11 36.5v452l-472 193q-37 14 -40 55q-3 39 32 59l1664 960q35 21 68 -2zM1422 26l221 1323l-1434 -827l336 -137 l863 639l-478 -797z" /> +<glyph unicode="" d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61q-172 0 -327 72.5t-264 204.5q-7 10 -6.5 22.5t8.5 20.5l137 138q10 9 25 9q16 -2 23 -12q73 -95 179 -147t225 -52q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5 t-163.5 109.5t-198.5 40.5q-98 0 -188 -35.5t-160 -101.5l137 -138q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l130 -129q107 101 244.5 156.5t284.5 55.5q156 0 298 -61t245 -164t164 -245t61 -298zM896 928v-448q0 -14 -9 -23 t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23z" /> +<glyph unicode="" d="M768 1280q-130 0 -248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5t-51 248.5t-136.5 204t-204 136.5t-248.5 51zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1682 -128q-44 0 -132.5 3.5t-133.5 3.5q-44 0 -132 -3.5t-132 -3.5q-24 0 -37 20.5t-13 45.5q0 31 17 46t39 17t51 7t45 15q33 21 33 140l-1 391q0 21 -1 31q-13 4 -50 4h-675q-38 0 -51 -4q-1 -10 -1 -31l-1 -371q0 -142 37 -164q16 -10 48 -13t57 -3.5t45 -15 t20 -45.5q0 -26 -12.5 -48t-36.5 -22q-47 0 -139.5 3.5t-138.5 3.5q-43 0 -128 -3.5t-127 -3.5q-23 0 -35.5 21t-12.5 45q0 30 15.5 45t36 17.5t47.5 7.5t42 15q33 23 33 143l-1 57v813q0 3 0.5 26t0 36.5t-1.5 38.5t-3.5 42t-6.5 36.5t-11 31.5t-16 18q-15 10 -45 12t-53 2 t-41 14t-18 45q0 26 12 48t36 22q46 0 138.5 -3.5t138.5 -3.5q42 0 126.5 3.5t126.5 3.5q25 0 37.5 -22t12.5 -48q0 -30 -17 -43.5t-38.5 -14.5t-49.5 -4t-43 -13q-35 -21 -35 -160l1 -320q0 -21 1 -32q13 -3 39 -3h699q25 0 38 3q1 11 1 32l1 320q0 139 -35 160 q-18 11 -58.5 12.5t-66 13t-25.5 49.5q0 26 12.5 48t37.5 22q44 0 132 -3.5t132 -3.5q43 0 129 3.5t129 3.5q25 0 37.5 -22t12.5 -48q0 -30 -17.5 -44t-40 -14.5t-51.5 -3t-44 -12.5q-35 -23 -35 -161l1 -943q0 -119 34 -140q16 -10 46 -13.5t53.5 -4.5t41.5 -15.5t18 -44.5 q0 -26 -12 -48t-36 -22z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1278 1347v-73q0 -29 -18.5 -61t-42.5 -32q-50 0 -54 -1q-26 -6 -32 -31q-3 -11 -3 -64v-1152q0 -25 -18 -43t-43 -18h-108q-25 0 -43 18t-18 43v1218h-143v-1218q0 -25 -17.5 -43t-43.5 -18h-108q-26 0 -43.5 18t-17.5 43v496q-147 12 -245 59q-126 58 -192 179 q-64 117 -64 259q0 166 88 286q88 118 209 159q111 37 417 37h479q25 0 43 -18t18 -43z" /> +<glyph unicode="" d="M352 128v-128h-352v128h352zM704 256q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h256zM864 640v-128h-864v128h864zM224 1152v-128h-224v128h224zM1536 128v-128h-736v128h736zM576 1280q26 0 45 -19t19 -45v-256 q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h256zM1216 768q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h256zM1536 640v-128h-224v128h224zM1536 1152v-128h-864v128h864z" /> +<glyph unicode="" d="M1216 512q133 0 226.5 -93.5t93.5 -226.5t-93.5 -226.5t-226.5 -93.5t-226.5 93.5t-93.5 226.5q0 12 2 34l-360 180q-92 -86 -218 -86q-133 0 -226.5 93.5t-93.5 226.5t93.5 226.5t226.5 93.5q126 0 218 -86l360 180q-2 22 -2 34q0 133 93.5 226.5t226.5 93.5 t226.5 -93.5t93.5 -226.5t-93.5 -226.5t-226.5 -93.5q-126 0 -218 86l-360 -180q2 -22 2 -34t-2 -34l360 -180q92 86 218 86z" /> +<glyph unicode="" d="M1280 341q0 88 -62.5 151t-150.5 63q-84 0 -145 -58l-241 120q2 16 2 23t-2 23l241 120q61 -58 145 -58q88 0 150.5 63t62.5 151t-62.5 150.5t-150.5 62.5t-151 -62.5t-63 -150.5q0 -7 2 -23l-241 -120q-62 57 -145 57q-88 0 -150.5 -62.5t-62.5 -150.5t62.5 -150.5 t150.5 -62.5q83 0 145 57l241 -120q-2 -16 -2 -23q0 -88 63 -150.5t151 -62.5t150.5 62.5t62.5 150.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M571 947q-10 25 -34 35t-49 0q-108 -44 -191 -127t-127 -191q-10 -25 0 -49t35 -34q13 -5 24 -5q42 0 60 40q34 84 98.5 148.5t148.5 98.5q25 11 35 35t0 49zM1513 1303l46 -46l-244 -243l68 -68q19 -19 19 -45.5t-19 -45.5l-64 -64q89 -161 89 -343q0 -143 -55.5 -273.5 t-150 -225t-225 -150t-273.5 -55.5t-273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5q182 0 343 -89l64 64q19 19 45.5 19t45.5 -19l68 -68zM1521 1359q-10 -10 -22 -10q-13 0 -23 10l-91 90q-9 10 -9 23t9 23q10 9 23 9t23 -9l90 -91 q10 -9 10 -22.5t-10 -22.5zM1751 1129q-11 -9 -23 -9t-23 9l-90 91q-10 9 -10 22.5t10 22.5q9 10 22.5 10t22.5 -10l91 -90q9 -10 9 -23t-9 -23zM1792 1312q0 -14 -9 -23t-23 -9h-96q-14 0 -23 9t-9 23t9 23t23 9h96q14 0 23 -9t9 -23zM1600 1504v-96q0 -14 -9 -23t-23 -9 t-23 9t-9 23v96q0 14 9 23t23 9t23 -9t9 -23zM1751 1449l-91 -90q-10 -10 -22 -10q-13 0 -23 10q-10 9 -10 22.5t10 22.5l90 91q10 9 23 9t23 -9q9 -10 9 -23t-9 -23z" /> +<glyph unicode="" horiz-adv-x="1792" d="M609 720l287 208l287 -208l-109 -336h-355zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM1515 186q149 203 149 454v3l-102 -89l-240 224l63 323 l134 -12q-150 206 -389 282l53 -124l-287 -159l-287 159l53 124q-239 -76 -389 -282l135 12l62 -323l-240 -224l-102 89v-3q0 -251 149 -454l30 132l326 -40l139 -298l-116 -69q117 -39 240 -39t240 39l-116 69l139 298l326 40z" /> +<glyph unicode="" horiz-adv-x="1792" d="M448 224v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM256 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM832 224v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23 v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM640 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM66 768q-28 0 -47 19t-19 46v129h514v-129q0 -27 -19 -46t-46 -19h-383zM1216 224v-192q0 -14 -9 -23t-23 -9h-192 q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1024 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1600 224v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23 zM1408 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 1016v-13h-514v10q0 104 -382 102q-382 -1 -382 -102v-10h-514v13q0 17 8.5 43t34 64t65.5 75.5t110.5 76t160 67.5t224 47.5t293.5 18.5t293 -18.5t224 -47.5 t160.5 -67.5t110.5 -76t65.5 -75.5t34 -64t8.5 -43zM1792 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 962v-129q0 -27 -19 -46t-46 -19h-384q-27 0 -46 19t-19 46v129h514z" /> +<glyph unicode="" horiz-adv-x="1792" d="M704 1216v-768q0 -26 -19 -45t-45 -19v-576q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v512l249 873q7 23 31 23h424zM1024 1216v-704h-256v704h256zM1792 320v-512q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v576q-26 0 -45 19t-19 45v768h424q24 0 31 -23z M736 1504v-224h-352v224q0 14 9 23t23 9h288q14 0 23 -9t9 -23zM1408 1504v-224h-352v224q0 14 9 23t23 9h288q14 0 23 -9t9 -23z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1755 1083q37 -37 37 -90t-37 -91l-401 -400l150 -150l-160 -160q-163 -163 -389.5 -186.5t-411.5 100.5l-362 -362h-181v181l362 362q-124 185 -100.5 411.5t186.5 389.5l160 160l150 -150l400 401q38 37 91 37t90 -37t37 -90.5t-37 -90.5l-400 -401l234 -234l401 400 q38 37 91 37t90 -37z" /> +<glyph unicode="" horiz-adv-x="1792" d="M873 796q0 -83 -63.5 -142.5t-152.5 -59.5t-152.5 59.5t-63.5 142.5q0 84 63.5 143t152.5 59t152.5 -59t63.5 -143zM1375 796q0 -83 -63 -142.5t-153 -59.5q-89 0 -152.5 59.5t-63.5 142.5q0 84 63.5 143t152.5 59q90 0 153 -59t63 -143zM1600 616v667q0 87 -32 123.5 t-111 36.5h-1112q-83 0 -112.5 -34t-29.5 -126v-673q43 -23 88.5 -40t81 -28t81 -18.5t71 -11t70 -4t58.5 -0.5t56.5 2t44.5 2q68 1 95 -27q6 -6 10 -9q26 -25 61 -51q7 91 118 87q5 0 36.5 -1.5t43 -2t45.5 -1t53 1t54.5 4.5t61 8.5t62 13.5t67 19.5t67.5 27t72 34.5z M1763 621q-121 -149 -372 -252q84 -285 -23 -465q-66 -113 -183 -148q-104 -32 -182 15q-86 51 -82 164l-1 326v1q-8 2 -24.5 6t-23.5 5l-1 -338q4 -114 -83 -164q-79 -47 -183 -15q-117 36 -182 150q-105 180 -22 463q-251 103 -372 252q-25 37 -4 63t60 -1q3 -2 11 -7 t11 -8v694q0 72 47 123t114 51h1257q67 0 114 -51t47 -123v-694l21 15q39 27 60 1t-4 -63z" /> +<glyph unicode="" horiz-adv-x="1792" d="M896 1102v-434h-145v434h145zM1294 1102v-434h-145v434h145zM1294 342l253 254v795h-1194v-1049h326v-217l217 217h398zM1692 1536v-1013l-434 -434h-326l-217 -217h-217v217h-398v1158l109 289h1483z" /> +<glyph unicode="" d="M773 217v-127q-1 -292 -6 -305q-12 -32 -51 -40q-54 -9 -181.5 38t-162.5 89q-13 15 -17 36q-1 12 4 26q4 10 34 47t181 216q1 0 60 70q15 19 39.5 24.5t49.5 -3.5q24 -10 37.5 -29t12.5 -42zM624 468q-3 -55 -52 -70l-120 -39q-275 -88 -292 -88q-35 2 -54 36 q-12 25 -17 75q-8 76 1 166.5t30 124.5t56 32q13 0 202 -77q70 -29 115 -47l84 -34q23 -9 35.5 -30.5t11.5 -48.5zM1450 171q-7 -54 -91.5 -161t-135.5 -127q-37 -14 -63 7q-14 10 -184 287l-47 77q-14 21 -11.5 46t19.5 46q35 43 83 26q1 -1 119 -40q203 -66 242 -79.5 t47 -20.5q28 -22 22 -61zM778 803q5 -102 -54 -122q-58 -17 -114 71l-378 598q-8 35 19 62q41 43 207.5 89.5t224.5 31.5q40 -10 49 -45q3 -18 22 -305.5t24 -379.5zM1440 695q3 -39 -26 -59q-15 -10 -329 -86q-67 -15 -91 -23l1 2q-23 -6 -46 4t-37 32q-30 47 0 87 q1 1 75 102q125 171 150 204t34 39q28 19 65 2q48 -23 123 -133.5t81 -167.5v-3z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1024 1024h-384v-384h384v384zM1152 384v-128h-640v128h640zM1152 1152v-640h-640v640h640zM1792 384v-128h-512v128h512zM1792 640v-128h-512v128h512zM1792 896v-128h-512v128h512zM1792 1152v-128h-512v128h512zM256 192v960h-128v-960q0 -26 19 -45t45 -19t45 19 t19 45zM1920 192v1088h-1536v-1088q0 -33 -11 -64h1483q26 0 45 19t19 45zM2048 1408v-1216q0 -80 -56 -136t-136 -56h-1664q-80 0 -136 56t-56 136v1088h256v128h1792z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1024 13q-20 0 -93 73.5t-73 93.5q0 32 62.5 54t103.5 22t103.5 -22t62.5 -54q0 -20 -73 -93.5t-93 -73.5zM1294 284q-2 0 -40 25t-101.5 50t-128.5 25t-128.5 -25t-101 -50t-40.5 -25q-18 0 -93.5 75t-75.5 93q0 13 10 23q78 77 196 121t233 44t233 -44t196 -121 q10 -10 10 -23q0 -18 -75.5 -93t-93.5 -75zM1567 556q-11 0 -23 8q-136 105 -252 154.5t-268 49.5q-85 0 -170.5 -22t-149 -53t-113.5 -62t-79 -53t-31 -22q-17 0 -92 75t-75 93q0 12 10 22q132 132 320 205t380 73t380 -73t320 -205q10 -10 10 -22q0 -18 -75 -93t-92 -75z M1838 827q-11 0 -22 9q-179 157 -371.5 236.5t-420.5 79.5t-420.5 -79.5t-371.5 -236.5q-11 -9 -22 -9q-17 0 -92.5 75t-75.5 93q0 13 10 23q187 186 445 288t527 102t527 -102t445 -288q10 -10 10 -23q0 -18 -75.5 -93t-92.5 -75z" /> +<glyph unicode="" horiz-adv-x="1792" d="M384 0q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM768 0q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM384 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5 t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1152 0q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM768 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5 t37.5 90.5zM384 768q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1152 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM768 768q0 53 -37.5 90.5t-90.5 37.5 t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1536 0v384q0 52 -38 90t-90 38t-90 -38t-38 -90v-384q0 -52 38 -90t90 -38t90 38t38 90zM1152 768q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5z M1536 1088v256q0 26 -19 45t-45 19h-1280q-26 0 -45 -19t-19 -45v-256q0 -26 19 -45t45 -19h1280q26 0 45 19t19 45zM1536 768q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 1408v-1536q0 -52 -38 -90t-90 -38 h-1408q-52 0 -90 38t-38 90v1536q0 52 38 90t90 38h1408q52 0 90 -38t38 -90z" /> +<glyph unicode="" d="M1519 890q18 -84 -4 -204q-87 -444 -565 -444h-44q-25 0 -44 -16.5t-24 -42.5l-4 -19l-55 -346l-2 -15q-5 -26 -24.5 -42.5t-44.5 -16.5h-251q-21 0 -33 15t-9 36q9 56 26.5 168t26.5 168t27 167.5t27 167.5q5 37 43 37h131q133 -2 236 21q175 39 287 144q102 95 155 246 q24 70 35 133q1 6 2.5 7.5t3.5 1t6 -3.5q79 -59 98 -162zM1347 1172q0 -107 -46 -236q-80 -233 -302 -315q-113 -40 -252 -42q0 -1 -90 -1l-90 1q-100 0 -118 -96q-2 -8 -85 -530q-1 -10 -12 -10h-295q-22 0 -36.5 16.5t-11.5 38.5l232 1471q5 29 27.5 48t51.5 19h598 q34 0 97.5 -13t111.5 -32q107 -41 163.5 -123t56.5 -196z" /> +<glyph unicode="" horiz-adv-x="1792" d="M441 864q32 0 52 -26q266 -364 362 -774h-446q-127 441 -367 749q-12 16 -3 33.5t29 17.5h373zM1000 507q-49 -199 -125 -393q-79 310 -256 594q40 221 44 449q211 -340 337 -650zM1099 1216q235 -324 384.5 -698.5t184.5 -773.5h-451q-41 665 -553 1472h435zM1792 640 q0 -424 -101 -812q-67 560 -359 1083q-25 301 -106 584q-4 16 5.5 28.5t25.5 12.5h359q21 0 38.5 -13t22.5 -33q115 -409 115 -850z" /> +<glyph unicode="" horiz-adv-x="2304" d="M1975 546h-138q14 37 66 179l3 9q4 10 10 26t9 26l12 -55zM531 611l-58 295q-11 54 -75 54h-268l-2 -13q311 -79 403 -336zM710 960l-162 -438l-17 89q-26 70 -85 129.5t-131 88.5l135 -510h175l261 641h-176zM849 318h166l104 642h-166zM1617 944q-69 27 -149 27 q-123 0 -201 -59t-79 -153q-1 -102 145 -174q48 -23 67 -41t19 -39q0 -30 -30 -46t-69 -16q-86 0 -156 33l-22 11l-23 -144q74 -34 185 -34q130 -1 208.5 59t80.5 160q0 106 -140 174q-49 25 -71 42t-22 38q0 22 24.5 38.5t70.5 16.5q70 1 124 -24l15 -8zM2042 960h-128 q-65 0 -87 -54l-246 -588h174l35 96h212q5 -22 20 -96h154zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" /> +<glyph unicode="" horiz-adv-x="2304" d="M671 603h-13q-47 0 -47 -32q0 -22 20 -22q17 0 28 15t12 39zM1066 639h62v3q1 4 0.5 6.5t-1 7t-2 8t-4.5 6.5t-7.5 5t-11.5 2q-28 0 -36 -38zM1606 603h-12q-48 0 -48 -32q0 -22 20 -22q17 0 28 15t12 39zM1925 629q0 41 -30 41q-19 0 -31 -20t-12 -51q0 -42 28 -42 q20 0 32.5 20t12.5 52zM480 770h87l-44 -262h-56l32 201l-71 -201h-39l-4 200l-34 -200h-53l44 262h81l2 -163zM733 663q0 -6 -4 -42q-16 -101 -17 -113h-47l1 22q-20 -26 -58 -26q-23 0 -37.5 16t-14.5 42q0 39 26 60.5t73 21.5q14 0 23 -1q0 3 0.5 5.5t1 4.5t0.5 3 q0 20 -36 20q-29 0 -59 -10q0 4 7 48q38 11 67 11q74 0 74 -62zM889 721l-8 -49q-22 3 -41 3q-27 0 -27 -17q0 -8 4.5 -12t21.5 -11q40 -19 40 -60q0 -72 -87 -71q-34 0 -58 6q0 2 7 49q29 -8 51 -8q32 0 32 19q0 7 -4.5 11.5t-21.5 12.5q-43 20 -43 59q0 72 84 72 q30 0 50 -4zM977 721h28l-7 -52h-29q-2 -17 -6.5 -40.5t-7 -38.5t-2.5 -18q0 -16 19 -16q8 0 16 2l-8 -47q-21 -7 -40 -7q-43 0 -45 47q0 12 8 56q3 20 25 146h55zM1180 648q0 -23 -7 -52h-111q-3 -22 10 -33t38 -11q30 0 58 14l-9 -54q-30 -8 -57 -8q-95 0 -95 95 q0 55 27.5 90.5t69.5 35.5q35 0 55.5 -21t20.5 -56zM1319 722q-13 -23 -22 -62q-22 2 -31 -24t-25 -128h-56l3 14q22 130 29 199h51l-3 -33q14 21 25.5 29.5t28.5 4.5zM1506 763l-9 -57q-28 14 -50 14q-31 0 -51 -27.5t-20 -70.5q0 -30 13.5 -47t38.5 -17q21 0 48 13 l-10 -59q-28 -8 -50 -8q-45 0 -71.5 30.5t-26.5 82.5q0 70 35.5 114.5t91.5 44.5q26 0 61 -13zM1668 663q0 -18 -4 -42q-13 -79 -17 -113h-46l1 22q-20 -26 -59 -26q-23 0 -37 16t-14 42q0 39 25.5 60.5t72.5 21.5q15 0 23 -1q2 7 2 13q0 20 -36 20q-29 0 -59 -10q0 4 8 48 q38 11 67 11q73 0 73 -62zM1809 722q-14 -24 -21 -62q-23 2 -31.5 -23t-25.5 -129h-56l3 14q19 104 29 199h52q0 -11 -4 -33q15 21 26.5 29.5t27.5 4.5zM1950 770h56l-43 -262h-53l3 19q-23 -23 -52 -23q-31 0 -49.5 24t-18.5 64q0 53 27.5 92t64.5 39q31 0 53 -29z M2061 640q0 148 -72.5 273t-198 198t-273.5 73q-181 0 -328 -110q127 -116 171 -284h-50q-44 150 -158 253q-114 -103 -158 -253h-50q44 168 171 284q-147 110 -328 110q-148 0 -273.5 -73t-198 -198t-72.5 -273t72.5 -273t198 -198t273.5 -73q181 0 328 110 q-120 111 -165 264h50q46 -138 152 -233q106 95 152 233h50q-45 -153 -165 -264q147 -110 328 -110q148 0 273.5 73t198 198t72.5 273zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" /> +<glyph unicode="" horiz-adv-x="2304" d="M313 759q0 -51 -36 -84q-29 -26 -89 -26h-17v220h17q61 0 89 -27q36 -31 36 -83zM2089 824q0 -52 -64 -52h-19v101h20q63 0 63 -49zM380 759q0 74 -50 120.5t-129 46.5h-95v-333h95q74 0 119 38q60 51 60 128zM410 593h65v333h-65v-333zM730 694q0 40 -20.5 62t-75.5 42 q-29 10 -39.5 19t-10.5 23q0 16 13.5 26.5t34.5 10.5q29 0 53 -27l34 44q-41 37 -98 37q-44 0 -74 -27.5t-30 -67.5q0 -35 18 -55.5t64 -36.5q37 -13 45 -19q19 -12 19 -34q0 -20 -14 -33.5t-36 -13.5q-48 0 -71 44l-42 -40q44 -64 115 -64q51 0 83 30.5t32 79.5zM1008 604 v77q-37 -37 -78 -37q-49 0 -80.5 32.5t-31.5 82.5q0 48 31.5 81.5t77.5 33.5q43 0 81 -38v77q-40 20 -80 20q-74 0 -125.5 -50.5t-51.5 -123.5t51 -123.5t125 -50.5q42 0 81 19zM2240 0v527q-65 -40 -144.5 -84t-237.5 -117t-329.5 -137.5t-417.5 -134.5t-504 -118h1569 q26 0 45 19t19 45zM1389 757q0 75 -53 128t-128 53t-128 -53t-53 -128t53 -128t128 -53t128 53t53 128zM1541 584l144 342h-71l-90 -224l-89 224h-71l142 -342h35zM1714 593h184v56h-119v90h115v56h-115v74h119v57h-184v-333zM2105 593h80l-105 140q76 16 76 94q0 47 -31 73 t-87 26h-97v-333h65v133h9zM2304 1274v-1268q0 -56 -38.5 -95t-93.5 -39h-2040q-55 0 -93.5 39t-38.5 95v1268q0 56 38.5 95t93.5 39h2040q55 0 93.5 -39t38.5 -95z" /> +<glyph unicode="" horiz-adv-x="2304" d="M119 854h89l-45 108zM740 328l74 79l-70 79h-163v-49h142v-55h-142v-54h159zM898 406l99 -110v217zM1186 453q0 33 -40 33h-84v-69h83q41 0 41 36zM1475 457q0 29 -42 29h-82v-61h81q43 0 43 32zM1197 923q0 29 -42 29h-82v-60h81q43 0 43 31zM1656 854h89l-44 108z M699 1009v-271h-66v212l-94 -212h-57l-94 212v-212h-132l-25 60h-135l-25 -60h-70l116 271h96l110 -257v257h106l85 -184l77 184h108zM1255 453q0 -20 -5.5 -35t-14 -25t-22.5 -16.5t-26 -10t-31.5 -4.5t-31.5 -1t-32.5 0.5t-29.5 0.5v-91h-126l-80 90l-83 -90h-256v271h260 l80 -89l82 89h207q109 0 109 -89zM964 794v-56h-217v271h217v-57h-152v-49h148v-55h-148v-54h152zM2304 235v-229q0 -55 -38.5 -94.5t-93.5 -39.5h-2040q-55 0 -93.5 39.5t-38.5 94.5v678h111l25 61h55l25 -61h218v46l19 -46h113l20 47v-47h541v99l10 1q10 0 10 -14v-86h279 v23q23 -12 55 -18t52.5 -6.5t63 0.5t51.5 1l25 61h56l25 -61h227v58l34 -58h182v378h-180v-44l-25 44h-185v-44l-23 44h-249q-69 0 -109 -22v22h-172v-22q-24 22 -73 22h-628l-43 -97l-43 97h-198v-44l-22 44h-169l-78 -179v391q0 55 38.5 94.5t93.5 39.5h2040 q55 0 93.5 -39.5t38.5 -94.5v-678h-120q-51 0 -81 -22v22h-177q-55 0 -78 -22v22h-316v-22q-31 22 -87 22h-209v-22q-23 22 -91 22h-234l-54 -58l-50 58h-349v-378h343l55 59l52 -59h211v89h21q59 0 90 13v-102h174v99h8q8 0 10 -2t2 -10v-87h529q57 0 88 24v-24h168 q60 0 95 17zM1546 469q0 -23 -12 -43t-34 -29q25 -9 34 -26t9 -46v-54h-65v45q0 33 -12 43.5t-46 10.5h-69v-99h-65v271h154q48 0 77 -15t29 -58zM1269 936q0 -24 -12.5 -44t-33.5 -29q26 -9 34.5 -25.5t8.5 -46.5v-53h-65q0 9 0.5 26.5t0 25t-3 18.5t-8.5 16t-17.5 8.5 t-29.5 3.5h-70v-98h-64v271l153 -1q49 0 78 -14.5t29 -57.5zM1798 327v-56h-216v271h216v-56h-151v-49h148v-55h-148v-54zM1372 1009v-271h-66v271h66zM2065 357q0 -86 -102 -86h-126v58h126q34 0 34 25q0 16 -17 21t-41.5 5t-49.5 3.5t-42 22.5t-17 55q0 39 26 60t66 21 h130v-57h-119q-36 0 -36 -25q0 -16 17.5 -20.5t42 -4t49 -2.5t42 -21.5t17.5 -54.5zM2304 407v-101q-24 -35 -88 -35h-125v58h125q33 0 33 25q0 13 -12.5 19t-31 5.5t-40 2t-40 8t-31 24t-12.5 48.5q0 39 26.5 60t66.5 21h129v-57h-118q-36 0 -36 -25q0 -20 29 -22t68.5 -5 t56.5 -26zM2139 1008v-270h-92l-122 203v-203h-132l-26 60h-134l-25 -60h-75q-129 0 -129 133q0 138 133 138h63v-59q-7 0 -28 1t-28.5 0.5t-23 -2t-21.5 -6.5t-14.5 -13.5t-11.5 -23t-3 -33.5q0 -38 13.5 -58t49.5 -20h29l92 213h97l109 -256v256h99l114 -188v188h66z" /> +<glyph unicode="" horiz-adv-x="2304" d="M745 630q0 -37 -25.5 -61.5t-62.5 -24.5q-29 0 -46.5 16t-17.5 44q0 37 25 62.5t62 25.5q28 0 46.5 -16.5t18.5 -45.5zM1530 779q0 -42 -22 -57t-66 -15l-32 -1l17 107q2 11 13 11h18q22 0 35 -2t25 -12.5t12 -30.5zM1881 630q0 -36 -25.5 -61t-61.5 -25q-29 0 -47 16 t-18 44q0 37 25 62.5t62 25.5q28 0 46.5 -16.5t18.5 -45.5zM513 801q0 59 -38.5 85.5t-100.5 26.5h-160q-19 0 -21 -19l-65 -408q-1 -6 3 -11t10 -5h76q20 0 22 19l18 110q1 8 7 13t15 6.5t17 1.5t19 -1t14 -1q86 0 135 48.5t49 134.5zM822 489l41 261q1 6 -3 11t-10 5h-76 q-14 0 -17 -33q-27 40 -95 40q-72 0 -122.5 -54t-50.5 -127q0 -59 34.5 -94t92.5 -35q28 0 58 12t48 32q-4 -12 -4 -21q0 -16 13 -16h69q19 0 22 19zM1269 752q0 5 -4 9.5t-9 4.5h-77q-11 0 -18 -10l-106 -156l-44 150q-5 16 -22 16h-75q-5 0 -9 -4.5t-4 -9.5q0 -2 19.5 -59 t42 -123t23.5 -70q-82 -112 -82 -120q0 -13 13 -13h77q11 0 18 10l255 368q2 2 2 7zM1649 801q0 59 -38.5 85.5t-100.5 26.5h-159q-20 0 -22 -19l-65 -408q-1 -6 3 -11t10 -5h82q12 0 16 13l18 116q1 8 7 13t15 6.5t17 1.5t19 -1t14 -1q86 0 135 48.5t49 134.5zM1958 489 l41 261q1 6 -3 11t-10 5h-76q-14 0 -17 -33q-26 40 -95 40q-72 0 -122.5 -54t-50.5 -127q0 -59 34.5 -94t92.5 -35q29 0 59 12t47 32q0 -1 -2 -9t-2 -12q0 -16 13 -16h69q19 0 22 19zM2176 898v1q0 14 -13 14h-74q-11 0 -13 -11l-65 -416l-1 -2q0 -5 4 -9.5t10 -4.5h66 q19 0 21 19zM392 764q-5 -35 -26 -46t-60 -11l-33 -1l17 107q2 11 13 11h19q40 0 58 -11.5t12 -48.5zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" /> +<glyph unicode="" horiz-adv-x="2304" d="M1597 633q0 -69 -21 -106q-19 -35 -52 -35q-23 0 -41 9v224q29 30 57 30q57 0 57 -122zM2035 669h-110q6 98 56 98q51 0 54 -98zM476 534q0 59 -33 91.5t-101 57.5q-36 13 -52 24t-16 25q0 26 38 26q58 0 124 -33l18 112q-67 32 -149 32q-77 0 -123 -38q-48 -39 -48 -109 q0 -58 32.5 -90.5t99.5 -56.5q39 -14 54.5 -25.5t15.5 -27.5q0 -31 -48 -31q-29 0 -70 12.5t-72 30.5l-18 -113q72 -41 168 -41q81 0 129 37q51 41 51 117zM771 749l19 111h-96v135l-129 -21l-18 -114l-46 -8l-17 -103h62v-219q0 -84 44 -120q38 -30 111 -30q32 0 79 11v118 q-32 -7 -44 -7q-42 0 -42 50v197h77zM1087 724v139q-15 3 -28 3q-32 0 -55.5 -16t-33.5 -46l-10 56h-131v-471h150v306q26 31 82 31q16 0 26 -2zM1124 389h150v471h-150v-471zM1746 638q0 122 -45 179q-40 52 -111 52q-64 0 -117 -56l-8 47h-132v-645l150 25v151 q36 -11 68 -11q83 0 134 56q61 65 61 202zM1278 986q0 33 -23 56t-56 23t-56 -23t-23 -56t23 -56.5t56 -23.5t56 23.5t23 56.5zM2176 629q0 113 -48 176q-50 64 -144 64q-96 0 -151.5 -66t-55.5 -180q0 -128 63 -188q55 -55 161 -55q101 0 160 40l-16 103q-57 -31 -128 -31 q-43 0 -63 19q-23 19 -28 66h248q2 14 2 52zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1558 684q61 -356 298 -556q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-180.5 74.5t-75.5 180.5zM1024 -176q16 0 16 16t-16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5zM2026 1424q8 -10 7.5 -23.5t-10.5 -22.5 l-1872 -1622q-10 -8 -23.5 -7t-21.5 11l-84 96q-8 10 -7.5 23.5t10.5 21.5l186 161q-19 32 -19 66q50 42 91 88t85 119.5t74.5 158.5t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q124 -18 219 -82.5t148 -157.5 l418 363q10 8 23.5 7t21.5 -11z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1040 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM503 315l877 760q-42 88 -132.5 146.5t-223.5 58.5q-93 0 -169.5 -31.5t-121.5 -80.5t-69 -103t-24 -105q0 -384 -137 -645zM1856 128 q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-180.5 74.5t-75.5 180.5l149 129h757q-166 187 -227 459l111 97q61 -356 298 -556zM1942 1520l84 -96q8 -10 7.5 -23.5t-10.5 -22.5l-1872 -1622q-10 -8 -23.5 -7t-21.5 11l-84 96q-8 10 -7.5 23.5t10.5 21.5l186 161 q-19 32 -19 66q50 42 91 88t85 119.5t74.5 158.5t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q124 -18 219 -82.5t148 -157.5l418 363q10 8 23.5 7t21.5 -11z" /> +<glyph unicode="" horiz-adv-x="1408" d="M512 160v704q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-704q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM768 160v704q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-704q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1024 160v704q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-704 q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM480 1152h448l-48 117q-7 9 -17 11h-317q-10 -2 -17 -11zM1408 1120v-64q0 -14 -9 -23t-23 -9h-96v-948q0 -83 -47 -143.5t-113 -60.5h-832q-66 0 -113 58.5t-47 141.5v952h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h309l70 167 q15 37 54 63t79 26h320q40 0 79 -26t54 -63l70 -167h309q14 0 23 -9t9 -23z" /> +<glyph unicode="" d="M1150 462v-109q0 -50 -36.5 -89t-94 -60.5t-118 -32.5t-117.5 -11q-205 0 -342.5 139t-137.5 346q0 203 136 339t339 136q34 0 75.5 -4.5t93 -18t92.5 -34t69 -56.5t28 -81v-109q0 -16 -16 -16h-118q-16 0 -16 16v70q0 43 -65.5 67.5t-137.5 24.5q-140 0 -228.5 -91.5 t-88.5 -237.5q0 -151 91.5 -249.5t233.5 -98.5q68 0 138 24t70 66v70q0 7 4.5 11.5t10.5 4.5h119q6 0 11 -4.5t5 -11.5zM768 1280q-130 0 -248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5 t-51 248.5t-136.5 204t-204 136.5t-248.5 51zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M972 761q0 108 -53.5 169t-147.5 61q-63 0 -124 -30.5t-110 -84.5t-79.5 -137t-30.5 -180q0 -112 53.5 -173t150.5 -61q96 0 176 66.5t122.5 166t42.5 203.5zM1536 640q0 -111 -37 -197t-98.5 -135t-131.5 -74.5t-145 -27.5q-6 0 -15.5 -0.5t-16.5 -0.5q-95 0 -142 53 q-28 33 -33 83q-52 -66 -131.5 -110t-173.5 -44q-161 0 -249.5 95.5t-88.5 269.5q0 157 66 290t179 210.5t246 77.5q87 0 155 -35.5t106 -99.5l2 19l11 56q1 6 5.5 12t9.5 6h118q5 0 13 -11q5 -5 3 -16l-120 -614q-5 -24 -5 -48q0 -39 12.5 -52t44.5 -13q28 1 57 5.5t73 24 t77 50t57 89.5t24 137q0 292 -174 466t-466 174q-130 0 -248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51q228 0 405 144q11 9 24 8t21 -12l41 -49q8 -12 7 -24q-2 -13 -12 -22q-102 -83 -227.5 -128t-258.5 -45q-156 0 -298 61 t-245 164t-164 245t-61 298t61 298t164 245t245 164t298 61q344 0 556 -212t212 -556z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1698 1442q94 -94 94 -226.5t-94 -225.5l-225 -223l104 -104q10 -10 10 -23t-10 -23l-210 -210q-10 -10 -23 -10t-23 10l-105 105l-603 -603q-37 -37 -90 -37h-203l-256 -128l-64 64l128 256v203q0 53 37 90l603 603l-105 105q-10 10 -10 23t10 23l210 210q10 10 23 10 t23 -10l104 -104l223 225q93 94 225.5 94t226.5 -94zM512 64l576 576l-192 192l-576 -576v-192h192z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1615 1536q70 0 122.5 -46.5t52.5 -116.5q0 -63 -45 -151q-332 -629 -465 -752q-97 -91 -218 -91q-126 0 -216.5 92.5t-90.5 219.5q0 128 92 212l638 579q59 54 130 54zM706 502q39 -76 106.5 -130t150.5 -76l1 -71q4 -213 -129.5 -347t-348.5 -134q-123 0 -218 46.5 t-152.5 127.5t-86.5 183t-29 220q7 -5 41 -30t62 -44.5t59 -36.5t46 -17q41 0 55 37q25 66 57.5 112.5t69.5 76t88 47.5t103 25.5t125 10.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 128v-384h-1792v384q45 0 85 14t59 27.5t47 37.5q30 27 51.5 38t56.5 11t55.5 -11t52.5 -38q29 -25 47 -38t58 -27t86 -14q45 0 85 14.5t58 27t48 37.5q21 19 32.5 27t31 15t43.5 7q35 0 56.5 -11t51.5 -38q28 -24 47 -37.5t59 -27.5t85 -14t85 14t59 27.5t47 37.5 q30 27 51.5 38t56.5 11q34 0 55.5 -11t51.5 -38q28 -24 47 -37.5t59 -27.5t85 -14zM1792 448v-192q-35 0 -55.5 11t-52.5 38q-29 25 -47 38t-58 27t-85 14q-46 0 -86 -14t-58 -27t-47 -38q-22 -19 -33 -27t-31 -15t-44 -7q-35 0 -56.5 11t-51.5 38q-29 25 -47 38t-58 27 t-86 14q-45 0 -85 -14.5t-58 -27t-48 -37.5q-21 -19 -32.5 -27t-31 -15t-43.5 -7q-35 0 -56.5 11t-51.5 38q-28 24 -47 37.5t-59 27.5t-85 14q-46 0 -86 -14t-58 -27t-47 -38q-30 -27 -51.5 -38t-56.5 -11v192q0 80 56 136t136 56h64v448h256v-448h256v448h256v-448h256v448 h256v-448h64q80 0 136 -56t56 -136zM512 1312q0 -77 -36 -118.5t-92 -41.5q-53 0 -90.5 37.5t-37.5 90.5q0 29 9.5 51t23.5 34t31 28t31 31.5t23.5 44.5t9.5 67q38 0 83 -74t45 -150zM1024 1312q0 -77 -36 -118.5t-92 -41.5q-53 0 -90.5 37.5t-37.5 90.5q0 29 9.5 51 t23.5 34t31 28t31 31.5t23.5 44.5t9.5 67q38 0 83 -74t45 -150zM1536 1312q0 -77 -36 -118.5t-92 -41.5q-53 0 -90.5 37.5t-37.5 90.5q0 29 9.5 51t23.5 34t31 28t31 31.5t23.5 44.5t9.5 67q38 0 83 -74t45 -150z" /> +<glyph unicode="" horiz-adv-x="2048" d="M2048 0v-128h-2048v1536h128v-1408h1920zM1664 1024l256 -896h-1664v576l448 576l576 -576z" /> +<glyph unicode="" horiz-adv-x="1792" d="M768 646l546 -546q-106 -108 -247.5 -168t-298.5 -60q-209 0 -385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103v-762zM955 640h773q0 -157 -60 -298.5t-168 -247.5zM1664 768h-768v768q209 0 385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="2048" d="M2048 0v-128h-2048v1536h128v-1408h1920zM1920 1248v-435q0 -21 -19.5 -29.5t-35.5 7.5l-121 121l-633 -633q-10 -10 -23 -10t-23 10l-233 233l-416 -416l-192 192l585 585q10 10 23 10t23 -10l233 -233l464 464l-121 121q-16 16 -7.5 35.5t29.5 19.5h435q14 0 23 -9 t9 -23z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1292 832q0 -6 10 -41q10 -29 25 -49.5t41 -34t44 -20t55 -16.5q325 -91 325 -332q0 -146 -105.5 -242.5t-254.5 -96.5q-59 0 -111.5 18.5t-91.5 45.5t-77 74.5t-63 87.5t-53.5 103.5t-43.5 103t-39.5 106.5t-35.5 95q-32 81 -61.5 133.5t-73.5 96.5t-104 64t-142 20 q-96 0 -183 -55.5t-138 -144.5t-51 -185q0 -160 106.5 -279.5t263.5 -119.5q177 0 258 95q56 63 83 116l84 -152q-15 -34 -44 -70l1 -1q-131 -152 -388 -152q-147 0 -269.5 79t-190.5 207.5t-68 274.5q0 105 43.5 206t116 176.5t172 121.5t204.5 46q87 0 159 -19t123.5 -50 t95 -80t72.5 -99t58.5 -117t50.5 -124.5t50 -130.5t55 -127q96 -200 233 -200q81 0 138.5 48.5t57.5 128.5q0 42 -19 72t-50.5 46t-72.5 31.5t-84.5 27t-87.5 34t-81 52t-65 82t-39 122.5q-3 16 -3 33q0 110 87.5 192t198.5 78q78 -3 120.5 -14.5t90.5 -53.5h-1 q12 -11 23 -24.5t26 -36t19 -27.5l-129 -99q-26 49 -54 70v1q-23 21 -97 21q-49 0 -84 -33t-35 -83z" /> +<glyph unicode="" d="M1432 484q0 173 -234 239q-35 10 -53 16.5t-38 25t-29 46.5q0 2 -2 8.5t-3 12t-1 7.5q0 36 24.5 59.5t60.5 23.5q54 0 71 -15h-1q20 -15 39 -51l93 71q-39 54 -49 64q-33 29 -67.5 39t-85.5 10q-80 0 -142 -57.5t-62 -137.5q0 -7 2 -23q16 -96 64.5 -140t148.5 -73 q29 -8 49 -15.5t45 -21.5t38.5 -34.5t13.5 -46.5v-5q1 -58 -40.5 -93t-100.5 -35q-97 0 -167 144q-23 47 -51.5 121.5t-48 125.5t-54 110.5t-74 95.5t-103.5 60.5t-147 24.5q-101 0 -192 -56t-144 -148t-50 -192v-1q4 -108 50.5 -199t133.5 -147.5t196 -56.5q186 0 279 110 q20 27 31 51l-60 109q-42 -80 -99 -116t-146 -36q-115 0 -191 87t-76 204q0 105 82 189t186 84q112 0 170 -53.5t104 -172.5q8 -21 25.5 -68.5t28.5 -76.5t31.5 -74.5t38.5 -74t45.5 -62.5t55.5 -53.5t66 -33t80 -13.5q107 0 183 69.5t76 174.5zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1152 640q0 104 -40.5 198.5t-109.5 163.5t-163.5 109.5t-198.5 40.5t-198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5t198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5zM1920 640q0 104 -40.5 198.5 t-109.5 163.5t-163.5 109.5t-198.5 40.5h-386q119 -90 188.5 -224t69.5 -288t-69.5 -288t-188.5 -224h386q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5zM2048 640q0 -130 -51 -248.5t-136.5 -204t-204 -136.5t-248.5 -51h-768q-130 0 -248.5 51t-204 136.5 t-136.5 204t-51 248.5t51 248.5t136.5 204t204 136.5t248.5 51h768q130 0 248.5 -51t204 -136.5t136.5 -204t51 -248.5z" /> +<glyph unicode="" horiz-adv-x="2048" d="M0 640q0 130 51 248.5t136.5 204t204 136.5t248.5 51h768q130 0 248.5 -51t204 -136.5t136.5 -204t51 -248.5t-51 -248.5t-136.5 -204t-204 -136.5t-248.5 -51h-768q-130 0 -248.5 51t-204 136.5t-136.5 204t-51 248.5zM1408 128q104 0 198.5 40.5t163.5 109.5 t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5t-163.5 109.5t-198.5 40.5t-198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5z" /> +<glyph unicode="" horiz-adv-x="2304" d="M762 384h-314q-40 0 -57.5 35t6.5 67l188 251q-65 31 -137 31q-132 0 -226 -94t-94 -226t94 -226t226 -94q115 0 203 72.5t111 183.5zM576 512h186q-18 85 -75 148zM1056 512l288 384h-480l-99 -132q105 -103 126 -252h165zM2176 448q0 132 -94 226t-226 94 q-60 0 -121 -24l174 -260q15 -23 10 -49t-27 -40q-15 -11 -36 -11q-35 0 -53 29l-174 260q-93 -95 -93 -225q0 -132 94 -226t226 -94t226 94t94 226zM2304 448q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 97 39.5 183.5t109.5 149.5l-65 98l-353 -469 q-18 -26 -51 -26h-197q-23 -164 -149 -274t-294 -110q-185 0 -316.5 131.5t-131.5 316.5t131.5 316.5t316.5 131.5q114 0 215 -55l137 183h-224q-26 0 -45 19t-19 45t19 45t45 19h384v-128h435l-85 128h-222q-26 0 -45 19t-19 45t19 45t45 19h256q33 0 53 -28l267 -400 q91 44 192 44q185 0 316.5 -131.5t131.5 -316.5z" /> +<glyph unicode="" d="M384 320q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1408 320q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1362 716l-72 384q-5 23 -22.5 37.5t-40.5 14.5 h-918q-23 0 -40.5 -14.5t-22.5 -37.5l-72 -384q-5 -30 14 -53t49 -23h1062q30 0 49 23t14 53zM1136 1328q0 20 -14 34t-34 14h-640q-20 0 -34 -14t-14 -34t14 -34t34 -14h640q20 0 34 14t14 34zM1536 603v-603h-128v-128q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 t-37.5 90.5v128h-768v-128q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5v128h-128v603q0 112 25 223l103 454q9 78 97.5 137t230 89t312.5 30t312.5 -30t230 -89t97.5 -137l105 -454q23 -102 23 -223z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1463 704q0 -35 -25 -60.5t-61 -25.5h-702q-36 0 -61 25.5t-25 60.5t25 60.5t61 25.5h702q36 0 61 -25.5t25 -60.5zM1677 704q0 86 -23 170h-982q-36 0 -61 25t-25 60q0 36 25 61t61 25h908q-88 143 -235 227t-320 84q-177 0 -327.5 -87.5t-238 -237.5t-87.5 -327 q0 -86 23 -170h982q36 0 61 -25t25 -60q0 -36 -25 -61t-61 -25h-908q88 -143 235.5 -227t320.5 -84q132 0 253 51.5t208 139t139 208t52 253.5zM2048 959q0 -35 -25 -60t-61 -25h-131q17 -85 17 -170q0 -167 -65.5 -319.5t-175.5 -263t-262.5 -176t-319.5 -65.5 q-246 0 -448.5 133t-301.5 350h-189q-36 0 -61 25t-25 61q0 35 25 60t61 25h132q-17 85 -17 170q0 167 65.5 319.5t175.5 263t262.5 176t320.5 65.5q245 0 447.5 -133t301.5 -350h188q36 0 61 -25t25 -61z" /> +<glyph unicode="" horiz-adv-x="1280" d="M953 1158l-114 -328l117 -21q165 451 165 518q0 56 -38 56q-57 0 -130 -225zM654 471l33 -88q37 42 71 67l-33 5.5t-38.5 7t-32.5 8.5zM362 1367q0 -98 159 -521q18 10 49 10q15 0 75 -5l-121 351q-75 220 -123 220q-19 0 -29 -17.5t-10 -37.5zM283 608q0 -36 51.5 -119 t117.5 -153t100 -70q14 0 25.5 13t11.5 27q0 24 -32 102q-13 32 -32 72t-47.5 89t-61.5 81t-62 32q-20 0 -45.5 -27t-25.5 -47zM125 273q0 -41 25 -104q59 -145 183.5 -227t281.5 -82q227 0 382 170q152 169 152 427q0 43 -1 67t-11.5 62t-30.5 56q-56 49 -211.5 75.5 t-270.5 26.5q-37 0 -49 -11q-12 -5 -12 -35q0 -34 21.5 -60t55.5 -40t77.5 -23.5t87.5 -11.5t85 -4t70 0h23q24 0 40 -19q15 -19 19 -55q-28 -28 -96 -54q-61 -22 -93 -46q-64 -46 -108.5 -114t-44.5 -137q0 -31 18.5 -88.5t18.5 -87.5l-3 -12q-4 -12 -4 -14 q-137 10 -146 216q-8 -2 -41 -2q2 -7 2 -21q0 -53 -40.5 -89.5t-94.5 -36.5q-82 0 -166.5 78t-84.5 159q0 34 33 67q52 -64 60 -76q77 -104 133 -104q12 0 26.5 8.5t14.5 20.5q0 34 -87.5 145t-116.5 111q-43 0 -70 -44.5t-27 -90.5zM11 264q0 101 42.5 163t136.5 88 q-28 74 -28 104q0 62 61 123t122 61q29 0 70 -15q-163 462 -163 567q0 80 41 130.5t119 50.5q131 0 325 -581q6 -17 8 -23q6 16 29 79.5t43.5 118.5t54 127.5t64.5 123t70.5 86.5t76.5 36q71 0 112 -49t41 -122q0 -108 -159 -550q61 -15 100.5 -46t58.5 -78t26 -93.5 t7 -110.5q0 -150 -47 -280t-132 -225t-211 -150t-278 -55q-111 0 -223 42q-149 57 -258 191.5t-109 286.5z" /> +<glyph unicode="" horiz-adv-x="2048" d="M785 528h207q-14 -158 -98.5 -248.5t-214.5 -90.5q-162 0 -254.5 116t-92.5 316q0 194 93 311.5t233 117.5q148 0 232 -87t97 -247h-203q-5 64 -35.5 99t-81.5 35q-57 0 -88.5 -60.5t-31.5 -177.5q0 -48 5 -84t18 -69.5t40 -51.5t66 -18q95 0 109 139zM1497 528h206 q-14 -158 -98 -248.5t-214 -90.5q-162 0 -254.5 116t-92.5 316q0 194 93 311.5t233 117.5q148 0 232 -87t97 -247h-204q-4 64 -35 99t-81 35q-57 0 -88.5 -60.5t-31.5 -177.5q0 -48 5 -84t18 -69.5t39.5 -51.5t65.5 -18q49 0 76.5 38t33.5 101zM1856 647q0 207 -15.5 307 t-60.5 161q-6 8 -13.5 14t-21.5 15t-16 11q-86 63 -697 63q-625 0 -710 -63q-5 -4 -17.5 -11.5t-21 -14t-14.5 -14.5q-45 -60 -60 -159.5t-15 -308.5q0 -208 15 -307.5t60 -160.5q6 -8 15 -15t20.5 -14t17.5 -12q44 -33 239.5 -49t470.5 -16q610 0 697 65q5 4 17 11t20.5 14 t13.5 16q46 60 61 159t15 309zM2048 1408v-1536h-2048v1536h2048z" /> +<glyph unicode="" d="M992 912v-496q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v496q0 112 -80 192t-192 80h-272v-1152q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v1344q0 14 9 23t23 9h464q135 0 249 -66.5t180.5 -180.5t66.5 -249zM1376 1376v-880q0 -135 -66.5 -249t-180.5 -180.5 t-249 -66.5h-464q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h160q14 0 23 -9t9 -23v-768h272q112 0 192 80t80 192v880q0 14 9 23t23 9h160q14 0 23 -9t9 -23z" /> +<glyph unicode="" d="M1311 694v-114q0 -24 -13.5 -38t-37.5 -14h-202q-24 0 -38 14t-14 38v114q0 24 14 38t38 14h202q24 0 37.5 -14t13.5 -38zM821 464v250q0 53 -32.5 85.5t-85.5 32.5h-133q-68 0 -96 -52q-28 52 -96 52h-130q-53 0 -85.5 -32.5t-32.5 -85.5v-250q0 -22 21 -22h55 q22 0 22 22v230q0 24 13.5 38t38.5 14h94q24 0 38 -14t14 -38v-230q0 -22 21 -22h54q22 0 22 22v230q0 24 14 38t38 14h97q24 0 37.5 -14t13.5 -38v-230q0 -22 22 -22h55q21 0 21 22zM1410 560v154q0 53 -33 85.5t-86 32.5h-264q-53 0 -86 -32.5t-33 -85.5v-410 q0 -21 22 -21h55q21 0 21 21v180q31 -42 94 -42h191q53 0 86 32.5t33 85.5zM1536 1176v-1072q0 -96 -68 -164t-164 -68h-1072q-96 0 -164 68t-68 164v1072q0 96 68 164t164 68h1072q96 0 164 -68t68 -164z" /> +<glyph unicode="" d="M915 450h-294l147 551zM1001 128h311l-324 1024h-440l-324 -1024h311l383 314zM1536 1120v-960q0 -118 -85 -203t-203 -85h-960q-118 0 -203 85t-85 203v960q0 118 85 203t203 85h960q118 0 203 -85t85 -203z" /> +<glyph unicode="" horiz-adv-x="2048" d="M2048 641q0 -21 -13 -36.5t-33 -19.5l-205 -356q3 -9 3 -18q0 -20 -12.5 -35.5t-32.5 -19.5l-193 -337q3 -8 3 -16q0 -23 -16.5 -40t-40.5 -17q-25 0 -41 18h-400q-17 -20 -43 -20t-43 20h-399q-17 -20 -43 -20q-23 0 -40 16.5t-17 40.5q0 8 4 20l-193 335 q-20 4 -32.5 19.5t-12.5 35.5q0 9 3 18l-206 356q-20 5 -32.5 20.5t-12.5 35.5q0 21 13.5 36.5t33.5 19.5l199 344q0 1 -0.5 3t-0.5 3q0 36 34 51l209 363q-4 10 -4 18q0 24 17 40.5t40 16.5q26 0 44 -21h396q16 21 43 21t43 -21h398q18 21 44 21q23 0 40 -16.5t17 -40.5 q0 -6 -4 -18l207 -358q23 -1 39 -17.5t16 -38.5q0 -13 -7 -27l187 -324q19 -4 31.5 -19.5t12.5 -35.5zM1063 -158h389l-342 354h-143l-342 -354h360q18 16 39 16t39 -16zM112 654q1 -4 1 -13q0 -10 -2 -15l208 -360q2 0 4.5 -1t5.5 -2.5l5 -2.5l188 199v347l-187 194 q-13 -8 -29 -10zM986 1438h-388l190 -200l554 200h-280q-16 -16 -38 -16t-38 16zM1689 226q1 6 5 11l-64 68l-17 -79h76zM1583 226l22 105l-252 266l-296 -307l63 -64h463zM1495 -142l16 28l65 310h-427l333 -343q8 4 13 5zM578 -158h5l342 354h-373v-335l4 -6q14 -5 22 -13 zM552 226h402l64 66l-309 321l-157 -166v-221zM359 226h163v189l-168 -177q4 -8 5 -12zM358 1051q0 -1 0.5 -2t0.5 -2q0 -16 -8 -29l171 -177v269zM552 1121v-311l153 -157l297 314l-223 236zM556 1425l-4 -8v-264l205 74l-191 201q-6 -2 -10 -3zM1447 1438h-16l-621 -224 l213 -225zM1023 946l-297 -315l311 -319l296 307zM688 634l-136 141v-284zM1038 270l-42 -44h85zM1374 618l238 -251l132 624l-3 5l-1 1zM1718 1018q-8 13 -8 29v2l-216 376q-5 1 -13 5l-437 -463l310 -327zM522 1142v223l-163 -282zM522 196h-163l163 -283v283zM1607 196 l-48 -227l130 227h-82zM1729 266l207 361q-2 10 -2 14q0 1 3 16l-171 296l-129 -612l77 -82q5 3 15 7z" /> +<glyph unicode="" d="M0 856q0 131 91.5 226.5t222.5 95.5h742l352 358v-1470q0 -132 -91.5 -227t-222.5 -95h-780q-131 0 -222.5 95t-91.5 227v790zM1232 102l-176 180v425q0 46 -32 79t-78 33h-484q-46 0 -78 -33t-32 -79v-492q0 -46 32.5 -79.5t77.5 -33.5h770z" /> +<glyph unicode="" d="M934 1386q-317 -121 -556 -362.5t-358 -560.5q-20 89 -20 176q0 208 102.5 384.5t278.5 279t384 102.5q82 0 169 -19zM1203 1267q93 -65 164 -155q-389 -113 -674.5 -400.5t-396.5 -676.5q-93 72 -155 162q112 386 395 671t667 399zM470 -67q115 356 379.5 622t619.5 384 q40 -92 54 -195q-292 -120 -516 -345t-343 -518q-103 14 -194 52zM1536 -125q-193 50 -367 115q-135 -84 -290 -107q109 205 274 370.5t369 275.5q-21 -152 -101 -284q65 -175 115 -370z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1893 1144l155 -1272q-131 0 -257 57q-200 91 -393 91q-226 0 -374 -148q-148 148 -374 148q-193 0 -393 -91q-128 -57 -252 -57h-5l155 1272q224 127 482 127q233 0 387 -106q154 106 387 106q258 0 482 -127zM1398 157q129 0 232 -28.5t260 -93.5l-124 1021 q-171 78 -368 78q-224 0 -374 -141q-150 141 -374 141q-197 0 -368 -78l-124 -1021q105 43 165.5 65t148.5 39.5t178 17.5q202 0 374 -108q172 108 374 108zM1438 191l-55 907q-211 -4 -359 -155q-152 155 -374 155q-176 0 -336 -66l-114 -941q124 51 228.5 76t221.5 25 q209 0 374 -102q172 107 374 102z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1500 165v733q0 21 -15 36t-35 15h-93q-20 0 -35 -15t-15 -36v-733q0 -20 15 -35t35 -15h93q20 0 35 15t15 35zM1216 165v531q0 20 -15 35t-35 15h-101q-20 0 -35 -15t-15 -35v-531q0 -20 15 -35t35 -15h101q20 0 35 15t15 35zM924 165v429q0 20 -15 35t-35 15h-101 q-20 0 -35 -15t-15 -35v-429q0 -20 15 -35t35 -15h101q20 0 35 15t15 35zM632 165v362q0 20 -15 35t-35 15h-101q-20 0 -35 -15t-15 -35v-362q0 -20 15 -35t35 -15h101q20 0 35 15t15 35zM2048 311q0 -166 -118 -284t-284 -118h-1244q-166 0 -284 118t-118 284 q0 116 63 214.5t168 148.5q-10 34 -10 73q0 113 80.5 193.5t193.5 80.5q102 0 180 -67q45 183 194 300t338 117q149 0 275 -73.5t199.5 -199.5t73.5 -275q0 -66 -14 -122q135 -33 221 -142.5t86 -247.5z" /> +<glyph unicode="" d="M0 1536h1536v-1392l-776 -338l-760 338v1392zM1436 209v926h-1336v-926l661 -294zM1436 1235v201h-1336v-201h1336zM181 937v-115h-37v115h37zM181 789v-115h-37v115h37zM181 641v-115h-37v115h37zM181 493v-115h-37v115h37zM181 345v-115h-37v115h37zM207 202l15 34 l105 -47l-15 -33zM343 142l15 34l105 -46l-15 -34zM478 82l15 34l105 -46l-15 -34zM614 23l15 33l104 -46l-15 -34zM797 10l105 46l15 -33l-105 -47zM932 70l105 46l15 -34l-105 -46zM1068 130l105 46l15 -34l-105 -46zM1203 189l105 47l15 -34l-105 -46zM259 1389v-36h-114 v36h114zM421 1389v-36h-115v36h115zM583 1389v-36h-115v36h115zM744 1389v-36h-114v36h114zM906 1389v-36h-114v36h114zM1068 1389v-36h-115v36h115zM1230 1389v-36h-115v36h115zM1391 1389v-36h-114v36h114zM181 1049v-79h-37v115h115v-36h-78zM421 1085v-36h-115v36h115z M583 1085v-36h-115v36h115zM744 1085v-36h-114v36h114zM906 1085v-36h-114v36h114zM1068 1085v-36h-115v36h115zM1230 1085v-36h-115v36h115zM1355 970v79h-78v36h115v-115h-37zM1355 822v115h37v-115h-37zM1355 674v115h37v-115h-37zM1355 526v115h37v-115h-37zM1355 378 v115h37v-115h-37zM1355 230v115h37v-115h-37zM760 265q-129 0 -221 91.5t-92 221.5q0 129 92 221t221 92q130 0 221.5 -92t91.5 -221q0 -130 -91.5 -221.5t-221.5 -91.5zM595 646q0 -36 19.5 -56.5t49.5 -25t64 -7t64 -2t49.5 -9t19.5 -30.5q0 -49 -112 -49q-97 0 -123 51 h-3l-31 -63q67 -42 162 -42q29 0 56.5 5t55.5 16t45.5 33t17.5 53q0 46 -27.5 69.5t-67.5 27t-79.5 3t-67 5t-27.5 25.5q0 21 20.5 33t40.5 15t41 3q34 0 70.5 -11t51.5 -34h3l30 58q-3 1 -21 8.5t-22.5 9t-19.5 7t-22 7t-20 4.5t-24 4t-23 1q-29 0 -56.5 -5t-54 -16.5 t-43 -34t-16.5 -53.5z" /> +<glyph unicode="" horiz-adv-x="2048" d="M863 504q0 112 -79.5 191.5t-191.5 79.5t-191 -79.5t-79 -191.5t79 -191t191 -79t191.5 79t79.5 191zM1726 505q0 112 -79 191t-191 79t-191.5 -79t-79.5 -191q0 -113 79.5 -192t191.5 -79t191 79.5t79 191.5zM2048 1314v-1348q0 -44 -31.5 -75.5t-76.5 -31.5h-1832 q-45 0 -76.5 31.5t-31.5 75.5v1348q0 44 31.5 75.5t76.5 31.5h431q44 0 76 -31.5t32 -75.5v-161h754v161q0 44 32 75.5t76 31.5h431q45 0 76.5 -31.5t31.5 -75.5z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1430 953zM1690 749q148 0 253 -98.5t105 -244.5q0 -157 -109 -261.5t-267 -104.5q-85 0 -162 27.5t-138 73.5t-118 106t-109 126.5t-103.5 132.5t-108.5 126t-117 106t-136 73.5t-159 27.5q-154 0 -251.5 -91.5t-97.5 -244.5q0 -157 104 -250t263 -93q100 0 208 37.5 t193 98.5q5 4 21 18.5t30 24t22 9.5q14 0 24.5 -10.5t10.5 -24.5q0 -24 -60 -77q-101 -88 -234.5 -142t-260.5 -54q-133 0 -245.5 58t-180 165t-67.5 241q0 205 141.5 341t347.5 136q120 0 226.5 -43.5t185.5 -113t151.5 -153t139 -167.5t133.5 -153.5t149.5 -113 t172.5 -43.5q102 0 168.5 61.5t66.5 162.5q0 95 -64.5 159t-159.5 64q-30 0 -81.5 -18.5t-68.5 -18.5q-20 0 -35.5 15t-15.5 35q0 18 8.5 57t8.5 59q0 159 -107.5 263t-266.5 104q-58 0 -111.5 -18.5t-84 -40.5t-55.5 -40.5t-33 -18.5q-15 0 -25.5 10.5t-10.5 25.5 q0 19 25 46q59 67 147 103.5t182 36.5q191 0 318 -125.5t127 -315.5q0 -37 -4 -66q57 15 115 15z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1216 832q0 26 -19 45t-45 19h-128v128q0 26 -19 45t-45 19t-45 -19t-19 -45v-128h-128q-26 0 -45 -19t-19 -45t19 -45t45 -19h128v-128q0 -26 19 -45t45 -19t45 19t19 45v128h128q26 0 45 19t19 45zM640 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5 t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1536 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1664 1088v-512q0 -24 -16 -42.5t-41 -21.5l-1044 -122q1 -7 4.5 -21.5t6 -26.5t2.5 -22q0 -16 -24 -64h920 q26 0 45 -19t19 -45t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 14 11 39.5t29.5 59.5t20.5 38l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t20 -15.5t13 -24.5t7.5 -26.5t5.5 -29.5t4.5 -25.5h1201q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1664" d="M1280 832q0 26 -19 45t-45 19t-45 -19l-147 -146v293q0 26 -19 45t-45 19t-45 -19t-19 -45v-293l-147 146q-19 19 -45 19t-45 -19t-19 -45t19 -45l256 -256q19 -19 45 -19t45 19l256 256q19 19 19 45zM640 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5 t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1536 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1664 1088v-512q0 -24 -16 -42.5t-41 -21.5l-1044 -122q1 -7 4.5 -21.5t6 -26.5t2.5 -22q0 -16 -24 -64h920 q26 0 45 -19t19 -45t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 14 11 39.5t29.5 59.5t20.5 38l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t20 -15.5t13 -24.5t7.5 -26.5t5.5 -29.5t4.5 -25.5h1201q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="2048" d="M212 768l623 -665l-300 665h-323zM1024 -4l349 772h-698zM538 896l204 384h-262l-288 -384h346zM1213 103l623 665h-323zM683 896h682l-204 384h-274zM1510 896h346l-288 384h-262zM1651 1382l384 -512q14 -18 13 -41.5t-17 -40.5l-960 -1024q-18 -20 -47 -20t-47 20 l-960 1024q-16 17 -17 40.5t13 41.5l384 512q18 26 51 26h1152q33 0 51 -26z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1811 -19q19 19 45 19t45 -19l128 -128l-90 -90l-83 83l-83 -83q-18 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83 q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-128 128l90 90l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83 q19 19 45 19t45 -19l83 -83zM237 19q-19 -19 -45 -19t-45 19l-128 128l90 90l83 -82l83 82q19 19 45 19t45 -19l83 -82l64 64v293l-210 314q-17 26 -7 56.5t40 40.5l177 58v299h128v128h256v128h256v-128h256v-128h128v-299l177 -58q30 -10 40 -40.5t-7 -56.5l-210 -314 v-293l19 18q19 19 45 19t45 -19l83 -82l83 82q19 19 45 19t45 -19l128 -128l-90 -90l-83 83l-83 -83q-18 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83 q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83zM640 1152v-128l384 128l384 -128v128h-128v128h-512v-128h-128z" /> +<glyph unicode="" d="M576 0l96 448l-96 128l-128 64zM832 0l128 640l-128 -64l-96 -128zM992 1010q-2 4 -4 6q-10 8 -96 8q-70 0 -167 -19q-7 -2 -21 -2t-21 2q-97 19 -167 19q-86 0 -96 -8q-2 -2 -4 -6q2 -18 4 -27q2 -3 7.5 -6.5t7.5 -10.5q2 -4 7.5 -20.5t7 -20.5t7.5 -17t8.5 -17t9 -14 t12 -13.5t14 -9.5t17.5 -8t20.5 -4t24.5 -2q36 0 59 12.5t32.5 30t14.5 34.5t11.5 29.5t17.5 12.5h12q11 0 17.5 -12.5t11.5 -29.5t14.5 -34.5t32.5 -30t59 -12.5q13 0 24.5 2t20.5 4t17.5 8t14 9.5t12 13.5t9 14t8.5 17t7.5 17t7 20.5t7.5 20.5q2 7 7.5 10.5t7.5 6.5 q2 9 4 27zM1408 131q0 -121 -73 -190t-194 -69h-874q-121 0 -194 69t-73 190q0 61 4.5 118t19 125.5t37.5 123.5t63.5 103.5t93.5 74.5l-90 220h214q-22 64 -22 128q0 12 2 32q-194 40 -194 96q0 57 210 99q17 62 51.5 134t70.5 114q32 37 76 37q30 0 84 -31t84 -31t84 31 t84 31q44 0 76 -37q36 -42 70.5 -114t51.5 -134q210 -42 210 -99q0 -56 -194 -96q7 -81 -20 -160h214l-82 -225q63 -33 107.5 -96.5t65.5 -143.5t29 -151.5t8 -148.5z" /> +<glyph unicode="" horiz-adv-x="2304" d="M2301 500q12 -103 -22 -198.5t-99 -163.5t-158.5 -106t-196.5 -31q-161 11 -279.5 125t-134.5 274q-12 111 27.5 210.5t118.5 170.5l-71 107q-96 -80 -151 -194t-55 -244q0 -27 -18.5 -46.5t-45.5 -19.5h-256h-69q-23 -164 -149 -274t-294 -110q-185 0 -316.5 131.5 t-131.5 316.5t131.5 316.5t316.5 131.5q76 0 152 -27l24 45q-123 110 -304 110h-64q-26 0 -45 19t-19 45t19 45t45 19h128q78 0 145 -13.5t116.5 -38.5t71.5 -39.5t51 -36.5h512h115l-85 128h-222q-30 0 -49 22.5t-14 52.5q4 23 23 38t43 15h253q33 0 53 -28l70 -105 l114 114q19 19 46 19h101q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-179l115 -172q131 63 275 36q143 -26 244 -134.5t118 -253.5zM448 128q115 0 203 72.5t111 183.5h-314q-35 0 -55 31q-18 32 -1 63l147 277q-47 13 -91 13q-132 0 -226 -94t-94 -226t94 -226 t226 -94zM1856 128q132 0 226 94t94 226t-94 226t-226 94q-60 0 -121 -24l174 -260q15 -23 10 -49t-27 -40q-15 -11 -36 -11q-35 0 -53 29l-174 260q-93 -95 -93 -225q0 -132 94 -226t226 -94z" /> +<glyph unicode="" d="M1408 0q0 -63 -61.5 -113.5t-164 -81t-225 -46t-253.5 -15.5t-253.5 15.5t-225 46t-164 81t-61.5 113.5q0 49 33 88.5t91 66.5t118 44.5t131 29.5q26 5 48 -10.5t26 -41.5q5 -26 -10.5 -48t-41.5 -26q-58 -10 -106 -23.5t-76.5 -25.5t-48.5 -23.5t-27.5 -19.5t-8.5 -12 q3 -11 27 -26.5t73 -33t114 -32.5t160.5 -25t201.5 -10t201.5 10t160.5 25t114 33t73 33.5t27 27.5q-1 4 -8.5 11t-27.5 19t-48.5 23.5t-76.5 25t-106 23.5q-26 4 -41.5 26t-10.5 48q4 26 26 41.5t48 10.5q71 -12 131 -29.5t118 -44.5t91 -66.5t33 -88.5zM1024 896v-384 q0 -26 -19 -45t-45 -19h-64v-384q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v384h-64q-26 0 -45 19t-19 45v384q0 53 37.5 90.5t90.5 37.5h384q53 0 90.5 -37.5t37.5 -90.5zM928 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5 t158.5 -65.5t65.5 -158.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1280 512h305q-5 -6 -10 -10.5t-9 -7.5l-3 -4l-623 -600q-18 -18 -44 -18t-44 18l-624 602q-5 2 -21 20h369q22 0 39.5 13.5t22.5 34.5l70 281l190 -667q6 -20 23 -33t39 -13q21 0 38 13t23 33l146 485l56 -112q18 -35 57 -35zM1792 940q0 -145 -103 -300h-369l-111 221 q-8 17 -25.5 27t-36.5 8q-45 -5 -56 -46l-129 -430l-196 686q-6 20 -23.5 33t-39.5 13t-39 -13.5t-22 -34.5l-116 -464h-423q-103 155 -103 300q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5q224 0 351 -124 t127 -344z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1152 960q0 -221 -147.5 -384.5t-364.5 -187.5v-260h224q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-224q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v260q-150 16 -271.5 103t-186 224t-52.5 292 q11 134 80.5 249t182 188t245.5 88q170 19 319 -54t236 -212t87 -306zM128 960q0 -185 131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5z" /> +<glyph unicode="" d="M1472 1408q26 0 45 -19t19 -45v-416q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v262l-382 -383q126 -156 126 -359q0 -117 -45.5 -223.5t-123 -184t-184 -123t-223.5 -45.5t-223.5 45.5t-184 123t-123 184t-45.5 223.5t45.5 223.5t123 184t184 123t223.5 45.5 q203 0 359 -126l382 382h-261q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h416zM576 0q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> +<glyph unicode="" horiz-adv-x="1280" d="M830 1220q145 -72 233.5 -210.5t88.5 -305.5q0 -221 -147.5 -384.5t-364.5 -187.5v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-217 24 -364.5 187.5 t-147.5 384.5q0 167 88.5 305.5t233.5 210.5q-165 96 -228 273q-6 16 3.5 29.5t26.5 13.5h69q21 0 29 -20q44 -106 140 -171t214 -65t214 65t140 171q8 20 37 20h61q17 0 26.5 -13.5t3.5 -29.5q-63 -177 -228 -273zM576 256q185 0 316.5 131.5t131.5 316.5t-131.5 316.5 t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> +<glyph unicode="" d="M1024 1504q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q126 -158 126 -359q0 -221 -147.5 -384.5t-364.5 -187.5v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64 q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-149 16 -270.5 103t-186.5 223.5t-53 291.5q16 204 160 353.5t347 172.5q118 14 228 -19t198 -103l255 254h-134q-14 0 -23 9t-9 23v64zM576 256q185 0 316.5 131.5t131.5 316.5t-131.5 316.5 t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1280 1504q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q126 -158 126 -359q0 -221 -147.5 -384.5t-364.5 -187.5v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64 q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-217 24 -364.5 187.5t-147.5 384.5q0 201 126 359l-52 53l-101 -111q-9 -10 -22 -10.5t-23 7.5l-48 44q-10 8 -10.5 21.5t8.5 23.5l105 115l-111 112v-134q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9 t-9 23v288q0 26 19 45t45 19h288q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-133l106 -107l86 94q9 10 22 10.5t23 -7.5l48 -44q10 -8 10.5 -21.5t-8.5 -23.5l-90 -99l57 -56q158 126 359 126t359 -126l255 254h-134q-14 0 -23 9t-9 23v64zM832 256q185 0 316.5 131.5 t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1790 1007q12 -155 -52.5 -292t-186 -224t-271.5 -103v-260h224q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-512v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-224q-14 0 -23 9t-9 23v64q0 14 9 23 t23 9h224v260q-150 16 -271.5 103t-186 224t-52.5 292q17 206 164.5 356.5t352.5 169.5q206 21 377 -94q171 115 377 94q205 -19 352.5 -169.5t164.5 -356.5zM896 647q128 131 128 313t-128 313q-128 -131 -128 -313t128 -313zM576 512q115 0 218 57q-154 165 -154 391 q0 224 154 391q-103 57 -218 57q-185 0 -316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5zM1152 128v260q-137 15 -256 94q-119 -79 -256 -94v-260h512zM1216 512q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5q-115 0 -218 -57q154 -167 154 -391 q0 -226 -154 -391q103 -57 218 -57z" /> +<glyph unicode="" horiz-adv-x="1920" d="M1536 1120q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q76 -95 107.5 -214t9.5 -247q-31 -182 -166 -312t-318 -156q-210 -29 -384.5 80t-241.5 300q-117 6 -221 57.5t-177.5 133t-113.5 192.5t-32 230 q9 135 78 252t182 191.5t248 89.5q118 14 227.5 -19t198.5 -103l255 254h-134q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q59 -74 93 -169q182 -9 328 -124l255 254h-134q-14 0 -23 9 t-9 23v64zM1024 704q0 20 -4 58q-162 -25 -271 -150t-109 -292q0 -20 4 -58q162 25 271 150t109 292zM128 704q0 -168 111 -294t276 -149q-3 29 -3 59q0 210 135 369.5t338 196.5q-53 120 -163.5 193t-245.5 73q-185 0 -316.5 -131.5t-131.5 -316.5zM1088 -128 q185 0 316.5 131.5t131.5 316.5q0 168 -111 294t-276 149q3 -29 3 -59q0 -210 -135 -369.5t-338 -196.5q53 -120 163.5 -193t245.5 -73z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1664 1504q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q76 -95 107.5 -214t9.5 -247q-32 -180 -164.5 -310t-313.5 -157q-223 -34 -409 90q-117 -78 -256 -93v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23 t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-155 17 -279.5 109.5t-187 237.5t-39.5 307q25 187 159.5 322.5t320.5 164.5q224 34 410 -90q146 97 320 97q201 0 359 -126l255 254h-134q-14 0 -23 9 t-9 23v64zM896 391q128 131 128 313t-128 313q-128 -131 -128 -313t128 -313zM128 704q0 -185 131.5 -316.5t316.5 -131.5q117 0 218 57q-154 167 -154 391t154 391q-101 57 -218 57q-185 0 -316.5 -131.5t-131.5 -316.5zM1216 256q185 0 316.5 131.5t131.5 316.5 t-131.5 316.5t-316.5 131.5q-117 0 -218 -57q154 -167 154 -391t-154 -391q101 -57 218 -57z" /> +<glyph unicode="" d="M1472 1408q26 0 45 -19t19 -45v-416q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v262l-213 -214l140 -140q9 -10 9 -23t-9 -22l-46 -46q-9 -9 -22 -9t-23 9l-140 141l-78 -79q126 -156 126 -359q0 -117 -45.5 -223.5t-123 -184t-184 -123t-223.5 -45.5t-223.5 45.5 t-184 123t-123 184t-45.5 223.5t45.5 223.5t123 184t184 123t223.5 45.5q203 0 359 -126l78 78l-172 172q-9 10 -9 23t9 22l46 46q9 9 22 9t23 -9l172 -172l213 213h-261q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h416zM576 0q185 0 316.5 131.5t131.5 316.5t-131.5 316.5 t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> +<glyph unicode="" horiz-adv-x="1280" d="M640 892q217 -24 364.5 -187.5t147.5 -384.5q0 -167 -87 -306t-236 -212t-319 -54q-133 15 -245.5 88t-182 188t-80.5 249q-12 155 52.5 292t186 224t271.5 103v132h-160q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h160v165l-92 -92q-10 -9 -23 -9t-22 9l-46 46q-9 9 -9 22 t9 23l202 201q19 19 45 19t45 -19l202 -201q9 -10 9 -23t-9 -22l-46 -46q-9 -9 -22 -9t-23 9l-92 92v-165h160q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-160v-132zM576 -128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5 t131.5 -316.5t316.5 -131.5z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1901 621q19 -19 19 -45t-19 -45l-294 -294q-9 -10 -22.5 -10t-22.5 10l-45 45q-10 9 -10 22.5t10 22.5l185 185h-294v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-132q-24 -217 -187.5 -364.5t-384.5 -147.5q-167 0 -306 87t-212 236t-54 319q15 133 88 245.5 t188 182t249 80.5q155 12 292 -52.5t224 -186t103 -271.5h132v224q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-224h294l-185 185q-10 9 -10 22.5t10 22.5l45 45q9 10 22.5 10t22.5 -10zM576 128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5 t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1152 960q0 -221 -147.5 -384.5t-364.5 -187.5v-612q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v612q-217 24 -364.5 187.5t-147.5 384.5q0 117 45.5 223.5t123 184t184 123t223.5 45.5t223.5 -45.5t184 -123t123 -184t45.5 -223.5zM576 512q185 0 316.5 131.5 t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1024 576q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1152 576q0 -117 -45.5 -223.5t-123 -184t-184 -123t-223.5 -45.5t-223.5 45.5t-184 123t-123 184t-45.5 223.5t45.5 223.5t123 184t184 123 t223.5 45.5t223.5 -45.5t184 -123t123 -184t45.5 -223.5z" /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" d="M1451 1408q35 0 60 -25t25 -60v-1366q0 -35 -25 -60t-60 -25h-391v595h199l30 232h-229v148q0 56 23.5 84t91.5 28l122 1v207q-63 9 -178 9q-136 0 -217.5 -80t-81.5 -226v-171h-200v-232h200v-595h-735q-35 0 -60 25t-25 60v1366q0 35 25 60t60 25h1366z" /> +<glyph unicode="" horiz-adv-x="1280" d="M0 939q0 108 37.5 203.5t103.5 166.5t152 123t185 78t202 26q158 0 294 -66.5t221 -193.5t85 -287q0 -96 -19 -188t-60 -177t-100 -149.5t-145 -103t-189 -38.5q-68 0 -135 32t-96 88q-10 -39 -28 -112.5t-23.5 -95t-20.5 -71t-26 -71t-32 -62.5t-46 -77.5t-62 -86.5 l-14 -5l-9 10q-15 157 -15 188q0 92 21.5 206.5t66.5 287.5t52 203q-32 65 -32 169q0 83 52 156t132 73q61 0 95 -40.5t34 -102.5q0 -66 -44 -191t-44 -187q0 -63 45 -104.5t109 -41.5q55 0 102 25t78.5 68t56 95t38 110.5t20 111t6.5 99.5q0 173 -109.5 269.5t-285.5 96.5 q-200 0 -334 -129.5t-134 -328.5q0 -44 12.5 -85t27 -65t27 -45.5t12.5 -30.5q0 -28 -15 -73t-37 -45q-2 0 -17 3q-51 15 -90.5 56t-61 94.5t-32.5 108t-11 106.5z" /> +<glyph unicode="" d="M985 562q13 0 97.5 -44t89.5 -53q2 -5 2 -15q0 -33 -17 -76q-16 -39 -71 -65.5t-102 -26.5q-57 0 -190 62q-98 45 -170 118t-148 185q-72 107 -71 194v8q3 91 74 158q24 22 52 22q6 0 18 -1.5t19 -1.5q19 0 26.5 -6.5t15.5 -27.5q8 -20 33 -88t25 -75q0 -21 -34.5 -57.5 t-34.5 -46.5q0 -7 5 -15q34 -73 102 -137q56 -53 151 -101q12 -7 22 -7q15 0 54 48.5t52 48.5zM782 32q127 0 243.5 50t200.5 134t134 200.5t50 243.5t-50 243.5t-134 200.5t-200.5 134t-243.5 50t-243.5 -50t-200.5 -134t-134 -200.5t-50 -243.5q0 -203 120 -368l-79 -233 l242 77q158 -104 345 -104zM782 1414q153 0 292.5 -60t240.5 -161t161 -240.5t60 -292.5t-60 -292.5t-161 -240.5t-240.5 -161t-292.5 -60q-195 0 -365 94l-417 -134l136 405q-108 178 -108 389q0 153 60 292.5t161 240.5t240.5 161t292.5 60z" /> +<glyph unicode="" horiz-adv-x="1792" d="M128 128h1024v128h-1024v-128zM128 640h1024v128h-1024v-128zM1696 192q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM128 1152h1024v128h-1024v-128zM1696 704q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1696 1216 q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1792 384v-384h-1792v384h1792zM1792 896v-384h-1792v384h1792zM1792 1408v-384h-1792v384h1792z" /> +<glyph unicode="" horiz-adv-x="2048" d="M704 640q-159 0 -271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5t-112.5 -271.5t-271.5 -112.5zM1664 512h352q13 0 22.5 -9.5t9.5 -22.5v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-352v-352q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5 t-9.5 22.5v352h-352q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h352v352q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5v-352zM928 288q0 -52 38 -90t90 -38h256v-238q-68 -50 -171 -50h-874q-121 0 -194 69t-73 190q0 53 3.5 103.5t14 109t26.5 108.5 t43 97.5t62 81t85.5 53.5t111.5 20q19 0 39 -17q79 -61 154.5 -91.5t164.5 -30.5t164.5 30.5t154.5 91.5q20 17 39 17q132 0 217 -96h-223q-52 0 -90 -38t-38 -90v-192z" /> +<glyph unicode="" horiz-adv-x="2048" d="M704 640q-159 0 -271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5t-112.5 -271.5t-271.5 -112.5zM1781 320l249 -249q9 -9 9 -23q0 -13 -9 -22l-136 -136q-9 -9 -22 -9q-14 0 -23 9l-249 249l-249 -249q-9 -9 -23 -9q-13 0 -22 9l-136 136 q-9 9 -9 22q0 14 9 23l249 249l-249 249q-9 9 -9 23q0 13 9 22l136 136q9 9 22 9q14 0 23 -9l249 -249l249 249q9 9 23 9q13 0 22 -9l136 -136q9 -9 9 -22q0 -14 -9 -23zM1283 320l-181 -181q-37 -37 -37 -91q0 -53 37 -90l83 -83q-21 -3 -44 -3h-874q-121 0 -194 69 t-73 190q0 53 3.5 103.5t14 109t26.5 108.5t43 97.5t62 81t85.5 53.5t111.5 20q19 0 39 -17q154 -122 319 -122t319 122q20 17 39 17q28 0 57 -6q-28 -27 -41 -50t-13 -56q0 -54 37 -91z" /> +<glyph unicode="" horiz-adv-x="2048" d="M256 512h1728q26 0 45 -19t19 -45v-448h-256v256h-1536v-256h-256v1216q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-704zM832 832q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM2048 576v64q0 159 -112.5 271.5t-271.5 112.5h-704 q-26 0 -45 -19t-19 -45v-384h1152z" /> +<glyph unicode="" d="M1536 1536l-192 -448h192v-192h-274l-55 -128h329v-192h-411l-357 -832l-357 832h-411v192h329l-55 128h-274v192h192l-192 448h256l323 -768h378l323 768h256zM768 320l108 256h-216z" /> +<glyph unicode="" d="M1088 1536q185 0 316.5 -93.5t131.5 -226.5v-896q0 -130 -125.5 -222t-305.5 -97l213 -202q16 -15 8 -35t-30 -20h-1056q-22 0 -30 20t8 35l213 202q-180 5 -305.5 97t-125.5 222v896q0 133 131.5 226.5t316.5 93.5h640zM768 192q80 0 136 56t56 136t-56 136t-136 56 t-136 -56t-56 -136t56 -136t136 -56zM1344 768v512h-1152v-512h1152z" /> +<glyph unicode="" d="M1088 1536q185 0 316.5 -93.5t131.5 -226.5v-896q0 -130 -125.5 -222t-305.5 -97l213 -202q16 -15 8 -35t-30 -20h-1056q-22 0 -30 20t8 35l213 202q-180 5 -305.5 97t-125.5 222v896q0 133 131.5 226.5t316.5 93.5h640zM288 224q66 0 113 47t47 113t-47 113t-113 47 t-113 -47t-47 -113t47 -113t113 -47zM704 768v512h-544v-512h544zM1248 224q66 0 113 47t47 113t-47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47zM1408 768v512h-576v-512h576z" /> +<glyph unicode="" horiz-adv-x="1792" d="M597 1115v-1173q0 -25 -12.5 -42.5t-36.5 -17.5q-17 0 -33 8l-465 233q-21 10 -35.5 33.5t-14.5 46.5v1140q0 20 10 34t29 14q14 0 44 -15l511 -256q3 -3 3 -5zM661 1014l534 -866l-534 266v600zM1792 996v-1054q0 -25 -14 -40.5t-38 -15.5t-47 13l-441 220zM1789 1116 q0 -3 -256.5 -419.5t-300.5 -487.5l-390 634l324 527q17 28 52 28q14 0 26 -6l541 -270q4 -2 4 -6z" /> +<glyph unicode="" d="M809 532l266 499h-112l-157 -312q-24 -48 -44 -92l-42 92l-155 312h-120l263 -493v-324h101v318zM1536 1408v-1536h-1536v1536h1536z" /> +<glyph unicode="" horiz-adv-x="2296" d="M478 -139q-8 -16 -27 -34.5t-37 -25.5q-25 -9 -51.5 3.5t-28.5 31.5q-1 22 40 55t68 38q23 4 34 -21.5t2 -46.5zM1819 -139q7 -16 26 -34.5t38 -25.5q25 -9 51.5 3.5t27.5 31.5q2 22 -39.5 55t-68.5 38q-22 4 -33 -21.5t-2 -46.5zM1867 -30q13 -27 56.5 -59.5t77.5 -41.5 q45 -13 82 4.5t37 50.5q0 46 -67.5 100.5t-115.5 59.5q-40 5 -63.5 -37.5t-6.5 -76.5zM428 -30q-13 -27 -56 -59.5t-77 -41.5q-45 -13 -82 4.5t-37 50.5q0 46 67.5 100.5t115.5 59.5q40 5 63 -37.5t6 -76.5zM1158 1094h1q-41 0 -76 -15q27 -8 44 -30.5t17 -49.5 q0 -35 -27 -60t-65 -25q-52 0 -80 43q-5 -23 -5 -42q0 -74 56 -126.5t135 -52.5q80 0 136 52.5t56 126.5t-56 126.5t-136 52.5zM1462 1312q-99 109 -220.5 131.5t-245.5 -44.5q27 60 82.5 96.5t118 39.5t121.5 -17t99.5 -74.5t44.5 -131.5zM2212 73q8 -11 -11 -42 q7 -23 7 -40q1 -56 -44.5 -112.5t-109.5 -91.5t-118 -37q-48 -2 -92 21.5t-66 65.5q-687 -25 -1259 0q-23 -41 -66.5 -65t-92.5 -22q-86 3 -179.5 80.5t-92.5 160.5q2 22 7 40q-19 31 -11 42q6 10 31 1q14 22 41 51q-7 29 2 38q11 10 39 -4q29 20 59 34q0 29 13 37 q23 12 51 -16q35 5 61 -2q18 -4 38 -19v73q-11 0 -18 2q-53 10 -97 44.5t-55 87.5q-9 38 0 81q15 62 93 95q2 17 19 35.5t36 23.5t33 -7.5t19 -30.5h13q46 -5 60 -23q3 -3 5 -7q10 1 30.5 3.5t30.5 3.5q-15 11 -30 17q-23 40 -91 43q0 6 1 10q-62 2 -118.5 18.5t-84.5 47.5 q-32 36 -42.5 92t-2.5 112q16 126 90 179q23 16 52 4.5t32 -40.5q0 -1 1.5 -14t2.5 -21t3 -20t5.5 -19t8.5 -10q27 -14 76 -12q48 46 98 74q-40 4 -162 -14l47 46q61 58 163 111q145 73 282 86q-20 8 -41 15.5t-47 14t-42.5 10.5t-47.5 11t-43 10q595 126 904 -139 q98 -84 158 -222q85 -10 121 9h1q5 3 8.5 10t5.5 19t3 19.5t3 21.5l1 14q3 28 32 40t52 -5q73 -52 91 -178q7 -57 -3.5 -113t-42.5 -91q-28 -32 -83.5 -48.5t-115.5 -18.5v-10q-71 -2 -95 -43q-14 -5 -31 -17q11 -1 32 -3.5t30 -3.5q1 4 5 8q16 18 60 23h13q5 18 19 30t33 8 t36 -23t19 -36q79 -32 93 -95q9 -40 1 -81q-12 -53 -56 -88t-97 -44q-10 -2 -17 -2q0 -49 -1 -73q20 15 38 19q26 7 61 2q28 28 51 16q14 -9 14 -37q33 -16 59 -34q27 13 38 4q10 -10 2 -38q28 -30 41 -51q23 8 31 -1zM1937 1025q0 -29 -9 -54q82 -32 112 -132 q4 37 -9.5 98.5t-41.5 90.5q-20 19 -36 17t-16 -20zM1859 925q35 -42 47.5 -108.5t-0.5 -124.5q67 13 97 45q13 14 18 28q-3 64 -31 114.5t-79 66.5q-15 -15 -52 -21zM1822 921q-30 0 -44 1q42 -115 53 -239q21 0 43 3q16 68 1 135t-53 100zM258 839q30 100 112 132 q-9 25 -9 54q0 18 -16.5 20t-35.5 -17q-28 -29 -41.5 -90.5t-9.5 -98.5zM294 737q29 -31 97 -45q-13 58 -0.5 124.5t47.5 108.5v0q-37 6 -52 21q-51 -16 -78.5 -66t-31.5 -115q9 -17 18 -28zM471 683q14 124 73 235q-19 -4 -55 -18l-45 -19v1q-46 -89 -20 -196q25 -3 47 -3z M1434 644q8 -38 16.5 -108.5t11.5 -89.5q3 -18 9.5 -21.5t23.5 4.5q40 20 62 85.5t23 125.5q-24 2 -146 4zM1152 1285q-116 0 -199 -82.5t-83 -198.5q0 -117 83 -199.5t199 -82.5t199 82.5t83 199.5q0 116 -83 198.5t-199 82.5zM1380 646q-106 2 -211 0v1q-1 -27 2.5 -86 t13.5 -66q29 -14 93.5 -14.5t95.5 10.5q9 3 11 39t-0.5 69.5t-4.5 46.5zM1112 447q8 4 9.5 48t-0.5 88t-4 63v1q-212 -3 -214 -3q-4 -20 -7 -62t0 -83t14 -46q34 -15 101 -16t101 10zM718 636q-16 -59 4.5 -118.5t77.5 -84.5q15 -8 24 -5t12 21q3 16 8 90t10 103 q-69 -2 -136 -6zM591 510q3 -23 -34 -36q132 -141 271.5 -240t305.5 -154q172 49 310.5 146t293.5 250q-33 13 -30 34l3 9v1v-1q-17 2 -50 5.5t-48 4.5q-26 -90 -82 -132q-51 -38 -82 1q-5 6 -9 14q-7 13 -17 62q-2 -5 -5 -9t-7.5 -7t-8 -5.5t-9.5 -4l-10 -2.5t-12 -2 l-12 -1.5t-13.5 -1t-13.5 -0.5q-106 -9 -163 11q-4 -17 -10 -26.5t-21 -15t-23 -7t-36 -3.5q-2 0 -3 -0.5t-3 -0.5h-3q-179 -17 -203 40q-2 -63 -56 -54q-47 8 -91 54q-12 13 -20 26q-17 29 -26 65q-58 -6 -87 -10q1 -2 4 -10zM507 -118q3 14 3 30q-17 71 -51 130t-73 70 q-41 12 -101.5 -14.5t-104.5 -80t-39 -107.5q35 -53 100 -93t119 -42q51 -2 94 28t53 79zM510 53q23 -63 27 -119q195 113 392 174q-98 52 -180.5 120t-179.5 165q-6 -4 -29 -13q0 -2 -1 -5t-1 -4q31 -18 22 -37q-12 -23 -56 -34q-10 -13 -29 -24h-1q-2 -83 1 -150 q19 -34 35 -73zM579 -113q532 -21 1145 0q-254 147 -428 196q-76 -35 -156 -57q-8 -3 -16 0q-65 21 -129 49q-208 -60 -416 -188h-1v-1q1 0 1 1zM1763 -67q4 54 28 120q14 38 33 71l-1 -1q3 77 3 153q-15 8 -30 25q-42 9 -56 33q-9 20 22 38q-2 4 -2 9q-16 4 -28 12 q-204 -190 -383 -284q198 -59 414 -176zM2155 -90q5 54 -39 107.5t-104 80t-102 14.5q-38 -11 -72.5 -70.5t-51.5 -129.5q0 -16 3 -30q10 -49 53 -79t94 -28q54 2 119 42t100 93z" /> +<glyph unicode="" horiz-adv-x="2304" d="M1524 -25q0 -68 -48 -116t-116 -48t-116.5 48t-48.5 116t48.5 116.5t116.5 48.5t116 -48.5t48 -116.5zM775 -25q0 -68 -48.5 -116t-116.5 -48t-116 48t-48 116t48 116.5t116 48.5t116.5 -48.5t48.5 -116.5zM0 1469q57 -60 110.5 -104.5t121 -82t136 -63t166 -45.5 t200 -31.5t250 -18.5t304 -9.5t372.5 -2.5q139 0 244.5 -5t181 -16.5t124 -27.5t71 -39.5t24 -51.5t-19.5 -64t-56.5 -76.5t-89.5 -91t-116 -104.5t-139 -119q-185 -157 -286 -247q29 51 76.5 109t94 105.5t94.5 98.5t83 91.5t54 80.5t13 70t-45.5 55.5t-116.5 41t-204 23.5 t-304 5q-168 -2 -314 6t-256 23t-204.5 41t-159.5 51.5t-122.5 62.5t-91.5 66.5t-68 71.5t-50.5 69.5t-40 68t-36.5 59.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M896 1472q-169 0 -323 -66t-265.5 -177.5t-177.5 -265.5t-66 -323t66 -323t177.5 -265.5t265.5 -177.5t323 -66t323 66t265.5 177.5t177.5 265.5t66 323t-66 323t-177.5 265.5t-265.5 177.5t-323 66zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348 t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM496 704q16 0 16 -16v-480q0 -16 -16 -16h-32q-16 0 -16 16v480q0 16 16 16h32zM896 640q53 0 90.5 -37.5t37.5 -90.5q0 -35 -17.5 -64t-46.5 -46v-114q0 -14 -9 -23 t-23 -9h-64q-14 0 -23 9t-9 23v114q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5zM896 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM544 928v-96 q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v96q0 93 65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5v-96q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v96q0 146 -103 249t-249 103t-249 -103t-103 -249zM1408 192v512q0 26 -19 45t-45 19h-896q-26 0 -45 -19t-19 -45v-512 q0 -26 19 -45t45 -19h896q26 0 45 19t19 45z" /> +<glyph unicode="" horiz-adv-x="2304" d="M1920 1024v-768h-1664v768h1664zM2048 448h128v384h-128v288q0 14 -9 23t-23 9h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288zM2304 832v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113 v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160q53 0 90.5 -37.5t37.5 -90.5z" /> +<glyph unicode="" horiz-adv-x="2304" d="M256 256v768h1280v-768h-1280zM2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9 h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" /> +<glyph unicode="" horiz-adv-x="2304" d="M256 256v768h896v-768h-896zM2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9 h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" /> +<glyph unicode="" horiz-adv-x="2304" d="M256 256v768h512v-768h-512zM2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9 h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" /> +<glyph unicode="" horiz-adv-x="2304" d="M2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9h-1856q-14 0 -23 -9t-9 -23 v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1133 493q31 -30 14 -69q-17 -40 -59 -40h-382l201 -476q10 -25 0 -49t-34 -35l-177 -75q-25 -10 -49 0t-35 34l-191 452l-312 -312q-19 -19 -45 -19q-12 0 -24 5q-40 17 -40 59v1504q0 42 40 59q12 5 24 5q27 0 45 -19z" /> +<glyph unicode="" horiz-adv-x="1024" d="M832 1408q-320 0 -320 -224v-416h128v-128h-128v-544q0 -224 320 -224h64v-128h-64q-272 0 -384 146q-112 -146 -384 -146h-64v128h64q320 0 320 224v544h-128v128h128v416q0 224 -320 224h-64v128h64q272 0 384 -146q112 146 384 146h64v-128h-64z" /> +<glyph unicode="" horiz-adv-x="2048" d="M2048 1152h-128v-1024h128v-384h-384v128h-1280v-128h-384v384h128v1024h-128v384h384v-128h1280v128h384v-384zM1792 1408v-128h128v128h-128zM128 1408v-128h128v128h-128zM256 -128v128h-128v-128h128zM1664 0v128h128v1024h-128v128h-1280v-128h-128v-1024h128v-128 h1280zM1920 -128v128h-128v-128h128zM1280 896h384v-768h-896v256h-384v768h896v-256zM512 512h640v512h-640v-512zM1536 256v512h-256v-384h-384v-128h640z" /> +<glyph unicode="" horiz-adv-x="2304" d="M2304 768h-128v-640h128v-384h-384v128h-896v-128h-384v384h128v128h-384v-128h-384v384h128v640h-128v384h384v-128h896v128h384v-384h-128v-128h384v128h384v-384zM2048 1024v-128h128v128h-128zM1408 1408v-128h128v128h-128zM128 1408v-128h128v128h-128zM256 256 v128h-128v-128h128zM1536 384h-128v-128h128v128zM384 384h896v128h128v640h-128v128h-896v-128h-128v-640h128v-128zM896 -128v128h-128v-128h128zM2176 -128v128h-128v-128h128zM2048 128v640h-128v128h-384v-384h128v-384h-384v128h-384v-128h128v-128h896v128h128z" /> +<glyph unicode="" d="M1024 288v-416h-928q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1344q40 0 68 -28t28 -68v-928h-416q-40 0 -68 -28t-28 -68zM1152 256h381q-15 -82 -65 -132l-184 -184q-50 -50 -132 -65v381z" /> +<glyph unicode="" d="M1400 256h-248v-248q29 10 41 22l185 185q12 12 22 41zM1120 384h288v896h-1280v-1280h896v288q0 40 28 68t68 28zM1536 1312v-1024q0 -40 -20 -88t-48 -76l-184 -184q-28 -28 -76 -48t-88 -20h-1024q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1344q40 0 68 -28t28 -68 z" /> +<glyph unicode="" horiz-adv-x="2304" d="M1951 538q0 -26 -15.5 -44.5t-38.5 -23.5q-8 -2 -18 -2h-153v140h153q10 0 18 -2q23 -5 38.5 -23.5t15.5 -44.5zM1933 751q0 -25 -15 -42t-38 -21q-3 -1 -15 -1h-139v129h139q3 0 8.5 -0.5t6.5 -0.5q23 -4 38 -21.5t15 -42.5zM728 587v308h-228v-308q0 -58 -38 -94.5 t-105 -36.5q-108 0 -229 59v-112q53 -15 121 -23t109 -9l42 -1q328 0 328 217zM1442 403v113q-99 -52 -200 -59q-108 -8 -169 41t-61 142t61 142t169 41q101 -7 200 -58v112q-48 12 -100 19.5t-80 9.5l-28 2q-127 6 -218.5 -14t-140.5 -60t-71 -88t-22 -106t22 -106t71 -88 t140.5 -60t218.5 -14q101 4 208 31zM2176 518q0 54 -43 88.5t-109 39.5v3q57 8 89 41.5t32 79.5q0 55 -41 88t-107 36q-3 0 -12 0.5t-14 0.5h-455v-510h491q74 0 121.5 36.5t47.5 96.5zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90 t90 38h2048q52 0 90 -38t38 -90z" /> +<glyph unicode="" horiz-adv-x="2304" d="M858 295v693q-106 -41 -172 -135.5t-66 -211.5t66 -211.5t172 -134.5zM1362 641q0 117 -66 211.5t-172 135.5v-694q106 41 172 135.5t66 211.5zM1577 641q0 -159 -78.5 -294t-213.5 -213.5t-294 -78.5q-119 0 -227.5 46.5t-187 125t-125 187t-46.5 227.5q0 159 78.5 294 t213.5 213.5t294 78.5t294 -78.5t213.5 -213.5t78.5 -294zM1960 634q0 139 -55.5 261.5t-147.5 205.5t-213.5 131t-252.5 48h-301q-176 0 -323.5 -81t-235 -230t-87.5 -335q0 -171 87 -317.5t236 -231.5t323 -85h301q129 0 251.5 50.5t214.5 135t147.5 202.5t55.5 246z M2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1664 -96v1088q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5v-1088q0 -13 9.5 -22.5t22.5 -9.5h1088q13 0 22.5 9.5t9.5 22.5zM1792 992v-1088q0 -66 -47 -113t-113 -47h-1088q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1088q66 0 113 -47t47 -113 zM1408 1376v-160h-128v160q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5v-1088q0 -13 9.5 -22.5t22.5 -9.5h160v-128h-160q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1088q66 0 113 -47t47 -113z" /> +<glyph unicode="" horiz-adv-x="2304" d="M1728 1088l-384 -704h768zM448 1088l-384 -704h768zM1269 1280q-14 -40 -45.5 -71.5t-71.5 -45.5v-1291h608q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1344q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h608v1291q-40 14 -71.5 45.5t-45.5 71.5h-491q-14 0 -23 9t-9 23v64 q0 14 9 23t23 9h491q21 57 70 92.5t111 35.5t111 -35.5t70 -92.5h491q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-491zM1088 1264q33 0 56.5 23.5t23.5 56.5t-23.5 56.5t-56.5 23.5t-56.5 -23.5t-23.5 -56.5t23.5 -56.5t56.5 -23.5zM2176 384q0 -73 -46.5 -131t-117.5 -91 t-144.5 -49.5t-139.5 -16.5t-139.5 16.5t-144.5 49.5t-117.5 91t-46.5 131q0 11 35 81t92 174.5t107 195.5t102 184t56 100q18 33 56 33t56 -33q4 -7 56 -100t102 -184t107 -195.5t92 -174.5t35 -81zM896 384q0 -73 -46.5 -131t-117.5 -91t-144.5 -49.5t-139.5 -16.5 t-139.5 16.5t-144.5 49.5t-117.5 91t-46.5 131q0 11 35 81t92 174.5t107 195.5t102 184t56 100q18 33 56 33t56 -33q4 -7 56 -100t102 -184t107 -195.5t92 -174.5t35 -81z" /> +<glyph unicode="" d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9 t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM874 700q77 29 149 92.5t129.5 152.5t92.5 210t35 253h-1024q0 -132 35 -253t92.5 -210t129.5 -152.5t149 -92.5q19 -7 30.5 -23.5t11.5 -36.5t-11.5 -36.5t-30.5 -23.5q-77 -29 -149 -92.5 t-129.5 -152.5t-92.5 -210t-35 -253h1024q0 132 -35 253t-92.5 210t-129.5 152.5t-149 92.5q-19 7 -30.5 23.5t-11.5 36.5t11.5 36.5t30.5 23.5z" /> +<glyph unicode="" d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9 t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM1280 1408h-1024q0 -66 9 -128h1006q9 61 9 128zM1280 -128q0 130 -34 249.5t-90.5 208t-126.5 152t-146 94.5h-230q-76 -31 -146 -94.5t-126.5 -152t-90.5 -208t-34 -249.5h1024z" /> +<glyph unicode="" d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9 t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM1280 1408h-1024q0 -206 85 -384h854q85 178 85 384zM1223 192q-54 141 -145.5 241.5t-194.5 142.5h-230q-103 -42 -194.5 -142.5t-145.5 -241.5h910z" /> +<glyph unicode="" d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9 t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM874 700q77 29 149 92.5t129.5 152.5t92.5 210t35 253h-1024q0 -132 35 -253t92.5 -210t129.5 -152.5t149 -92.5q19 -7 30.5 -23.5t11.5 -36.5t-11.5 -36.5t-30.5 -23.5q-137 -51 -244 -196 h700q-107 145 -244 196q-19 7 -30.5 23.5t-11.5 36.5t11.5 36.5t30.5 23.5z" /> +<glyph unicode="" d="M1504 -64q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v128q0 14 9 23t23 9h1472zM130 0q3 55 16 107t30 95t46 87t53.5 76t64.5 69.5t66 60t70.5 55t66.5 47.5t65 43q-43 28 -65 43t-66.5 47.5t-70.5 55t-66 60t-64.5 69.5t-53.5 76t-46 87 t-30 95t-16 107h1276q-3 -55 -16 -107t-30 -95t-46 -87t-53.5 -76t-64.5 -69.5t-66 -60t-70.5 -55t-66.5 -47.5t-65 -43q43 -28 65 -43t66.5 -47.5t70.5 -55t66 -60t64.5 -69.5t53.5 -76t46 -87t30 -95t16 -107h-1276zM1504 1536q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9 h-1472q-14 0 -23 9t-9 23v128q0 14 9 23t23 9h1472z" /> +<glyph unicode="" d="M768 1152q-53 0 -90.5 -37.5t-37.5 -90.5v-128h-32v93q0 48 -32 81.5t-80 33.5q-46 0 -79 -33t-33 -79v-429l-32 30v172q0 48 -32 81.5t-80 33.5q-46 0 -79 -33t-33 -79v-224q0 -47 35 -82l310 -296q39 -39 39 -102q0 -26 19 -45t45 -19h640q26 0 45 19t19 45v25 q0 41 10 77l108 436q10 36 10 77v246q0 48 -32 81.5t-80 33.5q-46 0 -79 -33t-33 -79v-32h-32v125q0 40 -25 72.5t-64 40.5q-14 2 -23 2q-46 0 -79 -33t-33 -79v-128h-32v122q0 51 -32.5 89.5t-82.5 43.5q-5 1 -13 1zM768 1280q84 0 149 -50q57 34 123 34q59 0 111 -27 t86 -76q27 7 59 7q100 0 170 -71.5t70 -171.5v-246q0 -51 -13 -108l-109 -436q-6 -24 -6 -71q0 -80 -56 -136t-136 -56h-640q-84 0 -138 58.5t-54 142.5l-308 296q-76 73 -76 175v224q0 99 70.5 169.5t169.5 70.5q11 0 16 -1q6 95 75.5 160t164.5 65q52 0 98 -21 q72 69 174 69z" /> +<glyph unicode="" horiz-adv-x="1792" d="M880 1408q-46 0 -79 -33t-33 -79v-656h-32v528q0 46 -33 79t-79 33t-79 -33t-33 -79v-528v-256l-154 205q-38 51 -102 51q-53 0 -90.5 -37.5t-37.5 -90.5q0 -43 26 -77l384 -512q38 -51 102 -51h688q34 0 61 22t34 56l76 405q5 32 5 59v498q0 46 -33 79t-79 33t-79 -33 t-33 -79v-272h-32v528q0 46 -33 79t-79 33t-79 -33t-33 -79v-528h-32v656q0 46 -33 79t-79 33zM880 1536q68 0 125.5 -35.5t88.5 -96.5q19 4 42 4q99 0 169.5 -70.5t70.5 -169.5v-17q105 6 180.5 -64t75.5 -175v-498q0 -40 -8 -83l-76 -404q-14 -79 -76.5 -131t-143.5 -52 h-688q-60 0 -114.5 27.5t-90.5 74.5l-384 512q-51 68 -51 154q0 106 75 181t181 75q78 0 128 -34v434q0 99 70.5 169.5t169.5 70.5q23 0 42 -4q31 61 88.5 96.5t125.5 35.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1073 -128h-177q-163 0 -226 141q-23 49 -23 102v5q-62 30 -98.5 88.5t-36.5 127.5q0 38 5 48h-261q-106 0 -181 75t-75 181t75 181t181 75h113l-44 17q-74 28 -119.5 93.5t-45.5 145.5q0 106 75 181t181 75q46 0 91 -17l628 -239h401q106 0 181 -75t75 -181v-668 q0 -88 -54 -157.5t-140 -90.5l-339 -85q-92 -23 -186 -23zM1024 583l-155 -71l-163 -74q-30 -14 -48 -41.5t-18 -60.5q0 -46 33 -79t79 -33q26 0 46 10l338 154q-49 10 -80.5 50t-31.5 90v55zM1344 272q0 46 -33 79t-79 33q-26 0 -46 -10l-290 -132q-28 -13 -37 -17 t-30.5 -17t-29.5 -23.5t-16 -29t-8 -40.5q0 -50 31.5 -82t81.5 -32q20 0 38 9l352 160q30 14 48 41.5t18 60.5zM1112 1024l-650 248q-24 8 -46 8q-53 0 -90.5 -37.5t-37.5 -90.5q0 -40 22.5 -73t59.5 -47l526 -200v-64h-640q-53 0 -90.5 -37.5t-37.5 -90.5t37.5 -90.5 t90.5 -37.5h535l233 106v198q0 63 46 106l111 102h-69zM1073 0q82 0 155 19l339 85q43 11 70 45.5t27 78.5v668q0 53 -37.5 90.5t-90.5 37.5h-308l-136 -126q-36 -33 -36 -82v-296q0 -46 33 -77t79 -31t79 35t33 81v208h32v-208q0 -70 -57 -114q52 -8 86.5 -48.5t34.5 -93.5 q0 -42 -23 -78t-61 -53l-310 -141h91z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1151 1536q61 0 116 -28t91 -77l572 -781q118 -159 118 -359v-355q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v177l-286 143h-546q-80 0 -136 56t-56 136v32q0 119 84.5 203.5t203.5 84.5h420l42 128h-686q-100 0 -173.5 67.5t-81.5 166.5q-65 79 -65 182v32 q0 80 56 136t136 56h959zM1920 -64v355q0 157 -93 284l-573 781q-39 52 -103 52h-959q-26 0 -45 -19t-19 -45q0 -32 1.5 -49.5t9.5 -40.5t25 -43q10 31 35.5 50t56.5 19h832v-32h-832q-26 0 -45 -19t-19 -45q0 -44 3 -58q8 -44 44 -73t81 -29h640h91q40 0 68 -28t28 -68 q0 -15 -5 -30l-64 -192q-10 -29 -35 -47.5t-56 -18.5h-443q-66 0 -113 -47t-47 -113v-32q0 -26 19 -45t45 -19h561q16 0 29 -7l317 -158q24 -13 38.5 -36t14.5 -50v-197q0 -26 19 -45t45 -19h384q26 0 45 19t19 45z" /> +<glyph unicode="" horiz-adv-x="2048" d="M816 1408q-48 0 -79.5 -34t-31.5 -82q0 -14 3 -28l150 -624h-26l-116 482q-9 38 -39.5 62t-69.5 24q-47 0 -79 -34t-32 -81q0 -11 4 -29q3 -13 39 -161t68 -282t32 -138v-227l-307 230q-34 26 -77 26q-52 0 -89.5 -36.5t-37.5 -88.5q0 -67 56 -110l507 -379 q34 -26 76 -26h694q33 0 59 20.5t34 52.5l100 401q8 30 10 88t9 86l116 478q3 12 3 26q0 46 -33 79t-80 33q-38 0 -69 -25.5t-40 -62.5l-99 -408h-26l132 547q3 14 3 28q0 47 -32 80t-80 33q-38 0 -68.5 -24t-39.5 -62l-145 -602h-127l-164 682q-9 38 -39.5 62t-68.5 24z M1461 -256h-694q-85 0 -153 51l-507 380q-50 38 -78.5 94t-28.5 118q0 105 75 179t180 74q25 0 49.5 -5.5t41.5 -11t41 -20.5t35 -23t38.5 -29.5t37.5 -28.5l-123 512q-7 35 -7 59q0 93 60 162t152 79q14 87 80.5 144.5t155.5 57.5q83 0 148 -51.5t85 -132.5l103 -428 l83 348q20 81 85 132.5t148 51.5q87 0 152.5 -54t82.5 -139q93 -10 155 -78t62 -161q0 -30 -7 -57l-116 -477q-5 -22 -5 -67q0 -51 -13 -108l-101 -401q-19 -75 -79.5 -122.5t-137.5 -47.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M640 1408q-53 0 -90.5 -37.5t-37.5 -90.5v-512v-384l-151 202q-41 54 -107 54q-52 0 -89 -38t-37 -90q0 -43 26 -77l384 -512q38 -51 102 -51h718q22 0 39.5 13.5t22.5 34.5l92 368q24 96 24 194v217q0 41 -28 71t-68 30t-68 -28t-28 -68h-32v61q0 48 -32 81.5t-80 33.5 q-46 0 -79 -33t-33 -79v-64h-32v90q0 55 -37 94.5t-91 39.5q-53 0 -90.5 -37.5t-37.5 -90.5v-96h-32v570q0 55 -37 94.5t-91 39.5zM640 1536q107 0 181.5 -77.5t74.5 -184.5v-220q22 2 32 2q99 0 173 -69q47 21 99 21q113 0 184 -87q27 7 56 7q94 0 159 -67.5t65 -161.5 v-217q0 -116 -28 -225l-92 -368q-16 -64 -68 -104.5t-118 -40.5h-718q-60 0 -114.5 27.5t-90.5 74.5l-384 512q-51 68 -51 154q0 105 74.5 180.5t179.5 75.5q71 0 130 -35v547q0 106 75 181t181 75zM768 128v384h-32v-384h32zM1024 128v384h-32v-384h32zM1280 128v384h-32 v-384h32z" /> +<glyph unicode="" d="M1288 889q60 0 107 -23q141 -63 141 -226v-177q0 -94 -23 -186l-85 -339q-21 -86 -90.5 -140t-157.5 -54h-668q-106 0 -181 75t-75 181v401l-239 628q-17 45 -17 91q0 106 75 181t181 75q80 0 145.5 -45.5t93.5 -119.5l17 -44v113q0 106 75 181t181 75t181 -75t75 -181 v-261q27 5 48 5q69 0 127.5 -36.5t88.5 -98.5zM1072 896q-33 0 -60.5 -18t-41.5 -48l-74 -163l-71 -155h55q50 0 90 -31.5t50 -80.5l154 338q10 20 10 46q0 46 -33 79t-79 33zM1293 761q-22 0 -40.5 -8t-29 -16t-23.5 -29.5t-17 -30.5t-17 -37l-132 -290q-10 -20 -10 -46 q0 -46 33 -79t79 -33q33 0 60.5 18t41.5 48l160 352q9 18 9 38q0 50 -32 81.5t-82 31.5zM128 1120q0 -22 8 -46l248 -650v-69l102 111q43 46 106 46h198l106 233v535q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5v-640h-64l-200 526q-14 37 -47 59.5t-73 22.5 q-53 0 -90.5 -37.5t-37.5 -90.5zM1180 -128q44 0 78.5 27t45.5 70l85 339q19 73 19 155v91l-141 -310q-17 -38 -53 -61t-78 -23q-53 0 -93.5 34.5t-48.5 86.5q-44 -57 -114 -57h-208v32h208q46 0 81 33t35 79t-31 79t-77 33h-296q-49 0 -82 -36l-126 -136v-308 q0 -53 37.5 -90.5t90.5 -37.5h668z" /> +<glyph unicode="" horiz-adv-x="1973" d="M857 992v-117q0 -13 -9.5 -22t-22.5 -9h-298v-812q0 -13 -9 -22.5t-22 -9.5h-135q-13 0 -22.5 9t-9.5 23v812h-297q-13 0 -22.5 9t-9.5 22v117q0 14 9 23t23 9h793q13 0 22.5 -9.5t9.5 -22.5zM1895 995l77 -961q1 -13 -8 -24q-10 -10 -23 -10h-134q-12 0 -21 8.5 t-10 20.5l-46 588l-189 -425q-8 -19 -29 -19h-120q-20 0 -29 19l-188 427l-45 -590q-1 -12 -10 -20.5t-21 -8.5h-135q-13 0 -23 10q-9 10 -9 24l78 961q1 12 10 20.5t21 8.5h142q20 0 29 -19l220 -520q10 -24 20 -51q3 7 9.5 24.5t10.5 26.5l221 520q9 19 29 19h141 q13 0 22 -8.5t10 -20.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1042 833q0 88 -60 121q-33 18 -117 18h-123v-281h162q66 0 102 37t36 105zM1094 548l205 -373q8 -17 -1 -31q-8 -16 -27 -16h-152q-20 0 -28 17l-194 365h-155v-350q0 -14 -9 -23t-23 -9h-134q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h294q128 0 190 -24q85 -31 134 -109 t49 -180q0 -92 -42.5 -165.5t-115.5 -109.5q6 -10 9 -16zM896 1376q-150 0 -286 -58.5t-234.5 -157t-157 -234.5t-58.5 -286t58.5 -286t157 -234.5t234.5 -157t286 -58.5t286 58.5t234.5 157t157 234.5t58.5 286t-58.5 286t-157 234.5t-234.5 157t-286 58.5zM1792 640 q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> +<glyph unicode="" horiz-adv-x="1792" d="M605 303q153 0 257 104q14 18 3 36l-45 82q-6 13 -24 17q-16 2 -27 -11l-4 -3q-4 -4 -11.5 -10t-17.5 -13t-23.5 -14.5t-28.5 -13.5t-33.5 -9.5t-37.5 -3.5q-76 0 -125 50t-49 127q0 76 48 125.5t122 49.5q37 0 71.5 -14t50.5 -28l16 -14q11 -11 26 -10q16 2 24 14l53 78 q13 20 -2 39q-3 4 -11 12t-30 23.5t-48.5 28t-67.5 22.5t-86 10q-148 0 -246 -96.5t-98 -240.5q0 -146 97 -241.5t247 -95.5zM1235 303q153 0 257 104q14 18 4 36l-45 82q-8 14 -25 17q-16 2 -27 -11l-4 -3q-4 -4 -11.5 -10t-17.5 -13t-23.5 -14.5t-28.5 -13.5t-33.5 -9.5 t-37.5 -3.5q-76 0 -125 50t-49 127q0 76 48 125.5t122 49.5q37 0 71.5 -14t50.5 -28l16 -14q11 -11 26 -10q16 2 24 14l53 78q13 20 -2 39q-3 4 -11 12t-30 23.5t-48.5 28t-67.5 22.5t-86 10q-147 0 -245.5 -96.5t-98.5 -240.5q0 -146 97 -241.5t247 -95.5zM896 1376 q-150 0 -286 -58.5t-234.5 -157t-157 -234.5t-58.5 -286t58.5 -286t157 -234.5t234.5 -157t286 -58.5t286 58.5t234.5 157t157 234.5t58.5 286t-58.5 286t-157 234.5t-234.5 157t-286 58.5zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286t-286 -191 t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71z" /> +<glyph unicode="" horiz-adv-x="2048" d="M736 736l384 -384l-384 -384l-672 672l672 672l168 -168l-96 -96l-72 72l-480 -480l480 -480l193 193l-289 287zM1312 1312l672 -672l-672 -672l-168 168l96 96l72 -72l480 480l-480 480l-193 -193l289 -287l-96 -96l-384 384z" /> +<glyph unicode="" horiz-adv-x="1792" d="M717 182l271 271l-279 279l-88 -88l192 -191l-96 -96l-279 279l279 279l40 -40l87 87l-127 128l-454 -454zM1075 190l454 454l-454 454l-271 -271l279 -279l88 88l-192 191l96 96l279 -279l-279 -279l-40 40l-87 -88zM1792 640q0 -182 -71 -348t-191 -286t-286 -191 t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> +<glyph unicode="" horiz-adv-x="2304" d="M651 539q0 -39 -27.5 -66.5t-65.5 -27.5q-39 0 -66.5 27.5t-27.5 66.5q0 38 27.5 65.5t66.5 27.5q38 0 65.5 -27.5t27.5 -65.5zM1805 540q0 -39 -27.5 -66.5t-66.5 -27.5t-66.5 27.5t-27.5 66.5t27.5 66t66.5 27t66.5 -27t27.5 -66zM765 539q0 79 -56.5 136t-136.5 57 t-136.5 -56.5t-56.5 -136.5t56.5 -136.5t136.5 -56.5t136.5 56.5t56.5 136.5zM1918 540q0 80 -56.5 136.5t-136.5 56.5q-79 0 -136 -56.5t-57 -136.5t56.5 -136.5t136.5 -56.5t136.5 56.5t56.5 136.5zM850 539q0 -116 -81.5 -197.5t-196.5 -81.5q-116 0 -197.5 82t-81.5 197 t82 196.5t197 81.5t196.5 -81.5t81.5 -196.5zM2004 540q0 -115 -81.5 -196.5t-197.5 -81.5q-115 0 -196.5 81.5t-81.5 196.5t81.5 196.5t196.5 81.5q116 0 197.5 -81.5t81.5 -196.5zM1040 537q0 191 -135.5 326.5t-326.5 135.5q-125 0 -231 -62t-168 -168.5t-62 -231.5 t62 -231.5t168 -168.5t231 -62q191 0 326.5 135.5t135.5 326.5zM1708 1110q-254 111 -556 111q-319 0 -573 -110q117 0 223 -45.5t182.5 -122.5t122 -183t45.5 -223q0 115 43.5 219.5t118 180.5t177.5 123t217 50zM2187 537q0 191 -135 326.5t-326 135.5t-326.5 -135.5 t-135.5 -326.5t135.5 -326.5t326.5 -135.5t326 135.5t135 326.5zM1921 1103h383q-44 -51 -75 -114.5t-40 -114.5q110 -151 110 -337q0 -156 -77 -288t-209 -208.5t-287 -76.5q-133 0 -249 56t-196 155q-47 -56 -129 -179q-11 22 -53.5 82.5t-74.5 97.5 q-80 -99 -196.5 -155.5t-249.5 -56.5q-155 0 -287 76.5t-209 208.5t-77 288q0 186 110 337q-9 51 -40 114.5t-75 114.5h365q149 100 355 156.5t432 56.5q224 0 421 -56t348 -157z" /> +<glyph unicode="" horiz-adv-x="1280" d="M640 629q-188 0 -321 133t-133 320q0 188 133 321t321 133t321 -133t133 -321q0 -187 -133 -320t-321 -133zM640 1306q-92 0 -157.5 -65.5t-65.5 -158.5q0 -92 65.5 -157.5t157.5 -65.5t157.5 65.5t65.5 157.5q0 93 -65.5 158.5t-157.5 65.5zM1163 574q13 -27 15 -49.5 t-4.5 -40.5t-26.5 -38.5t-42.5 -37t-61.5 -41.5q-115 -73 -315 -94l73 -72l267 -267q30 -31 30 -74t-30 -73l-12 -13q-31 -30 -74 -30t-74 30q-67 68 -267 268l-267 -268q-31 -30 -74 -30t-73 30l-12 13q-31 30 -31 73t31 74l267 267l72 72q-203 21 -317 94 q-39 25 -61.5 41.5t-42.5 37t-26.5 38.5t-4.5 40.5t15 49.5q10 20 28 35t42 22t56 -2t65 -35q5 -4 15 -11t43 -24.5t69 -30.5t92 -24t113 -11q91 0 174 25.5t120 50.5l38 25q33 26 65 35t56 2t42 -22t28 -35z" /> +<glyph unicode="" d="M927 956q0 -66 -46.5 -112.5t-112.5 -46.5t-112.5 46.5t-46.5 112.5t46.5 112.5t112.5 46.5t112.5 -46.5t46.5 -112.5zM1141 593q-10 20 -28 32t-47.5 9.5t-60.5 -27.5q-10 -8 -29 -20t-81 -32t-127 -20t-124 18t-86 36l-27 18q-31 25 -60.5 27.5t-47.5 -9.5t-28 -32 q-22 -45 -2 -74.5t87 -73.5q83 -53 226 -67l-51 -52q-142 -142 -191 -190q-22 -22 -22 -52.5t22 -52.5l9 -9q22 -22 52.5 -22t52.5 22l191 191q114 -115 191 -191q22 -22 52.5 -22t52.5 22l9 9q22 22 22 52.5t-22 52.5l-191 190l-52 52q141 14 225 67q67 44 87 73.5t-2 74.5 zM1092 956q0 134 -95 229t-229 95t-229 -95t-95 -229t95 -229t229 -95t229 95t95 229zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1720" d="M1565 1408q65 0 110 -45.5t45 -110.5v-519q0 -176 -68 -336t-182.5 -275t-274 -182.5t-334.5 -67.5q-176 0 -335.5 67.5t-274.5 182.5t-183 275t-68 336v519q0 64 46 110t110 46h1409zM861 344q47 0 82 33l404 388q37 35 37 85q0 49 -34.5 83.5t-83.5 34.5q-47 0 -82 -33 l-323 -310l-323 310q-35 33 -81 33q-49 0 -83.5 -34.5t-34.5 -83.5q0 -51 36 -85l405 -388q33 -33 81 -33z" /> +<glyph unicode="" horiz-adv-x="2304" d="M1494 -103l-295 695q-25 -49 -158.5 -305.5t-198.5 -389.5q-1 -1 -27.5 -0.5t-26.5 1.5q-82 193 -255.5 587t-259.5 596q-21 50 -66.5 107.5t-103.5 100.5t-102 43q0 5 -0.5 24t-0.5 27h583v-50q-39 -2 -79.5 -16t-66.5 -43t-10 -64q26 -59 216.5 -499t235.5 -540 q31 61 140 266.5t131 247.5q-19 39 -126 281t-136 295q-38 69 -201 71v50l513 -1v-47q-60 -2 -93.5 -25t-12.5 -69q33 -70 87 -189.5t86 -187.5q110 214 173 363q24 55 -10 79.5t-129 26.5q1 7 1 25v24q64 0 170.5 0.5t180 1t92.5 0.5v-49q-62 -2 -119 -33t-90 -81 l-213 -442q13 -33 127.5 -290t121.5 -274l441 1017q-14 38 -49.5 62.5t-65 31.5t-55.5 8v50l460 -4l1 -2l-1 -44q-139 -4 -201 -145q-526 -1216 -559 -1291h-49z" /> +<glyph unicode="" horiz-adv-x="1792" d="M949 643q0 -26 -16.5 -45t-41.5 -19q-26 0 -45 16.5t-19 41.5q0 26 17 45t42 19t44 -16.5t19 -41.5zM964 585l350 581q-9 -8 -67.5 -62.5t-125.5 -116.5t-136.5 -127t-117 -110.5t-50.5 -51.5l-349 -580q7 7 67 62t126 116.5t136 127t117 111t50 50.5zM1611 640 q0 -201 -104 -371q-3 2 -17 11t-26.5 16.5t-16.5 7.5q-13 0 -13 -13q0 -10 59 -44q-74 -112 -184.5 -190.5t-241.5 -110.5l-16 67q-1 10 -15 10q-5 0 -8 -5.5t-2 -9.5l16 -68q-72 -15 -146 -15q-199 0 -372 105q1 2 13 20.5t21.5 33.5t9.5 19q0 13 -13 13q-6 0 -17 -14.5 t-22.5 -34.5t-13.5 -23q-113 75 -192 187.5t-110 244.5l69 15q10 3 10 15q0 5 -5.5 8t-10.5 2l-68 -15q-14 72 -14 139q0 206 109 379q2 -1 18.5 -12t30 -19t17.5 -8q13 0 13 12q0 6 -12.5 15.5t-32.5 21.5l-20 12q77 112 189 189t244 107l15 -67q2 -10 15 -10q5 0 8 5.5 t2 10.5l-15 66q71 13 134 13q204 0 379 -109q-39 -56 -39 -65q0 -13 12 -13q11 0 48 64q111 -75 187.5 -186t107.5 -241l-56 -12q-10 -2 -10 -16q0 -5 5.5 -8t9.5 -2l57 13q14 -72 14 -140zM1696 640q0 163 -63.5 311t-170.5 255t-255 170.5t-311 63.5t-311 -63.5 t-255 -170.5t-170.5 -255t-63.5 -311t63.5 -311t170.5 -255t255 -170.5t311 -63.5t311 63.5t255 170.5t170.5 255t63.5 311zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191 t191 -286t71 -348z" /> +<glyph unicode="" horiz-adv-x="1792" d="M893 1536q240 2 451 -120q232 -134 352 -372l-742 39q-160 9 -294 -74.5t-185 -229.5l-276 424q128 159 311 245.5t383 87.5zM146 1131l337 -663q72 -143 211 -217t293 -45l-230 -451q-212 33 -385 157.5t-272.5 316t-99.5 411.5q0 267 146 491zM1732 962 q58 -150 59.5 -310.5t-48.5 -306t-153 -272t-246 -209.5q-230 -133 -498 -119l405 623q88 131 82.5 290.5t-106.5 277.5zM896 942q125 0 213.5 -88.5t88.5 -213.5t-88.5 -213.5t-213.5 -88.5t-213.5 88.5t-88.5 213.5t88.5 213.5t213.5 88.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M903 -256q-283 0 -504.5 150.5t-329.5 398.5q-58 131 -67 301t26 332.5t111 312t179 242.5l-11 -281q11 14 68 15.5t70 -15.5q42 81 160.5 138t234.5 59q-54 -45 -119.5 -148.5t-58.5 -163.5q25 -8 62.5 -13.5t63 -7.5t68 -4t50.5 -3q15 -5 9.5 -45.5t-30.5 -75.5 q-5 -7 -16.5 -18.5t-56.5 -35.5t-101 -34l15 -189l-139 67q-18 -43 -7.5 -81.5t36 -66.5t65.5 -41.5t81 -6.5q51 9 98 34.5t83.5 45t73.5 17.5q61 -4 89.5 -33t19.5 -65q-1 -2 -2.5 -5.5t-8.5 -12.5t-18 -15.5t-31.5 -10.5t-46.5 -1q-60 -95 -144.5 -135.5t-209.5 -29.5 q74 -61 162.5 -82.5t168.5 -6t154.5 52t128 87.5t80.5 104q43 91 39 192.5t-37.5 188.5t-78.5 125q87 -38 137 -79.5t77 -112.5q15 170 -57.5 343t-209.5 284q265 -77 412 -279.5t151 -517.5q2 -127 -40.5 -255t-123.5 -238t-189 -196t-247.5 -135.5t-288.5 -49.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1493 1308q-165 110 -359 110q-155 0 -293 -73t-240 -200q-75 -93 -119.5 -218t-48.5 -266v-42q4 -141 48.5 -266t119.5 -218q102 -127 240 -200t293 -73q194 0 359 110q-121 -108 -274.5 -168t-322.5 -60q-29 0 -43 1q-175 8 -333 82t-272 193t-181 281t-67 339 q0 182 71 348t191 286t286 191t348 71h3q168 -1 320.5 -60.5t273.5 -167.5zM1792 640q0 -192 -77 -362.5t-213 -296.5q-104 -63 -222 -63q-137 0 -255 84q154 56 253.5 233t99.5 405q0 227 -99 404t-253 234q119 83 254 83q119 0 226 -65q135 -125 210.5 -295t75.5 -361z " /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 599q0 -56 -7 -104h-1151q0 -146 109.5 -244.5t257.5 -98.5q99 0 185.5 46.5t136.5 130.5h423q-56 -159 -170.5 -281t-267.5 -188.5t-321 -66.5q-187 0 -356 83q-228 -116 -394 -116q-237 0 -237 263q0 115 45 275q17 60 109 229q199 360 475 606 q-184 -79 -427 -354q63 274 283.5 449.5t501.5 175.5q30 0 45 -1q255 117 433 117q64 0 116 -13t94.5 -40.5t66.5 -76.5t24 -115q0 -116 -75 -286q101 -182 101 -390zM1722 1239q0 83 -53 132t-137 49q-108 0 -254 -70q121 -47 222.5 -131.5t170.5 -195.5q51 135 51 216z M128 2q0 -86 48.5 -132.5t134.5 -46.5q115 0 266 83q-122 72 -213.5 183t-137.5 245q-98 -205 -98 -332zM632 715h728q-5 142 -113 237t-251 95q-144 0 -251.5 -95t-112.5 -237z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1792 288v960q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5zM1920 1248v-960q0 -66 -47 -113t-113 -47h-736v-128h352q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23 v64q0 14 9 23t23 9h352v128h-736q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" /> +<glyph unicode="" horiz-adv-x="1792" d="M138 1408h197q-70 -64 -126 -149q-36 -56 -59 -115t-30 -125.5t-8.5 -120t10.5 -132t21 -126t28 -136.5q4 -19 6 -28q51 -238 81 -329q57 -171 152 -275h-272q-48 0 -82 34t-34 82v1304q0 48 34 82t82 34zM1346 1408h308q48 0 82 -34t34 -82v-1304q0 -48 -34 -82t-82 -34 h-178q212 210 196 565l-469 -101q-2 -45 -12 -82t-31 -72t-59.5 -59.5t-93.5 -36.5q-123 -26 -199 40q-32 27 -53 61t-51.5 129t-64.5 258q-35 163 -45.5 263t-5.5 139t23 77q20 41 62.5 73t102.5 45q45 12 83.5 6.5t67 -17t54 -35t43 -48t34.5 -56.5l468 100 q-68 175 -180 287z" /> +<glyph unicode="" d="M1401 -11l-6 -6q-113 -114 -259 -175q-154 -64 -317 -64q-165 0 -317 64q-148 63 -259 175q-113 112 -175 258q-42 103 -54 189q-4 28 48 36q51 8 56 -20q1 -1 1 -4q18 -90 46 -159q50 -124 152 -226q98 -98 226 -152q132 -56 276 -56q143 0 276 56q128 55 225 152l6 6 q10 10 25 6q12 -3 33 -22q36 -37 17 -58zM929 604l-66 -66l63 -63q21 -21 -7 -49q-17 -17 -32 -17q-10 0 -19 10l-62 61l-66 -66q-5 -5 -15 -5q-15 0 -31 16l-2 2q-18 15 -18 29q0 7 8 17l66 65l-66 66q-16 16 14 45q18 18 31 18q6 0 13 -5l65 -66l65 65q18 17 48 -13 q27 -27 11 -44zM1400 547q0 -118 -46 -228q-45 -105 -126 -186q-80 -80 -187 -126t-228 -46t-228 46t-187 126q-82 82 -125 186q-15 32 -15 40h-1q-9 27 43 44q50 16 60 -12q37 -99 97 -167h1v339v2q3 136 102 232q105 103 253 103q147 0 251 -103t104 -249 q0 -147 -104.5 -251t-250.5 -104q-58 0 -112 16q-28 11 -13 61q16 51 44 43l14 -3q14 -3 32.5 -6t30.5 -3q104 0 176 71.5t72 174.5q0 101 -72 171q-71 71 -175 71q-107 0 -178 -80q-64 -72 -64 -160v-413q110 -67 242 -67q96 0 185 36.5t156 103.5t103.5 155t36.5 183 q0 198 -141 339q-140 140 -339 140q-200 0 -340 -140q-53 -53 -77 -87l-2 -2q-8 -11 -13 -15.5t-21.5 -9.5t-38.5 3q-21 5 -36.5 16.5t-15.5 26.5v680q0 15 10.5 26.5t27.5 11.5h877q30 0 30 -55t-30 -55h-811v-483h1q40 42 102 84t108 61q109 46 231 46q121 0 228 -46 t187 -126q81 -81 126 -186q46 -112 46 -229zM1369 1128q9 -8 9 -18t-5.5 -18t-16.5 -21q-26 -26 -39 -26q-9 0 -16 7q-106 91 -207 133q-128 56 -276 56q-133 0 -262 -49q-27 -10 -45 37q-9 25 -8 38q3 16 16 20q130 57 299 57q164 0 316 -64q137 -58 235 -152z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1551 60q15 6 26 3t11 -17.5t-15 -33.5q-13 -16 -44 -43.5t-95.5 -68t-141 -74t-188 -58t-229.5 -24.5q-119 0 -238 31t-209 76.5t-172.5 104t-132.5 105t-84 87.5q-8 9 -10 16.5t1 12t8 7t11.5 2t11.5 -4.5q192 -117 300 -166q389 -176 799 -90q190 40 391 135z M1758 175q11 -16 2.5 -69.5t-28.5 -102.5q-34 -83 -85 -124q-17 -14 -26 -9t0 24q21 45 44.5 121.5t6.5 98.5q-5 7 -15.5 11.5t-27 6t-29.5 2.5t-35 0t-31.5 -2t-31 -3t-22.5 -2q-6 -1 -13 -1.5t-11 -1t-8.5 -1t-7 -0.5h-5.5h-4.5t-3 0.5t-2 1.5l-1.5 3q-6 16 47 40t103 30 q46 7 108 1t76 -24zM1364 618q0 -31 13.5 -64t32 -58t37.5 -46t33 -32l13 -11l-227 -224q-40 37 -79 75.5t-58 58.5l-19 20q-11 11 -25 33q-38 -59 -97.5 -102.5t-127.5 -63.5t-140 -23t-137.5 21t-117.5 65.5t-83 113t-31 162.5q0 84 28 154t72 116.5t106.5 83t122.5 57 t130 34.5t119.5 18.5t99.5 6.5v127q0 65 -21 97q-34 53 -121 53q-6 0 -16.5 -1t-40.5 -12t-56 -29.5t-56 -59.5t-48 -96l-294 27q0 60 22 119t67 113t108 95t151.5 65.5t190.5 24.5q100 0 181 -25t129.5 -61.5t81 -83t45 -86t12.5 -73.5v-589zM692 597q0 -86 70 -133 q66 -44 139 -22q84 25 114 123q14 45 14 101v162q-59 -2 -111 -12t-106.5 -33.5t-87 -71t-32.5 -114.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1536 1280q52 0 90 -38t38 -90v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128zM1152 1376v-288q0 -14 9 -23t23 -9 h64q14 0 23 9t9 23v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM384 1376v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM1536 -128v1024h-1408v-1024h1408zM896 448h224q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-224 v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-224q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v224q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-224z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1152 416v-64q0 -14 -9 -23t-23 -9h-576q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h576q14 0 23 -9t9 -23zM128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23 t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47 t47 -113v-96h128q52 0 90 -38t38 -90z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1111 151l-46 -46q-9 -9 -22 -9t-23 9l-188 189l-188 -189q-10 -9 -23 -9t-22 9l-46 46q-9 9 -9 22t9 23l189 188l-189 188q-9 10 -9 23t9 22l46 46q9 9 22 9t23 -9l188 -188l188 188q10 9 23 9t22 -9l46 -46q9 -9 9 -22t-9 -23l-188 -188l188 -188q9 -10 9 -23t-9 -22z M128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280 q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1303 572l-512 -512q-10 -9 -23 -9t-23 9l-288 288q-9 10 -9 23t9 22l46 46q9 9 22 9t23 -9l220 -220l444 444q10 9 23 9t22 -9l46 -46q9 -9 9 -22t-9 -23zM128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23 t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47 t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" /> +<glyph unicode="" horiz-adv-x="1792" d="M448 1536q26 0 45 -19t19 -45v-891l536 429q17 14 40 14q26 0 45 -19t19 -45v-379l536 429q17 14 40 14q26 0 45 -19t19 -45v-1152q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h384z" /> +<glyph unicode="" horiz-adv-x="1024" d="M512 448q66 0 128 15v-655q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v655q61 -15 128 -15zM512 1536q212 0 362 -150t150 -362t-150 -362t-362 -150t-362 150t-150 362t150 362t362 150zM512 1312q14 0 23 9t9 23t-9 23t-23 9q-146 0 -249 -103t-103 -249 q0 -14 9 -23t23 -9t23 9t9 23q0 119 84.5 203.5t203.5 84.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1745 1239q10 -10 10 -23t-10 -23l-141 -141q-28 -28 -68 -28h-1344q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h576v64q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-64h512q40 0 68 -28zM768 320h256v-512q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v512zM1600 768 q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19h-1344q-40 0 -68 28l-141 141q-10 10 -10 23t10 23l141 141q28 28 68 28h512v192h256v-192h576z" /> +<glyph unicode="" horiz-adv-x="2048" d="M2020 1525q28 -20 28 -53v-1408q0 -20 -11 -36t-29 -23l-640 -256q-24 -11 -48 0l-616 246l-616 -246q-10 -5 -24 -5q-19 0 -36 11q-28 20 -28 53v1408q0 20 11 36t29 23l640 256q24 11 48 0l616 -246l616 246q32 13 60 -6zM736 1390v-1270l576 -230v1270zM128 1173 v-1270l544 217v1270zM1920 107v1270l-544 -217v-1270z" /> +<glyph unicode="" horiz-adv-x="1792" d="M512 1536q13 0 22.5 -9.5t9.5 -22.5v-1472q0 -20 -17 -28l-480 -256q-7 -4 -15 -4q-13 0 -22.5 9.5t-9.5 22.5v1472q0 20 17 28l480 256q7 4 15 4zM1760 1536q13 0 22.5 -9.5t9.5 -22.5v-1472q0 -20 -17 -28l-480 -256q-7 -4 -15 -4q-13 0 -22.5 9.5t-9.5 22.5v1472 q0 20 17 28l480 256q7 4 15 4zM640 1536q8 0 14 -3l512 -256q18 -10 18 -29v-1472q0 -13 -9.5 -22.5t-22.5 -9.5q-8 0 -14 3l-512 256q-18 10 -18 29v1472q0 13 9.5 22.5t22.5 9.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M640 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1408 640q0 53 -37.5 90.5t-90.5 37.5 t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-110 0 -211 18q-173 -173 -435 -229q-52 -10 -86 -13q-12 -1 -22 6t-13 18q-4 15 20 37q5 5 23.5 21.5t25.5 23.5t23.5 25.5t24 31.5t20.5 37 t20 48t14.5 57.5t12.5 72.5q-146 90 -229.5 216.5t-83.5 269.5q0 174 120 321.5t326 233t450 85.5t450 -85.5t326 -233t120 -321.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M640 640q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1024 640q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 -53 -37.5 -90.5t-90.5 -37.5 t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM896 1152q-204 0 -381.5 -69.5t-282 -187.5t-104.5 -255q0 -112 71.5 -213.5t201.5 -175.5l87 -50l-27 -96q-24 -91 -70 -172q152 63 275 171l43 38l57 -6q69 -8 130 -8q204 0 381.5 69.5t282 187.5 t104.5 255t-104.5 255t-282 187.5t-381.5 69.5zM1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22h-5q-15 0 -27 10.5t-16 27.5v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51 t27 59t26 76q-157 89 -247.5 220t-90.5 281q0 130 71 248.5t191 204.5t286 136.5t348 50.5t348 -50.5t286 -136.5t191 -204.5t71 -248.5z" /> +<glyph unicode="" horiz-adv-x="1024" d="M512 345l512 295v-591l-512 -296v592zM0 640v-591l512 296zM512 1527v-591l-512 -296v591zM512 936l512 295v-591z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1709 1018q-10 -236 -332 -651q-333 -431 -562 -431q-142 0 -240 263q-44 160 -132 482q-72 262 -157 262q-18 0 -127 -76l-77 98q24 21 108 96.5t130 115.5q156 138 241 146q95 9 153 -55.5t81 -203.5q44 -287 66 -373q55 -249 120 -249q51 0 154 161q101 161 109 246 q13 139 -109 139q-57 0 -121 -26q120 393 459 382q251 -8 236 -326z" /> +<glyph unicode="" d="M0 1408h1536v-1536h-1536v1536zM1085 293l-221 631l221 297h-634l221 -297l-221 -631l317 -304z" /> +<glyph unicode="" d="M0 1408h1536v-1536h-1536v1536zM908 1088l-12 -33l75 -83l-31 -114l25 -25l107 57l107 -57l25 25l-31 114l75 83l-12 33h-95l-53 96h-32l-53 -96h-95zM641 925q32 0 44.5 -16t11.5 -63l174 21q0 55 -17.5 92.5t-50.5 56t-69 25.5t-85 7q-133 0 -199 -57.5t-66 -182.5v-72 h-96v-128h76q20 0 20 -8v-382q0 -14 -5 -20t-18 -7l-73 -7v-88h448v86l-149 14q-6 1 -8.5 1.5t-3.5 2.5t-0.5 4t1 7t0.5 10v387h191l38 128h-231q-6 0 -2 6t4 9v80q0 27 1.5 40.5t7.5 28t19.5 20t36.5 5.5zM1248 96v86l-54 9q-7 1 -9.5 2.5t-2.5 3t1 7.5t1 12v520h-275 l-23 -101l83 -22q23 -7 23 -27v-370q0 -14 -6 -18.5t-20 -6.5l-70 -9v-86h352z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1792 690q0 -58 -29.5 -105.5t-79.5 -72.5q12 -46 12 -96q0 -155 -106.5 -287t-290.5 -208.5t-400 -76.5t-399.5 76.5t-290 208.5t-106.5 287q0 47 11 94q-51 25 -82 73.5t-31 106.5q0 82 58 140.5t141 58.5q85 0 145 -63q218 152 515 162l116 521q3 13 15 21t26 5 l369 -81q18 37 54 59.5t79 22.5q62 0 106 -43.5t44 -105.5t-44 -106t-106 -44t-105.5 43.5t-43.5 105.5l-334 74l-104 -472q300 -9 519 -160q58 61 143 61q83 0 141 -58.5t58 -140.5zM418 491q0 -62 43.5 -106t105.5 -44t106 44t44 106t-44 105.5t-106 43.5q-61 0 -105 -44 t-44 -105zM1228 136q11 11 11 26t-11 26q-10 10 -25 10t-26 -10q-41 -42 -121 -62t-160 -20t-160 20t-121 62q-11 10 -26 10t-25 -10q-11 -10 -11 -25.5t11 -26.5q43 -43 118.5 -68t122.5 -29.5t91 -4.5t91 4.5t122.5 29.5t118.5 68zM1225 341q62 0 105.5 44t43.5 106 q0 61 -44 105t-105 44q-62 0 -106 -43.5t-44 -105.5t44 -106t106 -44z" /> +<glyph unicode="" horiz-adv-x="1792" d="M69 741h1q16 126 58.5 241.5t115 217t167.5 176t223.5 117.5t276.5 43q231 0 414 -105.5t294 -303.5q104 -187 104 -442v-188h-1125q1 -111 53.5 -192.5t136.5 -122.5t189.5 -57t213 -3t208 46.5t173.5 84.5v-377q-92 -55 -229.5 -92t-312.5 -38t-316 53 q-189 73 -311.5 249t-124.5 372q-3 242 111 412t325 268q-48 -60 -78 -125.5t-46 -159.5h635q8 77 -8 140t-47 101.5t-70.5 66.5t-80.5 41t-75 20.5t-56 8.5l-22 1q-135 -5 -259.5 -44.5t-223.5 -104.5t-176 -140.5t-138 -163.5z" /> +<glyph unicode="" horiz-adv-x="2304" d="M0 32v608h2304v-608q0 -66 -47 -113t-113 -47h-1984q-66 0 -113 47t-47 113zM640 256v-128h384v128h-384zM256 256v-128h256v128h-256zM2144 1408q66 0 113 -47t47 -113v-224h-2304v224q0 66 47 113t113 47h1984z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1549 857q55 0 85.5 -28.5t30.5 -83.5t-34 -82t-91 -27h-136v-177h-25v398h170zM1710 267l-4 -11l-5 -10q-113 -230 -330.5 -366t-474.5 -136q-182 0 -348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71q244 0 454.5 -124t329.5 -338l2 -4l8 -16 q-30 -15 -136.5 -68.5t-163.5 -84.5q-6 -3 -479 -268q384 -183 799 -366zM896 -234q250 0 462.5 132.5t322.5 357.5l-287 129q-72 -140 -206 -222t-292 -82q-151 0 -280 75t-204 204t-75 280t75 280t204 204t280 75t280 -73.5t204 -204.5l280 143q-116 208 -321 329 t-443 121q-119 0 -232.5 -31.5t-209 -87.5t-176.5 -137t-137 -176.5t-87.5 -209t-31.5 -232.5t31.5 -232.5t87.5 -209t137 -176.5t176.5 -137t209 -87.5t232.5 -31.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1427 827l-614 386l92 151h855zM405 562l-184 116v858l1183 -743zM1424 697l147 -95v-858l-532 335zM1387 718l-500 -802h-855l356 571z" /> +<glyph unicode="" horiz-adv-x="1792" d="M640 528v224q0 16 -16 16h-96q-16 0 -16 -16v-224q0 -16 16 -16h96q16 0 16 16zM1152 528v224q0 16 -16 16h-96q-16 0 -16 -16v-224q0 -16 16 -16h96q16 0 16 16zM1664 496v-752h-640v320q0 80 -56 136t-136 56t-136 -56t-56 -136v-320h-640v752q0 16 16 16h96 q16 0 16 -16v-112h128v624q0 16 16 16h96q16 0 16 -16v-112h128v112q0 16 16 16h96q16 0 16 -16v-112h128v112q0 6 2.5 9.5t8.5 5t9.5 2t11.5 0t9 -0.5v391q-32 15 -32 50q0 23 16.5 39t38.5 16t38.5 -16t16.5 -39q0 -35 -32 -50v-17q45 10 83 10q21 0 59.5 -7.5t54.5 -7.5 q17 0 47 7.5t37 7.5q16 0 16 -16v-210q0 -15 -35 -21.5t-62 -6.5q-18 0 -54.5 7.5t-55.5 7.5q-40 0 -90 -12v-133q1 0 9 0.5t11.5 0t9.5 -2t8.5 -5t2.5 -9.5v-112h128v112q0 16 16 16h96q16 0 16 -16v-112h128v112q0 16 16 16h96q16 0 16 -16v-624h128v112q0 16 16 16h96 q16 0 16 -16z" /> +<glyph unicode="" horiz-adv-x="2304" d="M2288 731q16 -8 16 -27t-16 -27l-320 -192q-8 -5 -16 -5q-9 0 -16 4q-16 10 -16 28v128h-858q37 -58 83 -165q16 -37 24.5 -55t24 -49t27 -47t27 -34t31.5 -26t33 -8h96v96q0 14 9 23t23 9h320q14 0 23 -9t9 -23v-320q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v96h-96 q-32 0 -61 10t-51 23.5t-45 40.5t-37 46t-33.5 57t-28.5 57.5t-28 60.5q-23 53 -37 81.5t-36 65t-44.5 53.5t-46.5 17h-360q-22 -84 -91 -138t-157 -54q-106 0 -181 75t-75 181t75 181t181 75q88 0 157 -54t91 -138h104q24 0 46.5 17t44.5 53.5t36 65t37 81.5q19 41 28 60.5 t28.5 57.5t33.5 57t37 46t45 40.5t51 23.5t61 10h107q21 57 70 92.5t111 35.5q80 0 136 -56t56 -136t-56 -136t-136 -56q-62 0 -111 35.5t-70 92.5h-107q-17 0 -33 -8t-31.5 -26t-27 -34t-27 -47t-24 -49t-24.5 -55q-46 -107 -83 -165h1114v128q0 18 16 28t32 -1z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1150 774q0 -56 -39.5 -95t-95.5 -39h-253v269h253q56 0 95.5 -39.5t39.5 -95.5zM1329 774q0 130 -91.5 222t-222.5 92h-433v-896h180v269h253q130 0 222 91.5t92 221.5zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348 t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> +<glyph unicode="" horiz-adv-x="2304" d="M1645 438q0 59 -34 106.5t-87 68.5q-7 -45 -23 -92q-7 -24 -27.5 -38t-44.5 -14q-12 0 -24 3q-31 10 -45 38.5t-4 58.5q23 71 23 143q0 123 -61 227.5t-166 165.5t-228 61q-134 0 -247 -73t-167 -194q108 -28 188 -106q22 -23 22 -55t-22 -54t-54 -22t-55 22 q-75 75 -180 75q-106 0 -181 -74.5t-75 -180.5t75 -180.5t181 -74.5h1046q79 0 134.5 55.5t55.5 133.5zM1798 438q0 -142 -100.5 -242t-242.5 -100h-1046q-169 0 -289 119.5t-120 288.5q0 153 100 267t249 136q62 184 221 298t354 114q235 0 408.5 -158.5t196.5 -389.5 q116 -25 192.5 -118.5t76.5 -214.5zM2048 438q0 -175 -97 -319q-23 -33 -64 -33q-24 0 -43 13q-26 17 -32 48.5t12 57.5q71 104 71 233t-71 233q-18 26 -12 57t32 49t57.5 11.5t49.5 -32.5q97 -142 97 -318zM2304 438q0 -244 -134 -443q-23 -34 -64 -34q-23 0 -42 13 q-26 18 -32.5 49t11.5 57q108 164 108 358q0 195 -108 357q-18 26 -11.5 57.5t32.5 48.5q26 18 57 12t49 -33q134 -198 134 -442z" /> +<glyph unicode="" d="M1500 -13q0 -89 -63 -152.5t-153 -63.5t-153.5 63.5t-63.5 152.5q0 90 63.5 153.5t153.5 63.5t153 -63.5t63 -153.5zM1267 268q-115 -15 -192.5 -102.5t-77.5 -205.5q0 -74 33 -138q-146 -78 -379 -78q-109 0 -201 21t-153.5 54.5t-110.5 76.5t-76 85t-44.5 83 t-23.5 66.5t-6 39.5q0 19 4.5 42.5t18.5 56t36.5 58t64 43.5t94.5 18t94 -17.5t63 -41t35.5 -53t17.5 -49t4 -33.5q0 -34 -23 -81q28 -27 82 -42t93 -17l40 -1q115 0 190 51t75 133q0 26 -9 48.5t-31.5 44.5t-49.5 41t-74 44t-93.5 47.5t-119.5 56.5q-28 13 -43 20 q-116 55 -187 100t-122.5 102t-72 125.5t-20.5 162.5q0 78 20.5 150t66 137.5t112.5 114t166.5 77t221.5 28.5q120 0 220 -26t164.5 -67t109.5 -94t64 -105.5t19 -103.5q0 -46 -15 -82.5t-36.5 -58t-48.5 -36t-49 -19.5t-39 -5h-8h-32t-39 5t-44 14t-41 28t-37 46t-24 70.5 t-10 97.5q-15 16 -59 25.5t-81 10.5l-37 1q-68 0 -117.5 -31t-70.5 -70t-21 -76q0 -24 5 -43t24 -46t53 -51t97 -53.5t150 -58.5q76 -25 138.5 -53.5t109 -55.5t83 -59t60.5 -59.5t41 -62.5t26.5 -62t14.5 -63.5t6 -62t1 -62.5z" /> +<glyph unicode="" d="M704 352v576q0 14 -9 23t-23 9h-256q-14 0 -23 -9t-9 -23v-576q0 -14 9 -23t23 -9h256q14 0 23 9t9 23zM1152 352v576q0 14 -9 23t-23 9h-256q-14 0 -23 -9t-9 -23v-576q0 -14 9 -23t23 -9h256q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103 t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM768 96q148 0 273 73t198 198t73 273t-73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273 t73 -273t198 -198t273 -73zM864 320q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-192zM480 320q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-192z" /> +<glyph unicode="" d="M1088 352v576q0 14 -9 23t-23 9h-576q-14 0 -23 -9t-9 -23v-576q0 -14 9 -23t23 -9h576q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5 t103 -385.5z" /> +<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM768 96q148 0 273 73t198 198t73 273t-73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273 t73 -273t198 -198t273 -73zM480 320q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h576q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-576z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1757 128l35 -313q3 -28 -16 -50q-19 -21 -48 -21h-1664q-29 0 -48 21q-19 22 -16 50l35 313h1722zM1664 967l86 -775h-1708l86 775q3 24 21 40.5t43 16.5h256v-128q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5v128h384v-128q0 -53 37.5 -90.5t90.5 -37.5 t90.5 37.5t37.5 90.5v128h256q25 0 43 -16.5t21 -40.5zM1280 1152v-256q0 -26 -19 -45t-45 -19t-45 19t-19 45v256q0 106 -75 181t-181 75t-181 -75t-75 -181v-256q0 -26 -19 -45t-45 -19t-45 19t-19 45v256q0 159 112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5z" /> +<glyph unicode="" horiz-adv-x="2048" d="M1920 768q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5h-15l-115 -662q-8 -46 -44 -76t-82 -30h-1280q-46 0 -82 30t-44 76l-115 662h-15q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5h1792zM485 -32q26 2 43.5 22.5t15.5 46.5l-32 416q-2 26 -22.5 43.5 t-46.5 15.5t-43.5 -22.5t-15.5 -46.5l32 -416q2 -25 20.5 -42t43.5 -17h5zM896 32v416q0 26 -19 45t-45 19t-45 -19t-19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45zM1280 32v416q0 26 -19 45t-45 19t-45 -19t-19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45zM1632 27l32 416 q2 26 -15.5 46.5t-43.5 22.5t-46.5 -15.5t-22.5 -43.5l-32 -416q-2 -26 15.5 -46.5t43.5 -22.5h5q25 0 43.5 17t20.5 42zM476 1244l-93 -412h-132l101 441q19 88 89 143.5t160 55.5h167q0 26 19 45t45 19h384q26 0 45 -19t19 -45h167q90 0 160 -55.5t89 -143.5l101 -441 h-132l-93 412q-11 44 -45.5 72t-79.5 28h-167q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45h-167q-45 0 -79.5 -28t-45.5 -72z" /> +<glyph unicode="" horiz-adv-x="1792" d="M991 512l64 256h-254l-64 -256h254zM1759 1016l-56 -224q-7 -24 -31 -24h-327l-64 -256h311q15 0 25 -12q10 -14 6 -28l-56 -224q-5 -24 -31 -24h-327l-81 -328q-7 -24 -31 -24h-224q-16 0 -26 12q-9 12 -6 28l78 312h-254l-81 -328q-7 -24 -31 -24h-225q-15 0 -25 12 q-9 12 -6 28l78 312h-311q-15 0 -25 12q-9 12 -6 28l56 224q7 24 31 24h327l64 256h-311q-15 0 -25 12q-10 14 -6 28l56 224q5 24 31 24h327l81 328q7 24 32 24h224q15 0 25 -12q9 -12 6 -28l-78 -312h254l81 328q7 24 32 24h224q15 0 25 -12q9 -12 6 -28l-78 -312h311 q15 0 25 -12q9 -12 6 -28z" /> +<glyph unicode="" d="M841 483l148 -148l-149 -149zM840 1094l149 -149l-148 -148zM710 -130l464 464l-306 306l306 306l-464 464v-611l-255 255l-93 -93l320 -321l-320 -321l93 -93l255 255v-611zM1429 640q0 -209 -32 -365.5t-87.5 -257t-140.5 -162.5t-181.5 -86.5t-219.5 -24.5 t-219.5 24.5t-181.5 86.5t-140.5 162.5t-87.5 257t-32 365.5t32 365.5t87.5 257t140.5 162.5t181.5 86.5t219.5 24.5t219.5 -24.5t181.5 -86.5t140.5 -162.5t87.5 -257t32 -365.5z" /> +<glyph unicode="" horiz-adv-x="1024" d="M596 113l173 172l-173 172v-344zM596 823l173 172l-173 172v-344zM628 640l356 -356l-539 -540v711l-297 -296l-108 108l372 373l-372 373l108 108l297 -296v711l539 -540z" /> +<glyph unicode="" d="M1280 256q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM512 1024q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM1536 256q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5 t112.5 -271.5zM1440 1344q0 -20 -13 -38l-1056 -1408q-19 -26 -51 -26h-160q-26 0 -45 19t-19 45q0 20 13 38l1056 1408q19 26 51 26h160q26 0 45 -19t19 -45zM768 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5 t271.5 -112.5t112.5 -271.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M104 830l792 -1015l-868 630q-18 13 -25 34.5t0 42.5l101 308v0zM566 830h660l-330 -1015v0zM368 1442l198 -612h-462l198 612q8 23 33 23t33 -23zM1688 830l101 -308q7 -21 0 -42.5t-25 -34.5l-868 -630l792 1015v0zM1688 830h-462l198 612q8 23 33 23t33 -23z" /> +<glyph unicode="" horiz-adv-x="1792" d="M384 704h160v224h-160v-224zM1221 372v92q-104 -36 -243 -38q-135 -1 -259.5 46.5t-220.5 122.5l1 -96q88 -80 212 -128.5t272 -47.5q129 0 238 49zM640 704h640v224h-640v-224zM1792 736q0 -187 -99 -352q89 -102 89 -229q0 -157 -129.5 -268t-313.5 -111 q-122 0 -225 52.5t-161 140.5q-19 -1 -57 -1t-57 1q-58 -88 -161 -140.5t-225 -52.5q-184 0 -313.5 111t-129.5 268q0 127 89 229q-99 165 -99 352q0 209 120 385.5t326.5 279.5t449.5 103t449.5 -103t326.5 -279.5t120 -385.5z" /> +<glyph unicode="" d="M515 625v-128h-252v128h252zM515 880v-127h-252v127h252zM1273 369v-128h-341v128h341zM1273 625v-128h-672v128h672zM1273 880v-127h-672v127h672zM1408 20v1240q0 8 -6 14t-14 6h-32l-378 -256l-210 171l-210 -171l-378 256h-32q-8 0 -14 -6t-6 -14v-1240q0 -8 6 -14 t14 -6h1240q8 0 14 6t6 14zM553 1130l185 150h-406zM983 1130l221 150h-406zM1536 1260v-1240q0 -62 -43 -105t-105 -43h-1240q-62 0 -105 43t-43 105v1240q0 62 43 105t105 43h1240q62 0 105 -43t43 -105z" /> +<glyph unicode="" horiz-adv-x="1792" d="M896 720q-104 196 -160 278q-139 202 -347 318q-34 19 -70 36q-89 40 -94 32t34 -38l39 -31q62 -43 112.5 -93.5t94.5 -116.5t70.5 -113t70.5 -131q9 -17 13 -25q44 -84 84 -153t98 -154t115.5 -150t131 -123.5t148.5 -90.5q153 -66 154 -60q1 3 -49 37q-53 36 -81 57 q-77 58 -179 211t-185 310zM549 177q-76 60 -132.5 125t-98 143.5t-71 154.5t-58.5 186t-52 209t-60.5 252t-76.5 289q273 0 497.5 -36t379 -92t271 -144.5t185.5 -172.5t110 -198.5t56 -199.5t12.5 -198.5t-9.5 -173t-20 -143.5t-13 -107l323 -327h-104l-281 285 q-22 -2 -91.5 -14t-121.5 -19t-138 -6t-160.5 17t-167.5 59t-179 111z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1374 879q-6 26 -28.5 39.5t-48.5 7.5q-261 -62 -401 -62t-401 62q-26 6 -48.5 -7.5t-28.5 -39.5t7.5 -48.5t39.5 -28.5q194 -46 303 -58q-2 -158 -15.5 -269t-26.5 -155.5t-41 -115.5l-9 -21q-10 -25 1 -49t36 -34q9 -4 23 -4q44 0 60 41l8 20q54 139 71 259h42 q17 -120 71 -259l8 -20q16 -41 60 -41q14 0 23 4q25 10 36 34t1 49l-9 21q-28 71 -41 115.5t-26.5 155.5t-15.5 269q109 12 303 58q26 6 39.5 28.5t7.5 48.5zM1024 1024q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5z M1600 640q0 -143 -55.5 -273.5t-150 -225t-225 -150t-273.5 -55.5t-273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5zM896 1408q-156 0 -298 -61t-245 -164t-164 -245t-61 -298t61 -298 t164 -245t245 -164t298 -61t298 61t245 164t164 245t61 298t-61 298t-164 245t-245 164t-298 61zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> +<glyph unicode="" d="M1438 723q34 -35 29 -82l-44 -551q-4 -42 -34.5 -70t-71.5 -28q-6 0 -9 1q-44 3 -72.5 36.5t-25.5 77.5l35 429l-143 -8q55 -113 55 -240q0 -216 -148 -372l-137 137q91 101 91 235q0 145 -102.5 248t-247.5 103q-134 0 -236 -92l-137 138q120 114 284 141l264 300 l-149 87l-181 -161q-33 -30 -77 -27.5t-73 35.5t-26.5 77t34.5 73l239 213q26 23 60 26.5t64 -14.5l488 -283q36 -21 48 -68q17 -67 -26 -117l-205 -232l371 20q49 3 83 -32zM1240 1180q-74 0 -126 52t-52 126t52 126t126 52t126.5 -52t52.5 -126t-52.5 -126t-126.5 -52z M613 -62q106 0 196 61l139 -139q-146 -116 -335 -116q-148 0 -273.5 73t-198.5 198t-73 273q0 188 116 336l139 -139q-60 -88 -60 -197q0 -145 102.5 -247.5t247.5 -102.5z" /> +<glyph unicode="" d="M880 336v-160q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v160q0 14 9 23t23 9h160q14 0 23 -9t9 -23zM1136 832q0 -50 -15 -90t-45.5 -69t-52 -44t-59.5 -36q-32 -18 -46.5 -28t-26 -24t-11.5 -29v-32q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v68q0 35 10.5 64.5 t24 47.5t39 35.5t41 25.5t44.5 21q53 25 75 43t22 49q0 42 -43.5 71.5t-95.5 29.5q-56 0 -95 -27q-29 -20 -80 -83q-9 -12 -25 -12q-11 0 -19 6l-108 82q-10 7 -12 20t5 23q122 192 349 192q129 0 238.5 -89.5t109.5 -214.5zM768 1280q-130 0 -248.5 -51t-204 -136.5 t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5t-51 248.5t-136.5 204t-204 136.5t-248.5 51zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5 t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M366 1225q-64 0 -110 45.5t-46 110.5q0 64 46 109.5t110 45.5t109.5 -45.5t45.5 -109.5q0 -65 -45.5 -110.5t-109.5 -45.5zM917 583q0 -50 -30 -67.5t-63.5 -6.5t-47.5 34l-367 438q-7 12 -14 15.5t-11 1.5l-3 -3q-7 -8 4 -21l122 -139l1 -354l-161 -457 q-67 -192 -92 -234q-16 -26 -28 -32q-50 -26 -103 -1q-29 13 -41.5 43t-9.5 57q2 17 197 618l5 416l-85 -164l35 -222q4 -24 -1 -42t-14 -27.5t-19 -16t-17 -7.5l-7 -2q-19 -3 -34.5 3t-24 16t-14 22t-7.5 19.5t-2 9.5l-46 299l211 381q23 34 113 34q75 0 107 -40l424 -521 q7 -5 14 -17l3 -3l-1 -1q7 -13 7 -29zM514 433q43 -113 88.5 -225t69.5 -168l24 -55q36 -93 42 -125q11 -70 -36 -97q-35 -22 -66 -16t-51 22t-29 35h-1q-6 16 -8 25l-124 351zM1338 -159q31 -49 31 -57q0 -5 -3 -7q-9 -5 -14.5 0.5t-15.5 26t-16 30.5q-114 172 -423 661 q3 -1 7 1t7 4l3 2q11 9 11 17z" /> +<glyph unicode="" horiz-adv-x="2304" d="M504 542h171l-1 265zM1530 641q0 87 -50.5 140t-146.5 53h-54v-388h52q91 0 145 57t54 138zM956 1018l1 -756q0 -14 -9.5 -24t-23.5 -10h-216q-14 0 -23.5 10t-9.5 24v62h-291l-55 -81q-10 -15 -28 -15h-267q-21 0 -30.5 18t3.5 35l556 757q9 14 27 14h332q14 0 24 -10 t10 -24zM1783 641q0 -193 -125.5 -303t-324.5 -110h-270q-14 0 -24 10t-10 24v756q0 14 10 24t24 10h268q200 0 326 -109t126 -302zM1939 640q0 -11 -0.5 -29t-8 -71.5t-21.5 -102t-44.5 -108t-73.5 -102.5h-51q38 45 66.5 104.5t41.5 112t21 98t9 72.5l1 27q0 8 -0.5 22.5 t-7.5 60t-20 91.5t-41 111.5t-66 124.5h43q41 -47 72 -107t45.5 -111.5t23 -96t10.5 -70.5zM2123 640q0 -11 -0.5 -29t-8 -71.5t-21.5 -102t-45 -108t-74 -102.5h-51q38 45 66.5 104.5t41.5 112t21 98t9 72.5l1 27q0 8 -0.5 22.5t-7.5 60t-19.5 91.5t-40.5 111.5t-66 124.5 h43q41 -47 72 -107t45.5 -111.5t23 -96t10.5 -70.5zM2304 640q0 -11 -0.5 -29t-8 -71.5t-21.5 -102t-44.5 -108t-73.5 -102.5h-51q38 45 66 104.5t41 112t21 98t9 72.5l1 27q0 8 -0.5 22.5t-7.5 60t-19.5 91.5t-40.5 111.5t-66 124.5h43q41 -47 72 -107t45.5 -111.5t23 -96 t9.5 -70.5z" /> +<glyph unicode="" horiz-adv-x="1408" d="M617 -153q0 11 -13 58t-31 107t-20 69q-1 4 -5 26.5t-8.5 36t-13.5 21.5q-15 14 -51 14q-23 0 -70 -5.5t-71 -5.5q-34 0 -47 11q-6 5 -11 15.5t-7.5 20t-6.5 24t-5 18.5q-37 128 -37 255t37 255q1 4 5 18.5t6.5 24t7.5 20t11 15.5q13 11 47 11q24 0 71 -5.5t70 -5.5 q36 0 51 14q9 8 13.5 21.5t8.5 36t5 26.5q2 9 20 69t31 107t13 58q0 22 -43.5 52.5t-75.5 42.5q-20 8 -45 8q-34 0 -98 -18q-57 -17 -96.5 -40.5t-71 -66t-46 -70t-45.5 -94.5q-6 -12 -9 -19q-49 -107 -68 -216t-19 -244t19 -244t68 -216q56 -122 83 -161q63 -91 179 -127 l6 -2q64 -18 98 -18q25 0 45 8q32 12 75.5 42.5t43.5 52.5zM776 760q-26 0 -45 19t-19 45.5t19 45.5q37 37 37 90q0 52 -37 91q-19 19 -19 45t19 45t45 19t45 -19q75 -75 75 -181t-75 -181q-21 -19 -45 -19zM957 579q-27 0 -45 19q-19 19 -19 45t19 45q112 114 112 272 t-112 272q-19 19 -19 45t19 45t45 19t45 -19q150 -150 150 -362t-150 -362q-18 -19 -45 -19zM1138 398q-27 0 -45 19q-19 19 -19 45t19 45q90 91 138.5 208t48.5 245t-48.5 245t-138.5 208q-19 19 -19 45t19 45t45 19t45 -19q109 -109 167 -249t58 -294t-58 -294t-167 -249 q-18 -19 -45 -19z" /> +<glyph unicode="" horiz-adv-x="2176" d="M192 352q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM704 352q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM704 864q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1472 352 q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1984 352q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1472 864q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1984 864 q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1984 1376q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM384 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 192q0 -80 -56 -136 t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 1216q0 -80 -56 -136t-136 -56 t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 1216q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM2176 192q0 -80 -56 -136t-136 -56t-136 56 t-56 136t56 136t136 56t136 -56t56 -136zM1664 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM2176 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 1216q0 -80 -56 -136t-136 -56t-136 56t-56 136 t56 136t136 56t136 -56t56 -136zM2176 1216q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136z" /> +<glyph unicode="" horiz-adv-x="1792" d="M128 -192q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM320 0q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM365 365l256 -256l-90 -90l-256 256zM704 384q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45z M1411 704q0 -59 -11.5 -108.5t-37.5 -93.5t-44 -67.5t-53 -64.5q-31 -35 -45.5 -54t-33.5 -50t-26.5 -64t-7.5 -74q0 -159 -112.5 -271.5t-271.5 -112.5q-26 0 -45 19t-19 45t19 45t45 19q106 0 181 75t75 181q0 57 11.5 105.5t37 91t43.5 66.5t52 63q40 46 59.5 72 t37.5 74.5t18 103.5q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5q0 -26 -19 -45t-45 -19t-45 19t-19 45q0 117 45.5 223.5t123 184t184 123t223.5 45.5t223.5 -45.5t184 -123t123 -184t45.5 -223.5zM896 576q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45 t45 19t45 -19t19 -45zM1184 704q0 -26 -19 -45t-45 -19t-45 19t-19 45q0 93 -65.5 158.5t-158.5 65.5q-92 0 -158 -65.5t-66 -158.5q0 -26 -19 -45t-45 -19t-45 19t-19 45q0 146 103 249t249 103t249 -103t103 -249zM1578 993q10 -25 -1 -49t-36 -34q-9 -4 -23 -4 q-19 0 -35.5 11t-23.5 30q-68 178 -224 295q-21 16 -25 42t12 47q17 21 43 25t47 -12q183 -137 266 -351zM1788 1074q9 -25 -1.5 -49t-35.5 -34q-11 -4 -23 -4q-44 0 -60 41q-92 238 -297 393q-22 16 -25.5 42t12.5 47q16 22 42 25.5t47 -12.5q235 -175 341 -449z" /> +<glyph unicode="" horiz-adv-x="2304" d="M1032 576q-59 2 -84 55q-17 34 -48 53.5t-68 19.5q-53 0 -90.5 -37.5t-37.5 -90.5q0 -56 36 -89l10 -8q34 -31 82 -31q37 0 68 19.5t48 53.5q25 53 84 55zM1600 704q0 56 -36 89l-10 8q-34 31 -82 31q-37 0 -68 -19.5t-48 -53.5q-25 -53 -84 -55q59 -2 84 -55 q17 -34 48 -53.5t68 -19.5q53 0 90.5 37.5t37.5 90.5zM1174 925q-17 -35 -55 -48t-73 4q-62 31 -134 31q-51 0 -99 -17q3 0 9.5 0.5t9.5 0.5q92 0 170.5 -50t118.5 -133q17 -36 3.5 -73.5t-49.5 -54.5q-18 -9 -39 -9q21 0 39 -9q36 -17 49.5 -54.5t-3.5 -73.5 q-40 -83 -118.5 -133t-170.5 -50h-6q-16 2 -44 4l-290 27l-239 -120q-14 -7 -29 -7q-40 0 -57 35l-160 320q-11 23 -4 47.5t29 37.5l209 119l148 267q17 155 91.5 291.5t195.5 236.5q31 25 70.5 21.5t64.5 -34.5t21.5 -70t-34.5 -65q-70 -59 -117 -128q123 84 267 101 q40 5 71.5 -19t35.5 -64q5 -40 -19 -71.5t-64 -35.5q-84 -10 -159 -55q46 10 99 10q115 0 218 -50q36 -18 49 -55.5t-5 -73.5zM2137 1085l160 -320q11 -23 4 -47.5t-29 -37.5l-209 -119l-148 -267q-17 -155 -91.5 -291.5t-195.5 -236.5q-26 -22 -61 -22q-45 0 -74 35 q-25 31 -21.5 70t34.5 65q70 59 117 128q-123 -84 -267 -101q-4 -1 -12 -1q-36 0 -63.5 24t-31.5 60q-5 40 19 71.5t64 35.5q84 10 159 55q-46 -10 -99 -10q-115 0 -218 50q-36 18 -49 55.5t5 73.5q17 35 55 48t73 -4q62 -31 134 -31q51 0 99 17q-3 0 -9.5 -0.5t-9.5 -0.5 q-92 0 -170.5 50t-118.5 133q-17 36 -3.5 73.5t49.5 54.5q18 9 39 9q-21 0 -39 9q-36 17 -49.5 54.5t3.5 73.5q40 83 118.5 133t170.5 50h6h1q14 -2 42 -4l291 -27l239 120q14 7 29 7q40 0 57 -35z" /> +<glyph unicode="" horiz-adv-x="1792" d="M1056 704q0 -26 19 -45t45 -19t45 19t19 45q0 146 -103 249t-249 103t-249 -103t-103 -249q0 -26 19 -45t45 -19t45 19t19 45q0 93 66 158.5t158 65.5t158 -65.5t66 -158.5zM835 1280q-117 0 -223.5 -45.5t-184 -123t-123 -184t-45.5 -223.5q0 -26 19 -45t45 -19t45 19 t19 45q0 185 131.5 316.5t316.5 131.5t316.5 -131.5t131.5 -316.5q0 -55 -18 -103.5t-37.5 -74.5t-59.5 -72q-34 -39 -52 -63t-43.5 -66.5t-37 -91t-11.5 -105.5q0 -106 -75 -181t-181 -75q-26 0 -45 -19t-19 -45t19 -45t45 -19q159 0 271.5 112.5t112.5 271.5q0 41 7.5 74 t26.5 64t33.5 50t45.5 54q35 41 53 64.5t44 67.5t37.5 93.5t11.5 108.5q0 117 -45.5 223.5t-123 184t-184 123t-223.5 45.5zM591 561l226 -226l-579 -579q-12 -12 -29 -12t-29 12l-168 168q-12 12 -12 29t12 29zM1612 1524l168 -168q12 -12 12 -29t-12 -30l-233 -233 l-26 -25l-71 -71q-66 153 -195 258l91 91l207 207q13 12 30 12t29 -12z" /> +<glyph unicode="" d="M866 1021q0 -27 -13 -94q-11 -50 -31.5 -150t-30.5 -150q-2 -11 -4.5 -12.5t-13.5 -2.5q-20 -2 -31 -2q-58 0 -84 49.5t-26 113.5q0 88 35 174t103 124q28 14 51 14q28 0 36.5 -16.5t8.5 -47.5zM1352 597q0 14 -39 75.5t-52 66.5q-21 8 -34 8q-91 0 -226 -77l-2 2 q3 22 27.5 135t24.5 178q0 233 -242 233q-24 0 -68 -6q-94 -17 -168.5 -89.5t-111.5 -166.5t-37 -189q0 -146 80.5 -225t227.5 -79q25 0 25 -3t-1 -5q-4 -34 -26 -117q-14 -52 -51.5 -101t-82.5 -49q-42 0 -42 47q0 24 10.5 47.5t25 39.5t29.5 28.5t26 20t11 8.5q0 3 -7 10 q-24 22 -58.5 36.5t-65.5 14.5q-35 0 -63.5 -34t-41 -75t-12.5 -75q0 -88 51.5 -142t138.5 -54q82 0 155 53t117.5 126t65.5 153q6 22 15.5 66.5t14.5 66.5q3 12 14 18q118 60 227 60q48 0 127 -18q1 -1 4 -1q5 0 9.5 4.5t4.5 8.5zM1536 1120v-960q0 -119 -84.5 -203.5 t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="1535" d="M744 1231q0 24 -2 38.5t-8.5 30t-21 23t-37.5 7.5q-39 0 -78 -23q-105 -58 -159 -190.5t-54 -269.5q0 -44 8.5 -85.5t26.5 -80.5t52.5 -62.5t81.5 -23.5q4 0 18 -0.5t20 0t16 3t15 8.5t7 16q16 77 48 231.5t48 231.5q19 91 19 146zM1498 575q0 -7 -7.5 -13.5t-15.5 -6.5 l-6 1q-22 3 -62 11t-72 12.5t-63 4.5q-167 0 -351 -93q-15 -8 -21 -27q-10 -36 -24.5 -105.5t-22.5 -100.5q-23 -91 -70 -179.5t-112.5 -164.5t-154.5 -123t-185 -47q-135 0 -214.5 83.5t-79.5 219.5q0 53 19.5 117t63 116.5t97.5 52.5q38 0 120 -33.5t83 -61.5 q0 -1 -16.5 -12.5t-39.5 -31t-46 -44.5t-39 -61t-16 -74q0 -33 16.5 -53t48.5 -20q45 0 85 31.5t66.5 78t48 105.5t32.5 107t16 90v9q0 2 -3.5 3.5t-8.5 1.5h-10t-10 -0.5t-6 -0.5q-227 0 -352 122.5t-125 348.5q0 108 34.5 221t96 210t156 167.5t204.5 89.5q52 9 106 9 q374 0 374 -360q0 -98 -38 -273t-43 -211l3 -3q101 57 182.5 88t167.5 31q22 0 53 -13q19 -7 80 -102.5t61 -116.5z" /> +<glyph unicode="" horiz-adv-x="1664" d="M831 863q32 0 59 -18l222 -148q61 -40 110 -97l146 -170q40 -46 29 -106l-72 -413q-6 -32 -29.5 -53.5t-55.5 -25.5l-527 -56l-352 -32h-9q-39 0 -67.5 28t-28.5 68q0 37 27 64t65 32l260 32h-448q-41 0 -69.5 30t-26.5 71q2 39 32 65t69 26l442 1l-521 64q-41 5 -66 37 t-19 73q6 35 34.5 57.5t65.5 22.5h10l481 -60l-351 94q-38 10 -62 41.5t-18 68.5q6 36 33 58.5t62 22.5q6 0 20 -2l448 -96l217 -37q1 0 3 -0.5t3 -0.5q23 0 30.5 23t-12.5 36l-186 125q-35 23 -42 63.5t18 73.5q27 38 76 38zM761 661l186 -125l-218 37l-5 2l-36 38 l-238 262q-1 1 -2.5 3.5t-2.5 3.5q-24 31 -18.5 70t37.5 64q31 23 68 17.5t64 -33.5l142 -147l-4 -4t-5 -4q-32 -45 -23 -99t55 -85zM1648 1115l15 -266q4 -73 -11 -147l-48 -219q-12 -59 -67 -87l-106 -54q2 62 -39 109l-146 170q-53 61 -117 103l-222 148q-34 23 -76 23 q-51 0 -88 -37l-235 312q-25 33 -18 73.5t41 63.5q33 22 71.5 14t62.5 -40l266 -352l-262 455q-21 35 -10.5 75t47.5 59q35 18 72.5 6t57.5 -46l241 -420l-136 337q-15 35 -4.5 74t44.5 56q37 19 76 6t56 -51l193 -415l101 -196q8 -15 23 -17.5t27 7.5t11 26l-12 224 q-2 41 26 71t69 31q39 0 67 -28.5t30 -67.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M335 180q-2 0 -6 2q-86 57 -168.5 145t-139.5 180q-21 30 -21 69q0 9 2 19t4 18t7 18t8.5 16t10.5 17t10 15t12 15.5t11 14.5q184 251 452 365q-110 198 -110 211q0 19 17 29q116 64 128 64q18 0 28 -16l124 -229q92 19 192 19q266 0 497.5 -137.5t378.5 -369.5 q20 -31 20 -69t-20 -69q-91 -142 -218.5 -253.5t-278.5 -175.5q110 -198 110 -211q0 -20 -17 -29q-116 -64 -127 -64q-19 0 -29 16l-124 229l-64 119l-444 820l7 7q-58 -24 -99 -47q3 -5 127 -234t243 -449t119 -223q0 -7 -9 -9q-13 -3 -72 -3q-57 0 -60 7l-456 841 q-39 -28 -82 -68q24 -43 214 -393.5t190 -354.5q0 -10 -11 -10q-14 0 -82.5 22t-72.5 28l-106 197l-224 413q-44 -53 -78 -106q2 -3 18 -25t23 -34l176 -327q0 -10 -10 -10zM1165 282l49 -91q273 111 450 385q-180 277 -459 389q67 -64 103 -148.5t36 -176.5 q0 -106 -47 -200.5t-132 -157.5zM848 896q0 -20 14 -34t34 -14q86 0 147 -61t61 -147q0 -20 14 -34t34 -14t34 14t14 34q0 126 -89 215t-215 89q-20 0 -34 -14t-14 -34zM1214 961l-9 4l7 -7z" /> +<glyph unicode="" horiz-adv-x="1280" d="M1050 430q0 -215 -147 -374q-148 -161 -378 -161q-232 0 -378 161q-147 159 -147 374q0 147 68 270.5t189 196.5t268 73q96 0 182 -31q-32 -62 -39 -126q-66 28 -143 28q-167 0 -280.5 -123t-113.5 -291q0 -170 112.5 -288.5t281.5 -118.5t281 118.5t112 288.5 q0 89 -32 166q66 13 123 49q41 -98 41 -212zM846 619q0 -192 -79.5 -345t-238.5 -253l-14 -1q-29 0 -62 5q83 32 146.5 102.5t99.5 154.5t58.5 189t30 192.5t7.5 178.5q0 69 -3 103q55 -160 55 -326zM791 947v-2q-73 214 -206 440q88 -59 142.5 -186.5t63.5 -251.5z M1035 744q-83 0 -160 75q218 120 290 247q19 37 21 56q-42 -94 -139.5 -166.5t-204.5 -97.5q-35 54 -35 113q0 37 17 79t43 68q46 44 157 74q59 16 106 58.5t74 100.5q74 -105 74 -253q0 -109 -24 -170q-32 -77 -88.5 -130.5t-130.5 -53.5z" /> +<glyph unicode="" d="M1050 495q0 78 -28 147q-41 -25 -85 -34q22 -50 22 -114q0 -117 -77 -198.5t-193 -81.5t-193.5 81.5t-77.5 198.5q0 115 78 199.5t193 84.5q53 0 98 -19q4 43 27 87q-60 21 -125 21q-154 0 -257.5 -108.5t-103.5 -263.5t103.5 -261t257.5 -106t257.5 106.5t103.5 260.5z M872 850q2 -24 2 -71q0 -63 -5 -123t-20.5 -132.5t-40.5 -130t-68.5 -106t-100.5 -70.5q21 -3 42 -3h10q219 139 219 411q0 116 -38 225zM872 850q-4 80 -44 171.5t-98 130.5q92 -156 142 -302zM1207 955q0 102 -51 174q-41 -86 -124 -109q-69 -19 -109 -53.5t-40 -99.5 q0 -40 24 -77q74 17 140.5 67t95.5 115q-4 -52 -74.5 -111.5t-138.5 -97.5q52 -52 110 -52q51 0 90 37t60 90q17 43 17 117zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5 t84.5 -203.5z" /> +<glyph unicode="" d="M1279 388q0 22 -22 27q-67 15 -118 59t-80 108q-7 19 -7 25q0 15 19.5 26t43 17t43 20.5t19.5 36.5q0 19 -18.5 31.5t-38.5 12.5q-12 0 -32 -8t-31 -8q-4 0 -12 2q5 95 5 114q0 79 -17 114q-36 78 -103 121.5t-152 43.5q-199 0 -275 -165q-17 -35 -17 -114q0 -19 5 -114 q-4 -2 -14 -2q-12 0 -32 7.5t-30 7.5q-21 0 -38.5 -12t-17.5 -32q0 -21 19.5 -35.5t43 -20.5t43 -17t19.5 -26q0 -6 -7 -25q-64 -138 -198 -167q-22 -5 -22 -27q0 -46 137 -68q2 -5 6 -26t11.5 -30.5t23.5 -9.5q12 0 37.5 4.5t39.5 4.5q35 0 67 -15t54 -32.5t57.5 -32.5 t76.5 -15q43 0 79 15t57.5 32.5t53.5 32.5t67 15q14 0 39.5 -4t38.5 -4q16 0 23 10t11 30t6 25q137 22 137 68zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5 t103 -385.5z" /> +<glyph unicode="" horiz-adv-x="1664" d="M848 1408q134 1 240.5 -68.5t163.5 -192.5q27 -58 27 -179q0 -47 -9 -191q14 -7 28 -7q18 0 51 13.5t51 13.5q29 0 56 -18t27 -46q0 -32 -31.5 -54t-69 -31.5t-69 -29t-31.5 -47.5q0 -15 12 -43q37 -82 102.5 -150t144.5 -101q28 -12 80 -23q28 -6 28 -35 q0 -70 -219 -103q-7 -11 -11 -39t-14 -46.5t-33 -18.5q-20 0 -62 6.5t-64 6.5q-37 0 -62 -5q-32 -5 -63 -22.5t-58 -38t-58 -40.5t-76 -33.5t-99 -13.5q-52 0 -96.5 13.5t-75 33.5t-57.5 40.5t-58 38t-62 22.5q-26 5 -63 5q-24 0 -65.5 -7.5t-58.5 -7.5q-25 0 -35 18.5 t-14 47.5t-11 40q-219 33 -219 103q0 29 28 35q52 11 80 23q78 32 144.5 101t102.5 150q12 28 12 43q0 28 -31.5 47.5t-69.5 29.5t-69.5 31.5t-31.5 52.5q0 27 26 45.5t55 18.5q15 0 48 -13t53 -13q18 0 32 7q-9 142 -9 190q0 122 27 180q64 137 172 198t264 63z" /> +<glyph unicode="" d="M1280 388q0 22 -22 27q-67 14 -118 58t-80 109q-7 14 -7 25q0 15 19.5 26t42.5 17t42.5 20.5t19.5 36.5q0 19 -18.5 31.5t-38.5 12.5q-11 0 -31 -8t-32 -8q-4 0 -12 2q5 63 5 115q0 78 -17 114q-36 78 -102.5 121.5t-152.5 43.5q-198 0 -275 -165q-18 -38 -18 -115 q0 -38 6 -114q-10 -2 -15 -2q-11 0 -31.5 8t-30.5 8q-20 0 -37.5 -12.5t-17.5 -32.5q0 -21 19.5 -35.5t42.5 -20.5t42.5 -17t19.5 -26q0 -11 -7 -25q-64 -138 -198 -167q-22 -5 -22 -27q0 -47 138 -69q2 -5 6 -26t11 -30.5t23 -9.5q13 0 38.5 5t38.5 5q35 0 67.5 -15 t54.5 -32.5t57.5 -32.5t76.5 -15q43 0 79 15t57.5 32.5t54 32.5t67.5 15q13 0 39 -4.5t39 -4.5q15 0 22.5 9.5t11.5 31t5 24.5q138 22 138 69zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960 q119 0 203.5 -84.5t84.5 -203.5z" /> +<glyph unicode="" horiz-adv-x="2304" d="M2304 1536q-69 -46 -125 -92t-89 -81t-59.5 -71.5t-37.5 -57.5t-22 -44.5t-14 -29.5q-10 -18 -35.5 -136.5t-48.5 -164.5q-15 -29 -50 -60.5t-67.5 -50.5t-72.5 -41t-48 -28q-47 -31 -151 -231q-341 14 -630 -158q-92 -53 -303 -179q47 16 86 31t55 22l15 7 q71 27 163 64.5t133.5 53.5t108 34.5t142.5 31.5q186 31 465 -7q1 0 10 -3q11 -6 14 -17t-3 -22l-194 -345q-15 -29 -47 -22q-128 24 -354 24q-146 0 -402 -44.5t-392 -46.5q-82 -1 -149 13t-107 37t-61 40t-33 34l-1 1v2q0 6 6 6q138 0 371 55q192 366 374.5 524t383.5 158 q5 0 14.5 -0.5t38 -5t55 -12t61.5 -24.5t63 -39.5t54 -59t40 -82.5l102 177q2 4 21 42.5t44.5 86.5t61 109.5t84 133.5t100.5 137q66 82 128 141.5t121.5 96.5t92.5 53.5t88 39.5z" /> +<glyph unicode="" d="M1322 640q0 -45 -5 -76l-236 14l224 -78q-19 -73 -58 -141l-214 103l177 -158q-44 -61 -107 -108l-157 178l103 -215q-61 -37 -140 -59l-79 228l14 -240q-38 -6 -76 -6t-76 6l14 238l-78 -226q-74 19 -140 59l103 215l-157 -178q-59 43 -108 108l178 158l-214 -104 q-39 69 -58 141l224 79l-237 -14q-5 42 -5 76q0 35 5 77l238 -14l-225 79q19 73 58 140l214 -104l-177 159q46 61 107 108l158 -178l-103 215q67 39 140 58l77 -224l-13 236q36 6 75 6q38 0 76 -6l-14 -237l78 225q74 -19 140 -59l-103 -214l158 178q61 -47 107 -108 l-177 -159l213 104q37 -62 58 -141l-224 -78l237 14q5 -31 5 -77zM1352 640q0 160 -78.5 295.5t-213 214t-292.5 78.5q-119 0 -227 -46.5t-186.5 -125t-124.5 -187.5t-46 -229q0 -119 46 -228t124.5 -187.5t186.5 -125t227 -46.5q158 0 292.5 78.5t213 214t78.5 294.5z M1425 1023v-766l-657 -383l-657 383v766l657 383zM768 -183l708 412v823l-708 411l-708 -411v-823zM1536 1088v-896l-768 -448l-768 448v896l768 448z" /> +<glyph unicode="" horiz-adv-x="1664" d="M339 1318h691l-26 -72h-665q-110 0 -188.5 -79t-78.5 -189v-771q0 -95 60.5 -169.5t153.5 -93.5q23 -5 98 -5v-72h-45q-140 0 -239.5 100t-99.5 240v771q0 140 99.5 240t239.5 100zM1190 1536h247l-482 -1294q-23 -61 -40.5 -103.5t-45 -98t-54 -93.5t-64.5 -78.5 t-79.5 -65t-95.5 -41t-116 -18.5v195q163 26 220 182q20 52 20 105q0 54 -20 106l-285 733h228l187 -585zM1664 978v-1111h-795q37 55 45 73h678v1038q0 85 -49.5 155t-129.5 99l25 67q101 -34 163.5 -123.5t62.5 -197.5z" /> +<glyph unicode="" horiz-adv-x="1792" d="M852 1227q0 -29 -17 -52.5t-45 -23.5t-45 23.5t-17 52.5t17 52.5t45 23.5t45 -23.5t17 -52.5zM688 -149v114q0 30 -20.5 51.5t-50.5 21.5t-50 -21.5t-20 -51.5v-114q0 -30 20.5 -52t49.5 -22q30 0 50.5 22t20.5 52zM860 -149v114q0 30 -20 51.5t-50 21.5t-50.5 -21.5 t-20.5 -51.5v-114q0 -30 20.5 -52t50.5 -22q29 0 49.5 22t20.5 52zM1034 -149v114q0 30 -20.5 51.5t-50.5 21.5t-50.5 -21.5t-20.5 -51.5v-114q0 -30 20.5 -52t50.5 -22t50.5 22t20.5 52zM1208 -149v114q0 30 -20.5 51.5t-50.5 21.5t-50.5 -21.5t-20.5 -51.5v-114 q0 -30 20.5 -52t50.5 -22t50.5 22t20.5 52zM1476 535q-84 -160 -232 -259.5t-323 -99.5q-123 0 -229.5 51.5t-178.5 137t-113 197.5t-41 232q0 88 21 174q-104 -175 -104 -390q0 -162 65 -312t185 -251q30 57 91 57q56 0 86 -50q32 50 87 50q56 0 86 -50q32 50 87 50t87 -50 q30 50 86 50q28 0 52.5 -15.5t37.5 -40.5q112 94 177 231.5t73 287.5zM1326 564q0 75 -72 75q-17 0 -47 -6q-95 -19 -149 -19q-226 0 -226 243q0 86 30 204q-83 -127 -83 -275q0 -150 89 -260.5t235 -110.5q111 0 210 70q13 48 13 79zM884 1223q0 50 -32 89.5t-81 39.5 t-81 -39.5t-32 -89.5q0 -51 31.5 -90.5t81.5 -39.5t81.5 39.5t31.5 90.5zM1513 884q0 96 -37.5 179t-113 137t-173.5 54q-77 0 -149 -35t-127 -94q-48 -159 -48 -268q0 -104 45.5 -157t147.5 -53q53 0 142 19q36 6 53 6q51 0 77.5 -28t26.5 -80q0 -26 -4 -46 q75 68 117.5 165.5t42.5 200.5zM1792 667q0 -111 -33.5 -249.5t-93.5 -204.5q-58 -64 -195 -142.5t-228 -104.5l-4 -1v-114q0 -43 -29.5 -75t-72.5 -32q-56 0 -86 50q-32 -50 -87 -50t-87 50q-30 -50 -86 -50q-55 0 -87 50q-30 -50 -86 -50q-47 0 -75 33.5t-28 81.5 q-90 -68 -198 -68q-118 0 -211 80q54 1 106 20q-113 31 -182 127q32 -7 71 -7q89 0 164 46q-192 192 -240 306q-24 56 -24 160q0 57 9 125.5t31.5 146.5t55 141t86.5 105t120 42q59 0 81 -52q19 29 42 54q2 3 12 13t13 16q10 15 23 38t25 42t28 39q87 111 211.5 177 t260.5 66q35 0 62 -4q59 64 146 64q83 0 140 -57q5 -5 5 -12q0 -5 -6 -13.5t-12.5 -16t-16 -17l-10.5 -10.5q17 -6 36 -18t19 -24q0 -6 -16 -25q157 -138 197 -378q25 30 60 30q45 0 100 -49q90 -80 90 -279z" /> +<glyph unicode="" d="M917 631q0 33 -6 64h-362v-132h217q-12 -76 -74.5 -120.5t-142.5 -44.5q-99 0 -169 71.5t-70 170.5t70 170.5t169 71.5q93 0 153 -59l104 101q-108 100 -257 100q-160 0 -272 -112.5t-112 -271.5t112 -271.5t272 -112.5q165 0 266.5 105t101.5 270zM1262 585h109v110 h-109v110h-110v-110h-110v-110h110v-110h110v110zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> +<glyph unicode="" d="M1536 1024v-839q0 -48 -49 -62q-174 -52 -338 -52q-73 0 -215.5 29.5t-227.5 29.5q-164 0 -370 -48v-338h-160v1368q-63 25 -101 81t-38 124q0 91 64 155t155 64t155 -64t64 -155q0 -68 -38 -124t-101 -81v-68q190 44 343 44q99 0 198 -15q14 -2 111.5 -22.5t149.5 -20.5 q77 0 165 18q11 2 80 21t89 19q26 0 45 -19t19 -45z" /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" horiz-adv-x="1792" /> +<glyph unicode="" horiz-adv-x="1792" /> +</font> +</defs></svg>
\ No newline at end of file diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.svg.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.svg.meta new file mode 100644 index 00000000..c62809fc --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.svg.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 7b0e2552919dc70488a6d4a342b928a5 +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.ttf b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.ttf Binary files differnew file mode 100644 index 00000000..f221e50a --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.ttf diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.ttf.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.ttf.meta new file mode 100644 index 00000000..6e06f8eb --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.ttf.meta @@ -0,0 +1,22 @@ +fileFormatVersion: 2 +guid: 6cb934e9a1d9ea6448040aad7dbeac81 +TrueTypeFontImporter: + externalObjects: {} + serializedVersion: 4 + fontSize: 16 + forceTextureCase: -2 + characterSpacing: 0 + characterPadding: 1 + includeFontData: 1 + fontName: FontAwesome + fontNames: + - FontAwesome + fallbackFontReferences: [] + customCharacters: + fontRenderingMode: 0 + ascentCalculationMode: 1 + useLegacyBoundsCalculation: 0 + shouldRoundAdvanceValue: 1 + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.woff b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.woff Binary files differnew file mode 100644 index 00000000..6e7483cf --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.woff diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.woff.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.woff.meta new file mode 100644 index 00000000..12929d94 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.woff.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 157434a595e08d248a65d0700ba86a66 +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.woff2 b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.woff2 Binary files differnew file mode 100644 index 00000000..7eb74fd1 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.woff2 diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.woff2.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.woff2.meta new file mode 100644 index 00000000..202e0484 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/fonts/fontawesome-webfont.woff2.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 7facddc01811f7b4aae49393880e1384 +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/glpi.css b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/glpi.css new file mode 100644 index 00000000..83ff80ee --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/glpi.css @@ -0,0 +1,13 @@ +.wy-side-nav-search > a, .wy-side-nav-search .wy-dropdown > a { + padding: 0; + margin: 0; +} + +.wy-side-nav-search > div.version { + color: inherit; +} + +.wy-side-nav-search > div.version > span.rtdversion { + color:rgba(255,255,255,0.3); + margin-left: .3em; +} diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/glpi.css.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/glpi.css.meta new file mode 100644 index 00000000..7aa90c55 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/glpi.css.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 9f9fca788822d57458584aac0824c6f1 +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/images.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/images.meta new file mode 100644 index 00000000..30163959 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/images.meta @@ -0,0 +1,8 @@ +fileFormatVersion: 2 +guid: d28d57071f817b74099394e4658a96fe +folderAsset: yes +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/images/glpi.png b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/images/glpi.png Binary files differnew file mode 100644 index 00000000..6d79bcb0 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/images/glpi.png diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/images/glpi.png.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/images/glpi.png.meta new file mode 100644 index 00000000..05d2b73e --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/images/glpi.png.meta @@ -0,0 +1,88 @@ +fileFormatVersion: 2 +guid: 3aaee8d59be89024aaf6ddeb191374ff +TextureImporter: + fileIDToRecycleName: {} + externalObjects: {} + serializedVersion: 9 + mipmaps: + mipMapMode: 0 + enableMipMap: 1 + sRGBTexture: 1 + linearTexture: 0 + fadeOut: 0 + borderMipMap: 0 + mipMapsPreserveCoverage: 0 + alphaTestReferenceValue: 0.5 + mipMapFadeDistanceStart: 1 + mipMapFadeDistanceEnd: 3 + bumpmap: + convertToNormalMap: 0 + externalNormalMap: 0 + heightScale: 0.25 + normalMapFilter: 0 + isReadable: 0 + streamingMipmaps: 0 + streamingMipmapsPriority: 0 + grayScaleToAlpha: 0 + generateCubemap: 6 + cubemapConvolution: 0 + seamlessCubemap: 0 + textureFormat: 1 + maxTextureSize: 2048 + textureSettings: + serializedVersion: 2 + filterMode: -1 + aniso: -1 + mipBias: -100 + wrapU: -1 + wrapV: -1 + wrapW: -1 + nPOTScale: 1 + lightmap: 0 + compressionQuality: 50 + spriteMode: 0 + spriteExtrude: 1 + spriteMeshType: 1 + alignment: 0 + spritePivot: {x: 0.5, y: 0.5} + spritePixelsToUnits: 100 + spriteBorder: {x: 0, y: 0, z: 0, w: 0} + spriteGenerateFallbackPhysicsShape: 1 + alphaUsage: 1 + alphaIsTransparency: 0 + spriteTessellationDetail: -1 + textureType: 0 + textureShape: 1 + singleChannelComponent: 0 + maxTextureSizeSet: 0 + compressionQualitySet: 0 + textureFormatSet: 0 + platformSettings: + - serializedVersion: 2 + buildTarget: DefaultTexturePlatform + maxTextureSize: 2048 + resizeAlgorithm: 0 + textureFormat: -1 + textureCompression: 1 + compressionQuality: 50 + crunchedCompression: 0 + allowsAlphaSplitting: 0 + overridden: 0 + androidETC2FallbackOverride: 0 + spriteSheet: + serializedVersion: 2 + sprites: [] + outline: [] + physicsShape: [] + bones: [] + spriteID: + vertices: [] + indices: + edges: [] + weights: [] + spritePackingTag: + pSDRemoveMatte: 0 + pSDShowRemoveMatteOption: 0 + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery-3.4.1.js b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery-3.4.1.js new file mode 100644 index 00000000..773ad95c --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery-3.4.1.js @@ -0,0 +1,10598 @@ +/*! + * jQuery JavaScript Library v3.4.1 + * https://jquery.com/ + * + * Includes Sizzle.js + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://jquery.org/license + * + * Date: 2019-05-01T21:04Z + */ +( function( global, factory ) { + + "use strict"; + + if ( typeof module === "object" && typeof module.exports === "object" ) { + + // For CommonJS and CommonJS-like environments where a proper `window` + // is present, execute the factory and get jQuery. + // For environments that do not have a `window` with a `document` + // (such as Node.js), expose a factory as module.exports. + // This accentuates the need for the creation of a real `window`. + // e.g. var jQuery = require("jquery")(window); + // See ticket #14549 for more info. + module.exports = global.document ? + factory( global, true ) : + function( w ) { + if ( !w.document ) { + throw new Error( "jQuery requires a window with a document" ); + } + return factory( w ); + }; + } else { + factory( global ); + } + +// Pass this if window is not defined yet +} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) { + +// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 +// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode +// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common +// enough that all such attempts are guarded in a try block. +"use strict"; + +var arr = []; + +var document = window.document; + +var getProto = Object.getPrototypeOf; + +var slice = arr.slice; + +var concat = arr.concat; + +var push = arr.push; + +var indexOf = arr.indexOf; + +var class2type = {}; + +var toString = class2type.toString; + +var hasOwn = class2type.hasOwnProperty; + +var fnToString = hasOwn.toString; + +var ObjectFunctionString = fnToString.call( Object ); + +var support = {}; + +var isFunction = function isFunction( obj ) { + + // Support: Chrome <=57, Firefox <=52 + // In some browsers, typeof returns "function" for HTML <object> elements + // (i.e., `typeof document.createElement( "object" ) === "function"`). + // We don't want to classify *any* DOM node as a function. + return typeof obj === "function" && typeof obj.nodeType !== "number"; + }; + + +var isWindow = function isWindow( obj ) { + return obj != null && obj === obj.window; + }; + + + + + var preservedScriptAttributes = { + type: true, + src: true, + nonce: true, + noModule: true + }; + + function DOMEval( code, node, doc ) { + doc = doc || document; + + var i, val, + script = doc.createElement( "script" ); + + script.text = code; + if ( node ) { + for ( i in preservedScriptAttributes ) { + + // Support: Firefox 64+, Edge 18+ + // Some browsers don't support the "nonce" property on scripts. + // On the other hand, just using `getAttribute` is not enough as + // the `nonce` attribute is reset to an empty string whenever it + // becomes browsing-context connected. + // See https://github.com/whatwg/html/issues/2369 + // See https://html.spec.whatwg.org/#nonce-attributes + // The `node.getAttribute` check was added for the sake of + // `jQuery.globalEval` so that it can fake a nonce-containing node + // via an object. + val = node[ i ] || node.getAttribute && node.getAttribute( i ); + if ( val ) { + script.setAttribute( i, val ); + } + } + } + doc.head.appendChild( script ).parentNode.removeChild( script ); + } + + +function toType( obj ) { + if ( obj == null ) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[ toString.call( obj ) ] || "object" : + typeof obj; +} +/* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + + + +var + version = "3.4.1", + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }, + + // Support: Android <=4.0 only + // Make sure we trim BOM and NBSP + rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g; + +jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function() { + return slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + + // Return all the elements in a clean array + if ( num == null ) { + return slice.call( this ); + } + + // Return just the one element from the set + return num < 0 ? this[ num + this.length ] : this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function( callback ) { + return jQuery.each( this, callback ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); + }, + + end: function() { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice +}; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[ 0 ] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + + // Skip the boolean and the target + target = arguments[ i ] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !isFunction( target ) ) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if ( i === length ) { + target = this; + i--; + } + + for ( ; i < length; i++ ) { + + // Only deal with non-null/undefined values + if ( ( options = arguments[ i ] ) != null ) { + + // Extend the base object + for ( name in options ) { + copy = options[ name ]; + + // Prevent Object.prototype pollution + // Prevent never-ending loop + if ( name === "__proto__" || target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = Array.isArray( copy ) ) ) ) { + src = target[ name ]; + + // Ensure proper type for the source value + if ( copyIsArray && !Array.isArray( src ) ) { + clone = []; + } else if ( !copyIsArray && !jQuery.isPlainObject( src ) ) { + clone = {}; + } else { + clone = src; + } + copyIsArray = false; + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend( { + + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function( msg ) { + throw new Error( msg ); + }, + + noop: function() {}, + + isPlainObject: function( obj ) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if ( !obj || toString.call( obj ) !== "[object Object]" ) { + return false; + } + + proto = getProto( obj ); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if ( !proto ) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor; + return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString; + }, + + isEmptyObject: function( obj ) { + var name; + + for ( name in obj ) { + return false; + } + return true; + }, + + // Evaluates a script in a global context + globalEval: function( code, options ) { + DOMEval( code, { nonce: options && options.nonce } ); + }, + + each: function( obj, callback ) { + var length, i = 0; + + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } else { + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } + + return obj; + }, + + // Support: Android <=4.0 only + trim: function( text ) { + return text == null ? + "" : + ( text + "" ).replace( rtrim, "" ); + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : indexOf.call( arr, elem, i ); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function( first, second ) { + var len = +second.length, + j = 0, + i = first.length; + + for ( ; j < len; j++ ) { + first[ i++ ] = second[ j ]; + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + } + + // Flatten any nested arrays + return concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); + +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ]; +} + +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), +function( i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +} ); + +function isArrayLike( obj ) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = toType( obj ); + + if ( isFunction( obj ) || isWindow( obj ) ) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} +var Sizzle = +/*! + * Sizzle CSS Selector Engine v2.3.4 + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://js.foundation/ + * + * Date: 2019-04-08 + */ +(function( window ) { + +var i, + support, + Expr, + getText, + isXML, + tokenize, + compile, + select, + outermostContext, + sortInput, + hasDuplicate, + + // Local document vars + setDocument, + document, + docElem, + documentIsHTML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + + // Instance-specific data + expando = "sizzle" + 1 * new Date(), + preferredDoc = window.document, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + nonnativeSelectorCache = createCache(), + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + } + return 0; + }, + + // Instance methods + hasOwn = ({}).hasOwnProperty, + arr = [], + pop = arr.pop, + push_native = arr.push, + push = arr.push, + slice = arr.slice, + // Use a stripped-down indexOf as it's faster than native + // https://jsperf.com/thor-indexof-vs-for/5 + indexOf = function( list, elem ) { + var i = 0, + len = list.length; + for ( ; i < len; i++ ) { + if ( list[i] === elem ) { + return i; + } + } + return -1; + }, + + booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped", + + // Regular expressions + + // http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + + // http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier + identifier = "(?:\\\\.|[\\w-]|[^\0-\\xa0])+", + + // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors + attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + + // Operator (capture 2) + "*([*^$|!~]?=)" + whitespace + + // "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]" + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + whitespace + + "*\\]", + + pseudos = ":(" + identifier + ")(?:\\((" + + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: + // 1. quoted (capture 3; capture 4 or capture 5) + "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + + // 2. simple (capture 6) + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + + // 3. anything else (capture 2) + ".*" + + ")\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rwhitespace = new RegExp( whitespace + "+", "g" ), + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*" ), + rdescend = new RegExp( whitespace + "|>" ), + + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + "ID": new RegExp( "^#(" + identifier + ")" ), + "CLASS": new RegExp( "^\\.(" + identifier + ")" ), + "TAG": new RegExp( "^(" + identifier + "|[*])" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace + + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + "bool": new RegExp( "^(?:" + booleans + ")$", "i" ), + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + + whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rhtml = /HTML$/i, + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rnative = /^[^{]+\{\s*\[native \w/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rsibling = /[+~]/, + + // CSS escapes + // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = new RegExp( "\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig" ), + funescape = function( _, escaped, escapedWhitespace ) { + var high = "0x" + escaped - 0x10000; + // NaN means non-codepoint + // Support: Firefox<24 + // Workaround erroneous numeric interpretation of +"0x" + return high !== high || escapedWhitespace ? + escaped : + high < 0 ? + // BMP codepoint + String.fromCharCode( high + 0x10000 ) : + // Supplemental Plane codepoint (surrogate pair) + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }, + + // CSS string/identifier serialization + // https://drafts.csswg.org/cssom/#common-serializing-idioms + rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g, + fcssescape = function( ch, asCodePoint ) { + if ( asCodePoint ) { + + // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER + if ( ch === "\0" ) { + return "\uFFFD"; + } + + // Control characters and (dependent upon position) numbers get escaped as code points + return ch.slice( 0, -1 ) + "\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " "; + } + + // Other potentially-special ASCII characters get backslash-escaped + return "\\" + ch; + }, + + // Used for iframes + // See setDocument() + // Removing the function wrapper causes a "Permission Denied" + // error in IE + unloadHandler = function() { + setDocument(); + }, + + inDisabledFieldset = addCombinator( + function( elem ) { + return elem.disabled === true && elem.nodeName.toLowerCase() === "fieldset"; + }, + { dir: "parentNode", next: "legend" } + ); + +// Optimize for push.apply( _, NodeList ) +try { + push.apply( + (arr = slice.call( preferredDoc.childNodes )), + preferredDoc.childNodes + ); + // Support: Android<4.0 + // Detect silently failing push.apply + arr[ preferredDoc.childNodes.length ].nodeType; +} catch ( e ) { + push = { apply: arr.length ? + + // Leverage slice if possible + function( target, els ) { + push_native.apply( target, slice.call(els) ); + } : + + // Support: IE<9 + // Otherwise append directly + function( target, els ) { + var j = target.length, + i = 0; + // Can't trust NodeList.length + while ( (target[j++] = els[i++]) ) {} + target.length = j - 1; + } + }; +} + +function Sizzle( selector, context, results, seed ) { + var m, i, elem, nid, match, groups, newSelector, + newContext = context && context.ownerDocument, + + // nodeType defaults to 9, since context defaults to document + nodeType = context ? context.nodeType : 9; + + results = results || []; + + // Return early from calls with invalid selector or context + if ( typeof selector !== "string" || !selector || + nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) { + + return results; + } + + // Try to shortcut find operations (as opposed to filters) in HTML documents + if ( !seed ) { + + if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) { + setDocument( context ); + } + context = context || document; + + if ( documentIsHTML ) { + + // If the selector is sufficiently simple, try using a "get*By*" DOM method + // (excepting DocumentFragment context, where the methods don't exist) + if ( nodeType !== 11 && (match = rquickExpr.exec( selector )) ) { + + // ID selector + if ( (m = match[1]) ) { + + // Document context + if ( nodeType === 9 ) { + if ( (elem = context.getElementById( m )) ) { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + + // Element context + } else { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( newContext && (elem = newContext.getElementById( m )) && + contains( context, elem ) && + elem.id === m ) { + + results.push( elem ); + return results; + } + } + + // Type selector + } else if ( match[2] ) { + push.apply( results, context.getElementsByTagName( selector ) ); + return results; + + // Class selector + } else if ( (m = match[3]) && support.getElementsByClassName && + context.getElementsByClassName ) { + + push.apply( results, context.getElementsByClassName( m ) ); + return results; + } + } + + // Take advantage of querySelectorAll + if ( support.qsa && + !nonnativeSelectorCache[ selector + " " ] && + (!rbuggyQSA || !rbuggyQSA.test( selector )) && + + // Support: IE 8 only + // Exclude object elements + (nodeType !== 1 || context.nodeName.toLowerCase() !== "object") ) { + + newSelector = selector; + newContext = context; + + // qSA considers elements outside a scoping root when evaluating child or + // descendant combinators, which is not what we want. + // In such cases, we work around the behavior by prefixing every selector in the + // list with an ID selector referencing the scope context. + // Thanks to Andrew Dupont for this technique. + if ( nodeType === 1 && rdescend.test( selector ) ) { + + // Capture the context ID, setting it first if necessary + if ( (nid = context.getAttribute( "id" )) ) { + nid = nid.replace( rcssescape, fcssescape ); + } else { + context.setAttribute( "id", (nid = expando) ); + } + + // Prefix every selector in the list + groups = tokenize( selector ); + i = groups.length; + while ( i-- ) { + groups[i] = "#" + nid + " " + toSelector( groups[i] ); + } + newSelector = groups.join( "," ); + + // Expand context for sibling selectors + newContext = rsibling.test( selector ) && testContext( context.parentNode ) || + context; + } + + try { + push.apply( results, + newContext.querySelectorAll( newSelector ) + ); + return results; + } catch ( qsaError ) { + nonnativeSelectorCache( selector, true ); + } finally { + if ( nid === expando ) { + context.removeAttribute( "id" ); + } + } + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed ); +} + +/** + * Create key-value caches of limited size + * @returns {function(string, object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var keys = []; + + function cache( key, value ) { + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if ( keys.push( key + " " ) > Expr.cacheLength ) { + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return (cache[ key + " " ] = value); + } + return cache; +} + +/** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created element and returns a boolean result + */ +function assert( fn ) { + var el = document.createElement("fieldset"); + + try { + return !!fn( el ); + } catch (e) { + return false; + } finally { + // Remove from its parent by default + if ( el.parentNode ) { + el.parentNode.removeChild( el ); + } + // release memory in IE + el = null; + } +} + +/** + * Adds the same handler for all of the specified attrs + * @param {String} attrs Pipe-separated list of attributes + * @param {Function} handler The method that will be applied + */ +function addHandle( attrs, handler ) { + var arr = attrs.split("|"), + i = arr.length; + + while ( i-- ) { + Expr.attrHandle[ arr[i] ] = handler; + } +} + +/** + * Checks document order of two siblings + * @param {Element} a + * @param {Element} b + * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b + */ +function siblingCheck( a, b ) { + var cur = b && a, + diff = cur && a.nodeType === 1 && b.nodeType === 1 && + a.sourceIndex - b.sourceIndex; + + // Use IE sourceIndex if available on both nodes + if ( diff ) { + return diff; + } + + // Check if b follows a + if ( cur ) { + while ( (cur = cur.nextSibling) ) { + if ( cur === b ) { + return -1; + } + } + } + + return a ? 1 : -1; +} + +/** + * Returns a function to use in pseudos for input types + * @param {String} type + */ +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for buttons + * @param {String} type + */ +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for :enabled/:disabled + * @param {Boolean} disabled true for :disabled; false for :enabled + */ +function createDisabledPseudo( disabled ) { + + // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable + return function( elem ) { + + // Only certain elements can match :enabled or :disabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled + if ( "form" in elem ) { + + // Check for inherited disabledness on relevant non-disabled elements: + // * listed form-associated elements in a disabled fieldset + // https://html.spec.whatwg.org/multipage/forms.html#category-listed + // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled + // * option elements in a disabled optgroup + // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled + // All such elements have a "form" property. + if ( elem.parentNode && elem.disabled === false ) { + + // Option elements defer to a parent optgroup if present + if ( "label" in elem ) { + if ( "label" in elem.parentNode ) { + return elem.parentNode.disabled === disabled; + } else { + return elem.disabled === disabled; + } + } + + // Support: IE 6 - 11 + // Use the isDisabled shortcut property to check for disabled fieldset ancestors + return elem.isDisabled === disabled || + + // Where there is no isDisabled, check manually + /* jshint -W018 */ + elem.isDisabled !== !disabled && + inDisabledFieldset( elem ) === disabled; + } + + return elem.disabled === disabled; + + // Try to winnow out elements that can't be disabled before trusting the disabled property. + // Some victims get caught in our net (label, legend, menu, track), but it shouldn't + // even exist on them, let alone have a boolean value. + } else if ( "label" in elem ) { + return elem.disabled === disabled; + } + + // Remaining elements are neither :enabled nor :disabled + return false; + }; +} + +/** + * Returns a function to use in pseudos for positionals + * @param {Function} fn + */ +function createPositionalPseudo( fn ) { + return markFunction(function( argument ) { + argument = +argument; + return markFunction(function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ (j = matchIndexes[i]) ] ) { + seed[j] = !(matches[j] = seed[j]); + } + } + }); + }); +} + +/** + * Checks a node for validity as a Sizzle context + * @param {Element|Object=} context + * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value + */ +function testContext( context ) { + return context && typeof context.getElementsByTagName !== "undefined" && context; +} + +// Expose support vars for convenience +support = Sizzle.support = {}; + +/** + * Detects XML nodes + * @param {Element|Object} elem An element or a document + * @returns {Boolean} True iff elem is a non-HTML XML node + */ +isXML = Sizzle.isXML = function( elem ) { + var namespace = elem.namespaceURI, + docElem = (elem.ownerDocument || elem).documentElement; + + // Support: IE <=8 + // Assume HTML when documentElement doesn't yet exist, such as inside loading iframes + // https://bugs.jquery.com/ticket/4833 + return !rhtml.test( namespace || docElem && docElem.nodeName || "HTML" ); +}; + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +setDocument = Sizzle.setDocument = function( node ) { + var hasCompare, subWindow, + doc = node ? node.ownerDocument || node : preferredDoc; + + // Return early if doc is invalid or already selected + if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Update global variables + document = doc; + docElem = document.documentElement; + documentIsHTML = !isXML( document ); + + // Support: IE 9-11, Edge + // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936) + if ( preferredDoc !== document && + (subWindow = document.defaultView) && subWindow.top !== subWindow ) { + + // Support: IE 11, Edge + if ( subWindow.addEventListener ) { + subWindow.addEventListener( "unload", unloadHandler, false ); + + // Support: IE 9 - 10 only + } else if ( subWindow.attachEvent ) { + subWindow.attachEvent( "onunload", unloadHandler ); + } + } + + /* Attributes + ---------------------------------------------------------------------- */ + + // Support: IE<8 + // Verify that getAttribute really returns attributes and not properties + // (excepting IE8 booleans) + support.attributes = assert(function( el ) { + el.className = "i"; + return !el.getAttribute("className"); + }); + + /* getElement(s)By* + ---------------------------------------------------------------------- */ + + // Check if getElementsByTagName("*") returns only elements + support.getElementsByTagName = assert(function( el ) { + el.appendChild( document.createComment("") ); + return !el.getElementsByTagName("*").length; + }); + + // Support: IE<9 + support.getElementsByClassName = rnative.test( document.getElementsByClassName ); + + // Support: IE<10 + // Check if getElementById returns elements by name + // The broken getElementById methods don't pick up programmatically-set names, + // so use a roundabout getElementsByName test + support.getById = assert(function( el ) { + docElem.appendChild( el ).id = expando; + return !document.getElementsByName || !document.getElementsByName( expando ).length; + }); + + // ID filter and find + if ( support.getById ) { + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute("id") === attrId; + }; + }; + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var elem = context.getElementById( id ); + return elem ? [ elem ] : []; + } + }; + } else { + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== "undefined" && + elem.getAttributeNode("id"); + return node && node.value === attrId; + }; + }; + + // Support: IE 6 - 7 only + // getElementById is not reliable as a find shortcut + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var node, i, elems, + elem = context.getElementById( id ); + + if ( elem ) { + + // Verify the id attribute + node = elem.getAttributeNode("id"); + if ( node && node.value === id ) { + return [ elem ]; + } + + // Fall back on getElementsByName + elems = context.getElementsByName( id ); + i = 0; + while ( (elem = elems[i++]) ) { + node = elem.getAttributeNode("id"); + if ( node && node.value === id ) { + return [ elem ]; + } + } + } + + return []; + } + }; + } + + // Tag + Expr.find["TAG"] = support.getElementsByTagName ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( tag ); + + // DocumentFragment nodes don't have gEBTN + } else if ( support.qsa ) { + return context.querySelectorAll( tag ); + } + } : + + function( tag, context ) { + var elem, + tmp = [], + i = 0, + // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too + results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + while ( (elem = results[i++]) ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }; + + // Class + Expr.find["CLASS"] = support.getElementsByClassName && function( className, context ) { + if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) { + return context.getElementsByClassName( className ); + } + }; + + /* QSA/matchesSelector + ---------------------------------------------------------------------- */ + + // QSA and matchesSelector support + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + + // qSa(:focus) reports false when true (Chrome 21) + // We allow this because of a bug in IE8/9 that throws an error + // whenever `document.activeElement` is accessed on an iframe + // So, we allow :focus to pass through QSA all the time to avoid the IE error + // See https://bugs.jquery.com/ticket/13378 + rbuggyQSA = []; + + if ( (support.qsa = rnative.test( document.querySelectorAll )) ) { + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function( el ) { + // Select is set to empty string on purpose + // This is to test IE's treatment of not explicitly + // setting a boolean content attribute, + // since its presence should be enough + // https://bugs.jquery.com/ticket/12359 + docElem.appendChild( el ).innerHTML = "<a id='" + expando + "'></a>" + + "<select id='" + expando + "-\r\\' msallowcapture=''>" + + "<option selected=''></option></select>"; + + // Support: IE8, Opera 11-12.16 + // Nothing should be selected when empty strings follow ^= or $= or *= + // The test attribute must be unknown in Opera but "safe" for WinRT + // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section + if ( el.querySelectorAll("[msallowcapture^='']").length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" ); + } + + // Support: IE8 + // Boolean attributes and "value" are not treated correctly + if ( !el.querySelectorAll("[selected]").length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" ); + } + + // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+ + if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) { + rbuggyQSA.push("~="); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if ( !el.querySelectorAll(":checked").length ) { + rbuggyQSA.push(":checked"); + } + + // Support: Safari 8+, iOS 8+ + // https://bugs.webkit.org/show_bug.cgi?id=136851 + // In-page `selector#id sibling-combinator selector` fails + if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) { + rbuggyQSA.push(".#.+[+~]"); + } + }); + + assert(function( el ) { + el.innerHTML = "<a href='' disabled='disabled'></a>" + + "<select disabled='disabled'><option/></select>"; + + // Support: Windows 8 Native Apps + // The type and name attributes are restricted during .innerHTML assignment + var input = document.createElement("input"); + input.setAttribute( "type", "hidden" ); + el.appendChild( input ).setAttribute( "name", "D" ); + + // Support: IE8 + // Enforce case-sensitivity of name attribute + if ( el.querySelectorAll("[name=d]").length ) { + rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if ( el.querySelectorAll(":enabled").length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: IE9-11+ + // IE's :disabled selector does not pick up the children of disabled fieldsets + docElem.appendChild( el ).disabled = true; + if ( el.querySelectorAll(":disabled").length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Opera 10-11 does not throw on post-comma invalid pseudos + el.querySelectorAll("*,:x"); + rbuggyQSA.push(",.*:"); + }); + } + + if ( (support.matchesSelector = rnative.test( (matches = docElem.matches || + docElem.webkitMatchesSelector || + docElem.mozMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector) )) ) { + + assert(function( el ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call( el, "*" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( el, "[s!='']:x" ); + rbuggyMatches.push( "!=", pseudos ); + }); + } + + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") ); + rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join("|") ); + + /* Contains + ---------------------------------------------------------------------- */ + hasCompare = rnative.test( docElem.compareDocumentPosition ); + + // Element contains another + // Purposefully self-exclusive + // As in, an element does not contain itself + contains = hasCompare || rnative.test( docElem.contains ) ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + )); + } : + function( a, b ) { + if ( b ) { + while ( (b = b.parentNode) ) { + if ( b === a ) { + return true; + } + } + } + return false; + }; + + /* Sorting + ---------------------------------------------------------------------- */ + + // Document order sorting + sortOrder = hasCompare ? + function( a, b ) { + + // Flag for duplicate removal + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + // Sort on method existence if only one input has compareDocumentPosition + var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; + if ( compare ) { + return compare; + } + + // Calculate position if both inputs belong to the same document + compare = ( a.ownerDocument || a ) === ( b.ownerDocument || b ) ? + a.compareDocumentPosition( b ) : + + // Otherwise we know they are disconnected + 1; + + // Disconnected nodes + if ( compare & 1 || + (!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) { + + // Choose the first element that is related to our preferred document + if ( a === document || a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) { + return -1; + } + if ( b === document || b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) { + return 1; + } + + // Maintain original order + return sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + } + + return compare & 4 ? -1 : 1; + } : + function( a, b ) { + // Exit early if the nodes are identical + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [ a ], + bp = [ b ]; + + // Parentless nodes are either documents or disconnected + if ( !aup || !bup ) { + return a === document ? -1 : + b === document ? 1 : + aup ? -1 : + bup ? 1 : + sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + + // If the nodes are siblings, we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + } + + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ( (cur = cur.parentNode) ) { + ap.unshift( cur ); + } + cur = b; + while ( (cur = cur.parentNode) ) { + bp.unshift( cur ); + } + + // Walk down the tree looking for a discrepancy + while ( ap[i] === bp[i] ) { + i++; + } + + return i ? + // Do a sibling check if the nodes have a common ancestor + siblingCheck( ap[i], bp[i] ) : + + // Otherwise nodes in our document sort first + ap[i] === preferredDoc ? -1 : + bp[i] === preferredDoc ? 1 : + 0; + }; + + return document; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + if ( support.matchesSelector && documentIsHTML && + !nonnativeSelectorCache[ expr + " " ] && + ( !rbuggyMatches || !rbuggyMatches.test( expr ) ) && + ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) { + + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch (e) { + nonnativeSelectorCache( expr, true ); + } + } + + return Sizzle( expr, document, null, [ elem ] ).length > 0; +}; + +Sizzle.contains = function( context, elem ) { + // Set document vars if needed + if ( ( context.ownerDocument || context ) !== document ) { + setDocument( context ); + } + return contains( context, elem ); +}; + +Sizzle.attr = function( elem, name ) { + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + var fn = Expr.attrHandle[ name.toLowerCase() ], + // Don't get fooled by Object.prototype properties (jQuery #13807) + val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ? + fn( elem, name, !documentIsHTML ) : + undefined; + + return val !== undefined ? + val : + support.attributes || !documentIsHTML ? + elem.getAttribute( name ) : + (val = elem.getAttributeNode(name)) && val.specified ? + val.value : + null; +}; + +Sizzle.escape = function( sel ) { + return (sel + "").replace( rcssescape, fcssescape ); +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Document sorting and removing duplicates + * @param {ArrayLike} results + */ +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + j = 0, + i = 0; + + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + sortInput = !support.sortStable && results.slice( 0 ); + results.sort( sortOrder ); + + if ( hasDuplicate ) { + while ( (elem = results[i++]) ) { + if ( elem === results[ i ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + // Clear input after sorting to release objects + // See https://github.com/jquery/sizzle/pull/225 + sortInput = null; + + return results; +}; + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + // If no nodeType, this is expected to be an array + while ( (node = elem[i++]) ) { + // Do not traverse comment nodes + ret += getText( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + // Use textContent for elements + // innerText usage removed for consistency of new lines (jQuery #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + // Do not include comment or processing instruction nodes + + return ret; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + attrHandle: {}, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[1] = match[1].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[3] = ( match[3] || match[4] || match[5] || "" ).replace( runescape, funescape ); + + if ( match[2] === "~=" ) { + match[3] = " " + match[3] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if ( match[1].slice( 0, 3 ) === "nth" ) { + // nth-* requires argument + if ( !match[3] ) { + Sizzle.error( match[0] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) ); + match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" ); + + // other types prohibit arguments + } else if ( match[3] ) { + Sizzle.error( match[0] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var excess, + unquoted = !match[6] && match[2]; + + if ( matchExpr["CHILD"].test( match[0] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[3] ) { + match[2] = match[4] || match[5] || ""; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + // Get excess from tokenize (recursively) + (excess = tokenize( unquoted, true )) && + // advance to the next closing parenthesis + (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) { + + // excess is a negative index + match[0] = match[0].slice( 0, excess ); + match[2] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + "TAG": function( nodeNameSelector ) { + var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase(); + return nodeNameSelector === "*" ? + function() { return true; } : + function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) && + classCache( className, function( elem ) { + return pattern.test( typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") || "" ); + }); + }, + + "ATTR": function( name, operator, check ) { + return function( elem ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.slice( -check.length ) === check : + operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" : + false; + }; + }, + + "CHILD": function( type, what, argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, context, xml ) { + var cache, uniqueCache, outerCache, node, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType, + diff = false; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( (node = node[ dir ]) ) { + if ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) { + + return false; + } + } + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + + // Seek `elem` from a previously-cached index + + // ...in a gzip-friendly way + node = parent; + outerCache = node[ expando ] || (node[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex && cache[ 2 ]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( (node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + (diff = nodeIndex = 0) || start.pop()) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + uniqueCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + } else { + // Use previously-cached element index if available + if ( useCache ) { + // ...in a gzip-friendly way + node = elem; + outerCache = node[ expando ] || (node[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex; + } + + // xml :nth-child(...) + // or :nth-last-child(...) or :nth(-last)?-of-type(...) + if ( diff === false ) { + // Use the same loop as above to seek `elem` from the start + while ( (node = ++nodeIndex && node && node[ dir ] || + (diff = nodeIndex = 0) || start.pop()) ) { + + if ( ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) && + ++diff ) { + + // Cache the index of each encountered element + if ( useCache ) { + outerCache = node[ expando ] || (node[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); + + uniqueCache[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction(function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf( seed, matched[i] ); + seed[ idx ] = !( matches[ idx ] = matched[i] ); + } + }) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + // Potentially complex pseudos + "not": markFunction(function( selector ) { + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction(function( seed, matches, context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( (elem = unmatched[i]) ) { + seed[i] = !(matches[i] = elem); + } + } + }) : + function( elem, context, xml ) { + input[0] = elem; + matcher( input, null, xml, results ); + // Don't keep the element (issue #299) + input[0] = null; + return !results.pop(); + }; + }), + + "has": markFunction(function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + }), + + "contains": markFunction(function( text ) { + text = text.replace( runescape, funescape ); + return function( elem ) { + return ( elem.textContent || getText( elem ) ).indexOf( text ) > -1; + }; + }), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction( function( lang ) { + // lang value must be a valid identifier + if ( !ridentifier.test(lang || "") ) { + Sizzle.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( (elemLang = documentIsHTML ? + elem.lang : + elem.getAttribute("xml:lang") || elem.getAttribute("lang")) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( (elem = elem.parentNode) && elem.nodeType === 1 ); + return false; + }; + }), + + // Miscellaneous + "target": function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + "root": function( elem ) { + return elem === docElem; + }, + + "focus": function( elem ) { + return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex); + }, + + // Boolean properties + "enabled": createDisabledPseudo( false ), + "disabled": createDisabledPseudo( true ), + + "checked": function( elem ) { + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); + }, + + "selected": function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + "empty": function( elem ) { + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), + // but not by others (comment: 8; processing instruction: 7; etc.) + // nodeType < 6 works because attributes (2) do not appear as children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeType < 6 ) { + return false; + } + } + return true; + }, + + "parent": function( elem ) { + return !Expr.pseudos["empty"]( elem ); + }, + + // Element/input types + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "text": function( elem ) { + var attr; + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && + + // Support: IE<8 + // New HTML5 attribute values (e.g., "search") appear with elem.type === "text" + ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text" ); + }, + + // Position-in-collection + "first": createPositionalPseudo(function() { + return [ 0 ]; + }), + + "last": createPositionalPseudo(function( matchIndexes, length ) { + return [ length - 1 ]; + }), + + "eq": createPositionalPseudo(function( matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + }), + + "even": createPositionalPseudo(function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "odd": createPositionalPseudo(function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "lt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? + argument + length : + argument > length ? + length : + argument; + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "gt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }) + } +}; + +Expr.pseudos["nth"] = Expr.pseudos["eq"]; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +// Easy API for creating new setFilters +function setFilters() {} +setFilters.prototype = Expr.filters = Expr.pseudos; +Expr.setFilters = new setFilters(); + +tokenize = Sizzle.tokenize = function( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || (match = rcomma.exec( soFar )) ) { + if ( match ) { + // Don't consume trailing commas as valid + soFar = soFar.slice( match[0].length ) || soFar; + } + groups.push( (tokens = []) ); + } + + matched = false; + + // Combinators + if ( (match = rcombinators.exec( soFar )) ) { + matched = match.shift(); + tokens.push({ + value: matched, + // Cast descendant combinators to space + type: match[0].replace( rtrim, " " ) + }); + soFar = soFar.slice( matched.length ); + } + + // Filters + for ( type in Expr.filter ) { + if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] || + (match = preFilters[ type ]( match ))) ) { + matched = match.shift(); + tokens.push({ + value: matched, + type: type, + matches: match + }); + soFar = soFar.slice( matched.length ); + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +}; + +function toSelector( tokens ) { + var i = 0, + len = tokens.length, + selector = ""; + for ( ; i < len; i++ ) { + selector += tokens[i].value; + } + return selector; +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + skip = combinator.next, + key = skip || dir, + checkNonElements = base && key === "parentNode", + doneName = done++; + + return combinator.first ? + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + return false; + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var oldCache, uniqueCache, outerCache, + newCache = [ dirruns, doneName ]; + + // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching + if ( xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || (elem[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ elem.uniqueID ] || (outerCache[ elem.uniqueID ] = {}); + + if ( skip && skip === elem.nodeName.toLowerCase() ) { + elem = elem[ dir ] || elem; + } else if ( (oldCache = uniqueCache[ key ]) && + oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) { + + // Assign to newCache so results back-propagate to previous elements + return (newCache[ 2 ] = oldCache[ 2 ]); + } else { + // Reuse newcache so results back-propagate to previous elements + uniqueCache[ key ] = newCache; + + // A match means we're done; a fail means we have to keep checking + if ( (newCache[ 2 ] = matcher( elem, context, xml )) ) { + return true; + } + } + } + } + } + return false; + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[i]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[0]; +} + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[i], results ); + } + return results; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( (elem = unmatched[i]) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction(function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( (elem = temp[i]) ) { + matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) ) { + // Restore matcherIn since elem is not yet a final match + temp.push( (matcherIn[i] = elem) ); + } + } + postFinder( null, (matcherOut = []), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) && + (temp = postFinder ? indexOf( seed, elem ) : preMap[i]) > -1 ) { + + seed[temp] = !(results[temp] = elem); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + }); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[0].type ], + implicitRelative = leadingRelative || Expr.relative[" "], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + (checkContext = context).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + // Avoid hanging onto element (issue #299) + checkContext = null; + return ret; + } ]; + + for ( ; i < len; i++ ) { + if ( (matcher = Expr.relative[ tokens[i].type ]) ) { + matchers = [ addCombinator(elementMatcher( matchers ), matcher) ]; + } else { + matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[j].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && toSelector( + // If the preceding token was a descendant combinator, insert an implicit any-element `*` + tokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === " " ? "*" : "" }) + ).replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( (tokens = tokens.slice( j )) ), + j < len && toSelector( tokens ) + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, outermost ) { + var elem, j, matcher, + matchedCount = 0, + i = "0", + unmatched = seed && [], + setMatched = [], + contextBackup = outermostContext, + // We must always have either seed elements or outermost context + elems = seed || byElement && Expr.find["TAG"]( "*", outermost ), + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1), + len = elems.length; + + if ( outermost ) { + outermostContext = context === document || context || outermost; + } + + // Add elements passing elementMatchers directly to results + // Support: IE<9, Safari + // Tolerate NodeList properties (IE: "length"; Safari: <number>) matching elements by id + for ( ; i !== len && (elem = elems[i]) != null; i++ ) { + if ( byElement && elem ) { + j = 0; + if ( !context && elem.ownerDocument !== document ) { + setDocument( elem ); + xml = !documentIsHTML; + } + while ( (matcher = elementMatchers[j++]) ) { + if ( matcher( elem, context || document, xml) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + // They will have gone through all possible matchers + if ( (elem = !matcher && elem) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // `i` is now the count of elements visited above, and adding it to `matchedCount` + // makes the latter nonnegative. + matchedCount += i; + + // Apply set filters to unmatched elements + // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` + // equals `i`), unless we didn't visit _any_ elements in the above loop because we have + // no element matchers and no seed. + // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that + // case, which will result in a "00" `matchedCount` that differs from `i` but is also + // numerically zero. + if ( bySet && i !== matchedCount ) { + j = 0; + while ( (matcher = setMatchers[j++]) ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !(unmatched[i] || setMatched[i]) ) { + setMatched[i] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + // Generate a function of recursive functions that can be used to check each element + if ( !match ) { + match = tokenize( selector ); + } + i = match.length; + while ( i-- ) { + cached = matcherFromTokens( match[i] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) ); + + // Save selector and tokenization + cached.selector = selector; + } + return cached; +}; + +/** + * A low-level selection function that works with Sizzle's compiled + * selector functions + * @param {String|Function} selector A selector or a pre-compiled + * selector function built with Sizzle.compile + * @param {Element} context + * @param {Array} [results] + * @param {Array} [seed] A set of elements to match against + */ +select = Sizzle.select = function( selector, context, results, seed ) { + var i, tokens, token, type, find, + compiled = typeof selector === "function" && selector, + match = !seed && tokenize( (selector = compiled.selector || selector) ); + + results = results || []; + + // Try to minimize operations if there is only one selector in the list and no seed + // (the latter of which guarantees us context) + if ( match.length === 1 ) { + + // Reduce context if the leading compound selector is an ID + tokens = match[0] = match[0].slice( 0 ); + if ( tokens.length > 2 && (token = tokens[0]).type === "ID" && + context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[1].type ] ) { + + context = ( Expr.find["ID"]( token.matches[0].replace(runescape, funescape), context ) || [] )[0]; + if ( !context ) { + return results; + + // Precompiled matchers will still verify ancestry, so step up a level + } else if ( compiled ) { + context = context.parentNode; + } + + selector = selector.slice( tokens.shift().value.length ); + } + + // Fetch a seed set for right-to-left matching + i = matchExpr["needsContext"].test( selector ) ? 0 : tokens.length; + while ( i-- ) { + token = tokens[i]; + + // Abort if we hit a combinator + if ( Expr.relative[ (type = token.type) ] ) { + break; + } + if ( (find = Expr.find[ type ]) ) { + // Search, expanding context for leading sibling combinators + if ( (seed = find( + token.matches[0].replace( runescape, funescape ), + rsibling.test( tokens[0].type ) && testContext( context.parentNode ) || context + )) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && toSelector( tokens ); + if ( !selector ) { + push.apply( results, seed ); + return results; + } + + break; + } + } + } + } + + // Compile and execute a filtering function if one is not provided + // Provide `match` to avoid retokenization if we modified the selector above + ( compiled || compile( selector, match ) )( + seed, + context, + !documentIsHTML, + results, + !context || rsibling.test( selector ) && testContext( context.parentNode ) || context + ); + return results; +}; + +// One-time assignments + +// Sort stability +support.sortStable = expando.split("").sort( sortOrder ).join("") === expando; + +// Support: Chrome 14-35+ +// Always assume duplicates if they aren't passed to the comparison function +support.detectDuplicates = !!hasDuplicate; + +// Initialize against the default document +setDocument(); + +// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27) +// Detached nodes confoundingly follow *each other* +support.sortDetached = assert(function( el ) { + // Should return 1, but returns 4 (following) + return el.compareDocumentPosition( document.createElement("fieldset") ) & 1; +}); + +// Support: IE<8 +// Prevent attribute/property "interpolation" +// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx +if ( !assert(function( el ) { + el.innerHTML = "<a href='#'></a>"; + return el.firstChild.getAttribute("href") === "#" ; +}) ) { + addHandle( "type|href|height|width", function( elem, name, isXML ) { + if ( !isXML ) { + return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 ); + } + }); +} + +// Support: IE<9 +// Use defaultValue in place of getAttribute("value") +if ( !support.attributes || !assert(function( el ) { + el.innerHTML = "<input/>"; + el.firstChild.setAttribute( "value", "" ); + return el.firstChild.getAttribute( "value" ) === ""; +}) ) { + addHandle( "value", function( elem, name, isXML ) { + if ( !isXML && elem.nodeName.toLowerCase() === "input" ) { + return elem.defaultValue; + } + }); +} + +// Support: IE<9 +// Use getAttributeNode to fetch booleans when getAttribute lies +if ( !assert(function( el ) { + return el.getAttribute("disabled") == null; +}) ) { + addHandle( booleans, function( elem, name, isXML ) { + var val; + if ( !isXML ) { + return elem[ name ] === true ? name.toLowerCase() : + (val = elem.getAttributeNode( name )) && val.specified ? + val.value : + null; + } + }); +} + +return Sizzle; + +})( window ); + + + +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; + +// Deprecated +jQuery.expr[ ":" ] = jQuery.expr.pseudos; +jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; +jQuery.escapeSelector = Sizzle.escape; + + + + +var dir = function( elem, dir, until ) { + var matched = [], + truncate = until !== undefined; + + while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) { + if ( elem.nodeType === 1 ) { + if ( truncate && jQuery( elem ).is( until ) ) { + break; + } + matched.push( elem ); + } + } + return matched; +}; + + +var siblings = function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; +}; + + +var rneedsContext = jQuery.expr.match.needsContext; + + + +function nodeName( elem, name ) { + + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + +}; +var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i ); + + + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, not ) { + if ( isFunction( qualifier ) ) { + return jQuery.grep( elements, function( elem, i ) { + return !!qualifier.call( elem, i, elem ) !== not; + } ); + } + + // Single element + if ( qualifier.nodeType ) { + return jQuery.grep( elements, function( elem ) { + return ( elem === qualifier ) !== not; + } ); + } + + // Arraylike of elements (jQuery, arguments, Array) + if ( typeof qualifier !== "string" ) { + return jQuery.grep( elements, function( elem ) { + return ( indexOf.call( qualifier, elem ) > -1 ) !== not; + } ); + } + + // Filtered directly for both simple and complex selectors + return jQuery.filter( qualifier, elements, not ); +} + +jQuery.filter = function( expr, elems, not ) { + var elem = elems[ 0 ]; + + if ( not ) { + expr = ":not(" + expr + ")"; + } + + if ( elems.length === 1 && elem.nodeType === 1 ) { + return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : []; + } + + return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) { + return elem.nodeType === 1; + } ) ); +}; + +jQuery.fn.extend( { + find: function( selector ) { + var i, ret, + len = this.length, + self = this; + + if ( typeof selector !== "string" ) { + return this.pushStack( jQuery( selector ).filter( function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + } ) ); + } + + ret = this.pushStack( [] ); + + for ( i = 0; i < len; i++ ) { + jQuery.find( selector, self[ i ], ret ); + } + + return len > 1 ? jQuery.uniqueSort( ret ) : ret; + }, + filter: function( selector ) { + return this.pushStack( winnow( this, selector || [], false ) ); + }, + not: function( selector ) { + return this.pushStack( winnow( this, selector || [], true ) ); + }, + is: function( selector ) { + return !!winnow( + this, + + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + typeof selector === "string" && rneedsContext.test( selector ) ? + jQuery( selector ) : + selector || [], + false + ).length; + } +} ); + + +// Initialize a jQuery object + + +// A central reference to the root jQuery(document) +var rootjQuery, + + // A simple way to check for HTML strings + // Prioritize #id over <tag> to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + // Shortcut simple #id case for speed + rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, + + init = jQuery.fn.init = function( selector, context, root ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Method init() accepts an alternate rootjQuery + // so migrate can support jQuery.sub (gh-2101) + root = root || rootjQuery; + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector[ 0 ] === "<" && + selector[ selector.length - 1 ] === ">" && + selector.length >= 3 ) { + + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && ( match[ 1 ] || !context ) ) { + + // HANDLE: $(html) -> $(array) + if ( match[ 1 ] ) { + context = context instanceof jQuery ? context[ 0 ] : context; + + // Option to run scripts is true for back-compat + // Intentionally let the error be thrown if parseHTML is not present + jQuery.merge( this, jQuery.parseHTML( + match[ 1 ], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + + // Properties of context are called as methods if possible + if ( isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[ 2 ] ); + + if ( elem ) { + + // Inject the element directly into the jQuery object + this[ 0 ] = elem; + this.length = 1; + } + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || root ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this[ 0 ] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( isFunction( selector ) ) { + return root.ready !== undefined ? + root.ready( selector ) : + + // Execute immediately if ready is not present + selector( jQuery ); + } + + return jQuery.makeArray( selector, this ); + }; + +// Give the init function the jQuery prototype for later instantiation +init.prototype = jQuery.fn; + +// Initialize central reference +rootjQuery = jQuery( document ); + + +var rparentsprev = /^(?:parents|prev(?:Until|All))/, + + // Methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend( { + has: function( target ) { + var targets = jQuery( target, this ), + l = targets.length; + + return this.filter( function() { + var i = 0; + for ( ; i < l; i++ ) { + if ( jQuery.contains( this, targets[ i ] ) ) { + return true; + } + } + } ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + targets = typeof selectors !== "string" && jQuery( selectors ); + + // Positional selectors never match, since there's no _selection_ context + if ( !rneedsContext.test( selectors ) ) { + for ( ; i < l; i++ ) { + for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) { + + // Always skip document fragments + if ( cur.nodeType < 11 && ( targets ? + targets.index( cur ) > -1 : + + // Don't pass non-elements to Sizzle + cur.nodeType === 1 && + jQuery.find.matchesSelector( cur, selectors ) ) ) { + + matched.push( cur ); + break; + } + } + } + } + + return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched ); + }, + + // Determine the position of an element within the set + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // Index in selector + if ( typeof elem === "string" ) { + return indexOf.call( jQuery( elem ), this[ 0 ] ); + } + + // Locate the position of the desired element + return indexOf.call( this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem + ); + }, + + add: function( selector, context ) { + return this.pushStack( + jQuery.uniqueSort( + jQuery.merge( this.get(), jQuery( selector, context ) ) + ) + ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + } +} ); + +function sibling( cur, dir ) { + while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {} + return cur; +} + +jQuery.each( { + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return siblings( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return siblings( elem.firstChild ); + }, + contents: function( elem ) { + if ( typeof elem.contentDocument !== "undefined" ) { + return elem.contentDocument; + } + + // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only + // Treat the template element as a regular one in browsers that + // don't support it. + if ( nodeName( elem, "template" ) ) { + elem = elem.content || elem; + } + + return jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var matched = jQuery.map( this, fn, until ); + + if ( name.slice( -5 ) !== "Until" ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + matched = jQuery.filter( selector, matched ); + } + + if ( this.length > 1 ) { + + // Remove duplicates + if ( !guaranteedUnique[ name ] ) { + jQuery.uniqueSort( matched ); + } + + // Reverse order for parents* and prev-derivatives + if ( rparentsprev.test( name ) ) { + matched.reverse(); + } + } + + return this.pushStack( matched ); + }; +} ); +var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g ); + + + +// Convert String-formatted options into Object-formatted ones +function createOptions( options ) { + var object = {}; + jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) { + object[ flag ] = true; + } ); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + createOptions( options ) : + jQuery.extend( {}, options ); + + var // Flag to know if list is currently firing + firing, + + // Last fire value for non-forgettable lists + memory, + + // Flag to know if list was already fired + fired, + + // Flag to prevent firing + locked, + + // Actual callback list + list = [], + + // Queue of execution data for repeatable lists + queue = [], + + // Index of currently firing callback (modified by add/remove as needed) + firingIndex = -1, + + // Fire callbacks + fire = function() { + + // Enforce single-firing + locked = locked || options.once; + + // Execute callbacks for all pending executions, + // respecting firingIndex overrides and runtime changes + fired = firing = true; + for ( ; queue.length; firingIndex = -1 ) { + memory = queue.shift(); + while ( ++firingIndex < list.length ) { + + // Run callback and check for early termination + if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false && + options.stopOnFalse ) { + + // Jump to end and forget the data so .add doesn't re-fire + firingIndex = list.length; + memory = false; + } + } + } + + // Forget the data if we're done with it + if ( !options.memory ) { + memory = false; + } + + firing = false; + + // Clean up if we're done firing for good + if ( locked ) { + + // Keep an empty list if we have data for future add calls + if ( memory ) { + list = []; + + // Otherwise, this object is spent + } else { + list = ""; + } + } + }, + + // Actual Callbacks object + self = { + + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + + // If we have memory from a past run, we should fire after adding + if ( memory && !firing ) { + firingIndex = list.length - 1; + queue.push( memory ); + } + + ( function add( args ) { + jQuery.each( args, function( _, arg ) { + if ( isFunction( arg ) ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && toType( arg ) !== "string" ) { + + // Inspect recursively + add( arg ); + } + } ); + } )( arguments ); + + if ( memory && !firing ) { + fire(); + } + } + return this; + }, + + // Remove a callback from the list + remove: function() { + jQuery.each( arguments, function( _, arg ) { + var index; + while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + + // Handle firing indexes + if ( index <= firingIndex ) { + firingIndex--; + } + } + } ); + return this; + }, + + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function( fn ) { + return fn ? + jQuery.inArray( fn, list ) > -1 : + list.length > 0; + }, + + // Remove all callbacks from the list + empty: function() { + if ( list ) { + list = []; + } + return this; + }, + + // Disable .fire and .add + // Abort any current/pending executions + // Clear all callbacks and values + disable: function() { + locked = queue = []; + list = memory = ""; + return this; + }, + disabled: function() { + return !list; + }, + + // Disable .fire + // Also disable .add unless we have memory (since it would have no effect) + // Abort any pending executions + lock: function() { + locked = queue = []; + if ( !memory && !firing ) { + list = memory = ""; + } + return this; + }, + locked: function() { + return !!locked; + }, + + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( !locked ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + queue.push( args ); + if ( !firing ) { + fire(); + } + } + return this; + }, + + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; + + +function Identity( v ) { + return v; +} +function Thrower( ex ) { + throw ex; +} + +function adoptValue( value, resolve, reject, noValue ) { + var method; + + try { + + // Check for promise aspect first to privilege synchronous behavior + if ( value && isFunction( ( method = value.promise ) ) ) { + method.call( value ).done( resolve ).fail( reject ); + + // Other thenables + } else if ( value && isFunction( ( method = value.then ) ) ) { + method.call( value, resolve, reject ); + + // Other non-thenables + } else { + + // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer: + // * false: [ value ].slice( 0 ) => resolve( value ) + // * true: [ value ].slice( 1 ) => resolve() + resolve.apply( undefined, [ value ].slice( noValue ) ); + } + + // For Promises/A+, convert exceptions into rejections + // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in + // Deferred#then to conditionally suppress rejection. + } catch ( value ) { + + // Support: Android 4.0 only + // Strict mode functions invoked without .call/.apply get global-object context + reject.apply( undefined, [ value ] ); + } +} + +jQuery.extend( { + + Deferred: function( func ) { + var tuples = [ + + // action, add listener, callbacks, + // ... .then handlers, argument index, [final state] + [ "notify", "progress", jQuery.Callbacks( "memory" ), + jQuery.Callbacks( "memory" ), 2 ], + [ "resolve", "done", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 0, "resolved" ], + [ "reject", "fail", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 1, "rejected" ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + "catch": function( fn ) { + return promise.then( null, fn ); + }, + + // Keep pipe for back-compat + pipe: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + + return jQuery.Deferred( function( newDefer ) { + jQuery.each( tuples, function( i, tuple ) { + + // Map tuples (progress, done, fail) to arguments (done, fail, progress) + var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ]; + + // deferred.progress(function() { bind to newDefer or newDefer.notify }) + // deferred.done(function() { bind to newDefer or newDefer.resolve }) + // deferred.fail(function() { bind to newDefer or newDefer.reject }) + deferred[ tuple[ 1 ] ]( function() { + var returned = fn && fn.apply( this, arguments ); + if ( returned && isFunction( returned.promise ) ) { + returned.promise() + .progress( newDefer.notify ) + .done( newDefer.resolve ) + .fail( newDefer.reject ); + } else { + newDefer[ tuple[ 0 ] + "With" ]( + this, + fn ? [ returned ] : arguments + ); + } + } ); + } ); + fns = null; + } ).promise(); + }, + then: function( onFulfilled, onRejected, onProgress ) { + var maxDepth = 0; + function resolve( depth, deferred, handler, special ) { + return function() { + var that = this, + args = arguments, + mightThrow = function() { + var returned, then; + + // Support: Promises/A+ section 2.3.3.3.3 + // https://promisesaplus.com/#point-59 + // Ignore double-resolution attempts + if ( depth < maxDepth ) { + return; + } + + returned = handler.apply( that, args ); + + // Support: Promises/A+ section 2.3.1 + // https://promisesaplus.com/#point-48 + if ( returned === deferred.promise() ) { + throw new TypeError( "Thenable self-resolution" ); + } + + // Support: Promises/A+ sections 2.3.3.1, 3.5 + // https://promisesaplus.com/#point-54 + // https://promisesaplus.com/#point-75 + // Retrieve `then` only once + then = returned && + + // Support: Promises/A+ section 2.3.4 + // https://promisesaplus.com/#point-64 + // Only check objects and functions for thenability + ( typeof returned === "object" || + typeof returned === "function" ) && + returned.then; + + // Handle a returned thenable + if ( isFunction( then ) ) { + + // Special processors (notify) just wait for resolution + if ( special ) { + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ) + ); + + // Normal processors (resolve) also hook into progress + } else { + + // ...and disregard older resolution values + maxDepth++; + + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ), + resolve( maxDepth, deferred, Identity, + deferred.notifyWith ) + ); + } + + // Handle all other returned values + } else { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Identity ) { + that = undefined; + args = [ returned ]; + } + + // Process the value(s) + // Default process is resolve + ( special || deferred.resolveWith )( that, args ); + } + }, + + // Only normal processors (resolve) catch and reject exceptions + process = special ? + mightThrow : + function() { + try { + mightThrow(); + } catch ( e ) { + + if ( jQuery.Deferred.exceptionHook ) { + jQuery.Deferred.exceptionHook( e, + process.stackTrace ); + } + + // Support: Promises/A+ section 2.3.3.3.4.1 + // https://promisesaplus.com/#point-61 + // Ignore post-resolution exceptions + if ( depth + 1 >= maxDepth ) { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Thrower ) { + that = undefined; + args = [ e ]; + } + + deferred.rejectWith( that, args ); + } + } + }; + + // Support: Promises/A+ section 2.3.3.3.1 + // https://promisesaplus.com/#point-57 + // Re-resolve promises immediately to dodge false rejection from + // subsequent errors + if ( depth ) { + process(); + } else { + + // Call an optional hook to record the stack, in case of exception + // since it's otherwise lost when execution goes async + if ( jQuery.Deferred.getStackHook ) { + process.stackTrace = jQuery.Deferred.getStackHook(); + } + window.setTimeout( process ); + } + }; + } + + return jQuery.Deferred( function( newDefer ) { + + // progress_handlers.add( ... ) + tuples[ 0 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onProgress ) ? + onProgress : + Identity, + newDefer.notifyWith + ) + ); + + // fulfilled_handlers.add( ... ) + tuples[ 1 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onFulfilled ) ? + onFulfilled : + Identity + ) + ); + + // rejected_handlers.add( ... ) + tuples[ 2 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onRejected ) ? + onRejected : + Thrower + ) + ); + } ).promise(); + }, + + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 5 ]; + + // promise.progress = list.add + // promise.done = list.add + // promise.fail = list.add + promise[ tuple[ 1 ] ] = list.add; + + // Handle state + if ( stateString ) { + list.add( + function() { + + // state = "resolved" (i.e., fulfilled) + // state = "rejected" + state = stateString; + }, + + // rejected_callbacks.disable + // fulfilled_callbacks.disable + tuples[ 3 - i ][ 2 ].disable, + + // rejected_handlers.disable + // fulfilled_handlers.disable + tuples[ 3 - i ][ 3 ].disable, + + // progress_callbacks.lock + tuples[ 0 ][ 2 ].lock, + + // progress_handlers.lock + tuples[ 0 ][ 3 ].lock + ); + } + + // progress_handlers.fire + // fulfilled_handlers.fire + // rejected_handlers.fire + list.add( tuple[ 3 ].fire ); + + // deferred.notify = function() { deferred.notifyWith(...) } + // deferred.resolve = function() { deferred.resolveWith(...) } + // deferred.reject = function() { deferred.rejectWith(...) } + deferred[ tuple[ 0 ] ] = function() { + deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments ); + return this; + }; + + // deferred.notifyWith = list.fireWith + // deferred.resolveWith = list.fireWith + // deferred.rejectWith = list.fireWith + deferred[ tuple[ 0 ] + "With" ] = list.fireWith; + } ); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( singleValue ) { + var + + // count of uncompleted subordinates + remaining = arguments.length, + + // count of unprocessed arguments + i = remaining, + + // subordinate fulfillment data + resolveContexts = Array( i ), + resolveValues = slice.call( arguments ), + + // the master Deferred + master = jQuery.Deferred(), + + // subordinate callback factory + updateFunc = function( i ) { + return function( value ) { + resolveContexts[ i ] = this; + resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value; + if ( !( --remaining ) ) { + master.resolveWith( resolveContexts, resolveValues ); + } + }; + }; + + // Single- and empty arguments are adopted like Promise.resolve + if ( remaining <= 1 ) { + adoptValue( singleValue, master.done( updateFunc( i ) ).resolve, master.reject, + !remaining ); + + // Use .then() to unwrap secondary thenables (cf. gh-3000) + if ( master.state() === "pending" || + isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) { + + return master.then(); + } + } + + // Multiple arguments are aggregated like Promise.all array elements + while ( i-- ) { + adoptValue( resolveValues[ i ], updateFunc( i ), master.reject ); + } + + return master.promise(); + } +} ); + + +// These usually indicate a programmer mistake during development, +// warn about them ASAP rather than swallowing them by default. +var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/; + +jQuery.Deferred.exceptionHook = function( error, stack ) { + + // Support: IE 8 - 9 only + // Console exists when dev tools are open, which can happen at any time + if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) { + window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack ); + } +}; + + + + +jQuery.readyException = function( error ) { + window.setTimeout( function() { + throw error; + } ); +}; + + + + +// The deferred used on DOM ready +var readyList = jQuery.Deferred(); + +jQuery.fn.ready = function( fn ) { + + readyList + .then( fn ) + + // Wrap jQuery.readyException in a function so that the lookup + // happens at the time of error handling instead of callback + // registration. + .catch( function( error ) { + jQuery.readyException( error ); + } ); + + return this; +}; + +jQuery.extend( { + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + } +} ); + +jQuery.ready.then = readyList.then; + +// The ready event handler and self cleanup method +function completed() { + document.removeEventListener( "DOMContentLoaded", completed ); + window.removeEventListener( "load", completed ); + jQuery.ready(); +} + +// Catch cases where $(document).ready() is called +// after the browser event has already occurred. +// Support: IE <=9 - 10 only +// Older IE sometimes signals "interactive" too soon +if ( document.readyState === "complete" || + ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) { + + // Handle it asynchronously to allow scripts the opportunity to delay ready + window.setTimeout( jQuery.ready ); + +} else { + + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", completed ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", completed ); +} + + + + +// Multifunctional method to get and set values of a collection +// The value/s can optionally be executed if it's a function +var access = function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + len = elems.length, + bulk = key == null; + + // Sets many values + if ( toType( key ) === "object" ) { + chainable = true; + for ( i in key ) { + access( elems, fn, i, key[ i ], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < len; i++ ) { + fn( + elems[ i ], key, raw ? + value : + value.call( elems[ i ], i, fn( elems[ i ], key ) ) + ); + } + } + } + + if ( chainable ) { + return elems; + } + + // Gets + if ( bulk ) { + return fn.call( elems ); + } + + return len ? fn( elems[ 0 ], key ) : emptyGet; +}; + + +// Matches dashed string for camelizing +var rmsPrefix = /^-ms-/, + rdashAlpha = /-([a-z])/g; + +// Used by camelCase as callback to replace() +function fcamelCase( all, letter ) { + return letter.toUpperCase(); +} + +// Convert dashed to camelCase; used by the css and data modules +// Support: IE <=9 - 11, Edge 12 - 15 +// Microsoft forgot to hump their vendor prefix (#9572) +function camelCase( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); +} +var acceptData = function( owner ) { + + // Accepts only: + // - Node + // - Node.ELEMENT_NODE + // - Node.DOCUMENT_NODE + // - Object + // - Any + return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType ); +}; + + + + +function Data() { + this.expando = jQuery.expando + Data.uid++; +} + +Data.uid = 1; + +Data.prototype = { + + cache: function( owner ) { + + // Check if the owner object already has a cache + var value = owner[ this.expando ]; + + // If not, create one + if ( !value ) { + value = {}; + + // We can accept data for non-element nodes in modern browsers, + // but we should not, see #8335. + // Always return an empty object. + if ( acceptData( owner ) ) { + + // If it is a node unlikely to be stringify-ed or looped over + // use plain assignment + if ( owner.nodeType ) { + owner[ this.expando ] = value; + + // Otherwise secure it in a non-enumerable property + // configurable must be true to allow the property to be + // deleted when data is removed + } else { + Object.defineProperty( owner, this.expando, { + value: value, + configurable: true + } ); + } + } + } + + return value; + }, + set: function( owner, data, value ) { + var prop, + cache = this.cache( owner ); + + // Handle: [ owner, key, value ] args + // Always use camelCase key (gh-2257) + if ( typeof data === "string" ) { + cache[ camelCase( data ) ] = value; + + // Handle: [ owner, { properties } ] args + } else { + + // Copy the properties one-by-one to the cache object + for ( prop in data ) { + cache[ camelCase( prop ) ] = data[ prop ]; + } + } + return cache; + }, + get: function( owner, key ) { + return key === undefined ? + this.cache( owner ) : + + // Always use camelCase key (gh-2257) + owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ]; + }, + access: function( owner, key, value ) { + + // In cases where either: + // + // 1. No key was specified + // 2. A string key was specified, but no value provided + // + // Take the "read" path and allow the get method to determine + // which value to return, respectively either: + // + // 1. The entire cache object + // 2. The data stored at the key + // + if ( key === undefined || + ( ( key && typeof key === "string" ) && value === undefined ) ) { + + return this.get( owner, key ); + } + + // When the key is not a string, or both a key and value + // are specified, set or extend (existing objects) with either: + // + // 1. An object of properties + // 2. A key and value + // + this.set( owner, key, value ); + + // Since the "set" path can have two possible entry points + // return the expected data based on which path was taken[*] + return value !== undefined ? value : key; + }, + remove: function( owner, key ) { + var i, + cache = owner[ this.expando ]; + + if ( cache === undefined ) { + return; + } + + if ( key !== undefined ) { + + // Support array or space separated string of keys + if ( Array.isArray( key ) ) { + + // If key is an array of keys... + // We always set camelCase keys, so remove that. + key = key.map( camelCase ); + } else { + key = camelCase( key ); + + // If a key with the spaces exists, use it. + // Otherwise, create an array by matching non-whitespace + key = key in cache ? + [ key ] : + ( key.match( rnothtmlwhite ) || [] ); + } + + i = key.length; + + while ( i-- ) { + delete cache[ key[ i ] ]; + } + } + + // Remove the expando if there's no more data + if ( key === undefined || jQuery.isEmptyObject( cache ) ) { + + // Support: Chrome <=35 - 45 + // Webkit & Blink performance suffers when deleting properties + // from DOM nodes, so set to undefined instead + // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted) + if ( owner.nodeType ) { + owner[ this.expando ] = undefined; + } else { + delete owner[ this.expando ]; + } + } + }, + hasData: function( owner ) { + var cache = owner[ this.expando ]; + return cache !== undefined && !jQuery.isEmptyObject( cache ); + } +}; +var dataPriv = new Data(); + +var dataUser = new Data(); + + + +// Implementation Summary +// +// 1. Enforce API surface and semantic compatibility with 1.9.x branch +// 2. Improve the module's maintainability by reducing the storage +// paths to a single mechanism. +// 3. Use the same single mechanism to support "private" and "user" data. +// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) +// 5. Avoid exposing implementation details on user objects (eg. expando properties) +// 6. Provide a clear path for implementation upgrade to WeakMap in 2014 + +var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, + rmultiDash = /[A-Z]/g; + +function getData( data ) { + if ( data === "true" ) { + return true; + } + + if ( data === "false" ) { + return false; + } + + if ( data === "null" ) { + return null; + } + + // Only convert to a number if it doesn't change the string + if ( data === +data + "" ) { + return +data; + } + + if ( rbrace.test( data ) ) { + return JSON.parse( data ); + } + + return data; +} + +function dataAttr( elem, key, data ) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase(); + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = getData( data ); + } catch ( e ) {} + + // Make sure we set the data so it isn't changed later + dataUser.set( elem, key, data ); + } else { + data = undefined; + } + } + return data; +} + +jQuery.extend( { + hasData: function( elem ) { + return dataUser.hasData( elem ) || dataPriv.hasData( elem ); + }, + + data: function( elem, name, data ) { + return dataUser.access( elem, name, data ); + }, + + removeData: function( elem, name ) { + dataUser.remove( elem, name ); + }, + + // TODO: Now that all calls to _data and _removeData have been replaced + // with direct calls to dataPriv methods, these can be deprecated. + _data: function( elem, name, data ) { + return dataPriv.access( elem, name, data ); + }, + + _removeData: function( elem, name ) { + dataPriv.remove( elem, name ); + } +} ); + +jQuery.fn.extend( { + data: function( key, value ) { + var i, name, data, + elem = this[ 0 ], + attrs = elem && elem.attributes; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = dataUser.get( elem ); + + if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) { + i = attrs.length; + while ( i-- ) { + + // Support: IE 11 only + // The attrs elements can be null (#14894) + if ( attrs[ i ] ) { + name = attrs[ i ].name; + if ( name.indexOf( "data-" ) === 0 ) { + name = camelCase( name.slice( 5 ) ); + dataAttr( elem, name, data[ name ] ); + } + } + } + dataPriv.set( elem, "hasDataAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each( function() { + dataUser.set( this, key ); + } ); + } + + return access( this, function( value ) { + var data; + + // The calling jQuery object (element matches) is not empty + // (and therefore has an element appears at this[ 0 ]) and the + // `value` parameter was not undefined. An empty jQuery object + // will result in `undefined` for elem = this[ 0 ] which will + // throw an exception if an attempt to read a data cache is made. + if ( elem && value === undefined ) { + + // Attempt to get data from the cache + // The key will always be camelCased in Data + data = dataUser.get( elem, key ); + if ( data !== undefined ) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr( elem, key ); + if ( data !== undefined ) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return; + } + + // Set the data... + this.each( function() { + + // We always store the camelCased key + dataUser.set( this, key, value ); + } ); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each( function() { + dataUser.remove( this, key ); + } ); + } +} ); + + +jQuery.extend( { + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = dataPriv.get( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || Array.isArray( data ) ) { + queue = dataPriv.access( elem, type, jQuery.makeArray( data ) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // Clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // Not public - generate a queueHooks object, or return the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return dataPriv.get( elem, key ) || dataPriv.access( elem, key, { + empty: jQuery.Callbacks( "once memory" ).add( function() { + dataPriv.remove( elem, [ type + "queue", key ] ); + } ) + } ); + } +} ); + +jQuery.fn.extend( { + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[ 0 ], type ); + } + + return data === undefined ? + this : + this.each( function() { + var queue = jQuery.queue( this, type, data ); + + // Ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[ 0 ] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + } ); + }, + dequeue: function( type ) { + return this.each( function() { + jQuery.dequeue( this, type ); + } ); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while ( i-- ) { + tmp = dataPriv.get( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +} ); +var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source; + +var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ); + + +var cssExpand = [ "Top", "Right", "Bottom", "Left" ]; + +var documentElement = document.documentElement; + + + + var isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ); + }, + composed = { composed: true }; + + // Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only + // Check attachment across shadow DOM boundaries when possible (gh-3504) + // Support: iOS 10.0-10.2 only + // Early iOS 10 versions support `attachShadow` but not `getRootNode`, + // leading to errors. We need to check for `getRootNode`. + if ( documentElement.getRootNode ) { + isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ) || + elem.getRootNode( composed ) === elem.ownerDocument; + }; + } +var isHiddenWithinTree = function( elem, el ) { + + // isHiddenWithinTree might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + + // Inline style trumps all + return elem.style.display === "none" || + elem.style.display === "" && + + // Otherwise, check computed style + // Support: Firefox <=43 - 45 + // Disconnected elements can have computed display: none, so first confirm that elem is + // in the document. + isAttached( elem ) && + + jQuery.css( elem, "display" ) === "none"; + }; + +var swap = function( elem, options, callback, args ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.apply( elem, args || [] ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; +}; + + + + +function adjustCSS( elem, prop, valueParts, tween ) { + var adjusted, scale, + maxIterations = 20, + currentValue = tween ? + function() { + return tween.cur(); + } : + function() { + return jQuery.css( elem, prop, "" ); + }, + initial = currentValue(), + unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ), + + // Starting value computation is required for potential unit mismatches + initialInUnit = elem.nodeType && + ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) && + rcssNum.exec( jQuery.css( elem, prop ) ); + + if ( initialInUnit && initialInUnit[ 3 ] !== unit ) { + + // Support: Firefox <=54 + // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144) + initial = initial / 2; + + // Trust units reported by jQuery.css + unit = unit || initialInUnit[ 3 ]; + + // Iteratively approximate from a nonzero starting point + initialInUnit = +initial || 1; + + while ( maxIterations-- ) { + + // Evaluate and update our best guess (doubling guesses that zero out). + // Finish if the scale equals or crosses 1 (making the old*new product non-positive). + jQuery.style( elem, prop, initialInUnit + unit ); + if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) { + maxIterations = 0; + } + initialInUnit = initialInUnit / scale; + + } + + initialInUnit = initialInUnit * 2; + jQuery.style( elem, prop, initialInUnit + unit ); + + // Make sure we update the tween properties later on + valueParts = valueParts || []; + } + + if ( valueParts ) { + initialInUnit = +initialInUnit || +initial || 0; + + // Apply relative offset (+=/-=) if specified + adjusted = valueParts[ 1 ] ? + initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] : + +valueParts[ 2 ]; + if ( tween ) { + tween.unit = unit; + tween.start = initialInUnit; + tween.end = adjusted; + } + } + return adjusted; +} + + +var defaultDisplayMap = {}; + +function getDefaultDisplay( elem ) { + var temp, + doc = elem.ownerDocument, + nodeName = elem.nodeName, + display = defaultDisplayMap[ nodeName ]; + + if ( display ) { + return display; + } + + temp = doc.body.appendChild( doc.createElement( nodeName ) ); + display = jQuery.css( temp, "display" ); + + temp.parentNode.removeChild( temp ); + + if ( display === "none" ) { + display = "block"; + } + defaultDisplayMap[ nodeName ] = display; + + return display; +} + +function showHide( elements, show ) { + var display, elem, + values = [], + index = 0, + length = elements.length; + + // Determine new display value for elements that need to change + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + + display = elem.style.display; + if ( show ) { + + // Since we force visibility upon cascade-hidden elements, an immediate (and slow) + // check is required in this first loop unless we have a nonempty display value (either + // inline or about-to-be-restored) + if ( display === "none" ) { + values[ index ] = dataPriv.get( elem, "display" ) || null; + if ( !values[ index ] ) { + elem.style.display = ""; + } + } + if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) { + values[ index ] = getDefaultDisplay( elem ); + } + } else { + if ( display !== "none" ) { + values[ index ] = "none"; + + // Remember what we're overwriting + dataPriv.set( elem, "display", display ); + } + } + } + + // Set the display of the elements in a second loop to avoid constant reflow + for ( index = 0; index < length; index++ ) { + if ( values[ index ] != null ) { + elements[ index ].style.display = values[ index ]; + } + } + + return elements; +} + +jQuery.fn.extend( { + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state ) { + if ( typeof state === "boolean" ) { + return state ? this.show() : this.hide(); + } + + return this.each( function() { + if ( isHiddenWithinTree( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + } ); + } +} ); +var rcheckableType = ( /^(?:checkbox|radio)$/i ); + +var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]*)/i ); + +var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i ); + + + +// We have to close these tags to support XHTML (#13200) +var wrapMap = { + + // Support: IE <=9 only + option: [ 1, "<select multiple='multiple'>", "</select>" ], + + // XHTML parsers do not magically insert elements in the + // same way that tag soup parsers do. So we cannot shorten + // this by omitting <tbody> or other required elements. + thead: [ 1, "<table>", "</table>" ], + col: [ 2, "<table><colgroup>", "</colgroup></table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + + _default: [ 0, "", "" ] +}; + +// Support: IE <=9 only +wrapMap.optgroup = wrapMap.option; + +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + + +function getAll( context, tag ) { + + // Support: IE <=9 - 11 only + // Use typeof to avoid zero-argument method invocation on host objects (#15151) + var ret; + + if ( typeof context.getElementsByTagName !== "undefined" ) { + ret = context.getElementsByTagName( tag || "*" ); + + } else if ( typeof context.querySelectorAll !== "undefined" ) { + ret = context.querySelectorAll( tag || "*" ); + + } else { + ret = []; + } + + if ( tag === undefined || tag && nodeName( context, tag ) ) { + return jQuery.merge( [ context ], ret ); + } + + return ret; +} + + +// Mark scripts as having already been evaluated +function setGlobalEval( elems, refElements ) { + var i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + dataPriv.set( + elems[ i ], + "globalEval", + !refElements || dataPriv.get( refElements[ i ], "globalEval" ) + ); + } +} + + +var rhtml = /<|&#?\w+;/; + +function buildFragment( elems, context, scripts, selection, ignored ) { + var elem, tmp, tag, wrap, attached, j, + fragment = context.createDocumentFragment(), + nodes = [], + i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + elem = elems[ i ]; + + if ( elem || elem === 0 ) { + + // Add nodes directly + if ( toType( elem ) === "object" ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem ); + + // Convert non-html into a text node + } else if ( !rhtml.test( elem ) ) { + nodes.push( context.createTextNode( elem ) ); + + // Convert html into DOM nodes + } else { + tmp = tmp || fragment.appendChild( context.createElement( "div" ) ); + + // Deserialize a standard representation + tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ]; + + // Descend through wrappers to the right content + j = wrap[ 0 ]; + while ( j-- ) { + tmp = tmp.lastChild; + } + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, tmp.childNodes ); + + // Remember the top-level container + tmp = fragment.firstChild; + + // Ensure the created nodes are orphaned (#12392) + tmp.textContent = ""; + } + } + } + + // Remove wrapper from fragment + fragment.textContent = ""; + + i = 0; + while ( ( elem = nodes[ i++ ] ) ) { + + // Skip elements already in the context collection (trac-4087) + if ( selection && jQuery.inArray( elem, selection ) > -1 ) { + if ( ignored ) { + ignored.push( elem ); + } + continue; + } + + attached = isAttached( elem ); + + // Append to fragment + tmp = getAll( fragment.appendChild( elem ), "script" ); + + // Preserve script evaluation history + if ( attached ) { + setGlobalEval( tmp ); + } + + // Capture executables + if ( scripts ) { + j = 0; + while ( ( elem = tmp[ j++ ] ) ) { + if ( rscriptType.test( elem.type || "" ) ) { + scripts.push( elem ); + } + } + } + } + + return fragment; +} + + +( function() { + var fragment = document.createDocumentFragment(), + div = fragment.appendChild( document.createElement( "div" ) ), + input = document.createElement( "input" ); + + // Support: Android 4.0 - 4.3 only + // Check state lost if the name is set (#11217) + // Support: Windows Web Apps (WWA) + // `name` and `type` must use .setAttribute for WWA (#14901) + input.setAttribute( "type", "radio" ); + input.setAttribute( "checked", "checked" ); + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + + // Support: Android <=4.1 only + // Older WebKit doesn't clone checked state correctly in fragments + support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE <=11 only + // Make sure textarea (and checkbox) defaultValue is properly cloned + div.innerHTML = "<textarea>x</textarea>"; + support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue; +} )(); + + +var + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/, + rtypenamespace = /^([^.]*)(?:\.(.+)|)/; + +function returnTrue() { + return true; +} + +function returnFalse() { + return false; +} + +// Support: IE <=9 - 11+ +// focus() and blur() are asynchronous, except when they are no-op. +// So expect focus to be synchronous when the element is already active, +// and blur to be synchronous when the element is not already active. +// (focus and blur are always synchronous in other supported browsers, +// this just defines when we can count on it). +function expectSync( elem, type ) { + return ( elem === safeActiveElement() ) === ( type === "focus" ); +} + +// Support: IE <=9 only +// Accessing document.activeElement can throw unexpectedly +// https://bugs.jquery.com/ticket/13393 +function safeActiveElement() { + try { + return document.activeElement; + } catch ( err ) { } +} + +function on( elem, types, selector, data, fn, one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + on( elem, type, selector, data, types[ type ], one ); + } + return elem; + } + + if ( data == null && fn == null ) { + + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return elem; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return elem.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + } ); +} + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + global: {}, + + add: function( elem, types, handler, data, selector ) { + + var handleObjIn, eventHandle, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.get( elem ); + + // Don't attach events to noData or text/comment nodes (but allow plain objects) + if ( !elemData ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Ensure that invalid selectors throw exceptions at attach time + // Evaluate against documentElement in case elem is a non-element node (e.g., document) + if ( selector ) { + jQuery.find.matchesSelector( documentElement, selector ); + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + if ( !( events = elemData.events ) ) { + events = elemData.events = {}; + } + if ( !( eventHandle = elemData.handle ) ) { + eventHandle = elemData.handle = function( e ) { + + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ? + jQuery.event.dispatch.apply( elem, arguments ) : undefined; + }; + } + + // Handle multiple events separated by a space + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // There *must* be a type, no attaching namespace-only handlers + if ( !type ) { + continue; + } + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend( { + type: type, + origType: origType, + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join( "." ) + }, handleObjIn ); + + // Init the event handler queue if we're the first + if ( !( handlers = events[ type ] ) ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if ( !special.setup || + special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + }, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var j, origCount, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.hasData( elem ) && dataPriv.get( elem ); + + if ( !elemData || !( events = elemData.events ) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector ? special.delegateType : special.bindType ) || type; + handlers = events[ type ] || []; + tmp = tmp[ 2 ] && + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ); + + // Remove matching events + origCount = j = handlers.length; + while ( j-- ) { + handleObj = handlers[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !tmp || tmp.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || + selector === "**" && handleObj.selector ) ) { + handlers.splice( j, 1 ); + + if ( handleObj.selector ) { + handlers.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( origCount && !handlers.length ) { + if ( !special.teardown || + special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove data and the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + dataPriv.remove( elem, "handle events" ); + } + }, + + dispatch: function( nativeEvent ) { + + // Make a writable jQuery.Event from the native event object + var event = jQuery.event.fix( nativeEvent ); + + var i, j, ret, matched, handleObj, handlerQueue, + args = new Array( arguments.length ), + handlers = ( dataPriv.get( this, "events" ) || {} )[ event.type ] || [], + special = jQuery.event.special[ event.type ] || {}; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[ 0 ] = event; + + for ( i = 1; i < arguments.length; i++ ) { + args[ i ] = arguments[ i ]; + } + + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers + handlerQueue = jQuery.event.handlers.call( this, event, handlers ); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) { + event.currentTarget = matched.elem; + + j = 0; + while ( ( handleObj = matched.handlers[ j++ ] ) && + !event.isImmediatePropagationStopped() ) { + + // If the event is namespaced, then each handler is only invoked if it is + // specially universal or its namespaces are a superset of the event's. + if ( !event.rnamespace || handleObj.namespace === false || + event.rnamespace.test( handleObj.namespace ) ) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle || + handleObj.handler ).apply( matched.elem, args ); + + if ( ret !== undefined ) { + if ( ( event.result = ret ) === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + handlers: function( event, handlers ) { + var i, handleObj, sel, matchedHandlers, matchedSelectors, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Find delegate handlers + if ( delegateCount && + + // Support: IE <=9 + // Black-hole SVG <use> instance trees (trac-13180) + cur.nodeType && + + // Support: Firefox <=42 + // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861) + // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click + // Support: IE 11 only + // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343) + !( event.type === "click" && event.button >= 1 ) ) { + + for ( ; cur !== this; cur = cur.parentNode || this ) { + + // Don't check non-elements (#13208) + // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) { + matchedHandlers = []; + matchedSelectors = {}; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + + // Don't conflict with Object.prototype properties (#13203) + sel = handleObj.selector + " "; + + if ( matchedSelectors[ sel ] === undefined ) { + matchedSelectors[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) > -1 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( matchedSelectors[ sel ] ) { + matchedHandlers.push( handleObj ); + } + } + if ( matchedHandlers.length ) { + handlerQueue.push( { elem: cur, handlers: matchedHandlers } ); + } + } + } + } + + // Add the remaining (directly-bound) handlers + cur = this; + if ( delegateCount < handlers.length ) { + handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } ); + } + + return handlerQueue; + }, + + addProp: function( name, hook ) { + Object.defineProperty( jQuery.Event.prototype, name, { + enumerable: true, + configurable: true, + + get: isFunction( hook ) ? + function() { + if ( this.originalEvent ) { + return hook( this.originalEvent ); + } + } : + function() { + if ( this.originalEvent ) { + return this.originalEvent[ name ]; + } + }, + + set: function( value ) { + Object.defineProperty( this, name, { + enumerable: true, + configurable: true, + writable: true, + value: value + } ); + } + } ); + }, + + fix: function( originalEvent ) { + return originalEvent[ jQuery.expando ] ? + originalEvent : + new jQuery.Event( originalEvent ); + }, + + special: { + load: { + + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + click: { + + // Utilize native event to ensure correct state for checkable inputs + setup: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Claim the first handler + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + // dataPriv.set( el, "click", ... ) + leverageNative( el, "click", returnTrue ); + } + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Force setup before triggering a click + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + leverageNative( el, "click" ); + } + + // Return non-false to allow normal event-path propagation + return true; + }, + + // For cross-browser consistency, suppress native .click() on links + // Also prevent it if we're currently inside a leveraged native-event stack + _default: function( event ) { + var target = event.target; + return rcheckableType.test( target.type ) && + target.click && nodeName( target, "input" ) && + dataPriv.get( target, "click" ) || + nodeName( target, "a" ); + } + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 20+ + // Firefox doesn't alert if the returnValue field is not set. + if ( event.result !== undefined && event.originalEvent ) { + event.originalEvent.returnValue = event.result; + } + } + } + } +}; + +// Ensure the presence of an event listener that handles manually-triggered +// synthetic events by interrupting progress until reinvoked in response to +// *native* events that it fires directly, ensuring that state changes have +// already occurred before other listeners are invoked. +function leverageNative( el, type, expectSync ) { + + // Missing expectSync indicates a trigger call, which must force setup through jQuery.event.add + if ( !expectSync ) { + if ( dataPriv.get( el, type ) === undefined ) { + jQuery.event.add( el, type, returnTrue ); + } + return; + } + + // Register the controller as a special universal handler for all event namespaces + dataPriv.set( el, type, false ); + jQuery.event.add( el, type, { + namespace: false, + handler: function( event ) { + var notAsync, result, + saved = dataPriv.get( this, type ); + + if ( ( event.isTrigger & 1 ) && this[ type ] ) { + + // Interrupt processing of the outer synthetic .trigger()ed event + // Saved data should be false in such cases, but might be a leftover capture object + // from an async native handler (gh-4350) + if ( !saved.length ) { + + // Store arguments for use when handling the inner native event + // There will always be at least one argument (an event object), so this array + // will not be confused with a leftover capture object. + saved = slice.call( arguments ); + dataPriv.set( this, type, saved ); + + // Trigger the native event and capture its result + // Support: IE <=9 - 11+ + // focus() and blur() are asynchronous + notAsync = expectSync( this, type ); + this[ type ](); + result = dataPriv.get( this, type ); + if ( saved !== result || notAsync ) { + dataPriv.set( this, type, false ); + } else { + result = {}; + } + if ( saved !== result ) { + + // Cancel the outer synthetic event + event.stopImmediatePropagation(); + event.preventDefault(); + return result.value; + } + + // If this is an inner synthetic event for an event with a bubbling surrogate + // (focus or blur), assume that the surrogate already propagated from triggering the + // native event and prevent that from happening again here. + // This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the + // bubbling surrogate propagates *after* the non-bubbling base), but that seems + // less bad than duplication. + } else if ( ( jQuery.event.special[ type ] || {} ).delegateType ) { + event.stopPropagation(); + } + + // If this is a native event triggered above, everything is now in order + // Fire an inner synthetic event with the original arguments + } else if ( saved.length ) { + + // ...and capture the result + dataPriv.set( this, type, { + value: jQuery.event.trigger( + + // Support: IE <=9 - 11+ + // Extend with the prototype to reset the above stopImmediatePropagation() + jQuery.extend( saved[ 0 ], jQuery.Event.prototype ), + saved.slice( 1 ), + this + ) + } ); + + // Abort handling of the native event + event.stopImmediatePropagation(); + } + } + } ); +} + +jQuery.removeEvent = function( elem, type, handle ) { + + // This "if" is needed for plain objects + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle ); + } +}; + +jQuery.Event = function( src, props ) { + + // Allow instantiation without the 'new' keyword + if ( !( this instanceof jQuery.Event ) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = src.defaultPrevented || + src.defaultPrevented === undefined && + + // Support: Android <=2.3 only + src.returnValue === false ? + returnTrue : + returnFalse; + + // Create target properties + // Support: Safari <=6 - 7 only + // Target should not be a text node (#504, #13143) + this.target = ( src.target && src.target.nodeType === 3 ) ? + src.target.parentNode : + src.target; + + this.currentTarget = src.currentTarget; + this.relatedTarget = src.relatedTarget; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || Date.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + constructor: jQuery.Event, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + isSimulated: false, + + preventDefault: function() { + var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; + + if ( e && !this.isSimulated ) { + e.preventDefault(); + } + }, + stopPropagation: function() { + var e = this.originalEvent; + + this.isPropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function() { + var e = this.originalEvent; + + this.isImmediatePropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopImmediatePropagation(); + } + + this.stopPropagation(); + } +}; + +// Includes all common event props including KeyEvent and MouseEvent specific props +jQuery.each( { + altKey: true, + bubbles: true, + cancelable: true, + changedTouches: true, + ctrlKey: true, + detail: true, + eventPhase: true, + metaKey: true, + pageX: true, + pageY: true, + shiftKey: true, + view: true, + "char": true, + code: true, + charCode: true, + key: true, + keyCode: true, + button: true, + buttons: true, + clientX: true, + clientY: true, + offsetX: true, + offsetY: true, + pointerId: true, + pointerType: true, + screenX: true, + screenY: true, + targetTouches: true, + toElement: true, + touches: true, + + which: function( event ) { + var button = event.button; + + // Add which for key events + if ( event.which == null && rkeyEvent.test( event.type ) ) { + return event.charCode != null ? event.charCode : event.keyCode; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + if ( !event.which && button !== undefined && rmouseEvent.test( event.type ) ) { + if ( button & 1 ) { + return 1; + } + + if ( button & 2 ) { + return 3; + } + + if ( button & 4 ) { + return 2; + } + + return 0; + } + + return event.which; + } +}, jQuery.event.addProp ); + +jQuery.each( { focus: "focusin", blur: "focusout" }, function( type, delegateType ) { + jQuery.event.special[ type ] = { + + // Utilize native event if possible so blur/focus sequence is correct + setup: function() { + + // Claim the first handler + // dataPriv.set( this, "focus", ... ) + // dataPriv.set( this, "blur", ... ) + leverageNative( this, type, expectSync ); + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function() { + + // Force setup before trigger + leverageNative( this, type ); + + // Return non-false to allow normal event-path propagation + return true; + }, + + delegateType: delegateType + }; +} ); + +// Create mouseenter/leave events using mouseover/out and event-time checks +// so that event delegation works in jQuery. +// Do the same for pointerenter/pointerleave and pointerover/pointerout +// +// Support: Safari 7 only +// Safari sends mouseenter too often; see: +// https://bugs.chromium.org/p/chromium/issues/detail?id=470258 +// for the description of the bug (it existed in older Chrome versions as well). +jQuery.each( { + mouseenter: "mouseover", + mouseleave: "mouseout", + pointerenter: "pointerover", + pointerleave: "pointerout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mouseenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +} ); + +jQuery.fn.extend( { + + on: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn ); + }, + one: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? + handleObj.origType + "." + handleObj.namespace : + handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each( function() { + jQuery.event.remove( this, types, fn, selector ); + } ); + } +} ); + + +var + + /* eslint-disable max-len */ + + // See https://github.com/eslint/eslint/issues/3229 + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi, + + /* eslint-enable */ + + // Support: IE <=10 - 11, Edge 12 - 13 only + // In IE/Edge using regex groups here causes severe slowdowns. + // See https://connect.microsoft.com/IE/feedback/details/1736512/ + rnoInnerhtml = /<script|<style|<link/i, + + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g; + +// Prefer a tbody over its parent table for containing new rows +function manipulationTarget( elem, content ) { + if ( nodeName( elem, "table" ) && + nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) { + + return jQuery( elem ).children( "tbody" )[ 0 ] || elem; + } + + return elem; +} + +// Replace/restore the type attribute of script elements for safe DOM manipulation +function disableScript( elem ) { + elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type; + return elem; +} +function restoreScript( elem ) { + if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) { + elem.type = elem.type.slice( 5 ); + } else { + elem.removeAttribute( "type" ); + } + + return elem; +} + +function cloneCopyEvent( src, dest ) { + var i, l, type, pdataOld, pdataCur, udataOld, udataCur, events; + + if ( dest.nodeType !== 1 ) { + return; + } + + // 1. Copy private data: events, handlers, etc. + if ( dataPriv.hasData( src ) ) { + pdataOld = dataPriv.access( src ); + pdataCur = dataPriv.set( dest, pdataOld ); + events = pdataOld.events; + + if ( events ) { + delete pdataCur.handle; + pdataCur.events = {}; + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + } + + // 2. Copy user data + if ( dataUser.hasData( src ) ) { + udataOld = dataUser.access( src ); + udataCur = jQuery.extend( {}, udataOld ); + + dataUser.set( dest, udataCur ); + } +} + +// Fix IE bugs, see support tests +function fixInput( src, dest ) { + var nodeName = dest.nodeName.toLowerCase(); + + // Fails to persist the checked state of a cloned checkbox or radio button. + if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + dest.checked = src.checked; + + // Fails to return the selected option to the default selected state when cloning options + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } +} + +function domManip( collection, args, callback, ignored ) { + + // Flatten any nested arrays + args = concat.apply( [], args ); + + var fragment, first, scripts, hasScripts, node, doc, + i = 0, + l = collection.length, + iNoClone = l - 1, + value = args[ 0 ], + valueIsFunction = isFunction( value ); + + // We can't cloneNode fragments that contain checked, in WebKit + if ( valueIsFunction || + ( l > 1 && typeof value === "string" && + !support.checkClone && rchecked.test( value ) ) ) { + return collection.each( function( index ) { + var self = collection.eq( index ); + if ( valueIsFunction ) { + args[ 0 ] = value.call( this, index, self.html() ); + } + domManip( self, args, callback, ignored ); + } ); + } + + if ( l ) { + fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored ); + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + // Require either new content or an interest in ignored elements to invoke the callback + if ( first || ignored ) { + scripts = jQuery.map( getAll( fragment, "script" ), disableScript ); + hasScripts = scripts.length; + + // Use the original fragment for the last item + // instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + for ( ; i < l; i++ ) { + node = fragment; + + if ( i !== iNoClone ) { + node = jQuery.clone( node, true, true ); + + // Keep references to cloned scripts for later restoration + if ( hasScripts ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( scripts, getAll( node, "script" ) ); + } + } + + callback.call( collection[ i ], node, i ); + } + + if ( hasScripts ) { + doc = scripts[ scripts.length - 1 ].ownerDocument; + + // Reenable scripts + jQuery.map( scripts, restoreScript ); + + // Evaluate executable scripts on first document insertion + for ( i = 0; i < hasScripts; i++ ) { + node = scripts[ i ]; + if ( rscriptType.test( node.type || "" ) && + !dataPriv.access( node, "globalEval" ) && + jQuery.contains( doc, node ) ) { + + if ( node.src && ( node.type || "" ).toLowerCase() !== "module" ) { + + // Optional AJAX dependency, but won't run scripts if not present + if ( jQuery._evalUrl && !node.noModule ) { + jQuery._evalUrl( node.src, { + nonce: node.nonce || node.getAttribute( "nonce" ) + } ); + } + } else { + DOMEval( node.textContent.replace( rcleanScript, "" ), node, doc ); + } + } + } + } + } + } + + return collection; +} + +function remove( elem, selector, keepData ) { + var node, + nodes = selector ? jQuery.filter( selector, elem ) : elem, + i = 0; + + for ( ; ( node = nodes[ i ] ) != null; i++ ) { + if ( !keepData && node.nodeType === 1 ) { + jQuery.cleanData( getAll( node ) ); + } + + if ( node.parentNode ) { + if ( keepData && isAttached( node ) ) { + setGlobalEval( getAll( node, "script" ) ); + } + node.parentNode.removeChild( node ); + } + } + + return elem; +} + +jQuery.extend( { + htmlPrefilter: function( html ) { + return html.replace( rxhtmlTag, "<$1></$2>" ); + }, + + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var i, l, srcElements, destElements, + clone = elem.cloneNode( true ), + inPage = isAttached( elem ); + + // Fix IE cloning issues + if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) && + !jQuery.isXMLDoc( elem ) ) { + + // We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2 + destElements = getAll( clone ); + srcElements = getAll( elem ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + fixInput( srcElements[ i ], destElements[ i ] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + if ( deepDataAndEvents ) { + srcElements = srcElements || getAll( elem ); + destElements = destElements || getAll( clone ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + cloneCopyEvent( srcElements[ i ], destElements[ i ] ); + } + } else { + cloneCopyEvent( elem, clone ); + } + } + + // Preserve script evaluation history + destElements = getAll( clone, "script" ); + if ( destElements.length > 0 ) { + setGlobalEval( destElements, !inPage && getAll( elem, "script" ) ); + } + + // Return the cloned set + return clone; + }, + + cleanData: function( elems ) { + var data, elem, type, + special = jQuery.event.special, + i = 0; + + for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) { + if ( acceptData( elem ) ) { + if ( ( data = elem[ dataPriv.expando ] ) ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataPriv.expando ] = undefined; + } + if ( elem[ dataUser.expando ] ) { + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataUser.expando ] = undefined; + } + } + } + } +} ); + +jQuery.fn.extend( { + detach: function( selector ) { + return remove( this, selector, true ); + }, + + remove: function( selector ) { + return remove( this, selector ); + }, + + text: function( value ) { + return access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().each( function() { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + this.textContent = value; + } + } ); + }, null, value, arguments.length ); + }, + + append: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.appendChild( elem ); + } + } ); + }, + + prepend: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.insertBefore( elem, target.firstChild ); + } + } ); + }, + + before: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this ); + } + } ); + }, + + after: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + } + } ); + }, + + empty: function() { + var elem, + i = 0; + + for ( ; ( elem = this[ i ] ) != null; i++ ) { + if ( elem.nodeType === 1 ) { + + // Prevent memory leaks + jQuery.cleanData( getAll( elem, false ) ); + + // Remove any remaining nodes + elem.textContent = ""; + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function() { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + } ); + }, + + html: function( value ) { + return access( this, function( value ) { + var elem = this[ 0 ] || {}, + i = 0, + l = this.length; + + if ( value === undefined && elem.nodeType === 1 ) { + return elem.innerHTML; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + !wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) { + + value = jQuery.htmlPrefilter( value ); + + try { + for ( ; i < l; i++ ) { + elem = this[ i ] || {}; + + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch ( e ) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function() { + var ignored = []; + + // Make the changes, replacing each non-ignored context element with the new content + return domManip( this, arguments, function( elem ) { + var parent = this.parentNode; + + if ( jQuery.inArray( this, ignored ) < 0 ) { + jQuery.cleanData( getAll( this ) ); + if ( parent ) { + parent.replaceChild( elem, this ); + } + } + + // Force callback invocation + }, ignored ); + } +} ); + +jQuery.each( { + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + ret = [], + insert = jQuery( selector ), + last = insert.length - 1, + i = 0; + + for ( ; i <= last; i++ ) { + elems = i === last ? this : this.clone( true ); + jQuery( insert[ i ] )[ original ]( elems ); + + // Support: Android <=4.0 only, PhantomJS 1 only + // .get() because push.apply(_, arraylike) throws on ancient WebKit + push.apply( ret, elems.get() ); + } + + return this.pushStack( ret ); + }; +} ); +var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" ); + +var getStyles = function( elem ) { + + // Support: IE <=11 only, Firefox <=30 (#15098, #14150) + // IE throws on elements created in popups + // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" + var view = elem.ownerDocument.defaultView; + + if ( !view || !view.opener ) { + view = window; + } + + return view.getComputedStyle( elem ); + }; + +var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" ); + + + +( function() { + + // Executing both pixelPosition & boxSizingReliable tests require only one layout + // so they're executed at the same time to save the second computation. + function computeStyleTests() { + + // This is a singleton, we need to execute it only once + if ( !div ) { + return; + } + + container.style.cssText = "position:absolute;left:-11111px;width:60px;" + + "margin-top:1px;padding:0;border:0"; + div.style.cssText = + "position:relative;display:block;box-sizing:border-box;overflow:scroll;" + + "margin:auto;border:1px;padding:1px;" + + "width:60%;top:1%"; + documentElement.appendChild( container ).appendChild( div ); + + var divStyle = window.getComputedStyle( div ); + pixelPositionVal = divStyle.top !== "1%"; + + // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44 + reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12; + + // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3 + // Some styles come back with percentage values, even though they shouldn't + div.style.right = "60%"; + pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36; + + // Support: IE 9 - 11 only + // Detect misreporting of content dimensions for box-sizing:border-box elements + boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36; + + // Support: IE 9 only + // Detect overflow:scroll screwiness (gh-3699) + // Support: Chrome <=64 + // Don't get tricked when zoom affects offsetWidth (gh-4029) + div.style.position = "absolute"; + scrollboxSizeVal = roundPixelMeasures( div.offsetWidth / 3 ) === 12; + + documentElement.removeChild( container ); + + // Nullify the div so it wouldn't be stored in the memory and + // it will also be a sign that checks already performed + div = null; + } + + function roundPixelMeasures( measure ) { + return Math.round( parseFloat( measure ) ); + } + + var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, + reliableMarginLeftVal, + container = document.createElement( "div" ), + div = document.createElement( "div" ); + + // Finish early in limited (non-browser) environments + if ( !div.style ) { + return; + } + + // Support: IE <=9 - 11 only + // Style of cloned element affects source element cloned (#8908) + div.style.backgroundClip = "content-box"; + div.cloneNode( true ).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; + + jQuery.extend( support, { + boxSizingReliable: function() { + computeStyleTests(); + return boxSizingReliableVal; + }, + pixelBoxStyles: function() { + computeStyleTests(); + return pixelBoxStylesVal; + }, + pixelPosition: function() { + computeStyleTests(); + return pixelPositionVal; + }, + reliableMarginLeft: function() { + computeStyleTests(); + return reliableMarginLeftVal; + }, + scrollboxSize: function() { + computeStyleTests(); + return scrollboxSizeVal; + } + } ); +} )(); + + +function curCSS( elem, name, computed ) { + var width, minWidth, maxWidth, ret, + + // Support: Firefox 51+ + // Retrieving style before computed somehow + // fixes an issue with getting wrong values + // on detached elements + style = elem.style; + + computed = computed || getStyles( elem ); + + // getPropertyValue is needed for: + // .css('filter') (IE 9 only, #12537) + // .css('--customProperty) (#3144) + if ( computed ) { + ret = computed.getPropertyValue( name ) || computed[ name ]; + + if ( ret === "" && !isAttached( elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Android Browser returns percentage for some values, + // but width seems to be reliably pixels. + // This is against the CSSOM draft spec: + // https://drafts.csswg.org/cssom/#resolved-values + if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) { + + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret !== undefined ? + + // Support: IE <=9 - 11 only + // IE returns zIndex value as an integer. + ret + "" : + ret; +} + + +function addGetHookIf( conditionFn, hookFn ) { + + // Define the hook, we'll check on the first run if it's really needed. + return { + get: function() { + if ( conditionFn() ) { + + // Hook not needed (or it's not possible to use it due + // to missing dependency), remove it. + delete this.get; + return; + } + + // Hook needed; redefine it so that the support test is not executed again. + return ( this.get = hookFn ).apply( this, arguments ); + } + }; +} + + +var cssPrefixes = [ "Webkit", "Moz", "ms" ], + emptyStyle = document.createElement( "div" ).style, + vendorProps = {}; + +// Return a vendor-prefixed property or undefined +function vendorPropName( name ) { + + // Check for vendor prefixed names + var capName = name[ 0 ].toUpperCase() + name.slice( 1 ), + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in emptyStyle ) { + return name; + } + } +} + +// Return a potentially-mapped jQuery.cssProps or vendor prefixed property +function finalPropName( name ) { + var final = jQuery.cssProps[ name ] || vendorProps[ name ]; + + if ( final ) { + return final; + } + if ( name in emptyStyle ) { + return name; + } + return vendorProps[ name ] = vendorPropName( name ) || name; +} + + +var + + // Swappable if display is none or starts with table + // except "table", "table-cell", or "table-caption" + // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rcustomProp = /^--/, + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: "0", + fontWeight: "400" + }; + +function setPositiveNumber( elem, value, subtract ) { + + // Any relative (+/-) values have already been + // normalized at this point + var matches = rcssNum.exec( value ); + return matches ? + + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) : + value; +} + +function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) { + var i = dimension === "width" ? 1 : 0, + extra = 0, + delta = 0; + + // Adjustment may not be necessary + if ( box === ( isBorderBox ? "border" : "content" ) ) { + return 0; + } + + for ( ; i < 4; i += 2 ) { + + // Both box models exclude margin + if ( box === "margin" ) { + delta += jQuery.css( elem, box + cssExpand[ i ], true, styles ); + } + + // If we get here with a content-box, we're seeking "padding" or "border" or "margin" + if ( !isBorderBox ) { + + // Add padding + delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + + // For "border" or "margin", add border + if ( box !== "padding" ) { + delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + + // But still keep track of it otherwise + } else { + extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + + // If we get here with a border-box (content + padding + border), we're seeking "content" or + // "padding" or "margin" + } else { + + // For "content", subtract padding + if ( box === "content" ) { + delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + } + + // For "content" or "padding", subtract border + if ( box !== "margin" ) { + delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } + } + + // Account for positive content-box scroll gutter when requested by providing computedVal + if ( !isBorderBox && computedVal >= 0 ) { + + // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border + // Assuming integer scroll gutter, subtract the rest and round down + delta += Math.max( 0, Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + computedVal - + delta - + extra - + 0.5 + + // If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter + // Use an explicit zero to avoid NaN (gh-3964) + ) ) || 0; + } + + return delta; +} + +function getWidthOrHeight( elem, dimension, extra ) { + + // Start with computed style + var styles = getStyles( elem ), + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322). + // Fake content-box until we know it's needed to know the true value. + boxSizingNeeded = !support.boxSizingReliable() || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + valueIsBorderBox = isBorderBox, + + val = curCSS( elem, dimension, styles ), + offsetProp = "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ); + + // Support: Firefox <=54 + // Return a confounding non-pixel value or feign ignorance, as appropriate. + if ( rnumnonpx.test( val ) ) { + if ( !extra ) { + return val; + } + val = "auto"; + } + + + // Fall back to offsetWidth/offsetHeight when value is "auto" + // This happens for inline elements with no explicit setting (gh-3571) + // Support: Android <=4.1 - 4.3 only + // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602) + // Support: IE 9-11 only + // Also use offsetWidth/offsetHeight for when box sizing is unreliable + // We use getClientRects() to check for hidden/disconnected. + // In those cases, the computed value can be trusted to be border-box + if ( ( !support.boxSizingReliable() && isBorderBox || + val === "auto" || + !parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) && + elem.getClientRects().length ) { + + isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box"; + + // Where available, offsetWidth/offsetHeight approximate border box dimensions. + // Where not available (e.g., SVG), assume unreliable box-sizing and interpret the + // retrieved value as a content box dimension. + valueIsBorderBox = offsetProp in elem; + if ( valueIsBorderBox ) { + val = elem[ offsetProp ]; + } + } + + // Normalize "" and auto + val = parseFloat( val ) || 0; + + // Adjust for the element's box model + return ( val + + boxModelAdjustment( + elem, + dimension, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox, + styles, + + // Provide the current computed size to request scroll gutter calculation (gh-3589) + val + ) + ) + "px"; +} + +jQuery.extend( { + + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + } + } + } + }, + + // Don't automatically add "px" to these possibly-unitless properties + cssNumber: { + "animationIterationCount": true, + "columnCount": true, + "fillOpacity": true, + "flexGrow": true, + "flexShrink": true, + "fontWeight": true, + "gridArea": true, + "gridColumn": true, + "gridColumnEnd": true, + "gridColumnStart": true, + "gridRow": true, + "gridRowEnd": true, + "gridRowStart": true, + "lineHeight": true, + "opacity": true, + "order": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: {}, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ), + style = elem.style; + + // Make sure that we're working with the right name. We don't + // want to query the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Gets hook for the prefixed version, then unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // Convert "+=" or "-=" to relative numbers (#7345) + if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) { + value = adjustCSS( elem, name, ret ); + + // Fixes bug #9237 + type = "number"; + } + + // Make sure that null and NaN values aren't set (#7116) + if ( value == null || value !== value ) { + return; + } + + // If a number was passed in, add the unit (except for certain CSS properties) + // The isCustomProp check can be removed in jQuery 4.0 when we only auto-append + // "px" to a few hardcoded values. + if ( type === "number" && !isCustomProp ) { + value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" ); + } + + // background-* props affect original clone's values + if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) { + style[ name ] = "inherit"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !( "set" in hooks ) || + ( value = hooks.set( elem, value, extra ) ) !== undefined ) { + + if ( isCustomProp ) { + style.setProperty( name, value ); + } else { + style[ name ] = value; + } + } + + } else { + + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && + ( ret = hooks.get( elem, false, extra ) ) !== undefined ) { + + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra, styles ) { + var val, num, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ); + + // Make sure that we're working with the right name. We don't + // want to modify the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Try prefixed name followed by the unprefixed name + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name, styles ); + } + + // Convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Make numeric if forced or a qualifier was provided and val looks numeric + if ( extra === "" || extra ) { + num = parseFloat( val ); + return extra === true || isFinite( num ) ? num || 0 : val; + } + + return val; + } +} ); + +jQuery.each( [ "height", "width" ], function( i, dimension ) { + jQuery.cssHooks[ dimension ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + + // Certain elements can have dimension info if we invisibly show them + // but it must have a current display style that would benefit + return rdisplayswap.test( jQuery.css( elem, "display" ) ) && + + // Support: Safari 8+ + // Table columns in Safari have non-zero offsetWidth & zero + // getBoundingClientRect().width unless display is changed. + // Support: IE <=11 only + // Running getBoundingClientRect on a disconnected node + // in IE throws an error. + ( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ? + swap( elem, cssShow, function() { + return getWidthOrHeight( elem, dimension, extra ); + } ) : + getWidthOrHeight( elem, dimension, extra ); + } + }, + + set: function( elem, value, extra ) { + var matches, + styles = getStyles( elem ), + + // Only read styles.position if the test has a chance to fail + // to avoid forcing a reflow. + scrollboxSizeBuggy = !support.scrollboxSize() && + styles.position === "absolute", + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991) + boxSizingNeeded = scrollboxSizeBuggy || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + subtract = extra ? + boxModelAdjustment( + elem, + dimension, + extra, + isBorderBox, + styles + ) : + 0; + + // Account for unreliable border-box dimensions by comparing offset* to computed and + // faking a content-box to get border and padding (gh-3699) + if ( isBorderBox && scrollboxSizeBuggy ) { + subtract -= Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + parseFloat( styles[ dimension ] ) - + boxModelAdjustment( elem, dimension, "border", false, styles ) - + 0.5 + ); + } + + // Convert to pixels if value adjustment is needed + if ( subtract && ( matches = rcssNum.exec( value ) ) && + ( matches[ 3 ] || "px" ) !== "px" ) { + + elem.style[ dimension ] = value; + value = jQuery.css( elem, dimension ); + } + + return setPositiveNumber( elem, value, subtract ); + } + }; +} ); + +jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft, + function( elem, computed ) { + if ( computed ) { + return ( parseFloat( curCSS( elem, "marginLeft" ) ) || + elem.getBoundingClientRect().left - + swap( elem, { marginLeft: 0 }, function() { + return elem.getBoundingClientRect().left; + } ) + ) + "px"; + } + } +); + +// These hooks are used by animate to expand properties +jQuery.each( { + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i = 0, + expanded = {}, + + // Assumes a single number if not a string + parts = typeof value === "string" ? value.split( " " ) : [ value ]; + + for ( ; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( prefix !== "margin" ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +} ); + +jQuery.fn.extend( { + css: function( name, value ) { + return access( this, function( elem, name, value ) { + var styles, len, + map = {}, + i = 0; + + if ( Array.isArray( name ) ) { + styles = getStyles( elem ); + len = name.length; + + for ( ; i < len; i++ ) { + map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles ); + } + + return map; + } + + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + } +} ); + + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || jQuery.easing._default; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + // Use a property on the element directly when it is not a DOM element, + // or when there is no matching style property that exists. + if ( tween.elem.nodeType !== 1 || + tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) { + return tween.elem[ tween.prop ]; + } + + // Passing an empty string as a 3rd parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails. + // Simple values such as "10px" are parsed to Float; + // complex values such as "rotate(1rad)" are returned as-is. + result = jQuery.css( tween.elem, tween.prop, "" ); + + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + + // Use step hook for back compat. + // Use cssHook if its there. + // Use .style if available and use plain properties where available. + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.nodeType === 1 && ( + jQuery.cssHooks[ tween.prop ] || + tween.elem.style[ finalPropName( tween.prop ) ] != null ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Support: IE <=9 only +// Panic based approach to setting things on disconnected nodes +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p * Math.PI ) / 2; + }, + _default: "swing" +}; + +jQuery.fx = Tween.prototype.init; + +// Back compat <1.8 extension point +jQuery.fx.step = {}; + + + + +var + fxNow, inProgress, + rfxtypes = /^(?:toggle|show|hide)$/, + rrun = /queueHooks$/; + +function schedule() { + if ( inProgress ) { + if ( document.hidden === false && window.requestAnimationFrame ) { + window.requestAnimationFrame( schedule ); + } else { + window.setTimeout( schedule, jQuery.fx.interval ); + } + + jQuery.fx.tick(); + } +} + +// Animations created synchronously will run synchronously +function createFxNow() { + window.setTimeout( function() { + fxNow = undefined; + } ); + return ( fxNow = Date.now() ); +} + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + i = 0, + attrs = { height: type }; + + // If we include width, step value is 1 to do all cssExpand values, + // otherwise step value is 2 to skip over Left and Right + includeWidth = includeWidth ? 1 : 0; + for ( ; i < 4; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +function createTween( value, prop, animation ) { + var tween, + collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) { + + // We're done with this property + return tween; + } + } +} + +function defaultPrefilter( elem, props, opts ) { + var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, + isBox = "width" in props || "height" in props, + anim = this, + orig = {}, + style = elem.style, + hidden = elem.nodeType && isHiddenWithinTree( elem ), + dataShow = dataPriv.get( elem, "fxshow" ); + + // Queue-skipping animations hijack the fx hooks + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always( function() { + + // Ensure the complete handler is called before this completes + anim.always( function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + } ); + } ); + } + + // Detect show/hide animations + for ( prop in props ) { + value = props[ prop ]; + if ( rfxtypes.test( value ) ) { + delete props[ prop ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + + // Pretend to be hidden if this is a "show" and + // there is still data from a stopped show/hide + if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) { + hidden = true; + + // Ignore all other no-op show/hide data + } else { + continue; + } + } + orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop ); + } + } + + // Bail out if this is a no-op like .hide().hide() + propTween = !jQuery.isEmptyObject( props ); + if ( !propTween && jQuery.isEmptyObject( orig ) ) { + return; + } + + // Restrict "overflow" and "display" styles during box animations + if ( isBox && elem.nodeType === 1 ) { + + // Support: IE <=9 - 11, Edge 12 - 15 + // Record all 3 overflow attributes because IE does not infer the shorthand + // from identically-valued overflowX and overflowY and Edge just mirrors + // the overflowX value there. + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Identify a display type, preferring old show/hide data over the CSS cascade + restoreDisplay = dataShow && dataShow.display; + if ( restoreDisplay == null ) { + restoreDisplay = dataPriv.get( elem, "display" ); + } + display = jQuery.css( elem, "display" ); + if ( display === "none" ) { + if ( restoreDisplay ) { + display = restoreDisplay; + } else { + + // Get nonempty value(s) by temporarily forcing visibility + showHide( [ elem ], true ); + restoreDisplay = elem.style.display || restoreDisplay; + display = jQuery.css( elem, "display" ); + showHide( [ elem ] ); + } + } + + // Animate inline elements as inline-block + if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) { + if ( jQuery.css( elem, "float" ) === "none" ) { + + // Restore the original display value at the end of pure show/hide animations + if ( !propTween ) { + anim.done( function() { + style.display = restoreDisplay; + } ); + if ( restoreDisplay == null ) { + display = style.display; + restoreDisplay = display === "none" ? "" : display; + } + } + style.display = "inline-block"; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + anim.always( function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + } ); + } + + // Implement show/hide animations + propTween = false; + for ( prop in orig ) { + + // General show/hide setup for this element animation + if ( !propTween ) { + if ( dataShow ) { + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + } else { + dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } ); + } + + // Store hidden/visible for toggle so `.stop().toggle()` "reverses" + if ( toggle ) { + dataShow.hidden = !hidden; + } + + // Show elements before animating them + if ( hidden ) { + showHide( [ elem ], true ); + } + + /* eslint-disable no-loop-func */ + + anim.done( function() { + + /* eslint-enable no-loop-func */ + + // The final step of a "hide" animation is actually hiding the element + if ( !hidden ) { + showHide( [ elem ] ); + } + dataPriv.remove( elem, "fxshow" ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + } ); + } + + // Per-property setup + propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim ); + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = propTween.start; + if ( hidden ) { + propTween.end = propTween.start; + propTween.start = 0; + } + } + } +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( Array.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // Not quite $.extend, this won't overwrite existing keys. + // Reusing 'index' because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +function Animation( elem, properties, options ) { + var result, + stopped, + index = 0, + length = Animation.prefilters.length, + deferred = jQuery.Deferred().always( function() { + + // Don't match elem in the :animated selector + delete tick.elem; + } ), + tick = function() { + if ( stopped ) { + return false; + } + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + + // Support: Android 2.3 only + // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ] ); + + // If there's more to do, yield + if ( percent < 1 && length ) { + return remaining; + } + + // If this was an empty animation, synthesize a final progress notification + if ( !length ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + } + + // Resolve the animation and report its conclusion + deferred.resolveWith( elem, [ animation ] ); + return false; + }, + animation = deferred.promise( { + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { + specialEasing: {}, + easing: jQuery.easing._default + }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + + // If we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + if ( stopped ) { + return this; + } + stopped = true; + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // Resolve when we played the last frame; otherwise, reject + if ( gotoEnd ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + } ), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length; index++ ) { + result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + if ( isFunction( result.stop ) ) { + jQuery._queueHooks( animation.elem, animation.opts.queue ).stop = + result.stop.bind( result ); + } + return result; + } + } + + jQuery.map( props, createTween, animation ); + + if ( isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + // Attach callbacks from options + animation + .progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); + + jQuery.fx.timer( + jQuery.extend( tick, { + elem: elem, + anim: animation, + queue: animation.opts.queue + } ) + ); + + return animation; +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweeners: { + "*": [ function( prop, value ) { + var tween = this.createTween( prop, value ); + adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween ); + return tween; + } ] + }, + + tweener: function( props, callback ) { + if ( isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.match( rnothtmlwhite ); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length; index++ ) { + prop = props[ index ]; + Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || []; + Animation.tweeners[ prop ].unshift( callback ); + } + }, + + prefilters: [ defaultPrefilter ], + + prefilter: function( callback, prepend ) { + if ( prepend ) { + Animation.prefilters.unshift( callback ); + } else { + Animation.prefilters.push( callback ); + } + } +} ); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !isFunction( easing ) && easing + }; + + // Go to the end state if fx are off + if ( jQuery.fx.off ) { + opt.duration = 0; + + } else { + if ( typeof opt.duration !== "number" ) { + if ( opt.duration in jQuery.fx.speeds ) { + opt.duration = jQuery.fx.speeds[ opt.duration ]; + + } else { + opt.duration = jQuery.fx.speeds._default; + } + } + } + + // Normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.fn.extend( { + fadeTo: function( speed, to, easing, callback ) { + + // Show any hidden elements after setting opacity to 0 + return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show() + + // Animate to the value specified + .end().animate( { opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations, or finishing resolves immediately + if ( empty || dataPriv.get( this, "finish" ) ) { + anim.stop( true ); + } + }; + doAnimation.finish = doAnimation; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue && type !== false ) { + this.queue( type || "fx", [] ); + } + + return this.each( function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = dataPriv.get( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && + ( type == null || timers[ index ].queue === type ) ) { + + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // Start the next in the queue if the last step wasn't forced. + // Timers currently will call their complete callbacks, which + // will dequeue but only if they were gotoEnd. + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + } ); + }, + finish: function( type ) { + if ( type !== false ) { + type = type || "fx"; + } + return this.each( function() { + var index, + data = dataPriv.get( this ), + queue = data[ type + "queue" ], + hooks = data[ type + "queueHooks" ], + timers = jQuery.timers, + length = queue ? queue.length : 0; + + // Enable finishing flag on private data + data.finish = true; + + // Empty the queue first + jQuery.queue( this, type, [] ); + + if ( hooks && hooks.stop ) { + hooks.stop.call( this, true ); + } + + // Look for any active animations, and finish them + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && timers[ index ].queue === type ) { + timers[ index ].anim.stop( true ); + timers.splice( index, 1 ); + } + } + + // Look for any animations in the old queue and finish them + for ( index = 0; index < length; index++ ) { + if ( queue[ index ] && queue[ index ].finish ) { + queue[ index ].finish.call( this ); + } + } + + // Turn off finishing flag + delete data.finish; + } ); + } +} ); + +jQuery.each( [ "toggle", "show", "hide" ], function( i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +} ); + +// Generate shortcuts for custom animations +jQuery.each( { + slideDown: genFx( "show" ), + slideUp: genFx( "hide" ), + slideToggle: genFx( "toggle" ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +} ); + +jQuery.timers = []; +jQuery.fx.tick = function() { + var timer, + i = 0, + timers = jQuery.timers; + + fxNow = Date.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + + // Run the timer and safely remove it when done (allowing for external removal) + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; + +jQuery.fx.timer = function( timer ) { + jQuery.timers.push( timer ); + jQuery.fx.start(); +}; + +jQuery.fx.interval = 13; +jQuery.fx.start = function() { + if ( inProgress ) { + return; + } + + inProgress = true; + schedule(); +}; + +jQuery.fx.stop = function() { + inProgress = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + + // Default speed + _default: 400 +}; + + +// Based off of the plugin by Clint Helfers, with permission. +// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/ +jQuery.fn.delay = function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = window.setTimeout( next, time ); + hooks.stop = function() { + window.clearTimeout( timeout ); + }; + } ); +}; + + +( function() { + var input = document.createElement( "input" ), + select = document.createElement( "select" ), + opt = select.appendChild( document.createElement( "option" ) ); + + input.type = "checkbox"; + + // Support: Android <=4.3 only + // Default value for a checkbox should be "on" + support.checkOn = input.value !== ""; + + // Support: IE <=11 only + // Must access selectedIndex to make default options select + support.optSelected = opt.selected; + + // Support: IE <=11 only + // An input loses its value after becoming a radio + input = document.createElement( "input" ); + input.value = "t"; + input.type = "radio"; + support.radioValue = input.value === "t"; +} )(); + + +var boolHook, + attrHandle = jQuery.expr.attrHandle; + +jQuery.fn.extend( { + attr: function( name, value ) { + return access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each( function() { + jQuery.removeAttr( this, name ); + } ); + } +} ); + +jQuery.extend( { + attr: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set attributes on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + // Attribute hooks are determined by the lowercase version + // Grab necessary hook if one is defined + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + hooks = jQuery.attrHooks[ name.toLowerCase() ] || + ( jQuery.expr.match.bool.test( name ) ? boolHook : undefined ); + } + + if ( value !== undefined ) { + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + } + + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + elem.setAttribute( name, value + "" ); + return value; + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + ret = jQuery.find.attr( elem, name ); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? undefined : ret; + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !support.radioValue && value === "radio" && + nodeName( elem, "input" ) ) { + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + removeAttr: function( elem, value ) { + var name, + i = 0, + + // Attribute names can contain non-HTML whitespace characters + // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2 + attrNames = value && value.match( rnothtmlwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( ( name = attrNames[ i++ ] ) ) { + elem.removeAttribute( name ); + } + } + } +} ); + +// Hooks for boolean attributes +boolHook = { + set: function( elem, value, name ) { + if ( value === false ) { + + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + elem.setAttribute( name, name ); + } + return name; + } +}; + +jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( i, name ) { + var getter = attrHandle[ name ] || jQuery.find.attr; + + attrHandle[ name ] = function( elem, name, isXML ) { + var ret, handle, + lowercaseName = name.toLowerCase(); + + if ( !isXML ) { + + // Avoid an infinite loop by temporarily removing this function from the getter + handle = attrHandle[ lowercaseName ]; + attrHandle[ lowercaseName ] = ret; + ret = getter( elem, name, isXML ) != null ? + lowercaseName : + null; + attrHandle[ lowercaseName ] = handle; + } + return ret; + }; +} ); + + + + +var rfocusable = /^(?:input|select|textarea|button)$/i, + rclickable = /^(?:a|area)$/i; + +jQuery.fn.extend( { + prop: function( name, value ) { + return access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + return this.each( function() { + delete this[ jQuery.propFix[ name ] || name ]; + } ); + } +} ); + +jQuery.extend( { + prop: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set properties on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + return ( elem[ name ] = value ); + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + return elem[ name ]; + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + + // Support: IE <=9 - 11 only + // elem.tabIndex doesn't always return the + // correct value when it hasn't been explicitly set + // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + // Use proper attribute retrieval(#12072) + var tabindex = jQuery.find.attr( elem, "tabindex" ); + + if ( tabindex ) { + return parseInt( tabindex, 10 ); + } + + if ( + rfocusable.test( elem.nodeName ) || + rclickable.test( elem.nodeName ) && + elem.href + ) { + return 0; + } + + return -1; + } + } + }, + + propFix: { + "for": "htmlFor", + "class": "className" + } +} ); + +// Support: IE <=11 only +// Accessing the selectedIndex property +// forces the browser to respect setting selected +// on the option +// The getter ensures a default option is selected +// when in an optgroup +// eslint rule "no-unused-expressions" is disabled for this code +// since it considers such accessions noop +if ( !support.optSelected ) { + jQuery.propHooks.selected = { + get: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent && parent.parentNode ) { + parent.parentNode.selectedIndex; + } + return null; + }, + set: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }; +} + +jQuery.each( [ + "tabIndex", + "readOnly", + "maxLength", + "cellSpacing", + "cellPadding", + "rowSpan", + "colSpan", + "useMap", + "frameBorder", + "contentEditable" +], function() { + jQuery.propFix[ this.toLowerCase() ] = this; +} ); + + + + + // Strip and collapse whitespace according to HTML spec + // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace + function stripAndCollapse( value ) { + var tokens = value.match( rnothtmlwhite ) || []; + return tokens.join( " " ); + } + + +function getClass( elem ) { + return elem.getAttribute && elem.getAttribute( "class" ) || ""; +} + +function classesToArray( value ) { + if ( Array.isArray( value ) ) { + return value; + } + if ( typeof value === "string" ) { + return value.match( rnothtmlwhite ) || []; + } + return []; +} + +jQuery.fn.extend( { + addClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).addClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + if ( cur.indexOf( " " + clazz + " " ) < 0 ) { + cur += clazz + " "; + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + if ( !arguments.length ) { + return this.attr( "class", "" ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + + // Remove *all* instances + while ( cur.indexOf( " " + clazz + " " ) > -1 ) { + cur = cur.replace( " " + clazz + " ", " " ); + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isValidValue = type === "string" || Array.isArray( value ); + + if ( typeof stateVal === "boolean" && isValidValue ) { + return stateVal ? this.addClass( value ) : this.removeClass( value ); + } + + if ( isFunction( value ) ) { + return this.each( function( i ) { + jQuery( this ).toggleClass( + value.call( this, i, getClass( this ), stateVal ), + stateVal + ); + } ); + } + + return this.each( function() { + var className, i, self, classNames; + + if ( isValidValue ) { + + // Toggle individual class names + i = 0; + self = jQuery( this ); + classNames = classesToArray( value ); + + while ( ( className = classNames[ i++ ] ) ) { + + // Check each className given, space separated list + if ( self.hasClass( className ) ) { + self.removeClass( className ); + } else { + self.addClass( className ); + } + } + + // Toggle whole class name + } else if ( value === undefined || type === "boolean" ) { + className = getClass( this ); + if ( className ) { + + // Store className if set + dataPriv.set( this, "__className__", className ); + } + + // If the element has a class name or if we're passed `false`, + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + if ( this.setAttribute ) { + this.setAttribute( "class", + className || value === false ? + "" : + dataPriv.get( this, "__className__" ) || "" + ); + } + } + } ); + }, + + hasClass: function( selector ) { + var className, elem, + i = 0; + + className = " " + selector + " "; + while ( ( elem = this[ i++ ] ) ) { + if ( elem.nodeType === 1 && + ( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) { + return true; + } + } + + return false; + } +} ); + + + + +var rreturn = /\r/g; + +jQuery.fn.extend( { + val: function( value ) { + var hooks, ret, valueIsFunction, + elem = this[ 0 ]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || + jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && + "get" in hooks && + ( ret = hooks.get( elem, "value" ) ) !== undefined + ) { + return ret; + } + + ret = elem.value; + + // Handle most common string cases + if ( typeof ret === "string" ) { + return ret.replace( rreturn, "" ); + } + + // Handle cases where value is null/undef or number + return ret == null ? "" : ret; + } + + return; + } + + valueIsFunction = isFunction( value ); + + return this.each( function( i ) { + var val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( valueIsFunction ) { + val = value.call( this, i, jQuery( this ).val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + + } else if ( typeof val === "number" ) { + val += ""; + + } else if ( Array.isArray( val ) ) { + val = jQuery.map( val, function( value ) { + return value == null ? "" : value + ""; + } ); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + } ); + } +} ); + +jQuery.extend( { + valHooks: { + option: { + get: function( elem ) { + + var val = jQuery.find.attr( elem, "value" ); + return val != null ? + val : + + // Support: IE <=10 - 11 only + // option.text throws exceptions (#14686, #14858) + // Strip and collapse whitespace + // https://html.spec.whatwg.org/#strip-and-collapse-whitespace + stripAndCollapse( jQuery.text( elem ) ); + } + }, + select: { + get: function( elem ) { + var value, option, i, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one", + values = one ? null : [], + max = one ? index + 1 : options.length; + + if ( index < 0 ) { + i = max; + + } else { + i = one ? index : 0; + } + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Support: IE <=9 only + // IE8-9 doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + + // Don't return options that are disabled or in a disabled optgroup + !option.disabled && + ( !option.parentNode.disabled || + !nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var optionSet, option, + options = elem.options, + values = jQuery.makeArray( value ), + i = options.length; + + while ( i-- ) { + option = options[ i ]; + + /* eslint-disable no-cond-assign */ + + if ( option.selected = + jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1 + ) { + optionSet = true; + } + + /* eslint-enable no-cond-assign */ + } + + // Force browsers to behave consistently when non-matching value is set + if ( !optionSet ) { + elem.selectedIndex = -1; + } + return values; + } + } + } +} ); + +// Radios and checkboxes getter/setter +jQuery.each( [ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + set: function( elem, value ) { + if ( Array.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 ); + } + } + }; + if ( !support.checkOn ) { + jQuery.valHooks[ this ].get = function( elem ) { + return elem.getAttribute( "value" ) === null ? "on" : elem.value; + }; + } +} ); + + + + +// Return jQuery for attributes-only inclusion + + +support.focusin = "onfocusin" in window; + + +var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + stopPropagationCallback = function( e ) { + e.stopPropagation(); + }; + +jQuery.extend( jQuery.event, { + + trigger: function( event, data, elem, onlyHandlers ) { + + var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, + eventPath = [ elem || document ], + type = hasOwn.call( event, "type" ) ? event.type : event, + namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : []; + + cur = lastElement = tmp = elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "." ) > -1 ) { + + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split( "." ); + type = namespaces.shift(); + namespaces.sort(); + } + ontype = type.indexOf( ":" ) < 0 && "on" + type; + + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[ jQuery.expando ] ? + event : + new jQuery.Event( type, typeof event === "object" && event ); + + // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) + event.isTrigger = onlyHandlers ? 2 : 3; + event.namespace = namespaces.join( "." ); + event.rnamespace = event.namespace ? + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) : + null; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data == null ? + [ event ] : + jQuery.makeArray( data, [ event ] ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + if ( !rfocusMorph.test( bubbleType + type ) ) { + cur = cur.parentNode; + } + for ( ; cur; cur = cur.parentNode ) { + eventPath.push( cur ); + tmp = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( tmp === ( elem.ownerDocument || document ) ) { + eventPath.push( tmp.defaultView || tmp.parentWindow || window ); + } + } + + // Fire handlers on the event path + i = 0; + while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) { + lastElement = cur; + event.type = i > 1 ? + bubbleType : + special.bindType || type; + + // jQuery handler + handle = ( dataPriv.get( cur, "events" ) || {} )[ event.type ] && + dataPriv.get( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + + // Native handler + handle = ontype && cur[ ontype ]; + if ( handle && handle.apply && acceptData( cur ) ) { + event.result = handle.apply( cur, data ); + if ( event.result === false ) { + event.preventDefault(); + } + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( ( !special._default || + special._default.apply( eventPath.pop(), data ) === false ) && + acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name as the event. + // Don't do default actions on window, that's where global variables be (#6170) + if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + tmp = elem[ ontype ]; + + if ( tmp ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + + if ( event.isPropagationStopped() ) { + lastElement.addEventListener( type, stopPropagationCallback ); + } + + elem[ type ](); + + if ( event.isPropagationStopped() ) { + lastElement.removeEventListener( type, stopPropagationCallback ); + } + + jQuery.event.triggered = undefined; + + if ( tmp ) { + elem[ ontype ] = tmp; + } + } + } + } + + return event.result; + }, + + // Piggyback on a donor event to simulate a different one + // Used only for `focus(in | out)` events + simulate: function( type, elem, event ) { + var e = jQuery.extend( + new jQuery.Event(), + event, + { + type: type, + isSimulated: true + } + ); + + jQuery.event.trigger( e, null, elem ); + } + +} ); + +jQuery.fn.extend( { + + trigger: function( type, data ) { + return this.each( function() { + jQuery.event.trigger( type, data, this ); + } ); + }, + triggerHandler: function( type, data ) { + var elem = this[ 0 ]; + if ( elem ) { + return jQuery.event.trigger( type, data, elem, true ); + } + } +} ); + + +// Support: Firefox <=44 +// Firefox doesn't have focus(in | out) events +// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 +// +// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 +// focus(in | out) events fire after focus & blur events, +// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order +// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 +if ( !support.focusin ) { + jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler on the document while someone wants focusin/focusout + var handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + var doc = this.ownerDocument || this, + attaches = dataPriv.access( doc, fix ); + + if ( !attaches ) { + doc.addEventListener( orig, handler, true ); + } + dataPriv.access( doc, fix, ( attaches || 0 ) + 1 ); + }, + teardown: function() { + var doc = this.ownerDocument || this, + attaches = dataPriv.access( doc, fix ) - 1; + + if ( !attaches ) { + doc.removeEventListener( orig, handler, true ); + dataPriv.remove( doc, fix ); + + } else { + dataPriv.access( doc, fix, attaches ); + } + } + }; + } ); +} +var location = window.location; + +var nonce = Date.now(); + +var rquery = ( /\?/ ); + + + +// Cross-browser xml parsing +jQuery.parseXML = function( data ) { + var xml; + if ( !data || typeof data !== "string" ) { + return null; + } + + // Support: IE 9 - 11 only + // IE throws on parseFromString with invalid input. + try { + xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" ); + } catch ( e ) { + xml = undefined; + } + + if ( !xml || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; +}; + + +var + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, + rsubmittable = /^(?:input|select|textarea|keygen)/i; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( Array.isArray( obj ) ) { + + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + + // Item is non-scalar (array or object), encode its numeric index. + buildParams( + prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]", + v, + traditional, + add + ); + } + } ); + + } else if ( !traditional && toType( obj ) === "object" ) { + + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + + // Serialize scalar item. + add( prefix, obj ); + } +} + +// Serialize an array of form elements or a set of +// key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, valueOrFunction ) { + + // If value is a function, invoke it and use its return value + var value = isFunction( valueOrFunction ) ? + valueOrFunction() : + valueOrFunction; + + s[ s.length ] = encodeURIComponent( key ) + "=" + + encodeURIComponent( value == null ? "" : value ); + }; + + if ( a == null ) { + return ""; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + } ); + + } else { + + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ); +}; + +jQuery.fn.extend( { + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map( function() { + + // Can add propHook for "elements" to filter or add form elements + var elements = jQuery.prop( this, "elements" ); + return elements ? jQuery.makeArray( elements ) : this; + } ) + .filter( function() { + var type = this.type; + + // Use .is( ":disabled" ) so that fieldset[disabled] works + return this.name && !jQuery( this ).is( ":disabled" ) && + rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) && + ( this.checked || !rcheckableType.test( type ) ); + } ) + .map( function( i, elem ) { + var val = jQuery( this ).val(); + + if ( val == null ) { + return null; + } + + if ( Array.isArray( val ) ) { + return jQuery.map( val, function( val ) { + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ); + } + + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ).get(); + } +} ); + + +var + r20 = /%20/g, + rhash = /#.*$/, + rantiCache = /([?&])_=[^&]*/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, + + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = "*/".concat( "*" ), + + // Anchor tag for parsing the document origin + originAnchor = document.createElement( "a" ); + originAnchor.href = location.href; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, + i = 0, + dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || []; + + if ( isFunction( func ) ) { + + // For each dataType in the dataTypeExpression + while ( ( dataType = dataTypes[ i++ ] ) ) { + + // Prepend if requested + if ( dataType[ 0 ] === "+" ) { + dataType = dataType.slice( 1 ) || "*"; + ( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func ); + + // Otherwise append + } else { + ( structure[ dataType ] = structure[ dataType ] || [] ).push( func ); + } + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) { + + var inspected = {}, + seekingTransport = ( structure === transports ); + + function inspect( dataType ) { + var selected; + inspected[ dataType ] = true; + jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) { + var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR ); + if ( typeof dataTypeOrTransport === "string" && + !seekingTransport && !inspected[ dataTypeOrTransport ] ) { + + options.dataTypes.unshift( dataTypeOrTransport ); + inspect( dataTypeOrTransport ); + return false; + } else if ( seekingTransport ) { + return !( selected = dataTypeOrTransport ); + } + } ); + return selected; + } + + return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" ); +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } + + return target; +} + +/* Handles responses to an ajax request: + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes; + + // Remove auto dataType and get content-type in the process + while ( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +/* Chain conversions given the request and the original response + * Also sets the responseXXX fields on the jqXHR instance + */ +function ajaxConvert( s, response, jqXHR, isSuccess ) { + var conv2, current, conv, tmp, prev, + converters = {}, + + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(); + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + current = dataTypes.shift(); + + // Convert to each sequential dataType + while ( current ) { + + if ( s.responseFields[ current ] ) { + jqXHR[ s.responseFields[ current ] ] = response; + } + + // Apply the dataFilter if provided + if ( !prev && isSuccess && s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + prev = current; + current = dataTypes.shift(); + + if ( current ) { + + // There's only work to do if current dataType is non-auto + if ( current === "*" ) { + + current = prev; + + // Convert response if prev dataType is non-auto and differs from current + } else if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split( " " ); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.unshift( tmp[ 1 ] ); + } + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s.throws ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { + state: "parsererror", + error: conv ? e : "No conversion from " + prev + " to " + current + }; + } + } + } + } + } + } + + return { state: "success", data: response }; +} + +jQuery.extend( { + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + ajaxSettings: { + url: location.href, + type: "GET", + isLocal: rlocalProtocol.test( location.protocol ), + global: true, + processData: true, + async: true, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + "*": allTypes, + text: "text/plain", + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" + }, + + contents: { + xml: /\bxml\b/, + html: /\bhtml/, + json: /\bjson\b/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText", + json: "responseJSON" + }, + + // Data converters + // Keys separate source (or catchall "*") and destination types with a single space + converters: { + + // Convert anything to text + "* text": String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": JSON.parse, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + url: true, + context: true + } + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + return settings ? + + // Building a settings object + ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) : + + // Extending ajaxSettings + ajaxExtend( jQuery.ajaxSettings, target ); + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var transport, + + // URL without anti-cache param + cacheURL, + + // Response headers + responseHeadersString, + responseHeaders, + + // timeout handle + timeoutTimer, + + // Url cleanup var + urlAnchor, + + // Request state (becomes false upon send and true upon completion) + completed, + + // To know if global events are to be dispatched + fireGlobals, + + // Loop variable + i, + + // uncached part of the url + uncached, + + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + + // Callbacks context + callbackContext = s.context || s, + + // Context for global events is callbackContext if it is a DOM node or jQuery collection + globalEventContext = s.context && + ( callbackContext.nodeType || callbackContext.jquery ) ? + jQuery( callbackContext ) : + jQuery.event, + + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + + // Status-dependent callbacks + statusCode = s.statusCode || {}, + + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + + // Default abort message + strAbort = "canceled", + + // Fake xhr + jqXHR = { + readyState: 0, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( completed ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while ( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[ 1 ].toLowerCase() + " " ] = + ( responseHeaders[ match[ 1 ].toLowerCase() + " " ] || [] ) + .concat( match[ 2 ] ); + } + } + match = responseHeaders[ key.toLowerCase() + " " ]; + } + return match == null ? null : match.join( ", " ); + }, + + // Raw string + getAllResponseHeaders: function() { + return completed ? responseHeadersString : null; + }, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( completed == null ) { + name = requestHeadersNames[ name.toLowerCase() ] = + requestHeadersNames[ name.toLowerCase() ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( completed == null ) { + s.mimeType = type; + } + return this; + }, + + // Status-dependent callbacks + statusCode: function( map ) { + var code; + if ( map ) { + if ( completed ) { + + // Execute the appropriate callbacks + jqXHR.always( map[ jqXHR.status ] ); + } else { + + // Lazy-add the new callbacks in a way that preserves old ones + for ( code in map ) { + statusCode[ code ] = [ statusCode[ code ], map[ code ] ]; + } + } + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + var finalText = statusText || strAbort; + if ( transport ) { + transport.abort( finalText ); + } + done( 0, finalText ); + return this; + } + }; + + // Attach deferreds + deferred.promise( jqXHR ); + + // Add protocol if not provided (prefilters might expect it) + // Handle falsy url in the settings object (#10093: consistency with old signature) + // We also use the url parameter if available + s.url = ( ( url || s.url || location.href ) + "" ) + .replace( rprotocol, location.protocol + "//" ); + + // Alias method option to type as per ticket #12004 + s.type = options.method || options.type || s.method || s.type; + + // Extract dataTypes list + s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ]; + + // A cross-domain request is in order when the origin doesn't match the current origin. + if ( s.crossDomain == null ) { + urlAnchor = document.createElement( "a" ); + + // Support: IE <=8 - 11, Edge 12 - 15 + // IE throws exception on accessing the href property if url is malformed, + // e.g. http://example.com:80x/ + try { + urlAnchor.href = s.url; + + // Support: IE <=8 - 11 only + // Anchor's host property isn't correctly set when s.url is relative + urlAnchor.href = urlAnchor.href; + s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== + urlAnchor.protocol + "//" + urlAnchor.host; + } catch ( e ) { + + // If there is an error parsing the URL, assume it is crossDomain, + // it can be rejected by the transport if it is invalid + s.crossDomain = true; + } + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( completed ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118) + fireGlobals = jQuery.event && s.global; + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Save the URL in case we're toying with the If-Modified-Since + // and/or If-None-Match header later on + // Remove hash to simplify url manipulation + cacheURL = s.url.replace( rhash, "" ); + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // Remember the hash so we can put it back + uncached = s.url.slice( cacheURL.length ); + + // If data is available and should be processed, append data to url + if ( s.data && ( s.processData || typeof s.data === "string" ) ) { + cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data; + + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Add or update anti-cache param if needed + if ( s.cache === false ) { + cacheURL = cacheURL.replace( rantiCache, "$1" ); + uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce++ ) + uncached; + } + + // Put hash and anti-cache on the URL that will be requested (gh-1732) + s.url = cacheURL + uncached; + + // Change '%20' to '+' if this is encoded form body content (gh-2658) + } else if ( s.data && s.processData && + ( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) { + s.data = s.data.replace( r20, "+" ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] ); + } + if ( jQuery.etag[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ? + s.accepts[ s.dataTypes[ 0 ] ] + + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && + ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) { + + // Abort if not done already and return + return jqXHR.abort(); + } + + // Aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + completeDeferred.add( s.complete ); + jqXHR.done( s.success ); + jqXHR.fail( s.error ); + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + + // If request was aborted inside ajaxSend, stop there + if ( completed ) { + return jqXHR; + } + + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = window.setTimeout( function() { + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + completed = false; + transport.send( requestHeaders, done ); + } catch ( e ) { + + // Rethrow post-completion exceptions + if ( completed ) { + throw e; + } + + // Propagate others as results + done( -1, e ); + } + } + + // Callback for when everything is done + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Ignore repeat invocations + if ( completed ) { + return; + } + + completed = true; + + // Clear timeout if it exists + if ( timeoutTimer ) { + window.clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Determine if successful + isSuccess = status >= 200 && status < 300 || status === 304; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // Convert no matter what (that way responseXXX fields are always set) + response = ajaxConvert( s, response, jqXHR, isSuccess ); + + // If successful, handle type chaining + if ( isSuccess ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + modified = jqXHR.getResponseHeader( "Last-Modified" ); + if ( modified ) { + jQuery.lastModified[ cacheURL ] = modified; + } + modified = jqXHR.getResponseHeader( "etag" ); + if ( modified ) { + jQuery.etag[ cacheURL ] = modified; + } + } + + // if no content + if ( status === 204 || s.type === "HEAD" ) { + statusText = "nocontent"; + + // if not modified + } else if ( status === 304 ) { + statusText = "notmodified"; + + // If we have data, let's convert it + } else { + statusText = response.state; + success = response.data; + error = response.error; + isSuccess = !error; + } + } else { + + // Extract error from statusText and normalize for non-aborts + error = statusText; + if ( status || !statusText ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError", + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + return jqXHR; + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + } +} ); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + + // Shift arguments if data argument was omitted + if ( isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + // The url can be an options object (which then must have .url) + return jQuery.ajax( jQuery.extend( { + url: url, + type: method, + dataType: type, + data: data, + success: callback + }, jQuery.isPlainObject( url ) && url ) ); + }; +} ); + + +jQuery._evalUrl = function( url, options ) { + return jQuery.ajax( { + url: url, + + // Make this explicit, since user can override this through ajaxSetup (#11264) + type: "GET", + dataType: "script", + cache: true, + async: false, + global: false, + + // Only evaluate the response if it is successful (gh-4126) + // dataFilter is not invoked for failure responses, so using it instead + // of the default converter is kludgy but it works. + converters: { + "text script": function() {} + }, + dataFilter: function( response ) { + jQuery.globalEval( response, options ); + } + } ); +}; + + +jQuery.fn.extend( { + wrapAll: function( html ) { + var wrap; + + if ( this[ 0 ] ) { + if ( isFunction( html ) ) { + html = html.call( this[ 0 ] ); + } + + // The elements to wrap the target around + wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true ); + + if ( this[ 0 ].parentNode ) { + wrap.insertBefore( this[ 0 ] ); + } + + wrap.map( function() { + var elem = this; + + while ( elem.firstElementChild ) { + elem = elem.firstElementChild; + } + + return elem; + } ).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( isFunction( html ) ) { + return this.each( function( i ) { + jQuery( this ).wrapInner( html.call( this, i ) ); + } ); + } + + return this.each( function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + } ); + }, + + wrap: function( html ) { + var htmlIsFunction = isFunction( html ); + + return this.each( function( i ) { + jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html ); + } ); + }, + + unwrap: function( selector ) { + this.parent( selector ).not( "body" ).each( function() { + jQuery( this ).replaceWith( this.childNodes ); + } ); + return this; + } +} ); + + +jQuery.expr.pseudos.hidden = function( elem ) { + return !jQuery.expr.pseudos.visible( elem ); +}; +jQuery.expr.pseudos.visible = function( elem ) { + return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length ); +}; + + + + +jQuery.ajaxSettings.xhr = function() { + try { + return new window.XMLHttpRequest(); + } catch ( e ) {} +}; + +var xhrSuccessStatus = { + + // File protocol always yields status code 0, assume 200 + 0: 200, + + // Support: IE <=9 only + // #1450: sometimes IE returns 1223 when it should be 204 + 1223: 204 + }, + xhrSupported = jQuery.ajaxSettings.xhr(); + +support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported ); +support.ajax = xhrSupported = !!xhrSupported; + +jQuery.ajaxTransport( function( options ) { + var callback, errorCallback; + + // Cross domain only allowed if supported through XMLHttpRequest + if ( support.cors || xhrSupported && !options.crossDomain ) { + return { + send: function( headers, complete ) { + var i, + xhr = options.xhr(); + + xhr.open( + options.type, + options.url, + options.async, + options.username, + options.password + ); + + // Apply custom fields if provided + if ( options.xhrFields ) { + for ( i in options.xhrFields ) { + xhr[ i ] = options.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( options.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( options.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Set headers + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + + // Callback + callback = function( type ) { + return function() { + if ( callback ) { + callback = errorCallback = xhr.onload = + xhr.onerror = xhr.onabort = xhr.ontimeout = + xhr.onreadystatechange = null; + + if ( type === "abort" ) { + xhr.abort(); + } else if ( type === "error" ) { + + // Support: IE <=9 only + // On a manual native abort, IE9 throws + // errors on any property access that is not readyState + if ( typeof xhr.status !== "number" ) { + complete( 0, "error" ); + } else { + complete( + + // File: protocol always yields status 0; see #8605, #14207 + xhr.status, + xhr.statusText + ); + } + } else { + complete( + xhrSuccessStatus[ xhr.status ] || xhr.status, + xhr.statusText, + + // Support: IE <=9 only + // IE9 has no XHR2 but throws on binary (trac-11426) + // For XHR2 non-text, let the caller handle it (gh-2498) + ( xhr.responseType || "text" ) !== "text" || + typeof xhr.responseText !== "string" ? + { binary: xhr.response } : + { text: xhr.responseText }, + xhr.getAllResponseHeaders() + ); + } + } + }; + }; + + // Listen to events + xhr.onload = callback(); + errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" ); + + // Support: IE 9 only + // Use onreadystatechange to replace onabort + // to handle uncaught aborts + if ( xhr.onabort !== undefined ) { + xhr.onabort = errorCallback; + } else { + xhr.onreadystatechange = function() { + + // Check readyState before timeout as it changes + if ( xhr.readyState === 4 ) { + + // Allow onerror to be called first, + // but that will not handle a native abort + // Also, save errorCallback to a variable + // as xhr.onerror cannot be accessed + window.setTimeout( function() { + if ( callback ) { + errorCallback(); + } + } ); + } + }; + } + + // Create the abort callback + callback = callback( "abort" ); + + try { + + // Do send the request (this may raise an exception) + xhr.send( options.hasContent && options.data || null ); + } catch ( e ) { + + // #14683: Only rethrow if this hasn't been notified as an error yet + if ( callback ) { + throw e; + } + } + }, + + abort: function() { + if ( callback ) { + callback(); + } + } + }; + } +} ); + + + + +// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432) +jQuery.ajaxPrefilter( function( s ) { + if ( s.crossDomain ) { + s.contents.script = false; + } +} ); + +// Install script dataType +jQuery.ajaxSetup( { + accepts: { + script: "text/javascript, application/javascript, " + + "application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /\b(?:java|ecma)script\b/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +} ); + +// Handle cache's special case and crossDomain +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + } +} ); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function( s ) { + + // This transport only deals with cross domain or forced-by-attrs requests + if ( s.crossDomain || s.scriptAttrs ) { + var script, callback; + return { + send: function( _, complete ) { + script = jQuery( "<script>" ) + .attr( s.scriptAttrs || {} ) + .prop( { charset: s.scriptCharset, src: s.url } ) + .on( "load error", callback = function( evt ) { + script.remove(); + callback = null; + if ( evt ) { + complete( evt.type === "error" ? 404 : 200, evt.type ); + } + } ); + + // Use native DOM manipulation to avoid our domManip AJAX trickery + document.head.appendChild( script[ 0 ] ); + }, + abort: function() { + if ( callback ) { + callback(); + } + } + }; + } +} ); + + + + +var oldCallbacks = [], + rjsonp = /(=)\?(?=&|$)|\?\?/; + +// Default jsonp settings +jQuery.ajaxSetup( { + jsonp: "callback", + jsonpCallback: function() { + var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) ); + this[ callback ] = true; + return callback; + } +} ); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var callbackName, overwritten, responseContainer, + jsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ? + "url" : + typeof s.data === "string" && + ( s.contentType || "" ) + .indexOf( "application/x-www-form-urlencoded" ) === 0 && + rjsonp.test( s.data ) && "data" + ); + + // Handle iff the expected data type is "jsonp" or we have a parameter to set + if ( jsonProp || s.dataTypes[ 0 ] === "jsonp" ) { + + // Get callback name, remembering preexisting value associated with it + callbackName = s.jsonpCallback = isFunction( s.jsonpCallback ) ? + s.jsonpCallback() : + s.jsonpCallback; + + // Insert callback into url or form data + if ( jsonProp ) { + s[ jsonProp ] = s[ jsonProp ].replace( rjsonp, "$1" + callbackName ); + } else if ( s.jsonp !== false ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName; + } + + // Use data converter to retrieve json after script execution + s.converters[ "script json" ] = function() { + if ( !responseContainer ) { + jQuery.error( callbackName + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // Force json dataType + s.dataTypes[ 0 ] = "json"; + + // Install callback + overwritten = window[ callbackName ]; + window[ callbackName ] = function() { + responseContainer = arguments; + }; + + // Clean-up function (fires after converters) + jqXHR.always( function() { + + // If previous value didn't exist - remove it + if ( overwritten === undefined ) { + jQuery( window ).removeProp( callbackName ); + + // Otherwise restore preexisting value + } else { + window[ callbackName ] = overwritten; + } + + // Save back as free + if ( s[ callbackName ] ) { + + // Make sure that re-using the options doesn't screw things around + s.jsonpCallback = originalSettings.jsonpCallback; + + // Save the callback name for future use + oldCallbacks.push( callbackName ); + } + + // Call if it was a function and we have a response + if ( responseContainer && isFunction( overwritten ) ) { + overwritten( responseContainer[ 0 ] ); + } + + responseContainer = overwritten = undefined; + } ); + + // Delegate to script + return "script"; + } +} ); + + + + +// Support: Safari 8 only +// In Safari 8 documents created via document.implementation.createHTMLDocument +// collapse sibling forms: the second one becomes a child of the first one. +// Because of that, this security measure has to be disabled in Safari 8. +// https://bugs.webkit.org/show_bug.cgi?id=137337 +support.createHTMLDocument = ( function() { + var body = document.implementation.createHTMLDocument( "" ).body; + body.innerHTML = "<form></form><form></form>"; + return body.childNodes.length === 2; +} )(); + + +// Argument "data" should be string of html +// context (optional): If specified, the fragment will be created in this context, +// defaults to document +// keepScripts (optional): If true, will include scripts passed in the html string +jQuery.parseHTML = function( data, context, keepScripts ) { + if ( typeof data !== "string" ) { + return []; + } + if ( typeof context === "boolean" ) { + keepScripts = context; + context = false; + } + + var base, parsed, scripts; + + if ( !context ) { + + // Stop scripts or inline event handlers from being executed immediately + // by using document.implementation + if ( support.createHTMLDocument ) { + context = document.implementation.createHTMLDocument( "" ); + + // Set the base href for the created document + // so any parsed elements with URLs + // are based on the document's URL (gh-2965) + base = context.createElement( "base" ); + base.href = document.location.href; + context.head.appendChild( base ); + } else { + context = document; + } + } + + parsed = rsingleTag.exec( data ); + scripts = !keepScripts && []; + + // Single tag + if ( parsed ) { + return [ context.createElement( parsed[ 1 ] ) ]; + } + + parsed = buildFragment( [ data ], context, scripts ); + + if ( scripts && scripts.length ) { + jQuery( scripts ).remove(); + } + + return jQuery.merge( [], parsed.childNodes ); +}; + + +/** + * Load a url into a page + */ +jQuery.fn.load = function( url, params, callback ) { + var selector, type, response, + self = this, + off = url.indexOf( " " ); + + if ( off > -1 ) { + selector = stripAndCollapse( url.slice( off ) ); + url = url.slice( 0, off ); + } + + // If it's a function + if ( isFunction( params ) ) { + + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( params && typeof params === "object" ) { + type = "POST"; + } + + // If we have elements to modify, make the request + if ( self.length > 0 ) { + jQuery.ajax( { + url: url, + + // If "type" variable is undefined, then "GET" method will be used. + // Make value of this field explicit since + // user can override it through ajaxSetup method + type: type || "GET", + dataType: "html", + data: params + } ).done( function( responseText ) { + + // Save response for use in complete callback + response = arguments; + + self.html( selector ? + + // If a selector was specified, locate the right elements in a dummy div + // Exclude scripts to avoid IE 'Permission Denied' errors + jQuery( "<div>" ).append( jQuery.parseHTML( responseText ) ).find( selector ) : + + // Otherwise use the full result + responseText ); + + // If the request succeeds, this function gets "data", "status", "jqXHR" + // but they are ignored because response was set above. + // If it fails, this function gets "jqXHR", "status", "error" + } ).always( callback && function( jqXHR, status ) { + self.each( function() { + callback.apply( this, response || [ jqXHR.responseText, status, jqXHR ] ); + } ); + } ); + } + + return this; +}; + + + + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( [ + "ajaxStart", + "ajaxStop", + "ajaxComplete", + "ajaxError", + "ajaxSuccess", + "ajaxSend" +], function( i, type ) { + jQuery.fn[ type ] = function( fn ) { + return this.on( type, fn ); + }; +} ); + + + + +jQuery.expr.pseudos.animated = function( elem ) { + return jQuery.grep( jQuery.timers, function( fn ) { + return elem === fn.elem; + } ).length; +}; + + + + +jQuery.offset = { + setOffset: function( elem, options, i ) { + var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition, + position = jQuery.css( elem, "position" ), + curElem = jQuery( elem ), + props = {}; + + // Set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + curOffset = curElem.offset(); + curCSSTop = jQuery.css( elem, "top" ); + curCSSLeft = jQuery.css( elem, "left" ); + calculatePosition = ( position === "absolute" || position === "fixed" ) && + ( curCSSTop + curCSSLeft ).indexOf( "auto" ) > -1; + + // Need to be able to calculate position if either + // top or left is auto and position is either absolute or fixed + if ( calculatePosition ) { + curPosition = curElem.position(); + curTop = curPosition.top; + curLeft = curPosition.left; + + } else { + curTop = parseFloat( curCSSTop ) || 0; + curLeft = parseFloat( curCSSLeft ) || 0; + } + + if ( isFunction( options ) ) { + + // Use jQuery.extend here to allow modification of coordinates argument (gh-1848) + options = options.call( elem, i, jQuery.extend( {}, curOffset ) ); + } + + if ( options.top != null ) { + props.top = ( options.top - curOffset.top ) + curTop; + } + if ( options.left != null ) { + props.left = ( options.left - curOffset.left ) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + + } else { + curElem.css( props ); + } + } +}; + +jQuery.fn.extend( { + + // offset() relates an element's border box to the document origin + offset: function( options ) { + + // Preserve chaining for setter + if ( arguments.length ) { + return options === undefined ? + this : + this.each( function( i ) { + jQuery.offset.setOffset( this, options, i ); + } ); + } + + var rect, win, + elem = this[ 0 ]; + + if ( !elem ) { + return; + } + + // Return zeros for disconnected and hidden (display: none) elements (gh-2310) + // Support: IE <=11 only + // Running getBoundingClientRect on a + // disconnected node in IE throws an error + if ( !elem.getClientRects().length ) { + return { top: 0, left: 0 }; + } + + // Get document-relative position by adding viewport scroll to viewport-relative gBCR + rect = elem.getBoundingClientRect(); + win = elem.ownerDocument.defaultView; + return { + top: rect.top + win.pageYOffset, + left: rect.left + win.pageXOffset + }; + }, + + // position() relates an element's margin box to its offset parent's padding box + // This corresponds to the behavior of CSS absolute positioning + position: function() { + if ( !this[ 0 ] ) { + return; + } + + var offsetParent, offset, doc, + elem = this[ 0 ], + parentOffset = { top: 0, left: 0 }; + + // position:fixed elements are offset from the viewport, which itself always has zero offset + if ( jQuery.css( elem, "position" ) === "fixed" ) { + + // Assume position:fixed implies availability of getBoundingClientRect + offset = elem.getBoundingClientRect(); + + } else { + offset = this.offset(); + + // Account for the *real* offset parent, which can be the document or its root element + // when a statically positioned element is identified + doc = elem.ownerDocument; + offsetParent = elem.offsetParent || doc.documentElement; + while ( offsetParent && + ( offsetParent === doc.body || offsetParent === doc.documentElement ) && + jQuery.css( offsetParent, "position" ) === "static" ) { + + offsetParent = offsetParent.parentNode; + } + if ( offsetParent && offsetParent !== elem && offsetParent.nodeType === 1 ) { + + // Incorporate borders into its offset, since they are outside its content origin + parentOffset = jQuery( offsetParent ).offset(); + parentOffset.top += jQuery.css( offsetParent, "borderTopWidth", true ); + parentOffset.left += jQuery.css( offsetParent, "borderLeftWidth", true ); + } + } + + // Subtract parent offsets and element margins + return { + top: offset.top - parentOffset.top - jQuery.css( elem, "marginTop", true ), + left: offset.left - parentOffset.left - jQuery.css( elem, "marginLeft", true ) + }; + }, + + // This method will return documentElement in the following cases: + // 1) For the element inside the iframe without offsetParent, this method will return + // documentElement of the parent window + // 2) For the hidden or detached element + // 3) For body or html element, i.e. in case of the html node - it will return itself + // + // but those exceptions were never presented as a real life use-cases + // and might be considered as more preferable results. + // + // This logic, however, is not guaranteed and can change at any point in the future + offsetParent: function() { + return this.map( function() { + var offsetParent = this.offsetParent; + + while ( offsetParent && jQuery.css( offsetParent, "position" ) === "static" ) { + offsetParent = offsetParent.offsetParent; + } + + return offsetParent || documentElement; + } ); + } +} ); + +// Create scrollLeft and scrollTop methods +jQuery.each( { scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function( method, prop ) { + var top = "pageYOffset" === prop; + + jQuery.fn[ method ] = function( val ) { + return access( this, function( elem, method, val ) { + + // Coalesce documents and windows + var win; + if ( isWindow( elem ) ) { + win = elem; + } else if ( elem.nodeType === 9 ) { + win = elem.defaultView; + } + + if ( val === undefined ) { + return win ? win[ prop ] : elem[ method ]; + } + + if ( win ) { + win.scrollTo( + !top ? val : win.pageXOffset, + top ? val : win.pageYOffset + ); + + } else { + elem[ method ] = val; + } + }, method, val, arguments.length ); + }; +} ); + +// Support: Safari <=7 - 9.1, Chrome <=37 - 49 +// Add the top/left cssHooks using jQuery.fn.position +// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084 +// Blink bug: https://bugs.chromium.org/p/chromium/issues/detail?id=589347 +// getComputedStyle returns percent when specified for top/left/bottom/right; +// rather than make the css module depend on the offset module, just check for it here +jQuery.each( [ "top", "left" ], function( i, prop ) { + jQuery.cssHooks[ prop ] = addGetHookIf( support.pixelPosition, + function( elem, computed ) { + if ( computed ) { + computed = curCSS( elem, prop ); + + // If curCSS returns percentage, fallback to offset + return rnumnonpx.test( computed ) ? + jQuery( elem ).position()[ prop ] + "px" : + computed; + } + } + ); +} ); + + +// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods +jQuery.each( { Height: "height", Width: "width" }, function( name, type ) { + jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name }, + function( defaultExtra, funcName ) { + + // Margin is only for outerHeight, outerWidth + jQuery.fn[ funcName ] = function( margin, value ) { + var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ), + extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" ); + + return access( this, function( elem, type, value ) { + var doc; + + if ( isWindow( elem ) ) { + + // $( window ).outerWidth/Height return w/h including scrollbars (gh-1729) + return funcName.indexOf( "outer" ) === 0 ? + elem[ "inner" + name ] : + elem.document.documentElement[ "client" + name ]; + } + + // Get document width or height + if ( elem.nodeType === 9 ) { + doc = elem.documentElement; + + // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], + // whichever is greatest + return Math.max( + elem.body[ "scroll" + name ], doc[ "scroll" + name ], + elem.body[ "offset" + name ], doc[ "offset" + name ], + doc[ "client" + name ] + ); + } + + return value === undefined ? + + // Get width or height on the element, requesting but not forcing parseFloat + jQuery.css( elem, type, extra ) : + + // Set width or height on the element + jQuery.style( elem, type, value, extra ); + }, type, chainable ? margin : undefined, chainable ); + }; + } ); +} ); + + +jQuery.each( ( "blur focus focusin focusout resize scroll click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup contextmenu" ).split( " " ), + function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); + }; +} ); + +jQuery.fn.extend( { + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +} ); + + + + +jQuery.fn.extend( { + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length === 1 ? + this.off( selector, "**" ) : + this.off( types, selector || "**", fn ); + } +} ); + +// Bind a function to a context, optionally partially applying any +// arguments. +// jQuery.proxy is deprecated to promote standards (specifically Function#bind) +// However, it is not slated for removal any time soon +jQuery.proxy = function( fn, context ) { + var tmp, args, proxy; + + if ( typeof context === "string" ) { + tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + args = slice.call( arguments, 2 ); + proxy = function() { + return fn.apply( context || this, args.concat( slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || jQuery.guid++; + + return proxy; +}; + +jQuery.holdReady = function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } +}; +jQuery.isArray = Array.isArray; +jQuery.parseJSON = JSON.parse; +jQuery.nodeName = nodeName; +jQuery.isFunction = isFunction; +jQuery.isWindow = isWindow; +jQuery.camelCase = camelCase; +jQuery.type = toType; + +jQuery.now = Date.now; + +jQuery.isNumeric = function( obj ) { + + // As of jQuery 3.0, isNumeric is limited to + // strings and numbers (primitives or objects) + // that can be coerced to finite numbers (gh-2662) + var type = jQuery.type( obj ); + return ( type === "number" || type === "string" ) && + + // parseFloat NaNs numeric-cast false positives ("") + // ...but misinterprets leading-number strings, particularly hex literals ("0x...") + // subtraction forces infinities to NaN + !isNaN( obj - parseFloat( obj ) ); +}; + + + + +// Register as a named AMD module, since jQuery can be concatenated with other +// files that may use define, but not via a proper concatenation script that +// understands anonymous AMD modules. A named AMD is safest and most robust +// way to register. Lowercase jquery is used because AMD module names are +// derived from file names, and jQuery is normally delivered in a lowercase +// file name. Do this after creating the global so that if an AMD module wants +// to call noConflict to hide this version of jQuery, it will work. + +// Note that for maximum portability, libraries that are not jQuery should +// declare themselves as anonymous modules, and avoid setting a global if an +// AMD loader is present. jQuery is a special case. For more information, see +// https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon + +if ( typeof define === "function" && define.amd ) { + define( "jquery", [], function() { + return jQuery; + } ); +} + + + + +var + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$; + +jQuery.noConflict = function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; +}; + +// Expose jQuery and $ identifiers, even in AMD +// (#7102#comment:10, https://github.com/jquery/jquery/pull/557) +// and CommonJS for browser emulators (#13566) +if ( !noGlobal ) { + window.jQuery = window.$ = jQuery; +} + + + + +return jQuery; +} ); diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery-3.4.1.js.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery-3.4.1.js.meta new file mode 100644 index 00000000..1f9df1db --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery-3.4.1.js.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: f34239773db556f41a100e54edb6c0ff +TextScriptImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.fancybox.min.css b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.fancybox.min.css new file mode 100644 index 00000000..2354dec1 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.fancybox.min.css @@ -0,0 +1 @@ +@charset "UTF-8";.fancybox-enabled{overflow:hidden}.fancybox-enabled body{overflow:visible;height:100%}.fancybox-container{position:fixed;top:0;left:0;width:100%;height:100%;z-index:99993;-webkit-backface-visibility:hidden;backface-visibility:hidden}.fancybox-container~.fancybox-container{z-index:99992}.fancybox-bg{position:absolute;top:0;right:0;bottom:0;left:0;background:#0f0f11;opacity:0;transition-timing-function:cubic-bezier(.55,.06,.68,.19);-webkit-backface-visibility:hidden;backface-visibility:hidden}.fancybox-container--ready .fancybox-bg{opacity:.87;transition-timing-function:cubic-bezier(.22,.61,.36,1)}.fancybox-controls{position:absolute;top:0;left:0;right:0;text-align:center;opacity:0;z-index:99994;transition:opacity .2s;pointer-events:none;-webkit-backface-visibility:hidden;backface-visibility:hidden;direction:ltr}.fancybox-show-controls .fancybox-controls{opacity:1}.fancybox-infobar{display:none}.fancybox-show-infobar .fancybox-infobar{display:inline-block;pointer-events:all}.fancybox-infobar__body{display:inline-block;width:70px;line-height:44px;font-size:13px;font-family:Helvetica Neue,Helvetica,Arial,sans-serif;text-align:center;color:#ddd;background-color:rgba(30,30,30,.7);pointer-events:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;-webkit-touch-callout:none;-webkit-tap-highlight-color:transparent;-webkit-font-smoothing:subpixel-antialiased}.fancybox-buttons{position:absolute;top:0;right:0;display:none;pointer-events:all}.fancybox-show-buttons .fancybox-buttons{display:block}.fancybox-slider-wrap{overflow:hidden;direction:ltr}.fancybox-slider,.fancybox-slider-wrap{position:absolute;top:0;left:0;bottom:0;right:0;padding:0;margin:0;z-index:99993;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-tap-highlight-color:transparent}.fancybox-slide{position:absolute;top:0;left:0;width:100%;height:100%;margin:0;padding:0;overflow:auto;outline:none;white-space:normal;box-sizing:border-box;text-align:center;z-index:99994;-webkit-overflow-scrolling:touch}.fancybox-slide:before{content:"";height:100%;width:0}.fancybox-slide:before,.fancybox-slide>*{display:inline-block;vertical-align:middle}.fancybox-slide>*{position:relative;padding:24px;margin:44px 0;border-width:0;text-align:left;background-color:#fff;overflow:auto;box-sizing:border-box}.fancybox-slide--image{overflow:hidden}.fancybox-slide--image:before{display:none}.fancybox-content{display:inline-block;position:relative;margin:44px auto;padding:0;border:0;width:80%;height:calc(100% - 88px);vertical-align:middle;line-height:normal;text-align:left;white-space:normal;outline:none;font-size:16px;font-family:Arial,sans-serif;box-sizing:border-box;-webkit-tap-highlight-color:transparent;-webkit-overflow-scrolling:touch}.fancybox-iframe{display:block;margin:0;padding:0;border:0;width:100%;height:100%;background:#fff}.fancybox-slide--video .fancybox-content,.fancybox-slide--video .fancybox-iframe{background:transparent}.fancybox-placeholder{z-index:99995;background:transparent;cursor:default;overflow:visible;-webkit-transform-origin:top left;transform-origin:top left;background-size:100% 100%;background-repeat:no-repeat;-webkit-backface-visibility:hidden;backface-visibility:hidden}.fancybox-image,.fancybox-placeholder,.fancybox-spaceball{position:absolute;top:0;left:0;margin:0;padding:0;border:0}.fancybox-image,.fancybox-spaceball{width:100%;height:100%;max-width:none;max-height:none;background:transparent;background-size:100% 100%}.fancybox-controls--canzoomOut .fancybox-placeholder{cursor:zoom-out}.fancybox-controls--canzoomIn .fancybox-placeholder{cursor:zoom-in}.fancybox-controls--canGrab .fancybox-placeholder{cursor:-webkit-grab;cursor:grab}.fancybox-controls--isGrabbing .fancybox-placeholder{cursor:-webkit-grabbing;cursor:grabbing}.fancybox-spaceball{z-index:1}.fancybox-tmp{position:absolute;top:-9999px;left:-9999px;visibility:hidden}.fancybox-error{position:absolute;margin:0;padding:40px;top:50%;left:50%;width:380px;max-width:100%;-webkit-transform:translate(-50%,-50%);transform:translate(-50%,-50%);background:#fff;cursor:default}.fancybox-error p{margin:0;padding:0;color:#444;font:16px/20px Helvetica Neue,Helvetica,Arial,sans-serif}.fancybox-close-small{position:absolute;top:0;right:0;width:44px;height:44px;padding:0;margin:0;border:0;border-radius:0;outline:none;background:transparent;z-index:10;cursor:pointer}.fancybox-close-small:after{content:"×";position:absolute;top:5px;right:5px;width:30px;height:30px;font:20px/30px Arial,Helvetica Neue,Helvetica,sans-serif;color:#888;font-weight:300;text-align:center;border-radius:50%;border-width:0;background:#fff;transition:background .2s;box-sizing:border-box;z-index:2}.fancybox-close-small:focus:after{outline:1px dotted #888}.fancybox-slide--video .fancybox-close-small{top:-36px;right:-36px;background:transparent}.fancybox-close-small:hover:after{color:#555;background:#eee}.fancybox-caption-wrap{position:absolute;bottom:0;left:0;right:0;padding:60px 30px 0;z-index:99998;-webkit-backface-visibility:hidden;backface-visibility:hidden;box-sizing:border-box;background:linear-gradient(180deg,transparent 0,rgba(0,0,0,.1) 20%,rgba(0,0,0,.2) 40%,rgba(0,0,0,.6) 80%,rgba(0,0,0,.8));opacity:0;transition:opacity .2s;pointer-events:none}.fancybox-show-caption .fancybox-caption-wrap{opacity:1}.fancybox-caption{padding:30px 0;border-top:1px solid hsla(0,0%,100%,.4);font-size:14px;font-family:Helvetica Neue,Helvetica,Arial,sans-serif;color:#fff;line-height:20px;-webkit-text-size-adjust:none}.fancybox-caption a,.fancybox-caption button{pointer-events:all}.fancybox-caption a{color:#fff;text-decoration:underline}.fancybox-button{display:inline-block;position:relative;width:44px;height:44px;line-height:44px;margin:0;padding:0;border:0;border-radius:0;cursor:pointer;background:transparent;color:#fff;box-sizing:border-box;vertical-align:top;outline:none}.fancybox-button--disabled{cursor:default;pointer-events:none}.fancybox-button,.fancybox-infobar__body{background:rgba(30,30,30,.6)}.fancybox-button:hover{background:rgba(0,0,0,.8)}.fancybox-button:after,.fancybox-button:before{content:"";pointer-events:none;position:absolute;border-color:#fff;background-color:currentColor;color:currentColor;opacity:.9;box-sizing:border-box;display:inline-block}.fancybox-button--disabled:after,.fancybox-button--disabled:before{opacity:.5}.fancybox-button--left:after{left:20px;-webkit-transform:rotate(-135deg);transform:rotate(-135deg)}.fancybox-button--left:after,.fancybox-button--right:after{top:18px;width:6px;height:6px;background:transparent;border-top:2px solid currentColor;border-right:2px solid currentColor}.fancybox-button--right:after{right:20px;-webkit-transform:rotate(45deg);transform:rotate(45deg)}.fancybox-button--left{border-bottom-left-radius:5px}.fancybox-button--right{border-bottom-right-radius:5px}.fancybox-button--close{float:right}.fancybox-button--close:after,.fancybox-button--close:before{content:"";display:inline-block;position:absolute;height:2px;width:16px;top:calc(50% - 1px);left:calc(50% - 8px)}.fancybox-button--close:before{-webkit-transform:rotate(45deg);transform:rotate(45deg)}.fancybox-button--close:after{-webkit-transform:rotate(-45deg);transform:rotate(-45deg)}.fancybox-loading{border:6px solid hsla(0,0%,39%,.4);border-top:6px solid hsla(0,0%,100%,.6);border-radius:100%;height:50px;width:50px;-webkit-animation:a .8s infinite linear;animation:a .8s infinite linear;background:transparent;position:absolute;top:50%;left:50%;margin-top:-25px;margin-left:-25px;z-index:99999}@-webkit-keyframes a{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}to{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}@keyframes a{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}to{-webkit-transform:rotate(359deg);transform:rotate(359deg)}}@media (max-width:800px){.fancybox-controls{text-align:left}.fancybox-button--left,.fancybox-button--right,.fancybox-buttons button:not(.fancybox-button--close){display:none!important}.fancybox-caption{padding:20px 0;margin:0}}.fancybox-button--fullscreen:before{width:15px;height:11px;left:15px;top:16px;border:2px solid;background:none}.fancybox-button--play:before{top:16px;left:18px;width:0;height:0;border-top:6px inset transparent;border-bottom:6px inset transparent;border-left:10px solid;border-radius:1px;background:transparent}.fancybox-button--pause:before{top:16px;left:18px;width:7px;height:11px;border-style:solid;border-width:0 2px;background:transparent}.fancybox-button--thumbs span{font-size:23px}.fancybox-button--thumbs:before{top:20px;left:21px;width:3px;height:3px;box-shadow:0 -4px 0,-4px -4px 0,4px -4px 0,inset 0 0 0 32px,-4px 0 0,4px 0 0,0 4px 0,-4px 4px 0,4px 4px 0}.fancybox-container--thumbs .fancybox-caption-wrap,.fancybox-container--thumbs .fancybox-controls,.fancybox-container--thumbs .fancybox-slider-wrap{right:220px}.fancybox-thumbs{position:absolute;top:0;right:0;bottom:0;left:auto;width:220px;margin:0;padding:5px 5px 0 0;background:#fff;z-index:99993;word-break:normal;-webkit-overflow-scrolling:touch;-webkit-tap-highlight-color:transparent;box-sizing:border-box}.fancybox-thumbs>ul{list-style:none;position:absolute;position:relative;width:100%;height:100%;margin:0;padding:0;overflow-x:hidden;overflow-y:auto;font-size:0}.fancybox-thumbs>ul>li{float:left;overflow:hidden;max-width:50%;padding:0;margin:0;width:105px;height:75px;position:relative;cursor:pointer;outline:none;border:5px solid #fff;border-top-width:0;border-right-width:0;-webkit-tap-highlight-color:transparent;-webkit-backface-visibility:hidden;backface-visibility:hidden;box-sizing:border-box}li.fancybox-thumbs-loading{background:rgba(0,0,0,.1)}.fancybox-thumbs>ul>li>img{position:absolute;top:0;left:0;min-width:100%;min-height:100%;max-width:none;max-height:none;-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.fancybox-thumbs>ul>li:before{content:"";position:absolute;top:0;right:0;bottom:0;left:0;border-radius:2px;border:4px solid #4ea7f9;z-index:99991;opacity:0;transition:all .2s cubic-bezier(.25,.46,.45,.94)}.fancybox-thumbs>ul>li.fancybox-thumbs-active:before{opacity:1}@media (max-width:800px){.fancybox-thumbs{display:none!important}.fancybox-container--thumbs .fancybox-caption-wrap,.fancybox-container--thumbs .fancybox-controls,.fancybox-container--thumbs .fancybox-slider-wrap{right:0}}
\ No newline at end of file diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.fancybox.min.css.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.fancybox.min.css.meta new file mode 100644 index 00000000..6b48f462 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.fancybox.min.css.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 24201a4b83fbae14bb2fd8e405e67217 +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.fancybox.min.js b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.fancybox.min.js new file mode 100644 index 00000000..15ab71a8 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.fancybox.min.js @@ -0,0 +1,12 @@ +// ================================================== +// fancyBox v3.0.47 +// +// Licensed GPLv3 for open source use +// or fancyBox Commercial License for commercial use +// +// http://fancyapps.com/fancybox/ +// Copyright 2017 fancyApps +// +// ================================================== +!function(t,e,n,o){"use strict";function s(t){var e=t.currentTarget,o=t.data?t.data.options:{},s=t.data?t.data.items:[],i="",a=0;t.preventDefault(),t.stopPropagation(),n(e).attr("data-fancybox")&&(i=n(e).data("fancybox")),i?(s=s.length?s.filter('[data-fancybox="'+i+'"]'):n("[data-fancybox="+i+"]"),a=s.index(e)):s=[e],n.fancybox.open(s,o,a)}if(!n)return o;var i={speed:330,loop:!0,opacity:"auto",margin:[44,0],gutter:30,infobar:!0,buttons:!0,slideShow:!0,fullScreen:!0,thumbs:!0,closeBtn:!0,smallBtn:"auto",image:{preload:"auto",protect:!1},ajax:{settings:{data:{fancybox:!0}}},iframe:{tpl:'<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" frameborder="0" vspace="0" hspace="0" webkitAllowFullScreen mozallowfullscreen allowFullScreen allowtransparency="true" src=""></iframe>',preload:!0,scrolling:"no",css:{}},baseClass:"",slideClass:"",baseTpl:'<div class="fancybox-container" role="dialog" tabindex="-1"><div class="fancybox-bg"></div><div class="fancybox-controls"><div class="fancybox-infobar"><button data-fancybox-previous class="fancybox-button fancybox-button--left" title="Previous"></button><div class="fancybox-infobar__body"><span class="js-fancybox-index"></span> / <span class="js-fancybox-count"></span></div><button data-fancybox-next class="fancybox-button fancybox-button--right" title="Next"></button></div><div class="fancybox-buttons"><button data-fancybox-close class="fancybox-button fancybox-button--close" title="Close (Esc)"></button></div></div><div class="fancybox-slider-wrap"><div class="fancybox-slider"></div></div><div class="fancybox-caption-wrap"><div class="fancybox-caption"></div></div></div>',spinnerTpl:'<div class="fancybox-loading"></div>',errorTpl:'<div class="fancybox-error"><p>The requested content cannot be loaded. <br /> Please try again later.<p></div>',closeTpl:'<button data-fancybox-close class="fancybox-close-small"></button>',parentEl:"body",touch:!0,keyboard:!0,focus:!0,closeClickOutside:!0,beforeLoad:n.noop,afterLoad:n.noop,beforeMove:n.noop,afterMove:n.noop,onComplete:n.noop,onInit:n.noop,beforeClose:n.noop,afterClose:n.noop,onActivate:n.noop,onDeactivate:n.noop},a=n(t),r=n(e),c=0,l=function(t){return t&&t.hasOwnProperty&&t instanceof n},u=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||function(e){t.setTimeout(e,1e3/60)}}(),d=function(o){var s;return"function"==typeof n&&o instanceof n&&(o=o[0]),s=o.getBoundingClientRect(),s.bottom>0&&s.right>0&&s.left<(t.innerWidth||e.documentElement.clientWidth)&&s.top<(t.innerHeight||e.documentElement.clientHeight)},p=function(t,o,s){var a=this;a.opts=n.extend(!0,{index:s},i,o||{}),a.id=a.opts.id||++c,a.group=[],a.currIndex=parseInt(a.opts.index,10)||0,a.prevIndex=null,a.prevPos=null,a.currPos=0,a.firstRun=null,a.createGroup(t),a.group.length&&(a.$lastFocus=n(e.activeElement).blur(),a.slides={},a.init(t))};n.extend(p.prototype,{init:function(){var t,e,o=this,s=!1;o.scrollTop=r.scrollTop(),o.scrollLeft=r.scrollLeft(),n.fancybox.getInstance()||(t=n("body").width(),n("html").addClass("fancybox-enabled"),n.fancybox.isTouch?(n.each(o.group,function(t,e){if("image"!==e.type&&"iframe"!==e.type)return s=!0,!1}),s&&n("body").css({position:"fixed",width:t,top:o.scrollTop*-1})):(t=n("body").width()-t,t>1&&n('<style id="fancybox-noscroll" type="text/css">').html(".compensate-for-scrollbar, .fancybox-enabled body { margin-right: "+t+"px; }").appendTo("head"))),e=n(o.opts.baseTpl).attr("id","fancybox-container-"+o.id).data("FancyBox",o).addClass(o.opts.baseClass).hide().prependTo(o.opts.parentEl),o.$refs={container:e,bg:e.find(".fancybox-bg"),controls:e.find(".fancybox-controls"),buttons:e.find(".fancybox-buttons"),slider_wrap:e.find(".fancybox-slider-wrap"),slider:e.find(".fancybox-slider"),caption:e.find(".fancybox-caption")},o.trigger("onInit"),o.activate(),o.current||o.jumpTo(o.currIndex)},createGroup:function(t){var e=this,s=n.makeArray(t);n.each(s,function(t,s){var i,a,r,c,l={},u={},d=[];n.isPlainObject(s)?(l=s,u=s.opts||{}):"object"===n.type(s)&&n(s).length?(i=n(s),d=i.data(),u="options"in d?d.options:{},u="object"===n.type(u)?u:{},l.type="type"in d?d.type:u.type,l.src="src"in d?d.src:u.src||i.attr("href"),u.width="width"in d?d.width:u.width,u.height="height"in d?d.height:u.height,u.thumb="thumb"in d?d.thumb:u.thumb,u.selector="selector"in d?d.selector:u.selector,"srcset"in d&&(u.image={srcset:d.srcset}),u.$orig=i):l={type:"html",content:s+""},l.opts=n.extend(!0,{},e.opts,u),a=l.type,r=l.src||"",a||(l.content?a="html":r.match(/(^data:image\/[a-z0-9+\/=]*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg|ico)((\?|#).*)?$)/i)?a="image":r.match(/\.(pdf)((\?|#).*)?$/i)?a="pdf":"#"===r.charAt(0)&&(a="inline"),l.type=a),l.index=e.group.length,l.opts.$orig&&!l.opts.$orig.length&&delete l.opts.$orig,!l.opts.$thumb&&l.opts.$orig&&(l.opts.$thumb=l.opts.$orig.find("img:first")),l.opts.$thumb&&!l.opts.$thumb.length&&delete l.opts.$thumb,"function"===n.type(l.opts.caption)?l.opts.caption=l.opts.caption.apply(s,[e,l]):"caption"in d?l.opts.caption=d.caption:u.$orig&&(l.opts.caption=i.attr("title")),l.opts.caption=l.opts.caption===o?"":l.opts.caption+"","ajax"===a&&(c=r.split(/\s+/,2),c.length>1&&(l.src=c.shift(),l.opts.selector=c.shift())),"auto"==l.opts.smallBtn&&(n.inArray(a,["html","inline","ajax"])>-1?(l.opts.buttons=!1,l.opts.smallBtn=!0):l.opts.smallBtn=!1),"pdf"===a&&(l.type="iframe",l.opts.closeBtn=!0,l.opts.smallBtn=!1,l.opts.iframe.preload=!1),l.opts.modal&&n.extend(!0,l.opts,{infobar:0,buttons:0,keyboard:0,slideShow:0,fullScreen:0,closeClickOutside:0}),e.group.push(l)})},addEvents:function(){var e=this;e.removeEvents(),e.$refs.container.on("click.fb-close","[data-fancybox-close]",function(t){t.stopPropagation(),t.preventDefault(),e.close(t)}).on("click.fb-previous","[data-fancybox-previous]",function(t){t.stopPropagation(),t.preventDefault(),e.previous()}).on("click.fb-next","[data-fancybox-next]",function(t){t.stopPropagation(),t.preventDefault(),e.next()}),n(t).on("orientationchange.fb resize.fb",function(t){u(function(){t&&t.originalEvent&&"resize"===t.originalEvent.type?e.update():(e.$refs.slider_wrap.hide(),u(function(){e.$refs.slider_wrap.show(),e.update()}))})}),r.on("focusin.fb",function(t){var o=n.fancybox?n.fancybox.getInstance():null;!o||n(t.target).hasClass("fancybox-container")||n.contains(o.$refs.container[0],t.target)||(t.stopPropagation(),o.focus(),a.scrollTop(e.scrollTop).scrollLeft(e.scrollLeft))}),r.on("keydown.fb",function(t){var o=e.current,s=t.keyCode||t.which;if(o&&o.opts.keyboard&&!n(t.target).is("input")&&!n(t.target).is("textarea")){if(8===s||27===s)return t.preventDefault(),void e.close(t);switch(s){case 37:case 38:t.preventDefault(),e.previous();break;case 39:case 40:t.preventDefault(),e.next();break;case 80:case 32:t.preventDefault(),e.SlideShow&&(t.preventDefault(),e.SlideShow.toggle());break;case 70:e.FullScreen&&(t.preventDefault(),e.FullScreen.toggle());break;case 71:e.Thumbs&&(t.preventDefault(),e.Thumbs.toggle())}}})},removeEvents:function(){a.off("scroll.fb resize.fb orientationchange.fb"),r.off("keydown.fb focusin.fb click.fb-close"),this.$refs.container.off("click.fb-close click.fb-previous click.fb-next")},previous:function(t){this.jumpTo(this.currIndex-1,t)},next:function(t){this.jumpTo(this.currIndex+1,t)},jumpTo:function(t,e){var n,s,i,a,r=this;if(n=r.firstRun=null===r.firstRun,s=i=t=parseInt(t,10),a=!!r.current&&r.current.opts.loop,!r.isAnimating&&(s!=r.currIndex||n)){if(r.group.length>1&&a)s%=r.group.length,s=s<0?r.group.length+s:s,2==r.group.length?i=t-r.currIndex+r.currPos:(i=s-r.currIndex+r.currPos,Math.abs(r.currPos-(i+r.group.length))<Math.abs(r.currPos-i)?i+=r.group.length:Math.abs(r.currPos-(i-r.group.length))<Math.abs(r.currPos-i)&&(i-=r.group.length));else if(!r.group[s])return void r.update(!1,!1,e);r.current&&(r.current.$slide.removeClass("fancybox-slide--current fancybox-slide--complete"),r.updateSlide(r.current,!0)),r.prevIndex=r.currIndex,r.prevPos=r.currPos,r.currIndex=s,r.currPos=i,r.current=r.createSlide(i),r.group.length>1&&((r.opts.loop||i-1>=0)&&r.createSlide(i-1),(r.opts.loop||i+1<r.group.length)&&r.createSlide(i+1)),r.current.isMoved=!1,r.current.isComplete=!1,e=parseInt(e===o?1.5*r.current.opts.speed:e,10),r.trigger("beforeMove"),r.updateControls(),n&&(r.current.$slide.addClass("fancybox-slide--current"),r.$refs.container.show(),u(function(){r.$refs.bg.css("transition-duration",r.current.opts.speed+"ms"),r.$refs.container.addClass("fancybox-container--ready")})),r.update(!0,!1,n?0:e,function(){r.afterMove()}),r.loadSlide(r.current),n&&r.current.$ghost||r.preload()}},createSlide:function(t){var e,o,s,i=this;if(o=t%i.group.length,o=o<0?i.group.length+o:o,!i.slides[t]&&i.group[o]){if(i.opts.loop&&i.group.length>2)for(var a in i.slides)if(i.slides[a].index===o)return s=i.slides[a],s.pos=t,i.slides[t]=s,delete i.slides[a],i.updateSlide(s),s;e=n('<div class="fancybox-slide"></div>').appendTo(i.$refs.slider),i.slides[t]=n.extend(!0,{},i.group[o],{pos:t,$slide:e,isMoved:!1,isLoaded:!1})}return i.slides[t]},zoomInOut:function(t,e,o){var s,i,a,r=this,c=r.current,l=c.$placeholder,u=c.opts.opacity,p=c.opts.$thumb,h=p?p.offset():0,f=c.$slide.offset();return!!(l&&c.isMoved&&h&&d(p))&&(!("In"===t&&!r.firstRun)&&(n.fancybox.stop(l),r.isAnimating=!0,s={top:h.top-f.top+parseFloat(p.css("border-top-width")||0),left:h.left-f.left+parseFloat(p.css("border-left-width")||0),width:p.width(),height:p.height(),scaleX:1,scaleY:1},"auto"==u&&(u=Math.abs(c.width/c.height-s.width/s.height)>.1),"In"===t?(i=s,a=r.getFitPos(c),a.scaleX=a.width/i.width,a.scaleY=a.height/i.height,u&&(i.opacity=.1,a.opacity=1)):(i=n.fancybox.getTranslate(l),a=s,c.$ghost&&(c.$ghost.show(),c.$image&&c.$image.remove()),i.scaleX=i.width/a.width,i.scaleY=i.height/a.height,i.width=a.width,i.height=a.height,u&&(a.opacity=0)),r.updateCursor(a.width,a.height),delete a.width,delete a.height,n.fancybox.setTranslate(l,i),l.show(),r.trigger("beforeZoom"+t),l.css("transition","all "+e+"ms"),n.fancybox.setTranslate(l,a),setTimeout(function(){var e;l.css("transition","none"),e=n.fancybox.getTranslate(l),e.scaleX=1,e.scaleY=1,n.fancybox.setTranslate(l,e),r.trigger("afterZoom"+t),o.apply(r),r.isAnimating=!1},e),!0))},canPan:function(){var t=this,e=t.current,n=e.$placeholder,o=!1;return n&&(o=t.getFitPos(e),o=Math.abs(n.width()-o.width)>1||Math.abs(n.height()-o.height)>1),o},isScaledDown:function(){var t=this,e=t.current,o=e.$placeholder,s=!1;return o&&(s=n.fancybox.getTranslate(o),s=s.width<e.width||s.height<e.height),s},scaleToActual:function(t,e,s){var i,a,r,c,l,u=this,d=u.current,p=d.$placeholder,h=parseInt(d.$slide.width(),10),f=parseInt(d.$slide.height(),10),g=d.width,b=d.height;p&&(u.isAnimating=!0,t=t===o?.5*h:t,e=e===o?.5*f:e,i=n.fancybox.getTranslate(p),c=g/i.width,l=b/i.height,a=.5*h-.5*g,r=.5*f-.5*b,g>h&&(a=i.left*c-(t*c-t),a>0&&(a=0),a<h-g&&(a=h-g)),b>f&&(r=i.top*l-(e*l-e),r>0&&(r=0),r<f-b&&(r=f-b)),u.updateCursor(g,b),n.fancybox.animate(p,null,{top:r,left:a,scaleX:c,scaleY:l},s||d.opts.speed,function(){u.isAnimating=!1}))},scaleToFit:function(t){var e,o=this,s=o.current,i=s.$placeholder;i&&(o.isAnimating=!0,e=o.getFitPos(s),o.updateCursor(e.width,e.height),n.fancybox.animate(i,null,{top:e.top,left:e.left,scaleX:e.width/i.width(),scaleY:e.height/i.height()},t||s.opts.speed,function(){o.isAnimating=!1}))},getFitPos:function(t){var e,o,s,i,r,c,l,u=t.$placeholder||t.$content,d=t.width,p=t.height,h=t.opts.margin;return!(!u||!u.length||!d&&!p)&&("number"===n.type(h)&&(h=[h,h]),2==h.length&&(h=[h[0],h[1],h[0],h[1]]),a.width()<800&&(h=[0,0,0,0]),e=parseInt(t.$slide.width(),10)-(h[1]+h[3]),o=parseInt(t.$slide.height(),10)-(h[0]+h[2]),s=Math.min(1,e/d,o/p),c=Math.floor(s*d),l=Math.floor(s*p),i=Math.floor(.5*(o-l))+h[0],r=Math.floor(.5*(e-c))+h[3],{top:i,left:r,width:c,height:l})},update:function(t,e,o,s){var i,a=this;a.isAnimating!==!0&&a.current&&(i=a.current.pos*Math.floor(a.current.$slide.width())*-1-a.current.pos*a.current.opts.gutter,o=parseInt(o,10)||0,n.fancybox.stop(a.$refs.slider),t===!1?a.updateSlide(a.current,e):n.each(a.slides,function(t,n){a.updateSlide(n,e)}),o?n.fancybox.animate(a.$refs.slider,null,{top:0,left:i},o,function(){a.current.isMoved=!0,"function"===n.type(s)&&s.apply(a)}):(n.fancybox.setTranslate(a.$refs.slider,{top:0,left:i}),a.current.isMoved=!0,"function"===n.type(s)&&s.apply(a)))},updateSlide:function(t,e){var o,s=this,i=t.$placeholder;t=t||s.current,t&&!s.isClosing&&(o=t.pos*Math.floor(t.$slide.width())+t.pos*t.opts.gutter,o!==t.leftPos&&(n.fancybox.setTranslate(t.$slide,{top:0,left:o}),t.leftPos=o),e!==!1&&i&&(n.fancybox.setTranslate(i,s.getFitPos(t)),t.pos===s.currPos&&s.updateCursor()),t.$slide.trigger("refresh"),s.trigger("onUpdate",t))},updateCursor:function(t,e){var n,s=this,i=s.$refs.container.removeClass("fancybox-controls--canzoomIn fancybox-controls--canzoomOut fancybox-controls--canGrab");!s.isClosing&&s.opts.touch&&(n=t!==o&&e!==o?t<s.current.width&&e<s.current.height:s.isScaledDown(),n?i.addClass("fancybox-controls--canzoomIn"):s.group.length<2?i.addClass("fancybox-controls--canzoomOut"):i.addClass("fancybox-controls--canGrab"))},loadSlide:function(t){var e,o,s,i=this;if(t&&!t.isLoaded&&!t.isLoading){switch(t.isLoading=!0,i.trigger("beforeLoad",t),e=t.type,o=t.$slide,o.off("refresh").trigger("onReset").addClass("fancybox-slide--"+(e||"unknown")).addClass(t.opts.slideClass),e){case"image":i.setImage(t);break;case"iframe":i.setIframe(t);break;case"html":i.setContent(t,t.content);break;case"inline":n(t.src).length?i.setContent(t,n(t.src)):i.setError(t);break;case"ajax":i.showLoading(t),s=n.ajax(n.extend({},t.opts.ajax.settings,{url:t.src,success:function(e,n){"success"===n&&i.setContent(t,e)},error:function(e,n){e&&"abort"!==n&&i.setError(t)}})),o.one("onReset",function(){s.abort()});break;default:i.setError(t)}return!0}},setImage:function(e){var o,s,i,a,r=this,c=e.opts.image.srcset;if(e.isLoaded&&!e.hasError)return void r.afterLoad(e);if(c){i=t.devicePixelRatio||1,a=t.innerWidth*i,s=c.split(",").map(function(t){var e={};return t.trim().split(/\s+/).forEach(function(t,n){var o=parseInt(t.substring(0,t.length-1),10);return 0===n?e.url=t:void(o&&(e.value=o,e.postfix=t[t.length-1]))}),e}),s.sort(function(t,e){return t.value-e.value});for(var l=0;l<s.length;l++){var u=s[l];if("w"===u.postfix&&u.value>=a||"x"===u.postfix&&u.value>=i){o=u;break}}!o&&s.length&&(o=s[s.length-1]),o&&(e.src=o.url,e.width&&e.height&&"w"==o.postfix&&(e.height=e.width/e.height*o.value,e.width=o.value))}e.$placeholder=n('<div class="fancybox-placeholder"></div>').hide().appendTo(e.$slide),e.opts.preload!==!1&&e.opts.width&&e.opts.height&&(e.opts.thumb||e.opts.$thumb)?(e.width=e.opts.width,e.height=e.opts.height,e.$ghost=n("<img />").one("load error",function(){r.isClosing||(n("<img/>")[0].src=e.src,r.revealImage(e,function(){r.setBigImage(e),r.firstRun&&e.index===r.currIndex&&r.preload()}))}).addClass("fancybox-image").appendTo(e.$placeholder).attr("src",e.opts.thumb||e.opts.$thumb.attr("src"))):r.setBigImage(e)},setBigImage:function(t){var e=this,o=n("<img />");t.$image=o.one("error",function(){e.setError(t)}).one("load",function(){clearTimeout(t.timouts),t.timouts=null,e.isClosing||(t.width=this.naturalWidth,t.height=this.naturalHeight,t.opts.image.srcset&&o.attr("sizes","100vw").attr("srcset",t.opts.image.srcset),e.afterLoad(t),t.$ghost&&(t.timouts=setTimeout(function(){t.$ghost.hide()},350)))}).addClass("fancybox-image").attr("src",t.src).appendTo(t.$placeholder),o[0].complete?o.trigger("load"):o[0].error?o.trigger("error"):t.timouts=setTimeout(function(){o[0].complete||t.hasError||e.showLoading(t)},150),t.opts.image.protect&&n('<div class="fancybox-spaceball"></div>').appendTo(t.$placeholder).on("contextmenu.fb",function(t){return 2==t.button&&t.preventDefault(),!0})},revealImage:function(t,e){var o=this;return e=e||n.noop,"image"!==t.type||t.hasError||t.isRevealed===!0?void e.apply(o):(t.isRevealed=!0,void(t.pos===o.currPos&&o.zoomInOut("In",t.opts.speed,e)||(t.$ghost&&!t.isLoaded&&o.updateSlide(t,!0),t.pos===o.currPos?n.fancybox.animate(t.$placeholder,{opacity:0},{opacity:1},300,e):t.$placeholder.show(),e.apply(o))))},setIframe:function(t){var e,s=this,i=t.opts.iframe,a=t.$slide;t.$content=n('<div class="fancybox-content"></div>').css(i.css).appendTo(a),e=n(i.tpl.replace(/\{rnd\}/g,(new Date).getTime())).attr("scrolling",n.fancybox.isTouch?"auto":i.scrolling).appendTo(t.$content),i.preload?(t.$content.addClass("fancybox-tmp"),s.showLoading(t),e.on("load.fb error.fb",function(e){this.isReady=1,t.$slide.trigger("refresh"),s.afterLoad(t)}),a.on("refresh.fb",function(){var n,s,a,r,c,l=t.$content;if(1===e[0].isReady){try{n=e.contents(),s=n.find("body")}catch(t){}s&&s.length&&(i.css.width===o||i.css.height===o)&&(a=e[0].contentWindow.document.documentElement.scrollWidth,r=Math.ceil(s.outerWidth(!0)+(l.width()-a)),c=Math.ceil(s.outerHeight(!0)),l.css({width:i.css.width===o?r+(l.outerWidth()-l.innerWidth()):i.css.width,height:i.css.height===o?c+(l.outerHeight()-l.innerHeight()):i.css.height})),l.removeClass("fancybox-tmp")}})):this.afterLoad(t),e.attr("src",t.src),t.opts.smallBtn&&t.$content.prepend(t.opts.closeTpl),a.one("onReset",function(){try{n(this).find("iframe").hide().attr("src","//about:blank")}catch(t){}n(this).empty(),t.isLoaded=!1})},setContent:function(t,e){var o=this;o.isClosing||(o.hideLoading(t),t.$slide.empty(),l(e)&&e.parent().length?(e.data("placeholder")&&e.parents(".fancybox-slide").trigger("onReset"),e.data({placeholder:n("<div></div>").hide().insertAfter(e)}).css("display","inline-block")):("string"===n.type(e)&&(e=n("<div>").append(e).contents(),3===e[0].nodeType&&(e=n("<div>").html(e))),t.opts.selector&&(e=n("<div>").html(e).find(t.opts.selector))),t.$slide.one("onReset",function(){var o=l(e)?e.data("placeholder"):0;o&&(e.hide().replaceAll(o),e.data("placeholder",null)),t.hasError||(n(this).empty(),t.isLoaded=!1)}),t.$content=n(e).appendTo(t.$slide),t.opts.smallBtn===!0&&t.$content.find(".fancybox-close-small").remove().end().eq(0).append(t.opts.closeTpl),this.afterLoad(t))},setError:function(t){t.hasError=!0,this.setContent(t,t.opts.errorTpl)},showLoading:function(t){var e=this;t=t||e.current,t&&!t.$spinner&&(t.$spinner=n(e.opts.spinnerTpl).appendTo(t.$slide))},hideLoading:function(t){var e=this;t=t||e.current,t&&t.$spinner&&(t.$spinner.remove(),delete t.$spinner)},afterMove:function(){var t=this,e=t.current,o={};e&&(e.$slide.siblings().trigger("onReset"),n.each(t.slides,function(e,n){n.pos>=t.currPos-1&&n.pos<=t.currPos+1?o[n.pos]=n:n&&n.$slide.remove()}),t.slides=o,t.trigger("afterMove"),e.isLoaded&&t.complete())},afterLoad:function(t){var e=this;e.isClosing||(t.isLoading=!1,t.isLoaded=!0,e.trigger("afterLoad",t),e.hideLoading(t),t.$ghost||e.updateSlide(t,!0),t.index===e.currIndex&&t.isMoved?e.complete():t.$ghost||e.revealImage(t))},complete:function(){var t=this,e=t.current;t.revealImage(e,function(){e.isComplete=!0,e.$slide.addClass("fancybox-slide--complete"),t.updateCursor(),t.trigger("onComplete"),e.opts.focus&&"image"!==e.type&&"iframe"!==e.type&&t.focus()})},preload:function(){var t,e,n=this;n.group.length<2||(t=n.slides[n.currPos+1],e=n.slides[n.currPos-1],t&&"image"===t.type&&n.loadSlide(t),e&&"image"===e.type&&n.loadSlide(e))},focus:function(){var t,e=this.current;t=e&&e.isComplete?e.$slide.find('button,:input,[tabindex],a:not(".disabled")').filter(":visible:first"):null,t&&t.length||(t=this.$refs.container),t.focus(),this.$refs.slider_wrap.scrollLeft(0),e&&e.$slide.scrollTop(0)},activate:function(){var t=this;n(".fancybox-container").each(function(){var e=n(this).data("FancyBox");e&&e.uid!==t.uid&&!e.isClosing&&e.trigger("onDeactivate")}),t.current&&(t.$refs.container.index()>0&&t.$refs.container.prependTo(e.body),t.updateControls()),t.trigger("onActivate"),t.addEvents()},close:function(t){var e=this,o=e.current,s=o.opts.speed,i=n.proxy(function(){e.cleanUp(t)},this);return!e.isAnimating&&!e.isClosing&&(e.trigger("beforeClose",t)===!1?(n.fancybox.stop(e.$refs.slider),void u(function(){e.update(!0,!0,150)})):(e.isClosing=!0,o.timouts&&clearTimeout(o.timouts),t!==!0&&n.fancybox.stop(e.$refs.slider),e.$refs.container.removeClass("fancybox-container--active").addClass("fancybox-container--closing"),o.$slide.removeClass("fancybox-slide--complete").siblings().remove(),o.isMoved||o.$slide.css("overflow","visible"),e.removeEvents(),e.hideLoading(o),e.hideControls(),e.updateCursor(),e.$refs.bg.css("transition-duration",s+"ms"),this.$refs.container.removeClass("fancybox-container--ready"),void(t===!0?setTimeout(i,s):e.zoomInOut("Out",s,i)||n.fancybox.animate(e.$refs.container,null,{opacity:0},s,"easeInSine",i))))},cleanUp:function(t){var e,o=this;o.$refs.slider.children().trigger("onReset"),o.$refs.container.empty().remove(),o.trigger("afterClose",t),o.current=null,e=n.fancybox.getInstance(),e?e.activate():(n("html").removeClass("fancybox-enabled"),n("body").removeAttr("style"),a.scrollTop(o.scrollTop).scrollLeft(o.scrollLeft),n("#fancybox-noscroll").remove()),o.$lastFocus&&o.$lastFocus.focus()},trigger:function(t,o){var s,i=Array.prototype.slice.call(arguments,1),a=this,r=o&&o.opts?o:a.current;return r?i.unshift(r):r=a,i.unshift(a),n.isFunction(r.opts[t])&&(s=r.opts[t].apply(r,i)),s===!1?s:void("afterClose"===t?n(e).trigger(t+".fb",i):a.$refs.container.trigger(t+".fb",i))},toggleControls:function(t){this.isHiddenControls?this.updateControls(t):this.hideControls()},hideControls:function(){this.isHiddenControls=!0,this.$refs.container.removeClass("fancybox-show-controls"),this.$refs.container.removeClass("fancybox-show-caption")},updateControls:function(t){var e=this,o=e.$refs.container,s=e.$refs.caption,i=e.current,a=i.index,r=i.opts,c=r.caption;this.isHiddenControls&&t!==!0||(this.isHiddenControls=!1,o.addClass("fancybox-show-controls").toggleClass("fancybox-show-infobar",!!r.infobar&&e.group.length>1).toggleClass("fancybox-show-buttons",!!r.buttons).toggleClass("fancybox-is-modal",!!r.modal),n(".fancybox-button--left",o).toggleClass("fancybox-button--disabled",!r.loop&&a<=0),n(".fancybox-button--right",o).toggleClass("fancybox-button--disabled",!r.loop&&a>=e.group.length-1),n(".fancybox-button--play",o).toggle(!!(r.slideShow&&e.group.length>1)),n(".fancybox-button--close",o).toggle(!!r.closeBtn),n(".js-fancybox-count",o).html(e.group.length),n(".js-fancybox-index",o).html(a+1),i.$slide.trigger("refresh"),s&&s.empty(),c&&c.length?(s.html(c),this.$refs.container.addClass("fancybox-show-caption "),e.$caption=s):this.$refs.container.removeClass("fancybox-show-caption"))}}),n.fancybox={version:"3.0.47",defaults:i,getInstance:function(t){var e=n('.fancybox-container:not(".fancybox-container--closing"):first').data("FancyBox"),o=Array.prototype.slice.call(arguments,1);return e instanceof p&&("string"===n.type(t)?e[t].apply(e,o):"function"===n.type(t)&&t.apply(e,o),e)},open:function(t,e,n){return new p(t,e,n)},close:function(t){var e=this.getInstance();e&&(e.close(),t===!0&&this.close())},isTouch:e.createTouch!==o&&/Android|webOS|iPhone|iPad|iPod|BlackBerry/i.test(navigator.userAgent),use3d:function(){var n=e.createElement("div");return t.getComputedStyle(n).getPropertyValue("transform")&&!(e.documentMode&&e.documentMode<=11)}(),getTranslate:function(t){var e,n;return!(!t||!t.length)&&(e=t.get(0).getBoundingClientRect(),n=t.eq(0).css("transform"),n&&n.indexOf("matrix")!==-1?(n=n.split("(")[1],n=n.split(")")[0],n=n.split(",")):n=[],n.length?(n=n.length>10?[n[13],n[12],n[0],n[5]]:[n[5],n[4],n[0],n[3]],n=n.map(parseFloat)):n=[0,0,1,1],{top:n[0],left:n[1],scaleX:n[2],scaleY:n[3],opacity:parseFloat(t.css("opacity")),width:e.width,height:e.height})},setTranslate:function(t,e){var n="",s={};if(t&&e)return e.left===o&&e.top===o||(n=(e.left===o?t.position().top:e.left)+"px, "+(e.top===o?t.position().top:e.top)+"px",n=this.use3d?"translate3d("+n+", 0px)":"translate("+n+")"),e.scaleX!==o&&e.scaleY!==o&&(n=(n.length?n+" ":"")+"scale("+e.scaleX+", "+e.scaleY+")"),n.length&&(s.transform=n),e.opacity!==o&&(s.opacity=e.opacity),e.width!==o&&(s.width=e.width),e.height!==o&&(s.height=e.height),t.css(s)},easing:{easeOutCubic:function(t,e,n,o){return n*((t=t/o-1)*t*t+1)+e},easeInCubic:function(t,e,n,o){return n*(t/=o)*t*t+e},easeOutSine:function(t,e,n,o){return n*Math.sin(t/o*(Math.PI/2))+e},easeInSine:function(t,e,n,o){return-n*Math.cos(t/o*(Math.PI/2))+n+e}},stop:function(t){t.removeData("animateID")},animate:function(t,e,s,i,a,r){var c,l,d,p=this,h=null,f=0,g=function(){s.scaleX!==o&&s.scaleY!==o&&e&&e.width!==o&&e.height!==o&&(s.width=e.width*s.scaleX,s.height=e.height*s.scaleY,s.scaleX=1,s.scaleY=1),p.setTranslate(t,s),r()},b=function(n){if(c=[],l=0,t.length&&t.data("animateID")===d){if(n=n||Date.now(),h&&(l=n-h),h=n,f+=l,f>=i)return void g();for(var r in s)s.hasOwnProperty(r)&&e[r]!==o&&(e[r]==s[r]?c[r]=s[r]:c[r]=p.easing[a](f,e[r],s[r]-e[r],i));p.setTranslate(t,c),u(b)}};p.animateID=d=p.animateID===o?1:p.animateID+1,t.data("animateID",d),r===o&&"function"==n.type(a)&&(r=a,a=o),a||(a="easeOutCubic"),r=r||n.noop,e?this.setTranslate(t,e):e=this.getTranslate(t),i?(t.show(),u(b)):g()}},n.fn.fancybox=function(t){return this.off("click.fb-start").on("click.fb-start",{items:this,options:t||{}},s),this},n(e).on("click.fb-start","[data-fancybox]",s)}(window,document,window.jQuery),function(t){"use strict";var e=function(e,n,o){if(e)return o=o||"","object"===t.type(o)&&(o=t.param(o,!0)),t.each(n,function(t,n){e=e.replace("$"+t,n||"")}),o.length&&(e+=(e.indexOf("?")>0?"&":"?")+o),e},n={youtube:{matcher:/(youtube\.com|youtu\.be|youtube\-nocookie\.com)\/(watch\?(.*&)?v=|v\/|u\/|embed\/?)?(videoseries\?list=(.*)|[\w-]{11}|\?listType=(.*)&list=(.*))(.*)/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:"transparent",enablejsapi:1,html5:1},paramPlace:8,type:"iframe",url:"//www.youtube.com/embed/$4",thumb:"//img.youtube.com/vi/$4/hqdefault.jpg"},vimeo:{matcher:/^.+vimeo.com\/(.*\/)?([\d]+)(.*)?/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1,api:1},paramPlace:3,type:"iframe",url:"//player.vimeo.com/video/$2"},metacafe:{matcher:/metacafe.com\/watch\/(\d+)\/(.*)?/,type:"iframe",url:"//www.metacafe.com/embed/$1/?ap=1"},dailymotion:{matcher:/dailymotion.com\/video\/(.*)\/?(.*)/,params:{additionalInfos:0,autoStart:1},type:"iframe",url:"//www.dailymotion.com/embed/video/$1"},vine:{matcher:/vine.co\/v\/([a-zA-Z0-9\?\=\-]+)/,type:"iframe",url:"//vine.co/v/$1/embed/simple"},instagram:{matcher:/(instagr\.am|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,type:"image",url:"//$1/p/$2/media/?size=l"},google_maps:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.*)\/)?\@(.*),(\d+.?\d+?)z))|(\?ll=))(.*)?/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/?ll="+(t[9]?t[9]+"&z="+Math.floor(t[10])+(t[12]?t[12].replace(/^\//,"&"):""):t[12])+"&output="+(t[12]&&t[12].indexOf("layer=c")>0?"svembed":"embed")}}};t(document).on("onInit.fb",function(o,s){t.each(s.group,function(o,s){var i,a,r,c,l,u,d=s.src||"",p=!1;s.type||(t.each(n,function(n,o){if(a=d.match(o.matcher),l={},u=n,a){if(p=o.type,o.paramPlace&&a[o.paramPlace]){c=a[o.paramPlace],"?"==c[0]&&(c=c.substring(1)),c=c.split("&");for(var h=0;h<c.length;++h){var f=c[h].split("=",2);2==f.length&&(l[f[0]]=decodeURIComponent(f[1].replace(/\+/g," ")))}}return r=t.extend(!0,{},o.params,s.opts[n],l),d="function"===t.type(o.url)?o.url.call(this,a,r,s):e(o.url,a,r),i="function"===t.type(o.thumb)?o.thumb.call(this,a,r,s):e(o.thumb,a),"vimeo"===u&&(d=d.replace("&%23","#")),!1}}),p?(s.src=d,s.type=p,s.opts.thumb||s.opts.$thumb&&s.opts.$thumb.length||(s.opts.thumb=i),"iframe"===p&&(t.extend(!0,s.opts,{iframe:{preload:!1,scrolling:"no"},smallBtn:!1,closeBtn:!0,fullScreen:!1,slideShow:!1}),s.opts.slideClass+=" fancybox-slide--video")):s.type="iframe")})})}(window.jQuery),function(t,e,n){"use strict";var o=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||function(e){t.setTimeout(e,1e3/60)}}(),s=function(e){var n=[];e=e.originalEvent||e||t.e,e=e.touches&&e.touches.length?e.touches:e.changedTouches&&e.changedTouches.length?e.changedTouches:[e];for(var o in e)e[o].pageX?n.push({x:e[o].pageX,y:e[o].pageY}):e[o].clientX&&n.push({x:e[o].clientX,y:e[o].clientY});return n},i=function(t,e,n){return e&&t?"x"===n?t.x-e.x:"y"===n?t.y-e.y:Math.sqrt(Math.pow(t.x-e.x,2)+Math.pow(t.y-e.y,2)):0},a=function(t){return t.is("a")||t.is("button")||t.is("input")||t.is("select")||t.is("textarea")||n.isFunction(t.get(0).onclick)},r=function(e){var n=t.getComputedStyle(e)["overflow-y"],o=t.getComputedStyle(e)["overflow-x"],s=("scroll"===n||"auto"===n)&&e.scrollHeight>e.clientHeight,i=("scroll"===o||"auto"===o)&&e.scrollWidth>e.clientWidth;return s||i},c=function(t){for(var e=!1;;){if(e=r(t.get(0)))break;if(t=t.parent(),!t.length||t.hasClass("fancybox-slider")||t.is("body"))break}return e},l=function(t){var e=this;e.instance=t,e.$wrap=t.$refs.slider_wrap,e.$slider=t.$refs.slider,e.$container=t.$refs.container,e.destroy(),e.$wrap.on("touchstart.fb mousedown.fb",n.proxy(e,"ontouchstart"))};l.prototype.destroy=function(){this.$wrap.off("touchstart.fb mousedown.fb touchmove.fb mousemove.fb touchend.fb touchcancel.fb mouseup.fb mouseleave.fb")},l.prototype.ontouchstart=function(e){var o=this,r=n(e.target),l=o.instance,u=l.current,d=u.$content||u.$placeholder;return o.startPoints=s(e),o.$target=r,o.$content=d,o.canvasWidth=Math.round(u.$slide[0].clientWidth),o.canvasHeight=Math.round(u.$slide[0].clientHeight),o.startEvent=e,e.originalEvent.clientX>o.canvasWidth+u.$slide.offset().left||(a(r)||a(r.parent())||c(r)?void 0:u.opts.touch?void(e.originalEvent&&2==e.originalEvent.button||(e.stopPropagation(),e.preventDefault(),!u||o.instance.isAnimating||o.instance.isClosing||!o.startPoints||o.startPoints.length>1&&!u.isMoved||(o.$wrap.off("touchmove.fb mousemove.fb",n.proxy(o,"ontouchmove")),o.$wrap.off("touchend.fb touchcancel.fb mouseup.fb mouseleave.fb",n.proxy(o,"ontouchend")),o.$wrap.on("touchend.fb touchcancel.fb mouseup.fb mouseleave.fb",n.proxy(o,"ontouchend")),o.$wrap.on("touchmove.fb mousemove.fb",n.proxy(o,"ontouchmove")),o.startTime=(new Date).getTime(),o.distanceX=o.distanceY=o.distance=0,o.canTap=!1,o.isPanning=!1,o.isSwiping=!1,o.isZooming=!1,o.sliderStartPos=n.fancybox.getTranslate(o.$slider),o.contentStartPos=n.fancybox.getTranslate(o.$content),o.contentLastPos=null,1!==o.startPoints.length||o.isZooming||(o.canTap=u.isMoved,"image"===u.type&&(o.contentStartPos.width>o.canvasWidth+1||o.contentStartPos.height>o.canvasHeight+1)?(n.fancybox.stop(o.$content),o.isPanning=!0):(n.fancybox.stop(o.$slider),o.isSwiping=!0),o.$container.addClass("fancybox-controls--isGrabbing")),2===o.startPoints.length&&u.isMoved&&!u.hasError&&"image"===u.type&&(u.isLoaded||u.$ghost)&&(o.isZooming=!0,o.isSwiping=!1,o.isPanning=!1,n.fancybox.stop(o.$content),o.centerPointStartX=.5*(o.startPoints[0].x+o.startPoints[1].x)-n(t).scrollLeft(),o.centerPointStartY=.5*(o.startPoints[0].y+o.startPoints[1].y)-n(t).scrollTop(),o.percentageOfImageAtPinchPointX=(o.centerPointStartX-o.contentStartPos.left)/o.contentStartPos.width,o.percentageOfImageAtPinchPointY=(o.centerPointStartY-o.contentStartPos.top)/o.contentStartPos.height,o.startDistanceBetweenFingers=i(o.startPoints[0],o.startPoints[1]))))):(o.endPoints=o.startPoints,o.ontap()))},l.prototype.ontouchmove=function(t){var e=this;t.preventDefault(),e.newPoints=s(t),e.newPoints&&e.newPoints.length&&(e.distanceX=i(e.newPoints[0],e.startPoints[0],"x"),e.distanceY=i(e.newPoints[0],e.startPoints[0],"y"),e.distance=i(e.newPoints[0],e.startPoints[0]),e.distance>0&&(e.isSwiping?e.onSwipe():e.isPanning?e.onPan():e.isZooming&&e.onZoom()))},l.prototype.onSwipe=function(){var e,s=this,i=s.isSwiping,a=s.sliderStartPos.left;i===!0?Math.abs(s.distance)>10&&(s.instance.group.length<2?s.isSwiping="y":!s.instance.current.isMoved||s.instance.opts.touch.vertical===!1||"auto"===s.instance.opts.touch.vertical&&n(t).width()>800?s.isSwiping="x":(e=Math.abs(180*Math.atan2(s.distanceY,s.distanceX)/Math.PI), +s.isSwiping=e>45&&e<135?"y":"x"),s.canTap=!1,s.instance.current.isMoved=!1,s.startPoints=s.newPoints):("x"==i&&(!s.instance.current.opts.loop&&0===s.instance.current.index&&s.distanceX>0?a+=Math.pow(s.distanceX,.8):!s.instance.current.opts.loop&&s.instance.current.index===s.instance.group.length-1&&s.distanceX<0?a-=Math.pow(-s.distanceX,.8):a+=s.distanceX),s.sliderLastPos={top:"x"==i?0:s.sliderStartPos.top+s.distanceY,left:a},o(function(){n.fancybox.setTranslate(s.$slider,s.sliderLastPos)}))},l.prototype.onPan=function(){var t,e,s,i=this;i.canTap=!1,t=i.contentStartPos.width>i.canvasWidth?i.contentStartPos.left+i.distanceX:i.contentStartPos.left,e=i.contentStartPos.top+i.distanceY,s=i.limitMovement(t,e,i.contentStartPos.width,i.contentStartPos.height),s.scaleX=i.contentStartPos.scaleX,s.scaleY=i.contentStartPos.scaleY,i.contentLastPos=s,o(function(){n.fancybox.setTranslate(i.$content,i.contentLastPos)})},l.prototype.limitMovement=function(t,e,n,o){var s,i,a,r,c=this,l=c.canvasWidth,u=c.canvasHeight,d=c.contentStartPos.left,p=c.contentStartPos.top,h=c.distanceX,f=c.distanceY;return s=Math.max(0,.5*l-.5*n),i=Math.max(0,.5*u-.5*o),a=Math.min(l-n,.5*l-.5*n),r=Math.min(u-o,.5*u-.5*o),n>l&&(h>0&&t>s&&(t=s-1+Math.pow(-s+d+h,.8)||0),h<0&&t<a&&(t=a+1-Math.pow(a-d-h,.8)||0)),o>u&&(f>0&&e>i&&(e=i-1+Math.pow(-i+p+f,.8)||0),f<0&&e<r&&(e=r+1-Math.pow(r-p-f,.8)||0)),{top:e,left:t}},l.prototype.limitPosition=function(t,e,n,o){var s=this,i=s.canvasWidth,a=s.canvasHeight;return n>i?(t=t>0?0:t,t=t<i-n?i-n:t):t=Math.max(0,i/2-n/2),o>a?(e=e>0?0:e,e=e<a-o?a-o:e):e=Math.max(0,a/2-o/2),{top:e,left:t}},l.prototype.onZoom=function(){var e=this,s=e.contentStartPos.width,a=e.contentStartPos.height,r=e.contentStartPos.left,c=e.contentStartPos.top,l=i(e.newPoints[0],e.newPoints[1]),u=l/e.startDistanceBetweenFingers,d=Math.floor(s*u),p=Math.floor(a*u),h=(s-d)*e.percentageOfImageAtPinchPointX,f=(a-p)*e.percentageOfImageAtPinchPointY,g=(e.newPoints[0].x+e.newPoints[1].x)/2-n(t).scrollLeft(),b=(e.newPoints[0].y+e.newPoints[1].y)/2-n(t).scrollTop(),m=g-e.centerPointStartX,y=b-e.centerPointStartY,v=r+(h+m),x=c+(f+y),w={top:x,left:v,scaleX:e.contentStartPos.scaleX*u,scaleY:e.contentStartPos.scaleY*u};e.canTap=!1,e.newWidth=d,e.newHeight=p,e.contentLastPos=w,o(function(){n.fancybox.setTranslate(e.$content,e.contentLastPos)})},l.prototype.ontouchend=function(t){var e=this,o=e.instance.current,i=Math.max((new Date).getTime()-e.startTime,1),a=e.isSwiping,r=e.isPanning,c=e.isZooming;return e.endPoints=s(t),e.$container.removeClass("fancybox-controls--isGrabbing"),e.$wrap.off("touchmove.fb mousemove.fb",n.proxy(this,"ontouchmove")),e.$wrap.off("touchend.fb touchcancel.fb mouseup.fb mouseleave.fb",n.proxy(this,"ontouchend")),e.isSwiping=!1,e.isPanning=!1,e.isZooming=!1,e.canTap?e.ontap():(e.velocityX=e.distanceX/i*.5,e.velocityY=e.distanceY/i*.5,e.speed=o.opts.speed||330,e.speedX=Math.max(.75*e.speed,Math.min(1.5*e.speed,1/Math.abs(e.velocityX)*e.speed)),e.speedY=Math.max(.75*e.speed,Math.min(1.5*e.speed,1/Math.abs(e.velocityY)*e.speed)),void(r?e.endPanning():c?e.endZooming():e.endSwiping(a)))},l.prototype.endSwiping=function(t){var e=this;"y"==t&&Math.abs(e.distanceY)>50?(n.fancybox.animate(e.$slider,null,{top:e.sliderStartPos.top+e.distanceY+150*e.velocityY,left:e.sliderStartPos.left,opacity:0},e.speedY),e.instance.close(!0)):"x"==t&&e.distanceX>50?e.instance.previous(e.speedX):"x"==t&&e.distanceX<-50?e.instance.next(e.speedX):e.instance.update(!1,!0,150)},l.prototype.endPanning=function(){var t,e,o,s=this;s.contentLastPos&&(t=s.contentLastPos.left+s.velocityX*s.speed*2,e=s.contentLastPos.top+s.velocityY*s.speed*2,o=s.limitPosition(t,e,s.contentStartPos.width,s.contentStartPos.height),o.width=s.contentStartPos.width,o.height=s.contentStartPos.height,n.fancybox.animate(s.$content,null,o,s.speed,"easeOutSine"))},l.prototype.endZooming=function(){var t,e,o,s,i=this,a=i.instance.current,r=i.newWidth,c=i.newHeight;i.contentLastPos&&(t=i.contentLastPos.left,e=i.contentLastPos.top,s={top:e,left:t,width:r,height:c,scaleX:1,scaleY:1},n.fancybox.setTranslate(i.$content,s),r<i.canvasWidth&&c<i.canvasHeight?i.instance.scaleToFit(150):r>a.width||c>a.height?i.instance.scaleToActual(i.centerPointStartX,i.centerPointStartY,150):(o=i.limitPosition(t,e,r,c),n.fancybox.animate(i.$content,null,o,i.speed,"easeOutSine")))},l.prototype.ontap=function(){var t=this,e=t.instance,o=e.current,s=t.endPoints[0].x,i=t.endPoints[0].y;if(s-=t.$wrap.offset().left,i-=t.$wrap.offset().top,e.SlideShow&&e.SlideShow.isActive&&e.SlideShow.stop(),!n.fancybox.isTouch)return o.opts.closeClickOutside&&t.$target.is(".fancybox-slide")?void e.close(t.startEvent):void("image"==o.type&&o.isMoved&&(e.canPan()?e.scaleToFit():e.isScaledDown()?e.scaleToActual(s,i):e.group.length<2&&e.close(t.startEvent)));if(t.tapped){if(clearTimeout(t.tapped),t.tapped=null,Math.abs(s-t.x)>50||Math.abs(i-t.y)>50||!o.isMoved)return this;"image"==o.type&&(o.isLoaded||o.$ghost)&&(e.canPan()?e.scaleToFit():e.isScaledDown()&&e.scaleToActual(s,i))}else t.x=s,t.y=i,t.tapped=setTimeout(function(){t.tapped=null,e.toggleControls(!0)},300);return this},n(e).on("onActivate.fb",function(t,e){e&&!e.Guestures&&(e.Guestures=new l(e))}),n(e).on("beforeClose.fb",function(t,e){e&&e.Guestures&&e.Guestures.destroy()})}(window,document,window.jQuery),function(t,e){"use strict";var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{timer:null,isActive:!1,$button:null,speed:3e3,init:function(){var t=this;t.$button=e('<button data-fancybox-play class="fancybox-button fancybox-button--play" title="Slideshow (P)"></button>').appendTo(t.instance.$refs.buttons),t.instance.$refs.container.on("click","[data-fancybox-play]",function(){t.toggle()})},set:function(){var t=this;t.instance&&t.instance.current&&(t.instance.current.opts.loop||t.instance.currIndex<t.instance.group.length-1)?t.timer=setTimeout(function(){t.instance.next()},t.instance.current.opts.slideShow.speed||t.speed):t.stop()},clear:function(){var t=this;clearTimeout(t.timer),t.timer=null},start:function(){var t=this;t.stop(),t.instance&&t.instance.current&&(t.instance.current.opts.loop||t.instance.currIndex<t.instance.group.length-1)&&(t.instance.$refs.container.on({"beforeLoad.fb.player":e.proxy(t,"clear"),"onComplete.fb.player":e.proxy(t,"set")}),t.isActive=!0,t.instance.current.isComplete&&t.set(),t.instance.$refs.container.trigger("onPlayStart"),t.$button.addClass("fancybox-button--pause"))},stop:function(){var t=this;t.clear(),t.instance.$refs.container.trigger("onPlayEnd").off(".player"),t.$button.removeClass("fancybox-button--pause"),t.isActive=!1},toggle:function(){var t=this;t.isActive?t.stop():t.start()}}),e(t).on("onInit.fb",function(t,e){e&&e.group.length>1&&e.opts.slideShow&&!e.SlideShow&&(e.SlideShow=new n(e))}),e(t).on("beforeClose.fb onDeactivate.fb",function(t,e){e&&e.SlideShow&&e.SlideShow.stop()})}(document,window.jQuery),function(t,e){"use strict";var n=function(){var e,n,o,s=[["requestFullscreen","exitFullscreen","fullscreenElement","fullscreenEnabled","fullscreenchange","fullscreenerror"],["webkitRequestFullscreen","webkitExitFullscreen","webkitFullscreenElement","webkitFullscreenEnabled","webkitfullscreenchange","webkitfullscreenerror"],["webkitRequestFullScreen","webkitCancelFullScreen","webkitCurrentFullScreenElement","webkitCancelFullScreen","webkitfullscreenchange","webkitfullscreenerror"],["mozRequestFullScreen","mozCancelFullScreen","mozFullScreenElement","mozFullScreenEnabled","mozfullscreenchange","mozfullscreenerror"],["msRequestFullscreen","msExitFullscreen","msFullscreenElement","msFullscreenEnabled","MSFullscreenChange","MSFullscreenError"]],i={};for(n=0;n<s.length;n++)if(e=s[n],e&&e[1]in t){for(o=0;o<e.length;o++)i[s[0][o]]=e[o];return i}return!1}();if(n){var o={request:function(e){e=e||t.documentElement,e[n.requestFullscreen](e.ALLOW_KEYBOARD_INPUT)},exit:function(){t[n.exitFullscreen]()},toggle:function(t){this.isFullscreen()?this.exit():this.request(t)},isFullscreen:function(){return Boolean(t[n.fullscreenElement])},enabled:function(){return Boolean(t[n.fullscreenEnabled])}};e(t).on({"onInit.fb":function(t,n){var s;n&&n.opts.fullScreen&&!n.FullScreen&&(s=n.$refs.container,n.$refs.button_fs=e('<button data-fancybox-fullscreen class="fancybox-button fancybox-button--fullscreen" title="Full screen (F)"></button>').appendTo(n.$refs.buttons),s.on("click.fb-fullscreen","[data-fancybox-fullscreen]",function(t){t.stopPropagation(),t.preventDefault(),o.toggle(s[0])}),n.opts.fullScreen.requestOnStart===!0&&o.request(s[0]))},"beforeMove.fb":function(t,e){e&&e.$refs.button_fs&&e.$refs.button_fs.toggle(!!e.current.opts.fullScreen)},"beforeClose.fb":function(){o.exit()}}),e(t).on(n.fullscreenchange,function(){var t=e.fancybox.getInstance(),n=t?t.current.$placeholder:null;n&&(n.css("transition","none"),t.isAnimating=!1,t.update(!0,!0,0))})}}(document,window.jQuery),function(t,e){"use strict";var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{$button:null,$grid:null,$list:null,isVisible:!1,init:function(){var t=this;t.$button=e('<button data-fancybox-thumbs class="fancybox-button fancybox-button--thumbs" title="Thumbnails (G)"></button>').appendTo(this.instance.$refs.buttons).on("touchend click",function(e){e.stopPropagation(),e.preventDefault(),t.toggle()})},create:function(){var t,n,o=this.instance;this.$grid=e('<div class="fancybox-thumbs"></div>').appendTo(o.$refs.container),t="<ul>",e.each(o.group,function(e,o){n=o.opts.thumb||(o.opts.$thumb?o.opts.$thumb.attr("src"):null),n||"image"!==o.type||(n=o.src),n&&n.length&&(t+='<li data-index="'+e+'" tabindex="0" class="fancybox-thumbs-loading"><img data-src="'+n+'" /></li>')}),t+="</ul>",this.$list=e(t).appendTo(this.$grid).on("click touchstart","li",function(){o.jumpTo(e(this).data("index"))}),this.$list.find("img").hide().one("load",function(){var t,n,o,s,i=e(this).parent().removeClass("fancybox-thumbs-loading"),a=i.outerWidth(),r=i.outerHeight();t=this.naturalWidth||this.width,n=this.naturalHeight||this.height,o=t/a,s=n/r,o>=1&&s>=1&&(o>s?(t/=s,n=r):(t=a,n/=o)),e(this).css({width:Math.floor(t),height:Math.floor(n),"margin-top":Math.min(0,Math.floor(.3*r-.3*n)),"margin-left":Math.min(0,Math.floor(.5*a-.5*t))}).show()}).each(function(){this.src=e(this).data("src")})},focus:function(){this.instance.current&&this.$list.children().removeClass("fancybox-thumbs-active").filter('[data-index="'+this.instance.current.index+'"]').addClass("fancybox-thumbs-active").focus()},close:function(){this.$grid.hide()},update:function(){this.instance.$refs.container.toggleClass("fancybox-container--thumbs",this.isVisible),this.isVisible?(this.$grid||this.create(),this.$grid.show(),this.focus()):this.$grid&&this.$grid.hide(),this.instance.update()},hide:function(){this.isVisible=!1,this.update()},show:function(){this.isVisible=!0,this.update()},toggle:function(){this.isVisible?this.hide():this.show()}}),e(t).on("onInit.fb",function(t,e){var o=e.group[0],s=e.group[1];e.opts.thumbs&&!e.Thumbs&&e.group.length>1&&("image"==o.type||o.opts.thumb||o.opts.$thumb)&&("image"==s.type||s.opts.thumb||s.opts.$thumb)&&(e.Thumbs=new n(e))}),e(t).on("beforeMove.fb",function(t,e,n){var o=e&&e.Thumbs;o&&(n.modal?(o.$button.hide(),o.hide()):(e.opts.thumbs.showOnStart===!0&&e.firstRun&&o.show(),o.$button.show(),o.isVisible&&o.focus()))}),e(t).on("beforeClose.fb",function(t,e){e&&e.Thumbs&&(e.Thumbs.isVisible&&e.opts.thumbs.hideOnClosing!==!1&&e.Thumbs.close(),e.Thumbs=null)})}(document,window.jQuery),function(t,e,n){"use strict";function o(){var t=e.location.hash.substr(1),n=t.split("-"),o=n.length>1&&/^\+?\d+$/.test(n[n.length-1])?parseInt(n.pop(-1),10)||1:1,s=n.join("-");return o<1&&(o=1),{hash:t,index:o,gallery:s}}function s(t){var e;""!==t.gallery&&(e=n("[data-fancybox='"+n.escapeSelector(t.gallery)+"']").eq(t.index-1),e.length?e.trigger("click"):n("#"+n.escapeSelector(t.gallery)).trigger("click"))}function i(t){var e;return!!t&&(e=t.current?t.current.opts:t.opts,e.$orig?e.$orig.data("fancybox"):e.hash||"")}n.escapeSelector||(n.escapeSelector=function(t){var e=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g,n=function(t,e){return e?"\0"===t?"�":t.slice(0,-1)+"\\"+t.charCodeAt(t.length-1).toString(16)+" ":"\\"+t};return(t+"").replace(e,n)});var a=null;n(function(){setTimeout(function(){n.fancybox.defaults.hash!==!1&&(n(e).on("hashchange.fb",function(){var t=o();n.fancybox.getInstance()?a&&a!==t.gallery+"-"+t.index&&(a=null,n.fancybox.close()):""!==t.gallery&&s(t)}),n(t).on({"onInit.fb":function(t,e){var n=o(),s=i(e);s&&n.gallery&&s==n.gallery&&(e.currIndex=n.index-1)},"beforeMove.fb":function(n,o,s){var r=i(o);r&&""!==r&&(e.location.hash.indexOf(r)<0&&(o.opts.origHash=e.location.hash),a=r+(o.group.length>1?"-"+(s.index+1):""),"pushState"in history?history.pushState("",t.title,e.location.pathname+e.location.search+"#"+a):e.location.hash=a)},"beforeClose.fb":function(n,o,s){var r=i(o),c=o&&o.opts.origHash?o.opts.origHash:"";r&&""!==r&&("pushState"in history?history.pushState("",t.title,e.location.pathname+e.location.search+c):e.location.hash=c),a=null}}),s(o()))},50)})}(document,window,window.jQuery);
\ No newline at end of file diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.fancybox.min.js.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.fancybox.min.js.meta new file mode 100644 index 00000000..3adc1b73 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.fancybox.min.js.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: aae75c2781a58f542868b8b86ec348be +TextScriptImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.js b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.js new file mode 100644 index 00000000..a1c07fd8 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.js @@ -0,0 +1,2 @@ +/*! jQuery v3.4.1 | (c) JS Foundation and other contributors | jquery.org/license */ +!function(e,t){"use strict";"object"==typeof module&&"object"==typeof module.exports?module.exports=e.document?t(e,!0):function(e){if(!e.document)throw new Error("jQuery requires a window with a document");return t(e)}:t(e)}("undefined"!=typeof window?window:this,function(C,e){"use strict";var t=[],E=C.document,r=Object.getPrototypeOf,s=t.slice,g=t.concat,u=t.push,i=t.indexOf,n={},o=n.toString,v=n.hasOwnProperty,a=v.toString,l=a.call(Object),y={},m=function(e){return"function"==typeof e&&"number"!=typeof e.nodeType},x=function(e){return null!=e&&e===e.window},c={type:!0,src:!0,nonce:!0,noModule:!0};function b(e,t,n){var r,i,o=(n=n||E).createElement("script");if(o.text=e,t)for(r in c)(i=t[r]||t.getAttribute&&t.getAttribute(r))&&o.setAttribute(r,i);n.head.appendChild(o).parentNode.removeChild(o)}function w(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[o.call(e)]||"object":typeof e}var f="3.4.1",k=function(e,t){return new k.fn.init(e,t)},p=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g;function d(e){var t=!!e&&"length"in e&&e.length,n=w(e);return!m(e)&&!x(e)&&("array"===n||0===t||"number"==typeof t&&0<t&&t-1 in e)}k.fn=k.prototype={jquery:f,constructor:k,length:0,toArray:function(){return s.call(this)},get:function(e){return null==e?s.call(this):e<0?this[e+this.length]:this[e]},pushStack:function(e){var t=k.merge(this.constructor(),e);return t.prevObject=this,t},each:function(e){return k.each(this,e)},map:function(n){return this.pushStack(k.map(this,function(e,t){return n.call(e,t,e)}))},slice:function(){return this.pushStack(s.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(e){var t=this.length,n=+e+(e<0?t:0);return this.pushStack(0<=n&&n<t?[this[n]]:[])},end:function(){return this.prevObject||this.constructor()},push:u,sort:t.sort,splice:t.splice},k.extend=k.fn.extend=function(){var e,t,n,r,i,o,a=arguments[0]||{},s=1,u=arguments.length,l=!1;for("boolean"==typeof a&&(l=a,a=arguments[s]||{},s++),"object"==typeof a||m(a)||(a={}),s===u&&(a=this,s--);s<u;s++)if(null!=(e=arguments[s]))for(t in e)r=e[t],"__proto__"!==t&&a!==r&&(l&&r&&(k.isPlainObject(r)||(i=Array.isArray(r)))?(n=a[t],o=i&&!Array.isArray(n)?[]:i||k.isPlainObject(n)?n:{},i=!1,a[t]=k.extend(l,o,r)):void 0!==r&&(a[t]=r));return a},k.extend({expando:"jQuery"+(f+Math.random()).replace(/\D/g,""),isReady:!0,error:function(e){throw new Error(e)},noop:function(){},isPlainObject:function(e){var t,n;return!(!e||"[object Object]"!==o.call(e))&&(!(t=r(e))||"function"==typeof(n=v.call(t,"constructor")&&t.constructor)&&a.call(n)===l)},isEmptyObject:function(e){var t;for(t in e)return!1;return!0},globalEval:function(e,t){b(e,{nonce:t&&t.nonce})},each:function(e,t){var n,r=0;if(d(e)){for(n=e.length;r<n;r++)if(!1===t.call(e[r],r,e[r]))break}else for(r in e)if(!1===t.call(e[r],r,e[r]))break;return e},trim:function(e){return null==e?"":(e+"").replace(p,"")},makeArray:function(e,t){var n=t||[];return null!=e&&(d(Object(e))?k.merge(n,"string"==typeof e?[e]:e):u.call(n,e)),n},inArray:function(e,t,n){return null==t?-1:i.call(t,e,n)},merge:function(e,t){for(var n=+t.length,r=0,i=e.length;r<n;r++)e[i++]=t[r];return e.length=i,e},grep:function(e,t,n){for(var r=[],i=0,o=e.length,a=!n;i<o;i++)!t(e[i],i)!==a&&r.push(e[i]);return r},map:function(e,t,n){var r,i,o=0,a=[];if(d(e))for(r=e.length;o<r;o++)null!=(i=t(e[o],o,n))&&a.push(i);else for(o in e)null!=(i=t(e[o],o,n))&&a.push(i);return g.apply([],a)},guid:1,support:y}),"function"==typeof Symbol&&(k.fn[Symbol.iterator]=t[Symbol.iterator]),k.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(e,t){n["[object "+t+"]"]=t.toLowerCase()});var h=function(n){var e,d,b,o,i,h,f,g,w,u,l,T,C,a,E,v,s,c,y,k="sizzle"+1*new Date,m=n.document,S=0,r=0,p=ue(),x=ue(),N=ue(),A=ue(),D=function(e,t){return e===t&&(l=!0),0},j={}.hasOwnProperty,t=[],q=t.pop,L=t.push,H=t.push,O=t.slice,P=function(e,t){for(var n=0,r=e.length;n<r;n++)if(e[n]===t)return n;return-1},R="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",M="[\\x20\\t\\r\\n\\f]",I="(?:\\\\.|[\\w-]|[^\0-\\xa0])+",W="\\["+M+"*("+I+")(?:"+M+"*([*^$|!~]?=)"+M+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+I+"))|)"+M+"*\\]",$=":("+I+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+W+")*)|.*)\\)|)",F=new RegExp(M+"+","g"),B=new RegExp("^"+M+"+|((?:^|[^\\\\])(?:\\\\.)*)"+M+"+$","g"),_=new RegExp("^"+M+"*,"+M+"*"),z=new RegExp("^"+M+"*([>+~]|"+M+")"+M+"*"),U=new RegExp(M+"|>"),X=new RegExp($),V=new RegExp("^"+I+"$"),G={ID:new RegExp("^#("+I+")"),CLASS:new RegExp("^\\.("+I+")"),TAG:new RegExp("^("+I+"|[*])"),ATTR:new RegExp("^"+W),PSEUDO:new RegExp("^"+$),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+M+"*(even|odd|(([+-]|)(\\d*)n|)"+M+"*(?:([+-]|)"+M+"*(\\d+)|))"+M+"*\\)|)","i"),bool:new RegExp("^(?:"+R+")$","i"),needsContext:new RegExp("^"+M+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+M+"*((?:-\\d)?\\d*)"+M+"*\\)|)(?=[^-]|$)","i")},Y=/HTML$/i,Q=/^(?:input|select|textarea|button)$/i,J=/^h\d$/i,K=/^[^{]+\{\s*\[native \w/,Z=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,ee=/[+~]/,te=new RegExp("\\\\([\\da-f]{1,6}"+M+"?|("+M+")|.)","ig"),ne=function(e,t,n){var r="0x"+t-65536;return r!=r||n?t:r<0?String.fromCharCode(r+65536):String.fromCharCode(r>>10|55296,1023&r|56320)},re=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,ie=function(e,t){return t?"\0"===e?"\ufffd":e.slice(0,-1)+"\\"+e.charCodeAt(e.length-1).toString(16)+" ":"\\"+e},oe=function(){T()},ae=be(function(e){return!0===e.disabled&&"fieldset"===e.nodeName.toLowerCase()},{dir:"parentNode",next:"legend"});try{H.apply(t=O.call(m.childNodes),m.childNodes),t[m.childNodes.length].nodeType}catch(e){H={apply:t.length?function(e,t){L.apply(e,O.call(t))}:function(e,t){var n=e.length,r=0;while(e[n++]=t[r++]);e.length=n-1}}}function se(t,e,n,r){var i,o,a,s,u,l,c,f=e&&e.ownerDocument,p=e?e.nodeType:9;if(n=n||[],"string"!=typeof t||!t||1!==p&&9!==p&&11!==p)return n;if(!r&&((e?e.ownerDocument||e:m)!==C&&T(e),e=e||C,E)){if(11!==p&&(u=Z.exec(t)))if(i=u[1]){if(9===p){if(!(a=e.getElementById(i)))return n;if(a.id===i)return n.push(a),n}else if(f&&(a=f.getElementById(i))&&y(e,a)&&a.id===i)return n.push(a),n}else{if(u[2])return H.apply(n,e.getElementsByTagName(t)),n;if((i=u[3])&&d.getElementsByClassName&&e.getElementsByClassName)return H.apply(n,e.getElementsByClassName(i)),n}if(d.qsa&&!A[t+" "]&&(!v||!v.test(t))&&(1!==p||"object"!==e.nodeName.toLowerCase())){if(c=t,f=e,1===p&&U.test(t)){(s=e.getAttribute("id"))?s=s.replace(re,ie):e.setAttribute("id",s=k),o=(l=h(t)).length;while(o--)l[o]="#"+s+" "+xe(l[o]);c=l.join(","),f=ee.test(t)&&ye(e.parentNode)||e}try{return H.apply(n,f.querySelectorAll(c)),n}catch(e){A(t,!0)}finally{s===k&&e.removeAttribute("id")}}}return g(t.replace(B,"$1"),e,n,r)}function ue(){var r=[];return function e(t,n){return r.push(t+" ")>b.cacheLength&&delete e[r.shift()],e[t+" "]=n}}function le(e){return e[k]=!0,e}function ce(e){var t=C.createElement("fieldset");try{return!!e(t)}catch(e){return!1}finally{t.parentNode&&t.parentNode.removeChild(t),t=null}}function fe(e,t){var n=e.split("|"),r=n.length;while(r--)b.attrHandle[n[r]]=t}function pe(e,t){var n=t&&e,r=n&&1===e.nodeType&&1===t.nodeType&&e.sourceIndex-t.sourceIndex;if(r)return r;if(n)while(n=n.nextSibling)if(n===t)return-1;return e?1:-1}function de(t){return function(e){return"input"===e.nodeName.toLowerCase()&&e.type===t}}function he(n){return function(e){var t=e.nodeName.toLowerCase();return("input"===t||"button"===t)&&e.type===n}}function ge(t){return function(e){return"form"in e?e.parentNode&&!1===e.disabled?"label"in e?"label"in e.parentNode?e.parentNode.disabled===t:e.disabled===t:e.isDisabled===t||e.isDisabled!==!t&&ae(e)===t:e.disabled===t:"label"in e&&e.disabled===t}}function ve(a){return le(function(o){return o=+o,le(function(e,t){var n,r=a([],e.length,o),i=r.length;while(i--)e[n=r[i]]&&(e[n]=!(t[n]=e[n]))})})}function ye(e){return e&&"undefined"!=typeof e.getElementsByTagName&&e}for(e in d=se.support={},i=se.isXML=function(e){var t=e.namespaceURI,n=(e.ownerDocument||e).documentElement;return!Y.test(t||n&&n.nodeName||"HTML")},T=se.setDocument=function(e){var t,n,r=e?e.ownerDocument||e:m;return r!==C&&9===r.nodeType&&r.documentElement&&(a=(C=r).documentElement,E=!i(C),m!==C&&(n=C.defaultView)&&n.top!==n&&(n.addEventListener?n.addEventListener("unload",oe,!1):n.attachEvent&&n.attachEvent("onunload",oe)),d.attributes=ce(function(e){return e.className="i",!e.getAttribute("className")}),d.getElementsByTagName=ce(function(e){return e.appendChild(C.createComment("")),!e.getElementsByTagName("*").length}),d.getElementsByClassName=K.test(C.getElementsByClassName),d.getById=ce(function(e){return a.appendChild(e).id=k,!C.getElementsByName||!C.getElementsByName(k).length}),d.getById?(b.filter.ID=function(e){var t=e.replace(te,ne);return function(e){return e.getAttribute("id")===t}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&E){var n=t.getElementById(e);return n?[n]:[]}}):(b.filter.ID=function(e){var n=e.replace(te,ne);return function(e){var t="undefined"!=typeof e.getAttributeNode&&e.getAttributeNode("id");return t&&t.value===n}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&E){var n,r,i,o=t.getElementById(e);if(o){if((n=o.getAttributeNode("id"))&&n.value===e)return[o];i=t.getElementsByName(e),r=0;while(o=i[r++])if((n=o.getAttributeNode("id"))&&n.value===e)return[o]}return[]}}),b.find.TAG=d.getElementsByTagName?function(e,t){return"undefined"!=typeof t.getElementsByTagName?t.getElementsByTagName(e):d.qsa?t.querySelectorAll(e):void 0}:function(e,t){var n,r=[],i=0,o=t.getElementsByTagName(e);if("*"===e){while(n=o[i++])1===n.nodeType&&r.push(n);return r}return o},b.find.CLASS=d.getElementsByClassName&&function(e,t){if("undefined"!=typeof t.getElementsByClassName&&E)return t.getElementsByClassName(e)},s=[],v=[],(d.qsa=K.test(C.querySelectorAll))&&(ce(function(e){a.appendChild(e).innerHTML="<a id='"+k+"'></a><select id='"+k+"-\r\\' msallowcapture=''><option selected=''></option></select>",e.querySelectorAll("[msallowcapture^='']").length&&v.push("[*^$]="+M+"*(?:''|\"\")"),e.querySelectorAll("[selected]").length||v.push("\\["+M+"*(?:value|"+R+")"),e.querySelectorAll("[id~="+k+"-]").length||v.push("~="),e.querySelectorAll(":checked").length||v.push(":checked"),e.querySelectorAll("a#"+k+"+*").length||v.push(".#.+[+~]")}),ce(function(e){e.innerHTML="<a href='' disabled='disabled'></a><select disabled='disabled'><option/></select>";var t=C.createElement("input");t.setAttribute("type","hidden"),e.appendChild(t).setAttribute("name","D"),e.querySelectorAll("[name=d]").length&&v.push("name"+M+"*[*^$|!~]?="),2!==e.querySelectorAll(":enabled").length&&v.push(":enabled",":disabled"),a.appendChild(e).disabled=!0,2!==e.querySelectorAll(":disabled").length&&v.push(":enabled",":disabled"),e.querySelectorAll("*,:x"),v.push(",.*:")})),(d.matchesSelector=K.test(c=a.matches||a.webkitMatchesSelector||a.mozMatchesSelector||a.oMatchesSelector||a.msMatchesSelector))&&ce(function(e){d.disconnectedMatch=c.call(e,"*"),c.call(e,"[s!='']:x"),s.push("!=",$)}),v=v.length&&new RegExp(v.join("|")),s=s.length&&new RegExp(s.join("|")),t=K.test(a.compareDocumentPosition),y=t||K.test(a.contains)?function(e,t){var n=9===e.nodeType?e.documentElement:e,r=t&&t.parentNode;return e===r||!(!r||1!==r.nodeType||!(n.contains?n.contains(r):e.compareDocumentPosition&&16&e.compareDocumentPosition(r)))}:function(e,t){if(t)while(t=t.parentNode)if(t===e)return!0;return!1},D=t?function(e,t){if(e===t)return l=!0,0;var n=!e.compareDocumentPosition-!t.compareDocumentPosition;return n||(1&(n=(e.ownerDocument||e)===(t.ownerDocument||t)?e.compareDocumentPosition(t):1)||!d.sortDetached&&t.compareDocumentPosition(e)===n?e===C||e.ownerDocument===m&&y(m,e)?-1:t===C||t.ownerDocument===m&&y(m,t)?1:u?P(u,e)-P(u,t):0:4&n?-1:1)}:function(e,t){if(e===t)return l=!0,0;var n,r=0,i=e.parentNode,o=t.parentNode,a=[e],s=[t];if(!i||!o)return e===C?-1:t===C?1:i?-1:o?1:u?P(u,e)-P(u,t):0;if(i===o)return pe(e,t);n=e;while(n=n.parentNode)a.unshift(n);n=t;while(n=n.parentNode)s.unshift(n);while(a[r]===s[r])r++;return r?pe(a[r],s[r]):a[r]===m?-1:s[r]===m?1:0}),C},se.matches=function(e,t){return se(e,null,null,t)},se.matchesSelector=function(e,t){if((e.ownerDocument||e)!==C&&T(e),d.matchesSelector&&E&&!A[t+" "]&&(!s||!s.test(t))&&(!v||!v.test(t)))try{var n=c.call(e,t);if(n||d.disconnectedMatch||e.document&&11!==e.document.nodeType)return n}catch(e){A(t,!0)}return 0<se(t,C,null,[e]).length},se.contains=function(e,t){return(e.ownerDocument||e)!==C&&T(e),y(e,t)},se.attr=function(e,t){(e.ownerDocument||e)!==C&&T(e);var n=b.attrHandle[t.toLowerCase()],r=n&&j.call(b.attrHandle,t.toLowerCase())?n(e,t,!E):void 0;return void 0!==r?r:d.attributes||!E?e.getAttribute(t):(r=e.getAttributeNode(t))&&r.specified?r.value:null},se.escape=function(e){return(e+"").replace(re,ie)},se.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)},se.uniqueSort=function(e){var t,n=[],r=0,i=0;if(l=!d.detectDuplicates,u=!d.sortStable&&e.slice(0),e.sort(D),l){while(t=e[i++])t===e[i]&&(r=n.push(i));while(r--)e.splice(n[r],1)}return u=null,e},o=se.getText=function(e){var t,n="",r=0,i=e.nodeType;if(i){if(1===i||9===i||11===i){if("string"==typeof e.textContent)return e.textContent;for(e=e.firstChild;e;e=e.nextSibling)n+=o(e)}else if(3===i||4===i)return e.nodeValue}else while(t=e[r++])n+=o(t);return n},(b=se.selectors={cacheLength:50,createPseudo:le,match:G,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(te,ne),e[3]=(e[3]||e[4]||e[5]||"").replace(te,ne),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||se.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&se.error(e[0]),e},PSEUDO:function(e){var t,n=!e[6]&&e[2];return G.CHILD.test(e[0])?null:(e[3]?e[2]=e[4]||e[5]||"":n&&X.test(n)&&(t=h(n,!0))&&(t=n.indexOf(")",n.length-t)-n.length)&&(e[0]=e[0].slice(0,t),e[2]=n.slice(0,t)),e.slice(0,3))}},filter:{TAG:function(e){var t=e.replace(te,ne).toLowerCase();return"*"===e?function(){return!0}:function(e){return e.nodeName&&e.nodeName.toLowerCase()===t}},CLASS:function(e){var t=p[e+" "];return t||(t=new RegExp("(^|"+M+")"+e+"("+M+"|$)"))&&p(e,function(e){return t.test("string"==typeof e.className&&e.className||"undefined"!=typeof e.getAttribute&&e.getAttribute("class")||"")})},ATTR:function(n,r,i){return function(e){var t=se.attr(e,n);return null==t?"!="===r:!r||(t+="","="===r?t===i:"!="===r?t!==i:"^="===r?i&&0===t.indexOf(i):"*="===r?i&&-1<t.indexOf(i):"$="===r?i&&t.slice(-i.length)===i:"~="===r?-1<(" "+t.replace(F," ")+" ").indexOf(i):"|="===r&&(t===i||t.slice(0,i.length+1)===i+"-"))}},CHILD:function(h,e,t,g,v){var y="nth"!==h.slice(0,3),m="last"!==h.slice(-4),x="of-type"===e;return 1===g&&0===v?function(e){return!!e.parentNode}:function(e,t,n){var r,i,o,a,s,u,l=y!==m?"nextSibling":"previousSibling",c=e.parentNode,f=x&&e.nodeName.toLowerCase(),p=!n&&!x,d=!1;if(c){if(y){while(l){a=e;while(a=a[l])if(x?a.nodeName.toLowerCase()===f:1===a.nodeType)return!1;u=l="only"===h&&!u&&"nextSibling"}return!0}if(u=[m?c.firstChild:c.lastChild],m&&p){d=(s=(r=(i=(o=(a=c)[k]||(a[k]={}))[a.uniqueID]||(o[a.uniqueID]={}))[h]||[])[0]===S&&r[1])&&r[2],a=s&&c.childNodes[s];while(a=++s&&a&&a[l]||(d=s=0)||u.pop())if(1===a.nodeType&&++d&&a===e){i[h]=[S,s,d];break}}else if(p&&(d=s=(r=(i=(o=(a=e)[k]||(a[k]={}))[a.uniqueID]||(o[a.uniqueID]={}))[h]||[])[0]===S&&r[1]),!1===d)while(a=++s&&a&&a[l]||(d=s=0)||u.pop())if((x?a.nodeName.toLowerCase()===f:1===a.nodeType)&&++d&&(p&&((i=(o=a[k]||(a[k]={}))[a.uniqueID]||(o[a.uniqueID]={}))[h]=[S,d]),a===e))break;return(d-=v)===g||d%g==0&&0<=d/g}}},PSEUDO:function(e,o){var t,a=b.pseudos[e]||b.setFilters[e.toLowerCase()]||se.error("unsupported pseudo: "+e);return a[k]?a(o):1<a.length?(t=[e,e,"",o],b.setFilters.hasOwnProperty(e.toLowerCase())?le(function(e,t){var n,r=a(e,o),i=r.length;while(i--)e[n=P(e,r[i])]=!(t[n]=r[i])}):function(e){return a(e,0,t)}):a}},pseudos:{not:le(function(e){var r=[],i=[],s=f(e.replace(B,"$1"));return s[k]?le(function(e,t,n,r){var i,o=s(e,null,r,[]),a=e.length;while(a--)(i=o[a])&&(e[a]=!(t[a]=i))}):function(e,t,n){return r[0]=e,s(r,null,n,i),r[0]=null,!i.pop()}}),has:le(function(t){return function(e){return 0<se(t,e).length}}),contains:le(function(t){return t=t.replace(te,ne),function(e){return-1<(e.textContent||o(e)).indexOf(t)}}),lang:le(function(n){return V.test(n||"")||se.error("unsupported lang: "+n),n=n.replace(te,ne).toLowerCase(),function(e){var t;do{if(t=E?e.lang:e.getAttribute("xml:lang")||e.getAttribute("lang"))return(t=t.toLowerCase())===n||0===t.indexOf(n+"-")}while((e=e.parentNode)&&1===e.nodeType);return!1}}),target:function(e){var t=n.location&&n.location.hash;return t&&t.slice(1)===e.id},root:function(e){return e===a},focus:function(e){return e===C.activeElement&&(!C.hasFocus||C.hasFocus())&&!!(e.type||e.href||~e.tabIndex)},enabled:ge(!1),disabled:ge(!0),checked:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&!!e.checked||"option"===t&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,!0===e.selected},empty:function(e){for(e=e.firstChild;e;e=e.nextSibling)if(e.nodeType<6)return!1;return!0},parent:function(e){return!b.pseudos.empty(e)},header:function(e){return J.test(e.nodeName)},input:function(e){return Q.test(e.nodeName)},button:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&"button"===e.type||"button"===t},text:function(e){var t;return"input"===e.nodeName.toLowerCase()&&"text"===e.type&&(null==(t=e.getAttribute("type"))||"text"===t.toLowerCase())},first:ve(function(){return[0]}),last:ve(function(e,t){return[t-1]}),eq:ve(function(e,t,n){return[n<0?n+t:n]}),even:ve(function(e,t){for(var n=0;n<t;n+=2)e.push(n);return e}),odd:ve(function(e,t){for(var n=1;n<t;n+=2)e.push(n);return e}),lt:ve(function(e,t,n){for(var r=n<0?n+t:t<n?t:n;0<=--r;)e.push(r);return e}),gt:ve(function(e,t,n){for(var r=n<0?n+t:n;++r<t;)e.push(r);return e})}}).pseudos.nth=b.pseudos.eq,{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})b.pseudos[e]=de(e);for(e in{submit:!0,reset:!0})b.pseudos[e]=he(e);function me(){}function xe(e){for(var t=0,n=e.length,r="";t<n;t++)r+=e[t].value;return r}function be(s,e,t){var u=e.dir,l=e.next,c=l||u,f=t&&"parentNode"===c,p=r++;return e.first?function(e,t,n){while(e=e[u])if(1===e.nodeType||f)return s(e,t,n);return!1}:function(e,t,n){var r,i,o,a=[S,p];if(n){while(e=e[u])if((1===e.nodeType||f)&&s(e,t,n))return!0}else while(e=e[u])if(1===e.nodeType||f)if(i=(o=e[k]||(e[k]={}))[e.uniqueID]||(o[e.uniqueID]={}),l&&l===e.nodeName.toLowerCase())e=e[u]||e;else{if((r=i[c])&&r[0]===S&&r[1]===p)return a[2]=r[2];if((i[c]=a)[2]=s(e,t,n))return!0}return!1}}function we(i){return 1<i.length?function(e,t,n){var r=i.length;while(r--)if(!i[r](e,t,n))return!1;return!0}:i[0]}function Te(e,t,n,r,i){for(var o,a=[],s=0,u=e.length,l=null!=t;s<u;s++)(o=e[s])&&(n&&!n(o,r,i)||(a.push(o),l&&t.push(s)));return a}function Ce(d,h,g,v,y,e){return v&&!v[k]&&(v=Ce(v)),y&&!y[k]&&(y=Ce(y,e)),le(function(e,t,n,r){var i,o,a,s=[],u=[],l=t.length,c=e||function(e,t,n){for(var r=0,i=t.length;r<i;r++)se(e,t[r],n);return n}(h||"*",n.nodeType?[n]:n,[]),f=!d||!e&&h?c:Te(c,s,d,n,r),p=g?y||(e?d:l||v)?[]:t:f;if(g&&g(f,p,n,r),v){i=Te(p,u),v(i,[],n,r),o=i.length;while(o--)(a=i[o])&&(p[u[o]]=!(f[u[o]]=a))}if(e){if(y||d){if(y){i=[],o=p.length;while(o--)(a=p[o])&&i.push(f[o]=a);y(null,p=[],i,r)}o=p.length;while(o--)(a=p[o])&&-1<(i=y?P(e,a):s[o])&&(e[i]=!(t[i]=a))}}else p=Te(p===t?p.splice(l,p.length):p),y?y(null,t,p,r):H.apply(t,p)})}function Ee(e){for(var i,t,n,r=e.length,o=b.relative[e[0].type],a=o||b.relative[" "],s=o?1:0,u=be(function(e){return e===i},a,!0),l=be(function(e){return-1<P(i,e)},a,!0),c=[function(e,t,n){var r=!o&&(n||t!==w)||((i=t).nodeType?u(e,t,n):l(e,t,n));return i=null,r}];s<r;s++)if(t=b.relative[e[s].type])c=[be(we(c),t)];else{if((t=b.filter[e[s].type].apply(null,e[s].matches))[k]){for(n=++s;n<r;n++)if(b.relative[e[n].type])break;return Ce(1<s&&we(c),1<s&&xe(e.slice(0,s-1).concat({value:" "===e[s-2].type?"*":""})).replace(B,"$1"),t,s<n&&Ee(e.slice(s,n)),n<r&&Ee(e=e.slice(n)),n<r&&xe(e))}c.push(t)}return we(c)}return me.prototype=b.filters=b.pseudos,b.setFilters=new me,h=se.tokenize=function(e,t){var n,r,i,o,a,s,u,l=x[e+" "];if(l)return t?0:l.slice(0);a=e,s=[],u=b.preFilter;while(a){for(o in n&&!(r=_.exec(a))||(r&&(a=a.slice(r[0].length)||a),s.push(i=[])),n=!1,(r=z.exec(a))&&(n=r.shift(),i.push({value:n,type:r[0].replace(B," ")}),a=a.slice(n.length)),b.filter)!(r=G[o].exec(a))||u[o]&&!(r=u[o](r))||(n=r.shift(),i.push({value:n,type:o,matches:r}),a=a.slice(n.length));if(!n)break}return t?a.length:a?se.error(e):x(e,s).slice(0)},f=se.compile=function(e,t){var n,v,y,m,x,r,i=[],o=[],a=N[e+" "];if(!a){t||(t=h(e)),n=t.length;while(n--)(a=Ee(t[n]))[k]?i.push(a):o.push(a);(a=N(e,(v=o,m=0<(y=i).length,x=0<v.length,r=function(e,t,n,r,i){var o,a,s,u=0,l="0",c=e&&[],f=[],p=w,d=e||x&&b.find.TAG("*",i),h=S+=null==p?1:Math.random()||.1,g=d.length;for(i&&(w=t===C||t||i);l!==g&&null!=(o=d[l]);l++){if(x&&o){a=0,t||o.ownerDocument===C||(T(o),n=!E);while(s=v[a++])if(s(o,t||C,n)){r.push(o);break}i&&(S=h)}m&&((o=!s&&o)&&u--,e&&c.push(o))}if(u+=l,m&&l!==u){a=0;while(s=y[a++])s(c,f,t,n);if(e){if(0<u)while(l--)c[l]||f[l]||(f[l]=q.call(r));f=Te(f)}H.apply(r,f),i&&!e&&0<f.length&&1<u+y.length&&se.uniqueSort(r)}return i&&(S=h,w=p),c},m?le(r):r))).selector=e}return a},g=se.select=function(e,t,n,r){var i,o,a,s,u,l="function"==typeof e&&e,c=!r&&h(e=l.selector||e);if(n=n||[],1===c.length){if(2<(o=c[0]=c[0].slice(0)).length&&"ID"===(a=o[0]).type&&9===t.nodeType&&E&&b.relative[o[1].type]){if(!(t=(b.find.ID(a.matches[0].replace(te,ne),t)||[])[0]))return n;l&&(t=t.parentNode),e=e.slice(o.shift().value.length)}i=G.needsContext.test(e)?0:o.length;while(i--){if(a=o[i],b.relative[s=a.type])break;if((u=b.find[s])&&(r=u(a.matches[0].replace(te,ne),ee.test(o[0].type)&&ye(t.parentNode)||t))){if(o.splice(i,1),!(e=r.length&&xe(o)))return H.apply(n,r),n;break}}}return(l||f(e,c))(r,t,!E,n,!t||ee.test(e)&&ye(t.parentNode)||t),n},d.sortStable=k.split("").sort(D).join("")===k,d.detectDuplicates=!!l,T(),d.sortDetached=ce(function(e){return 1&e.compareDocumentPosition(C.createElement("fieldset"))}),ce(function(e){return e.innerHTML="<a href='#'></a>","#"===e.firstChild.getAttribute("href")})||fe("type|href|height|width",function(e,t,n){if(!n)return e.getAttribute(t,"type"===t.toLowerCase()?1:2)}),d.attributes&&ce(function(e){return e.innerHTML="<input/>",e.firstChild.setAttribute("value",""),""===e.firstChild.getAttribute("value")})||fe("value",function(e,t,n){if(!n&&"input"===e.nodeName.toLowerCase())return e.defaultValue}),ce(function(e){return null==e.getAttribute("disabled")})||fe(R,function(e,t,n){var r;if(!n)return!0===e[t]?t.toLowerCase():(r=e.getAttributeNode(t))&&r.specified?r.value:null}),se}(C);k.find=h,k.expr=h.selectors,k.expr[":"]=k.expr.pseudos,k.uniqueSort=k.unique=h.uniqueSort,k.text=h.getText,k.isXMLDoc=h.isXML,k.contains=h.contains,k.escapeSelector=h.escape;var T=function(e,t,n){var r=[],i=void 0!==n;while((e=e[t])&&9!==e.nodeType)if(1===e.nodeType){if(i&&k(e).is(n))break;r.push(e)}return r},S=function(e,t){for(var n=[];e;e=e.nextSibling)1===e.nodeType&&e!==t&&n.push(e);return n},N=k.expr.match.needsContext;function A(e,t){return e.nodeName&&e.nodeName.toLowerCase()===t.toLowerCase()}var D=/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i;function j(e,n,r){return m(n)?k.grep(e,function(e,t){return!!n.call(e,t,e)!==r}):n.nodeType?k.grep(e,function(e){return e===n!==r}):"string"!=typeof n?k.grep(e,function(e){return-1<i.call(n,e)!==r}):k.filter(n,e,r)}k.filter=function(e,t,n){var r=t[0];return n&&(e=":not("+e+")"),1===t.length&&1===r.nodeType?k.find.matchesSelector(r,e)?[r]:[]:k.find.matches(e,k.grep(t,function(e){return 1===e.nodeType}))},k.fn.extend({find:function(e){var t,n,r=this.length,i=this;if("string"!=typeof e)return this.pushStack(k(e).filter(function(){for(t=0;t<r;t++)if(k.contains(i[t],this))return!0}));for(n=this.pushStack([]),t=0;t<r;t++)k.find(e,i[t],n);return 1<r?k.uniqueSort(n):n},filter:function(e){return this.pushStack(j(this,e||[],!1))},not:function(e){return this.pushStack(j(this,e||[],!0))},is:function(e){return!!j(this,"string"==typeof e&&N.test(e)?k(e):e||[],!1).length}});var q,L=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/;(k.fn.init=function(e,t,n){var r,i;if(!e)return this;if(n=n||q,"string"==typeof e){if(!(r="<"===e[0]&&">"===e[e.length-1]&&3<=e.length?[null,e,null]:L.exec(e))||!r[1]&&t)return!t||t.jquery?(t||n).find(e):this.constructor(t).find(e);if(r[1]){if(t=t instanceof k?t[0]:t,k.merge(this,k.parseHTML(r[1],t&&t.nodeType?t.ownerDocument||t:E,!0)),D.test(r[1])&&k.isPlainObject(t))for(r in t)m(this[r])?this[r](t[r]):this.attr(r,t[r]);return this}return(i=E.getElementById(r[2]))&&(this[0]=i,this.length=1),this}return e.nodeType?(this[0]=e,this.length=1,this):m(e)?void 0!==n.ready?n.ready(e):e(k):k.makeArray(e,this)}).prototype=k.fn,q=k(E);var H=/^(?:parents|prev(?:Until|All))/,O={children:!0,contents:!0,next:!0,prev:!0};function P(e,t){while((e=e[t])&&1!==e.nodeType);return e}k.fn.extend({has:function(e){var t=k(e,this),n=t.length;return this.filter(function(){for(var e=0;e<n;e++)if(k.contains(this,t[e]))return!0})},closest:function(e,t){var n,r=0,i=this.length,o=[],a="string"!=typeof e&&k(e);if(!N.test(e))for(;r<i;r++)for(n=this[r];n&&n!==t;n=n.parentNode)if(n.nodeType<11&&(a?-1<a.index(n):1===n.nodeType&&k.find.matchesSelector(n,e))){o.push(n);break}return this.pushStack(1<o.length?k.uniqueSort(o):o)},index:function(e){return e?"string"==typeof e?i.call(k(e),this[0]):i.call(this,e.jquery?e[0]:e):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(e,t){return this.pushStack(k.uniqueSort(k.merge(this.get(),k(e,t))))},addBack:function(e){return this.add(null==e?this.prevObject:this.prevObject.filter(e))}}),k.each({parent:function(e){var t=e.parentNode;return t&&11!==t.nodeType?t:null},parents:function(e){return T(e,"parentNode")},parentsUntil:function(e,t,n){return T(e,"parentNode",n)},next:function(e){return P(e,"nextSibling")},prev:function(e){return P(e,"previousSibling")},nextAll:function(e){return T(e,"nextSibling")},prevAll:function(e){return T(e,"previousSibling")},nextUntil:function(e,t,n){return T(e,"nextSibling",n)},prevUntil:function(e,t,n){return T(e,"previousSibling",n)},siblings:function(e){return S((e.parentNode||{}).firstChild,e)},children:function(e){return S(e.firstChild)},contents:function(e){return"undefined"!=typeof e.contentDocument?e.contentDocument:(A(e,"template")&&(e=e.content||e),k.merge([],e.childNodes))}},function(r,i){k.fn[r]=function(e,t){var n=k.map(this,i,e);return"Until"!==r.slice(-5)&&(t=e),t&&"string"==typeof t&&(n=k.filter(t,n)),1<this.length&&(O[r]||k.uniqueSort(n),H.test(r)&&n.reverse()),this.pushStack(n)}});var R=/[^\x20\t\r\n\f]+/g;function M(e){return e}function I(e){throw e}function W(e,t,n,r){var i;try{e&&m(i=e.promise)?i.call(e).done(t).fail(n):e&&m(i=e.then)?i.call(e,t,n):t.apply(void 0,[e].slice(r))}catch(e){n.apply(void 0,[e])}}k.Callbacks=function(r){var e,n;r="string"==typeof r?(e=r,n={},k.each(e.match(R)||[],function(e,t){n[t]=!0}),n):k.extend({},r);var i,t,o,a,s=[],u=[],l=-1,c=function(){for(a=a||r.once,o=i=!0;u.length;l=-1){t=u.shift();while(++l<s.length)!1===s[l].apply(t[0],t[1])&&r.stopOnFalse&&(l=s.length,t=!1)}r.memory||(t=!1),i=!1,a&&(s=t?[]:"")},f={add:function(){return s&&(t&&!i&&(l=s.length-1,u.push(t)),function n(e){k.each(e,function(e,t){m(t)?r.unique&&f.has(t)||s.push(t):t&&t.length&&"string"!==w(t)&&n(t)})}(arguments),t&&!i&&c()),this},remove:function(){return k.each(arguments,function(e,t){var n;while(-1<(n=k.inArray(t,s,n)))s.splice(n,1),n<=l&&l--}),this},has:function(e){return e?-1<k.inArray(e,s):0<s.length},empty:function(){return s&&(s=[]),this},disable:function(){return a=u=[],s=t="",this},disabled:function(){return!s},lock:function(){return a=u=[],t||i||(s=t=""),this},locked:function(){return!!a},fireWith:function(e,t){return a||(t=[e,(t=t||[]).slice?t.slice():t],u.push(t),i||c()),this},fire:function(){return f.fireWith(this,arguments),this},fired:function(){return!!o}};return f},k.extend({Deferred:function(e){var o=[["notify","progress",k.Callbacks("memory"),k.Callbacks("memory"),2],["resolve","done",k.Callbacks("once memory"),k.Callbacks("once memory"),0,"resolved"],["reject","fail",k.Callbacks("once memory"),k.Callbacks("once memory"),1,"rejected"]],i="pending",a={state:function(){return i},always:function(){return s.done(arguments).fail(arguments),this},"catch":function(e){return a.then(null,e)},pipe:function(){var i=arguments;return k.Deferred(function(r){k.each(o,function(e,t){var n=m(i[t[4]])&&i[t[4]];s[t[1]](function(){var e=n&&n.apply(this,arguments);e&&m(e.promise)?e.promise().progress(r.notify).done(r.resolve).fail(r.reject):r[t[0]+"With"](this,n?[e]:arguments)})}),i=null}).promise()},then:function(t,n,r){var u=0;function l(i,o,a,s){return function(){var n=this,r=arguments,e=function(){var e,t;if(!(i<u)){if((e=a.apply(n,r))===o.promise())throw new TypeError("Thenable self-resolution");t=e&&("object"==typeof e||"function"==typeof e)&&e.then,m(t)?s?t.call(e,l(u,o,M,s),l(u,o,I,s)):(u++,t.call(e,l(u,o,M,s),l(u,o,I,s),l(u,o,M,o.notifyWith))):(a!==M&&(n=void 0,r=[e]),(s||o.resolveWith)(n,r))}},t=s?e:function(){try{e()}catch(e){k.Deferred.exceptionHook&&k.Deferred.exceptionHook(e,t.stackTrace),u<=i+1&&(a!==I&&(n=void 0,r=[e]),o.rejectWith(n,r))}};i?t():(k.Deferred.getStackHook&&(t.stackTrace=k.Deferred.getStackHook()),C.setTimeout(t))}}return k.Deferred(function(e){o[0][3].add(l(0,e,m(r)?r:M,e.notifyWith)),o[1][3].add(l(0,e,m(t)?t:M)),o[2][3].add(l(0,e,m(n)?n:I))}).promise()},promise:function(e){return null!=e?k.extend(e,a):a}},s={};return k.each(o,function(e,t){var n=t[2],r=t[5];a[t[1]]=n.add,r&&n.add(function(){i=r},o[3-e][2].disable,o[3-e][3].disable,o[0][2].lock,o[0][3].lock),n.add(t[3].fire),s[t[0]]=function(){return s[t[0]+"With"](this===s?void 0:this,arguments),this},s[t[0]+"With"]=n.fireWith}),a.promise(s),e&&e.call(s,s),s},when:function(e){var n=arguments.length,t=n,r=Array(t),i=s.call(arguments),o=k.Deferred(),a=function(t){return function(e){r[t]=this,i[t]=1<arguments.length?s.call(arguments):e,--n||o.resolveWith(r,i)}};if(n<=1&&(W(e,o.done(a(t)).resolve,o.reject,!n),"pending"===o.state()||m(i[t]&&i[t].then)))return o.then();while(t--)W(i[t],a(t),o.reject);return o.promise()}});var $=/^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;k.Deferred.exceptionHook=function(e,t){C.console&&C.console.warn&&e&&$.test(e.name)&&C.console.warn("jQuery.Deferred exception: "+e.message,e.stack,t)},k.readyException=function(e){C.setTimeout(function(){throw e})};var F=k.Deferred();function B(){E.removeEventListener("DOMContentLoaded",B),C.removeEventListener("load",B),k.ready()}k.fn.ready=function(e){return F.then(e)["catch"](function(e){k.readyException(e)}),this},k.extend({isReady:!1,readyWait:1,ready:function(e){(!0===e?--k.readyWait:k.isReady)||(k.isReady=!0)!==e&&0<--k.readyWait||F.resolveWith(E,[k])}}),k.ready.then=F.then,"complete"===E.readyState||"loading"!==E.readyState&&!E.documentElement.doScroll?C.setTimeout(k.ready):(E.addEventListener("DOMContentLoaded",B),C.addEventListener("load",B));var _=function(e,t,n,r,i,o,a){var s=0,u=e.length,l=null==n;if("object"===w(n))for(s in i=!0,n)_(e,t,s,n[s],!0,o,a);else if(void 0!==r&&(i=!0,m(r)||(a=!0),l&&(a?(t.call(e,r),t=null):(l=t,t=function(e,t,n){return l.call(k(e),n)})),t))for(;s<u;s++)t(e[s],n,a?r:r.call(e[s],s,t(e[s],n)));return i?e:l?t.call(e):u?t(e[0],n):o},z=/^-ms-/,U=/-([a-z])/g;function X(e,t){return t.toUpperCase()}function V(e){return e.replace(z,"ms-").replace(U,X)}var G=function(e){return 1===e.nodeType||9===e.nodeType||!+e.nodeType};function Y(){this.expando=k.expando+Y.uid++}Y.uid=1,Y.prototype={cache:function(e){var t=e[this.expando];return t||(t={},G(e)&&(e.nodeType?e[this.expando]=t:Object.defineProperty(e,this.expando,{value:t,configurable:!0}))),t},set:function(e,t,n){var r,i=this.cache(e);if("string"==typeof t)i[V(t)]=n;else for(r in t)i[V(r)]=t[r];return i},get:function(e,t){return void 0===t?this.cache(e):e[this.expando]&&e[this.expando][V(t)]},access:function(e,t,n){return void 0===t||t&&"string"==typeof t&&void 0===n?this.get(e,t):(this.set(e,t,n),void 0!==n?n:t)},remove:function(e,t){var n,r=e[this.expando];if(void 0!==r){if(void 0!==t){n=(t=Array.isArray(t)?t.map(V):(t=V(t))in r?[t]:t.match(R)||[]).length;while(n--)delete r[t[n]]}(void 0===t||k.isEmptyObject(r))&&(e.nodeType?e[this.expando]=void 0:delete e[this.expando])}},hasData:function(e){var t=e[this.expando];return void 0!==t&&!k.isEmptyObject(t)}};var Q=new Y,J=new Y,K=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,Z=/[A-Z]/g;function ee(e,t,n){var r,i;if(void 0===n&&1===e.nodeType)if(r="data-"+t.replace(Z,"-$&").toLowerCase(),"string"==typeof(n=e.getAttribute(r))){try{n="true"===(i=n)||"false"!==i&&("null"===i?null:i===+i+""?+i:K.test(i)?JSON.parse(i):i)}catch(e){}J.set(e,t,n)}else n=void 0;return n}k.extend({hasData:function(e){return J.hasData(e)||Q.hasData(e)},data:function(e,t,n){return J.access(e,t,n)},removeData:function(e,t){J.remove(e,t)},_data:function(e,t,n){return Q.access(e,t,n)},_removeData:function(e,t){Q.remove(e,t)}}),k.fn.extend({data:function(n,e){var t,r,i,o=this[0],a=o&&o.attributes;if(void 0===n){if(this.length&&(i=J.get(o),1===o.nodeType&&!Q.get(o,"hasDataAttrs"))){t=a.length;while(t--)a[t]&&0===(r=a[t].name).indexOf("data-")&&(r=V(r.slice(5)),ee(o,r,i[r]));Q.set(o,"hasDataAttrs",!0)}return i}return"object"==typeof n?this.each(function(){J.set(this,n)}):_(this,function(e){var t;if(o&&void 0===e)return void 0!==(t=J.get(o,n))?t:void 0!==(t=ee(o,n))?t:void 0;this.each(function(){J.set(this,n,e)})},null,e,1<arguments.length,null,!0)},removeData:function(e){return this.each(function(){J.remove(this,e)})}}),k.extend({queue:function(e,t,n){var r;if(e)return t=(t||"fx")+"queue",r=Q.get(e,t),n&&(!r||Array.isArray(n)?r=Q.access(e,t,k.makeArray(n)):r.push(n)),r||[]},dequeue:function(e,t){t=t||"fx";var n=k.queue(e,t),r=n.length,i=n.shift(),o=k._queueHooks(e,t);"inprogress"===i&&(i=n.shift(),r--),i&&("fx"===t&&n.unshift("inprogress"),delete o.stop,i.call(e,function(){k.dequeue(e,t)},o)),!r&&o&&o.empty.fire()},_queueHooks:function(e,t){var n=t+"queueHooks";return Q.get(e,n)||Q.access(e,n,{empty:k.Callbacks("once memory").add(function(){Q.remove(e,[t+"queue",n])})})}}),k.fn.extend({queue:function(t,n){var e=2;return"string"!=typeof t&&(n=t,t="fx",e--),arguments.length<e?k.queue(this[0],t):void 0===n?this:this.each(function(){var e=k.queue(this,t,n);k._queueHooks(this,t),"fx"===t&&"inprogress"!==e[0]&&k.dequeue(this,t)})},dequeue:function(e){return this.each(function(){k.dequeue(this,e)})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(e,t){var n,r=1,i=k.Deferred(),o=this,a=this.length,s=function(){--r||i.resolveWith(o,[o])};"string"!=typeof e&&(t=e,e=void 0),e=e||"fx";while(a--)(n=Q.get(o[a],e+"queueHooks"))&&n.empty&&(r++,n.empty.add(s));return s(),i.promise(t)}});var te=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,ne=new RegExp("^(?:([+-])=|)("+te+")([a-z%]*)$","i"),re=["Top","Right","Bottom","Left"],ie=E.documentElement,oe=function(e){return k.contains(e.ownerDocument,e)},ae={composed:!0};ie.getRootNode&&(oe=function(e){return k.contains(e.ownerDocument,e)||e.getRootNode(ae)===e.ownerDocument});var se=function(e,t){return"none"===(e=t||e).style.display||""===e.style.display&&oe(e)&&"none"===k.css(e,"display")},ue=function(e,t,n,r){var i,o,a={};for(o in t)a[o]=e.style[o],e.style[o]=t[o];for(o in i=n.apply(e,r||[]),t)e.style[o]=a[o];return i};function le(e,t,n,r){var i,o,a=20,s=r?function(){return r.cur()}:function(){return k.css(e,t,"")},u=s(),l=n&&n[3]||(k.cssNumber[t]?"":"px"),c=e.nodeType&&(k.cssNumber[t]||"px"!==l&&+u)&&ne.exec(k.css(e,t));if(c&&c[3]!==l){u/=2,l=l||c[3],c=+u||1;while(a--)k.style(e,t,c+l),(1-o)*(1-(o=s()/u||.5))<=0&&(a=0),c/=o;c*=2,k.style(e,t,c+l),n=n||[]}return n&&(c=+c||+u||0,i=n[1]?c+(n[1]+1)*n[2]:+n[2],r&&(r.unit=l,r.start=c,r.end=i)),i}var ce={};function fe(e,t){for(var n,r,i,o,a,s,u,l=[],c=0,f=e.length;c<f;c++)(r=e[c]).style&&(n=r.style.display,t?("none"===n&&(l[c]=Q.get(r,"display")||null,l[c]||(r.style.display="")),""===r.style.display&&se(r)&&(l[c]=(u=a=o=void 0,a=(i=r).ownerDocument,s=i.nodeName,(u=ce[s])||(o=a.body.appendChild(a.createElement(s)),u=k.css(o,"display"),o.parentNode.removeChild(o),"none"===u&&(u="block"),ce[s]=u)))):"none"!==n&&(l[c]="none",Q.set(r,"display",n)));for(c=0;c<f;c++)null!=l[c]&&(e[c].style.display=l[c]);return e}k.fn.extend({show:function(){return fe(this,!0)},hide:function(){return fe(this)},toggle:function(e){return"boolean"==typeof e?e?this.show():this.hide():this.each(function(){se(this)?k(this).show():k(this).hide()})}});var pe=/^(?:checkbox|radio)$/i,de=/<([a-z][^\/\0>\x20\t\r\n\f]*)/i,he=/^$|^module$|\/(?:java|ecma)script/i,ge={option:[1,"<select multiple='multiple'>","</select>"],thead:[1,"<table>","</table>"],col:[2,"<table><colgroup>","</colgroup></table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:[0,"",""]};function ve(e,t){var n;return n="undefined"!=typeof e.getElementsByTagName?e.getElementsByTagName(t||"*"):"undefined"!=typeof e.querySelectorAll?e.querySelectorAll(t||"*"):[],void 0===t||t&&A(e,t)?k.merge([e],n):n}function ye(e,t){for(var n=0,r=e.length;n<r;n++)Q.set(e[n],"globalEval",!t||Q.get(t[n],"globalEval"))}ge.optgroup=ge.option,ge.tbody=ge.tfoot=ge.colgroup=ge.caption=ge.thead,ge.th=ge.td;var me,xe,be=/<|&#?\w+;/;function we(e,t,n,r,i){for(var o,a,s,u,l,c,f=t.createDocumentFragment(),p=[],d=0,h=e.length;d<h;d++)if((o=e[d])||0===o)if("object"===w(o))k.merge(p,o.nodeType?[o]:o);else if(be.test(o)){a=a||f.appendChild(t.createElement("div")),s=(de.exec(o)||["",""])[1].toLowerCase(),u=ge[s]||ge._default,a.innerHTML=u[1]+k.htmlPrefilter(o)+u[2],c=u[0];while(c--)a=a.lastChild;k.merge(p,a.childNodes),(a=f.firstChild).textContent=""}else p.push(t.createTextNode(o));f.textContent="",d=0;while(o=p[d++])if(r&&-1<k.inArray(o,r))i&&i.push(o);else if(l=oe(o),a=ve(f.appendChild(o),"script"),l&&ye(a),n){c=0;while(o=a[c++])he.test(o.type||"")&&n.push(o)}return f}me=E.createDocumentFragment().appendChild(E.createElement("div")),(xe=E.createElement("input")).setAttribute("type","radio"),xe.setAttribute("checked","checked"),xe.setAttribute("name","t"),me.appendChild(xe),y.checkClone=me.cloneNode(!0).cloneNode(!0).lastChild.checked,me.innerHTML="<textarea>x</textarea>",y.noCloneChecked=!!me.cloneNode(!0).lastChild.defaultValue;var Te=/^key/,Ce=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,Ee=/^([^.]*)(?:\.(.+)|)/;function ke(){return!0}function Se(){return!1}function Ne(e,t){return e===function(){try{return E.activeElement}catch(e){}}()==("focus"===t)}function Ae(e,t,n,r,i,o){var a,s;if("object"==typeof t){for(s in"string"!=typeof n&&(r=r||n,n=void 0),t)Ae(e,s,n,r,t[s],o);return e}if(null==r&&null==i?(i=n,r=n=void 0):null==i&&("string"==typeof n?(i=r,r=void 0):(i=r,r=n,n=void 0)),!1===i)i=Se;else if(!i)return e;return 1===o&&(a=i,(i=function(e){return k().off(e),a.apply(this,arguments)}).guid=a.guid||(a.guid=k.guid++)),e.each(function(){k.event.add(this,t,i,r,n)})}function De(e,i,o){o?(Q.set(e,i,!1),k.event.add(e,i,{namespace:!1,handler:function(e){var t,n,r=Q.get(this,i);if(1&e.isTrigger&&this[i]){if(r.length)(k.event.special[i]||{}).delegateType&&e.stopPropagation();else if(r=s.call(arguments),Q.set(this,i,r),t=o(this,i),this[i](),r!==(n=Q.get(this,i))||t?Q.set(this,i,!1):n={},r!==n)return e.stopImmediatePropagation(),e.preventDefault(),n.value}else r.length&&(Q.set(this,i,{value:k.event.trigger(k.extend(r[0],k.Event.prototype),r.slice(1),this)}),e.stopImmediatePropagation())}})):void 0===Q.get(e,i)&&k.event.add(e,i,ke)}k.event={global:{},add:function(t,e,n,r,i){var o,a,s,u,l,c,f,p,d,h,g,v=Q.get(t);if(v){n.handler&&(n=(o=n).handler,i=o.selector),i&&k.find.matchesSelector(ie,i),n.guid||(n.guid=k.guid++),(u=v.events)||(u=v.events={}),(a=v.handle)||(a=v.handle=function(e){return"undefined"!=typeof k&&k.event.triggered!==e.type?k.event.dispatch.apply(t,arguments):void 0}),l=(e=(e||"").match(R)||[""]).length;while(l--)d=g=(s=Ee.exec(e[l])||[])[1],h=(s[2]||"").split(".").sort(),d&&(f=k.event.special[d]||{},d=(i?f.delegateType:f.bindType)||d,f=k.event.special[d]||{},c=k.extend({type:d,origType:g,data:r,handler:n,guid:n.guid,selector:i,needsContext:i&&k.expr.match.needsContext.test(i),namespace:h.join(".")},o),(p=u[d])||((p=u[d]=[]).delegateCount=0,f.setup&&!1!==f.setup.call(t,r,h,a)||t.addEventListener&&t.addEventListener(d,a)),f.add&&(f.add.call(t,c),c.handler.guid||(c.handler.guid=n.guid)),i?p.splice(p.delegateCount++,0,c):p.push(c),k.event.global[d]=!0)}},remove:function(e,t,n,r,i){var o,a,s,u,l,c,f,p,d,h,g,v=Q.hasData(e)&&Q.get(e);if(v&&(u=v.events)){l=(t=(t||"").match(R)||[""]).length;while(l--)if(d=g=(s=Ee.exec(t[l])||[])[1],h=(s[2]||"").split(".").sort(),d){f=k.event.special[d]||{},p=u[d=(r?f.delegateType:f.bindType)||d]||[],s=s[2]&&new RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"),a=o=p.length;while(o--)c=p[o],!i&&g!==c.origType||n&&n.guid!==c.guid||s&&!s.test(c.namespace)||r&&r!==c.selector&&("**"!==r||!c.selector)||(p.splice(o,1),c.selector&&p.delegateCount--,f.remove&&f.remove.call(e,c));a&&!p.length&&(f.teardown&&!1!==f.teardown.call(e,h,v.handle)||k.removeEvent(e,d,v.handle),delete u[d])}else for(d in u)k.event.remove(e,d+t[l],n,r,!0);k.isEmptyObject(u)&&Q.remove(e,"handle events")}},dispatch:function(e){var t,n,r,i,o,a,s=k.event.fix(e),u=new Array(arguments.length),l=(Q.get(this,"events")||{})[s.type]||[],c=k.event.special[s.type]||{};for(u[0]=s,t=1;t<arguments.length;t++)u[t]=arguments[t];if(s.delegateTarget=this,!c.preDispatch||!1!==c.preDispatch.call(this,s)){a=k.event.handlers.call(this,s,l),t=0;while((i=a[t++])&&!s.isPropagationStopped()){s.currentTarget=i.elem,n=0;while((o=i.handlers[n++])&&!s.isImmediatePropagationStopped())s.rnamespace&&!1!==o.namespace&&!s.rnamespace.test(o.namespace)||(s.handleObj=o,s.data=o.data,void 0!==(r=((k.event.special[o.origType]||{}).handle||o.handler).apply(i.elem,u))&&!1===(s.result=r)&&(s.preventDefault(),s.stopPropagation()))}return c.postDispatch&&c.postDispatch.call(this,s),s.result}},handlers:function(e,t){var n,r,i,o,a,s=[],u=t.delegateCount,l=e.target;if(u&&l.nodeType&&!("click"===e.type&&1<=e.button))for(;l!==this;l=l.parentNode||this)if(1===l.nodeType&&("click"!==e.type||!0!==l.disabled)){for(o=[],a={},n=0;n<u;n++)void 0===a[i=(r=t[n]).selector+" "]&&(a[i]=r.needsContext?-1<k(i,this).index(l):k.find(i,this,null,[l]).length),a[i]&&o.push(r);o.length&&s.push({elem:l,handlers:o})}return l=this,u<t.length&&s.push({elem:l,handlers:t.slice(u)}),s},addProp:function(t,e){Object.defineProperty(k.Event.prototype,t,{enumerable:!0,configurable:!0,get:m(e)?function(){if(this.originalEvent)return e(this.originalEvent)}:function(){if(this.originalEvent)return this.originalEvent[t]},set:function(e){Object.defineProperty(this,t,{enumerable:!0,configurable:!0,writable:!0,value:e})}})},fix:function(e){return e[k.expando]?e:new k.Event(e)},special:{load:{noBubble:!0},click:{setup:function(e){var t=this||e;return pe.test(t.type)&&t.click&&A(t,"input")&&De(t,"click",ke),!1},trigger:function(e){var t=this||e;return pe.test(t.type)&&t.click&&A(t,"input")&&De(t,"click"),!0},_default:function(e){var t=e.target;return pe.test(t.type)&&t.click&&A(t,"input")&&Q.get(t,"click")||A(t,"a")}},beforeunload:{postDispatch:function(e){void 0!==e.result&&e.originalEvent&&(e.originalEvent.returnValue=e.result)}}}},k.removeEvent=function(e,t,n){e.removeEventListener&&e.removeEventListener(t,n)},k.Event=function(e,t){if(!(this instanceof k.Event))return new k.Event(e,t);e&&e.type?(this.originalEvent=e,this.type=e.type,this.isDefaultPrevented=e.defaultPrevented||void 0===e.defaultPrevented&&!1===e.returnValue?ke:Se,this.target=e.target&&3===e.target.nodeType?e.target.parentNode:e.target,this.currentTarget=e.currentTarget,this.relatedTarget=e.relatedTarget):this.type=e,t&&k.extend(this,t),this.timeStamp=e&&e.timeStamp||Date.now(),this[k.expando]=!0},k.Event.prototype={constructor:k.Event,isDefaultPrevented:Se,isPropagationStopped:Se,isImmediatePropagationStopped:Se,isSimulated:!1,preventDefault:function(){var e=this.originalEvent;this.isDefaultPrevented=ke,e&&!this.isSimulated&&e.preventDefault()},stopPropagation:function(){var e=this.originalEvent;this.isPropagationStopped=ke,e&&!this.isSimulated&&e.stopPropagation()},stopImmediatePropagation:function(){var e=this.originalEvent;this.isImmediatePropagationStopped=ke,e&&!this.isSimulated&&e.stopImmediatePropagation(),this.stopPropagation()}},k.each({altKey:!0,bubbles:!0,cancelable:!0,changedTouches:!0,ctrlKey:!0,detail:!0,eventPhase:!0,metaKey:!0,pageX:!0,pageY:!0,shiftKey:!0,view:!0,"char":!0,code:!0,charCode:!0,key:!0,keyCode:!0,button:!0,buttons:!0,clientX:!0,clientY:!0,offsetX:!0,offsetY:!0,pointerId:!0,pointerType:!0,screenX:!0,screenY:!0,targetTouches:!0,toElement:!0,touches:!0,which:function(e){var t=e.button;return null==e.which&&Te.test(e.type)?null!=e.charCode?e.charCode:e.keyCode:!e.which&&void 0!==t&&Ce.test(e.type)?1&t?1:2&t?3:4&t?2:0:e.which}},k.event.addProp),k.each({focus:"focusin",blur:"focusout"},function(e,t){k.event.special[e]={setup:function(){return De(this,e,Ne),!1},trigger:function(){return De(this,e),!0},delegateType:t}}),k.each({mouseenter:"mouseover",mouseleave:"mouseout",pointerenter:"pointerover",pointerleave:"pointerout"},function(e,i){k.event.special[e]={delegateType:i,bindType:i,handle:function(e){var t,n=e.relatedTarget,r=e.handleObj;return n&&(n===this||k.contains(this,n))||(e.type=r.origType,t=r.handler.apply(this,arguments),e.type=i),t}}}),k.fn.extend({on:function(e,t,n,r){return Ae(this,e,t,n,r)},one:function(e,t,n,r){return Ae(this,e,t,n,r,1)},off:function(e,t,n){var r,i;if(e&&e.preventDefault&&e.handleObj)return r=e.handleObj,k(e.delegateTarget).off(r.namespace?r.origType+"."+r.namespace:r.origType,r.selector,r.handler),this;if("object"==typeof e){for(i in e)this.off(i,t,e[i]);return this}return!1!==t&&"function"!=typeof t||(n=t,t=void 0),!1===n&&(n=Se),this.each(function(){k.event.remove(this,e,n,t)})}});var je=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi,qe=/<script|<style|<link/i,Le=/checked\s*(?:[^=]|=\s*.checked.)/i,He=/^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g;function Oe(e,t){return A(e,"table")&&A(11!==t.nodeType?t:t.firstChild,"tr")&&k(e).children("tbody")[0]||e}function Pe(e){return e.type=(null!==e.getAttribute("type"))+"/"+e.type,e}function Re(e){return"true/"===(e.type||"").slice(0,5)?e.type=e.type.slice(5):e.removeAttribute("type"),e}function Me(e,t){var n,r,i,o,a,s,u,l;if(1===t.nodeType){if(Q.hasData(e)&&(o=Q.access(e),a=Q.set(t,o),l=o.events))for(i in delete a.handle,a.events={},l)for(n=0,r=l[i].length;n<r;n++)k.event.add(t,i,l[i][n]);J.hasData(e)&&(s=J.access(e),u=k.extend({},s),J.set(t,u))}}function Ie(n,r,i,o){r=g.apply([],r);var e,t,a,s,u,l,c=0,f=n.length,p=f-1,d=r[0],h=m(d);if(h||1<f&&"string"==typeof d&&!y.checkClone&&Le.test(d))return n.each(function(e){var t=n.eq(e);h&&(r[0]=d.call(this,e,t.html())),Ie(t,r,i,o)});if(f&&(t=(e=we(r,n[0].ownerDocument,!1,n,o)).firstChild,1===e.childNodes.length&&(e=t),t||o)){for(s=(a=k.map(ve(e,"script"),Pe)).length;c<f;c++)u=e,c!==p&&(u=k.clone(u,!0,!0),s&&k.merge(a,ve(u,"script"))),i.call(n[c],u,c);if(s)for(l=a[a.length-1].ownerDocument,k.map(a,Re),c=0;c<s;c++)u=a[c],he.test(u.type||"")&&!Q.access(u,"globalEval")&&k.contains(l,u)&&(u.src&&"module"!==(u.type||"").toLowerCase()?k._evalUrl&&!u.noModule&&k._evalUrl(u.src,{nonce:u.nonce||u.getAttribute("nonce")}):b(u.textContent.replace(He,""),u,l))}return n}function We(e,t,n){for(var r,i=t?k.filter(t,e):e,o=0;null!=(r=i[o]);o++)n||1!==r.nodeType||k.cleanData(ve(r)),r.parentNode&&(n&&oe(r)&&ye(ve(r,"script")),r.parentNode.removeChild(r));return e}k.extend({htmlPrefilter:function(e){return e.replace(je,"<$1></$2>")},clone:function(e,t,n){var r,i,o,a,s,u,l,c=e.cloneNode(!0),f=oe(e);if(!(y.noCloneChecked||1!==e.nodeType&&11!==e.nodeType||k.isXMLDoc(e)))for(a=ve(c),r=0,i=(o=ve(e)).length;r<i;r++)s=o[r],u=a[r],void 0,"input"===(l=u.nodeName.toLowerCase())&&pe.test(s.type)?u.checked=s.checked:"input"!==l&&"textarea"!==l||(u.defaultValue=s.defaultValue);if(t)if(n)for(o=o||ve(e),a=a||ve(c),r=0,i=o.length;r<i;r++)Me(o[r],a[r]);else Me(e,c);return 0<(a=ve(c,"script")).length&&ye(a,!f&&ve(e,"script")),c},cleanData:function(e){for(var t,n,r,i=k.event.special,o=0;void 0!==(n=e[o]);o++)if(G(n)){if(t=n[Q.expando]){if(t.events)for(r in t.events)i[r]?k.event.remove(n,r):k.removeEvent(n,r,t.handle);n[Q.expando]=void 0}n[J.expando]&&(n[J.expando]=void 0)}}}),k.fn.extend({detach:function(e){return We(this,e,!0)},remove:function(e){return We(this,e)},text:function(e){return _(this,function(e){return void 0===e?k.text(this):this.empty().each(function(){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||(this.textContent=e)})},null,e,arguments.length)},append:function(){return Ie(this,arguments,function(e){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||Oe(this,e).appendChild(e)})},prepend:function(){return Ie(this,arguments,function(e){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var t=Oe(this,e);t.insertBefore(e,t.firstChild)}})},before:function(){return Ie(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this)})},after:function(){return Ie(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this.nextSibling)})},empty:function(){for(var e,t=0;null!=(e=this[t]);t++)1===e.nodeType&&(k.cleanData(ve(e,!1)),e.textContent="");return this},clone:function(e,t){return e=null!=e&&e,t=null==t?e:t,this.map(function(){return k.clone(this,e,t)})},html:function(e){return _(this,function(e){var t=this[0]||{},n=0,r=this.length;if(void 0===e&&1===t.nodeType)return t.innerHTML;if("string"==typeof e&&!qe.test(e)&&!ge[(de.exec(e)||["",""])[1].toLowerCase()]){e=k.htmlPrefilter(e);try{for(;n<r;n++)1===(t=this[n]||{}).nodeType&&(k.cleanData(ve(t,!1)),t.innerHTML=e);t=0}catch(e){}}t&&this.empty().append(e)},null,e,arguments.length)},replaceWith:function(){var n=[];return Ie(this,arguments,function(e){var t=this.parentNode;k.inArray(this,n)<0&&(k.cleanData(ve(this)),t&&t.replaceChild(e,this))},n)}}),k.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,a){k.fn[e]=function(e){for(var t,n=[],r=k(e),i=r.length-1,o=0;o<=i;o++)t=o===i?this:this.clone(!0),k(r[o])[a](t),u.apply(n,t.get());return this.pushStack(n)}});var $e=new RegExp("^("+te+")(?!px)[a-z%]+$","i"),Fe=function(e){var t=e.ownerDocument.defaultView;return t&&t.opener||(t=C),t.getComputedStyle(e)},Be=new RegExp(re.join("|"),"i");function _e(e,t,n){var r,i,o,a,s=e.style;return(n=n||Fe(e))&&(""!==(a=n.getPropertyValue(t)||n[t])||oe(e)||(a=k.style(e,t)),!y.pixelBoxStyles()&&$e.test(a)&&Be.test(t)&&(r=s.width,i=s.minWidth,o=s.maxWidth,s.minWidth=s.maxWidth=s.width=a,a=n.width,s.width=r,s.minWidth=i,s.maxWidth=o)),void 0!==a?a+"":a}function ze(e,t){return{get:function(){if(!e())return(this.get=t).apply(this,arguments);delete this.get}}}!function(){function e(){if(u){s.style.cssText="position:absolute;left:-11111px;width:60px;margin-top:1px;padding:0;border:0",u.style.cssText="position:relative;display:block;box-sizing:border-box;overflow:scroll;margin:auto;border:1px;padding:1px;width:60%;top:1%",ie.appendChild(s).appendChild(u);var e=C.getComputedStyle(u);n="1%"!==e.top,a=12===t(e.marginLeft),u.style.right="60%",o=36===t(e.right),r=36===t(e.width),u.style.position="absolute",i=12===t(u.offsetWidth/3),ie.removeChild(s),u=null}}function t(e){return Math.round(parseFloat(e))}var n,r,i,o,a,s=E.createElement("div"),u=E.createElement("div");u.style&&(u.style.backgroundClip="content-box",u.cloneNode(!0).style.backgroundClip="",y.clearCloneStyle="content-box"===u.style.backgroundClip,k.extend(y,{boxSizingReliable:function(){return e(),r},pixelBoxStyles:function(){return e(),o},pixelPosition:function(){return e(),n},reliableMarginLeft:function(){return e(),a},scrollboxSize:function(){return e(),i}}))}();var Ue=["Webkit","Moz","ms"],Xe=E.createElement("div").style,Ve={};function Ge(e){var t=k.cssProps[e]||Ve[e];return t||(e in Xe?e:Ve[e]=function(e){var t=e[0].toUpperCase()+e.slice(1),n=Ue.length;while(n--)if((e=Ue[n]+t)in Xe)return e}(e)||e)}var Ye=/^(none|table(?!-c[ea]).+)/,Qe=/^--/,Je={position:"absolute",visibility:"hidden",display:"block"},Ke={letterSpacing:"0",fontWeight:"400"};function Ze(e,t,n){var r=ne.exec(t);return r?Math.max(0,r[2]-(n||0))+(r[3]||"px"):t}function et(e,t,n,r,i,o){var a="width"===t?1:0,s=0,u=0;if(n===(r?"border":"content"))return 0;for(;a<4;a+=2)"margin"===n&&(u+=k.css(e,n+re[a],!0,i)),r?("content"===n&&(u-=k.css(e,"padding"+re[a],!0,i)),"margin"!==n&&(u-=k.css(e,"border"+re[a]+"Width",!0,i))):(u+=k.css(e,"padding"+re[a],!0,i),"padding"!==n?u+=k.css(e,"border"+re[a]+"Width",!0,i):s+=k.css(e,"border"+re[a]+"Width",!0,i));return!r&&0<=o&&(u+=Math.max(0,Math.ceil(e["offset"+t[0].toUpperCase()+t.slice(1)]-o-u-s-.5))||0),u}function tt(e,t,n){var r=Fe(e),i=(!y.boxSizingReliable()||n)&&"border-box"===k.css(e,"boxSizing",!1,r),o=i,a=_e(e,t,r),s="offset"+t[0].toUpperCase()+t.slice(1);if($e.test(a)){if(!n)return a;a="auto"}return(!y.boxSizingReliable()&&i||"auto"===a||!parseFloat(a)&&"inline"===k.css(e,"display",!1,r))&&e.getClientRects().length&&(i="border-box"===k.css(e,"boxSizing",!1,r),(o=s in e)&&(a=e[s])),(a=parseFloat(a)||0)+et(e,t,n||(i?"border":"content"),o,r,a)+"px"}function nt(e,t,n,r,i){return new nt.prototype.init(e,t,n,r,i)}k.extend({cssHooks:{opacity:{get:function(e,t){if(t){var n=_e(e,"opacity");return""===n?"1":n}}}},cssNumber:{animationIterationCount:!0,columnCount:!0,fillOpacity:!0,flexGrow:!0,flexShrink:!0,fontWeight:!0,gridArea:!0,gridColumn:!0,gridColumnEnd:!0,gridColumnStart:!0,gridRow:!0,gridRowEnd:!0,gridRowStart:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{},style:function(e,t,n,r){if(e&&3!==e.nodeType&&8!==e.nodeType&&e.style){var i,o,a,s=V(t),u=Qe.test(t),l=e.style;if(u||(t=Ge(s)),a=k.cssHooks[t]||k.cssHooks[s],void 0===n)return a&&"get"in a&&void 0!==(i=a.get(e,!1,r))?i:l[t];"string"===(o=typeof n)&&(i=ne.exec(n))&&i[1]&&(n=le(e,t,i),o="number"),null!=n&&n==n&&("number"!==o||u||(n+=i&&i[3]||(k.cssNumber[s]?"":"px")),y.clearCloneStyle||""!==n||0!==t.indexOf("background")||(l[t]="inherit"),a&&"set"in a&&void 0===(n=a.set(e,n,r))||(u?l.setProperty(t,n):l[t]=n))}},css:function(e,t,n,r){var i,o,a,s=V(t);return Qe.test(t)||(t=Ge(s)),(a=k.cssHooks[t]||k.cssHooks[s])&&"get"in a&&(i=a.get(e,!0,n)),void 0===i&&(i=_e(e,t,r)),"normal"===i&&t in Ke&&(i=Ke[t]),""===n||n?(o=parseFloat(i),!0===n||isFinite(o)?o||0:i):i}}),k.each(["height","width"],function(e,u){k.cssHooks[u]={get:function(e,t,n){if(t)return!Ye.test(k.css(e,"display"))||e.getClientRects().length&&e.getBoundingClientRect().width?tt(e,u,n):ue(e,Je,function(){return tt(e,u,n)})},set:function(e,t,n){var r,i=Fe(e),o=!y.scrollboxSize()&&"absolute"===i.position,a=(o||n)&&"border-box"===k.css(e,"boxSizing",!1,i),s=n?et(e,u,n,a,i):0;return a&&o&&(s-=Math.ceil(e["offset"+u[0].toUpperCase()+u.slice(1)]-parseFloat(i[u])-et(e,u,"border",!1,i)-.5)),s&&(r=ne.exec(t))&&"px"!==(r[3]||"px")&&(e.style[u]=t,t=k.css(e,u)),Ze(0,t,s)}}}),k.cssHooks.marginLeft=ze(y.reliableMarginLeft,function(e,t){if(t)return(parseFloat(_e(e,"marginLeft"))||e.getBoundingClientRect().left-ue(e,{marginLeft:0},function(){return e.getBoundingClientRect().left}))+"px"}),k.each({margin:"",padding:"",border:"Width"},function(i,o){k.cssHooks[i+o]={expand:function(e){for(var t=0,n={},r="string"==typeof e?e.split(" "):[e];t<4;t++)n[i+re[t]+o]=r[t]||r[t-2]||r[0];return n}},"margin"!==i&&(k.cssHooks[i+o].set=Ze)}),k.fn.extend({css:function(e,t){return _(this,function(e,t,n){var r,i,o={},a=0;if(Array.isArray(t)){for(r=Fe(e),i=t.length;a<i;a++)o[t[a]]=k.css(e,t[a],!1,r);return o}return void 0!==n?k.style(e,t,n):k.css(e,t)},e,t,1<arguments.length)}}),((k.Tween=nt).prototype={constructor:nt,init:function(e,t,n,r,i,o){this.elem=e,this.prop=n,this.easing=i||k.easing._default,this.options=t,this.start=this.now=this.cur(),this.end=r,this.unit=o||(k.cssNumber[n]?"":"px")},cur:function(){var e=nt.propHooks[this.prop];return e&&e.get?e.get(this):nt.propHooks._default.get(this)},run:function(e){var t,n=nt.propHooks[this.prop];return this.options.duration?this.pos=t=k.easing[this.easing](e,this.options.duration*e,0,1,this.options.duration):this.pos=t=e,this.now=(this.end-this.start)*t+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),n&&n.set?n.set(this):nt.propHooks._default.set(this),this}}).init.prototype=nt.prototype,(nt.propHooks={_default:{get:function(e){var t;return 1!==e.elem.nodeType||null!=e.elem[e.prop]&&null==e.elem.style[e.prop]?e.elem[e.prop]:(t=k.css(e.elem,e.prop,""))&&"auto"!==t?t:0},set:function(e){k.fx.step[e.prop]?k.fx.step[e.prop](e):1!==e.elem.nodeType||!k.cssHooks[e.prop]&&null==e.elem.style[Ge(e.prop)]?e.elem[e.prop]=e.now:k.style(e.elem,e.prop,e.now+e.unit)}}}).scrollTop=nt.propHooks.scrollLeft={set:function(e){e.elem.nodeType&&e.elem.parentNode&&(e.elem[e.prop]=e.now)}},k.easing={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},_default:"swing"},k.fx=nt.prototype.init,k.fx.step={};var rt,it,ot,at,st=/^(?:toggle|show|hide)$/,ut=/queueHooks$/;function lt(){it&&(!1===E.hidden&&C.requestAnimationFrame?C.requestAnimationFrame(lt):C.setTimeout(lt,k.fx.interval),k.fx.tick())}function ct(){return C.setTimeout(function(){rt=void 0}),rt=Date.now()}function ft(e,t){var n,r=0,i={height:e};for(t=t?1:0;r<4;r+=2-t)i["margin"+(n=re[r])]=i["padding"+n]=e;return t&&(i.opacity=i.width=e),i}function pt(e,t,n){for(var r,i=(dt.tweeners[t]||[]).concat(dt.tweeners["*"]),o=0,a=i.length;o<a;o++)if(r=i[o].call(n,t,e))return r}function dt(o,e,t){var n,a,r=0,i=dt.prefilters.length,s=k.Deferred().always(function(){delete u.elem}),u=function(){if(a)return!1;for(var e=rt||ct(),t=Math.max(0,l.startTime+l.duration-e),n=1-(t/l.duration||0),r=0,i=l.tweens.length;r<i;r++)l.tweens[r].run(n);return s.notifyWith(o,[l,n,t]),n<1&&i?t:(i||s.notifyWith(o,[l,1,0]),s.resolveWith(o,[l]),!1)},l=s.promise({elem:o,props:k.extend({},e),opts:k.extend(!0,{specialEasing:{},easing:k.easing._default},t),originalProperties:e,originalOptions:t,startTime:rt||ct(),duration:t.duration,tweens:[],createTween:function(e,t){var n=k.Tween(o,l.opts,e,t,l.opts.specialEasing[e]||l.opts.easing);return l.tweens.push(n),n},stop:function(e){var t=0,n=e?l.tweens.length:0;if(a)return this;for(a=!0;t<n;t++)l.tweens[t].run(1);return e?(s.notifyWith(o,[l,1,0]),s.resolveWith(o,[l,e])):s.rejectWith(o,[l,e]),this}}),c=l.props;for(!function(e,t){var n,r,i,o,a;for(n in e)if(i=t[r=V(n)],o=e[n],Array.isArray(o)&&(i=o[1],o=e[n]=o[0]),n!==r&&(e[r]=o,delete e[n]),(a=k.cssHooks[r])&&"expand"in a)for(n in o=a.expand(o),delete e[r],o)n in e||(e[n]=o[n],t[n]=i);else t[r]=i}(c,l.opts.specialEasing);r<i;r++)if(n=dt.prefilters[r].call(l,o,c,l.opts))return m(n.stop)&&(k._queueHooks(l.elem,l.opts.queue).stop=n.stop.bind(n)),n;return k.map(c,pt,l),m(l.opts.start)&&l.opts.start.call(o,l),l.progress(l.opts.progress).done(l.opts.done,l.opts.complete).fail(l.opts.fail).always(l.opts.always),k.fx.timer(k.extend(u,{elem:o,anim:l,queue:l.opts.queue})),l}k.Animation=k.extend(dt,{tweeners:{"*":[function(e,t){var n=this.createTween(e,t);return le(n.elem,e,ne.exec(t),n),n}]},tweener:function(e,t){m(e)?(t=e,e=["*"]):e=e.match(R);for(var n,r=0,i=e.length;r<i;r++)n=e[r],dt.tweeners[n]=dt.tweeners[n]||[],dt.tweeners[n].unshift(t)},prefilters:[function(e,t,n){var r,i,o,a,s,u,l,c,f="width"in t||"height"in t,p=this,d={},h=e.style,g=e.nodeType&&se(e),v=Q.get(e,"fxshow");for(r in n.queue||(null==(a=k._queueHooks(e,"fx")).unqueued&&(a.unqueued=0,s=a.empty.fire,a.empty.fire=function(){a.unqueued||s()}),a.unqueued++,p.always(function(){p.always(function(){a.unqueued--,k.queue(e,"fx").length||a.empty.fire()})})),t)if(i=t[r],st.test(i)){if(delete t[r],o=o||"toggle"===i,i===(g?"hide":"show")){if("show"!==i||!v||void 0===v[r])continue;g=!0}d[r]=v&&v[r]||k.style(e,r)}if((u=!k.isEmptyObject(t))||!k.isEmptyObject(d))for(r in f&&1===e.nodeType&&(n.overflow=[h.overflow,h.overflowX,h.overflowY],null==(l=v&&v.display)&&(l=Q.get(e,"display")),"none"===(c=k.css(e,"display"))&&(l?c=l:(fe([e],!0),l=e.style.display||l,c=k.css(e,"display"),fe([e]))),("inline"===c||"inline-block"===c&&null!=l)&&"none"===k.css(e,"float")&&(u||(p.done(function(){h.display=l}),null==l&&(c=h.display,l="none"===c?"":c)),h.display="inline-block")),n.overflow&&(h.overflow="hidden",p.always(function(){h.overflow=n.overflow[0],h.overflowX=n.overflow[1],h.overflowY=n.overflow[2]})),u=!1,d)u||(v?"hidden"in v&&(g=v.hidden):v=Q.access(e,"fxshow",{display:l}),o&&(v.hidden=!g),g&&fe([e],!0),p.done(function(){for(r in g||fe([e]),Q.remove(e,"fxshow"),d)k.style(e,r,d[r])})),u=pt(g?v[r]:0,r,p),r in v||(v[r]=u.start,g&&(u.end=u.start,u.start=0))}],prefilter:function(e,t){t?dt.prefilters.unshift(e):dt.prefilters.push(e)}}),k.speed=function(e,t,n){var r=e&&"object"==typeof e?k.extend({},e):{complete:n||!n&&t||m(e)&&e,duration:e,easing:n&&t||t&&!m(t)&&t};return k.fx.off?r.duration=0:"number"!=typeof r.duration&&(r.duration in k.fx.speeds?r.duration=k.fx.speeds[r.duration]:r.duration=k.fx.speeds._default),null!=r.queue&&!0!==r.queue||(r.queue="fx"),r.old=r.complete,r.complete=function(){m(r.old)&&r.old.call(this),r.queue&&k.dequeue(this,r.queue)},r},k.fn.extend({fadeTo:function(e,t,n,r){return this.filter(se).css("opacity",0).show().end().animate({opacity:t},e,n,r)},animate:function(t,e,n,r){var i=k.isEmptyObject(t),o=k.speed(e,n,r),a=function(){var e=dt(this,k.extend({},t),o);(i||Q.get(this,"finish"))&&e.stop(!0)};return a.finish=a,i||!1===o.queue?this.each(a):this.queue(o.queue,a)},stop:function(i,e,o){var a=function(e){var t=e.stop;delete e.stop,t(o)};return"string"!=typeof i&&(o=e,e=i,i=void 0),e&&!1!==i&&this.queue(i||"fx",[]),this.each(function(){var e=!0,t=null!=i&&i+"queueHooks",n=k.timers,r=Q.get(this);if(t)r[t]&&r[t].stop&&a(r[t]);else for(t in r)r[t]&&r[t].stop&&ut.test(t)&&a(r[t]);for(t=n.length;t--;)n[t].elem!==this||null!=i&&n[t].queue!==i||(n[t].anim.stop(o),e=!1,n.splice(t,1));!e&&o||k.dequeue(this,i)})},finish:function(a){return!1!==a&&(a=a||"fx"),this.each(function(){var e,t=Q.get(this),n=t[a+"queue"],r=t[a+"queueHooks"],i=k.timers,o=n?n.length:0;for(t.finish=!0,k.queue(this,a,[]),r&&r.stop&&r.stop.call(this,!0),e=i.length;e--;)i[e].elem===this&&i[e].queue===a&&(i[e].anim.stop(!0),i.splice(e,1));for(e=0;e<o;e++)n[e]&&n[e].finish&&n[e].finish.call(this);delete t.finish})}}),k.each(["toggle","show","hide"],function(e,r){var i=k.fn[r];k.fn[r]=function(e,t,n){return null==e||"boolean"==typeof e?i.apply(this,arguments):this.animate(ft(r,!0),e,t,n)}}),k.each({slideDown:ft("show"),slideUp:ft("hide"),slideToggle:ft("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,r){k.fn[e]=function(e,t,n){return this.animate(r,e,t,n)}}),k.timers=[],k.fx.tick=function(){var e,t=0,n=k.timers;for(rt=Date.now();t<n.length;t++)(e=n[t])()||n[t]!==e||n.splice(t--,1);n.length||k.fx.stop(),rt=void 0},k.fx.timer=function(e){k.timers.push(e),k.fx.start()},k.fx.interval=13,k.fx.start=function(){it||(it=!0,lt())},k.fx.stop=function(){it=null},k.fx.speeds={slow:600,fast:200,_default:400},k.fn.delay=function(r,e){return r=k.fx&&k.fx.speeds[r]||r,e=e||"fx",this.queue(e,function(e,t){var n=C.setTimeout(e,r);t.stop=function(){C.clearTimeout(n)}})},ot=E.createElement("input"),at=E.createElement("select").appendChild(E.createElement("option")),ot.type="checkbox",y.checkOn=""!==ot.value,y.optSelected=at.selected,(ot=E.createElement("input")).value="t",ot.type="radio",y.radioValue="t"===ot.value;var ht,gt=k.expr.attrHandle;k.fn.extend({attr:function(e,t){return _(this,k.attr,e,t,1<arguments.length)},removeAttr:function(e){return this.each(function(){k.removeAttr(this,e)})}}),k.extend({attr:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return"undefined"==typeof e.getAttribute?k.prop(e,t,n):(1===o&&k.isXMLDoc(e)||(i=k.attrHooks[t.toLowerCase()]||(k.expr.match.bool.test(t)?ht:void 0)),void 0!==n?null===n?void k.removeAttr(e,t):i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:(e.setAttribute(t,n+""),n):i&&"get"in i&&null!==(r=i.get(e,t))?r:null==(r=k.find.attr(e,t))?void 0:r)},attrHooks:{type:{set:function(e,t){if(!y.radioValue&&"radio"===t&&A(e,"input")){var n=e.value;return e.setAttribute("type",t),n&&(e.value=n),t}}}},removeAttr:function(e,t){var n,r=0,i=t&&t.match(R);if(i&&1===e.nodeType)while(n=i[r++])e.removeAttribute(n)}}),ht={set:function(e,t,n){return!1===t?k.removeAttr(e,n):e.setAttribute(n,n),n}},k.each(k.expr.match.bool.source.match(/\w+/g),function(e,t){var a=gt[t]||k.find.attr;gt[t]=function(e,t,n){var r,i,o=t.toLowerCase();return n||(i=gt[o],gt[o]=r,r=null!=a(e,t,n)?o:null,gt[o]=i),r}});var vt=/^(?:input|select|textarea|button)$/i,yt=/^(?:a|area)$/i;function mt(e){return(e.match(R)||[]).join(" ")}function xt(e){return e.getAttribute&&e.getAttribute("class")||""}function bt(e){return Array.isArray(e)?e:"string"==typeof e&&e.match(R)||[]}k.fn.extend({prop:function(e,t){return _(this,k.prop,e,t,1<arguments.length)},removeProp:function(e){return this.each(function(){delete this[k.propFix[e]||e]})}}),k.extend({prop:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return 1===o&&k.isXMLDoc(e)||(t=k.propFix[t]||t,i=k.propHooks[t]),void 0!==n?i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:e[t]=n:i&&"get"in i&&null!==(r=i.get(e,t))?r:e[t]},propHooks:{tabIndex:{get:function(e){var t=k.find.attr(e,"tabindex");return t?parseInt(t,10):vt.test(e.nodeName)||yt.test(e.nodeName)&&e.href?0:-1}}},propFix:{"for":"htmlFor","class":"className"}}),y.optSelected||(k.propHooks.selected={get:function(e){var t=e.parentNode;return t&&t.parentNode&&t.parentNode.selectedIndex,null},set:function(e){var t=e.parentNode;t&&(t.selectedIndex,t.parentNode&&t.parentNode.selectedIndex)}}),k.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){k.propFix[this.toLowerCase()]=this}),k.fn.extend({addClass:function(t){var e,n,r,i,o,a,s,u=0;if(m(t))return this.each(function(e){k(this).addClass(t.call(this,e,xt(this)))});if((e=bt(t)).length)while(n=this[u++])if(i=xt(n),r=1===n.nodeType&&" "+mt(i)+" "){a=0;while(o=e[a++])r.indexOf(" "+o+" ")<0&&(r+=o+" ");i!==(s=mt(r))&&n.setAttribute("class",s)}return this},removeClass:function(t){var e,n,r,i,o,a,s,u=0;if(m(t))return this.each(function(e){k(this).removeClass(t.call(this,e,xt(this)))});if(!arguments.length)return this.attr("class","");if((e=bt(t)).length)while(n=this[u++])if(i=xt(n),r=1===n.nodeType&&" "+mt(i)+" "){a=0;while(o=e[a++])while(-1<r.indexOf(" "+o+" "))r=r.replace(" "+o+" "," ");i!==(s=mt(r))&&n.setAttribute("class",s)}return this},toggleClass:function(i,t){var o=typeof i,a="string"===o||Array.isArray(i);return"boolean"==typeof t&&a?t?this.addClass(i):this.removeClass(i):m(i)?this.each(function(e){k(this).toggleClass(i.call(this,e,xt(this),t),t)}):this.each(function(){var e,t,n,r;if(a){t=0,n=k(this),r=bt(i);while(e=r[t++])n.hasClass(e)?n.removeClass(e):n.addClass(e)}else void 0!==i&&"boolean"!==o||((e=xt(this))&&Q.set(this,"__className__",e),this.setAttribute&&this.setAttribute("class",e||!1===i?"":Q.get(this,"__className__")||""))})},hasClass:function(e){var t,n,r=0;t=" "+e+" ";while(n=this[r++])if(1===n.nodeType&&-1<(" "+mt(xt(n))+" ").indexOf(t))return!0;return!1}});var wt=/\r/g;k.fn.extend({val:function(n){var r,e,i,t=this[0];return arguments.length?(i=m(n),this.each(function(e){var t;1===this.nodeType&&(null==(t=i?n.call(this,e,k(this).val()):n)?t="":"number"==typeof t?t+="":Array.isArray(t)&&(t=k.map(t,function(e){return null==e?"":e+""})),(r=k.valHooks[this.type]||k.valHooks[this.nodeName.toLowerCase()])&&"set"in r&&void 0!==r.set(this,t,"value")||(this.value=t))})):t?(r=k.valHooks[t.type]||k.valHooks[t.nodeName.toLowerCase()])&&"get"in r&&void 0!==(e=r.get(t,"value"))?e:"string"==typeof(e=t.value)?e.replace(wt,""):null==e?"":e:void 0}}),k.extend({valHooks:{option:{get:function(e){var t=k.find.attr(e,"value");return null!=t?t:mt(k.text(e))}},select:{get:function(e){var t,n,r,i=e.options,o=e.selectedIndex,a="select-one"===e.type,s=a?null:[],u=a?o+1:i.length;for(r=o<0?u:a?o:0;r<u;r++)if(((n=i[r]).selected||r===o)&&!n.disabled&&(!n.parentNode.disabled||!A(n.parentNode,"optgroup"))){if(t=k(n).val(),a)return t;s.push(t)}return s},set:function(e,t){var n,r,i=e.options,o=k.makeArray(t),a=i.length;while(a--)((r=i[a]).selected=-1<k.inArray(k.valHooks.option.get(r),o))&&(n=!0);return n||(e.selectedIndex=-1),o}}}}),k.each(["radio","checkbox"],function(){k.valHooks[this]={set:function(e,t){if(Array.isArray(t))return e.checked=-1<k.inArray(k(e).val(),t)}},y.checkOn||(k.valHooks[this].get=function(e){return null===e.getAttribute("value")?"on":e.value})}),y.focusin="onfocusin"in C;var Tt=/^(?:focusinfocus|focusoutblur)$/,Ct=function(e){e.stopPropagation()};k.extend(k.event,{trigger:function(e,t,n,r){var i,o,a,s,u,l,c,f,p=[n||E],d=v.call(e,"type")?e.type:e,h=v.call(e,"namespace")?e.namespace.split("."):[];if(o=f=a=n=n||E,3!==n.nodeType&&8!==n.nodeType&&!Tt.test(d+k.event.triggered)&&(-1<d.indexOf(".")&&(d=(h=d.split(".")).shift(),h.sort()),u=d.indexOf(":")<0&&"on"+d,(e=e[k.expando]?e:new k.Event(d,"object"==typeof e&&e)).isTrigger=r?2:3,e.namespace=h.join("."),e.rnamespace=e.namespace?new RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,e.result=void 0,e.target||(e.target=n),t=null==t?[e]:k.makeArray(t,[e]),c=k.event.special[d]||{},r||!c.trigger||!1!==c.trigger.apply(n,t))){if(!r&&!c.noBubble&&!x(n)){for(s=c.delegateType||d,Tt.test(s+d)||(o=o.parentNode);o;o=o.parentNode)p.push(o),a=o;a===(n.ownerDocument||E)&&p.push(a.defaultView||a.parentWindow||C)}i=0;while((o=p[i++])&&!e.isPropagationStopped())f=o,e.type=1<i?s:c.bindType||d,(l=(Q.get(o,"events")||{})[e.type]&&Q.get(o,"handle"))&&l.apply(o,t),(l=u&&o[u])&&l.apply&&G(o)&&(e.result=l.apply(o,t),!1===e.result&&e.preventDefault());return e.type=d,r||e.isDefaultPrevented()||c._default&&!1!==c._default.apply(p.pop(),t)||!G(n)||u&&m(n[d])&&!x(n)&&((a=n[u])&&(n[u]=null),k.event.triggered=d,e.isPropagationStopped()&&f.addEventListener(d,Ct),n[d](),e.isPropagationStopped()&&f.removeEventListener(d,Ct),k.event.triggered=void 0,a&&(n[u]=a)),e.result}},simulate:function(e,t,n){var r=k.extend(new k.Event,n,{type:e,isSimulated:!0});k.event.trigger(r,null,t)}}),k.fn.extend({trigger:function(e,t){return this.each(function(){k.event.trigger(e,t,this)})},triggerHandler:function(e,t){var n=this[0];if(n)return k.event.trigger(e,t,n,!0)}}),y.focusin||k.each({focus:"focusin",blur:"focusout"},function(n,r){var i=function(e){k.event.simulate(r,e.target,k.event.fix(e))};k.event.special[r]={setup:function(){var e=this.ownerDocument||this,t=Q.access(e,r);t||e.addEventListener(n,i,!0),Q.access(e,r,(t||0)+1)},teardown:function(){var e=this.ownerDocument||this,t=Q.access(e,r)-1;t?Q.access(e,r,t):(e.removeEventListener(n,i,!0),Q.remove(e,r))}}});var Et=C.location,kt=Date.now(),St=/\?/;k.parseXML=function(e){var t;if(!e||"string"!=typeof e)return null;try{t=(new C.DOMParser).parseFromString(e,"text/xml")}catch(e){t=void 0}return t&&!t.getElementsByTagName("parsererror").length||k.error("Invalid XML: "+e),t};var Nt=/\[\]$/,At=/\r?\n/g,Dt=/^(?:submit|button|image|reset|file)$/i,jt=/^(?:input|select|textarea|keygen)/i;function qt(n,e,r,i){var t;if(Array.isArray(e))k.each(e,function(e,t){r||Nt.test(n)?i(n,t):qt(n+"["+("object"==typeof t&&null!=t?e:"")+"]",t,r,i)});else if(r||"object"!==w(e))i(n,e);else for(t in e)qt(n+"["+t+"]",e[t],r,i)}k.param=function(e,t){var n,r=[],i=function(e,t){var n=m(t)?t():t;r[r.length]=encodeURIComponent(e)+"="+encodeURIComponent(null==n?"":n)};if(null==e)return"";if(Array.isArray(e)||e.jquery&&!k.isPlainObject(e))k.each(e,function(){i(this.name,this.value)});else for(n in e)qt(n,e[n],t,i);return r.join("&")},k.fn.extend({serialize:function(){return k.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var e=k.prop(this,"elements");return e?k.makeArray(e):this}).filter(function(){var e=this.type;return this.name&&!k(this).is(":disabled")&&jt.test(this.nodeName)&&!Dt.test(e)&&(this.checked||!pe.test(e))}).map(function(e,t){var n=k(this).val();return null==n?null:Array.isArray(n)?k.map(n,function(e){return{name:t.name,value:e.replace(At,"\r\n")}}):{name:t.name,value:n.replace(At,"\r\n")}}).get()}});var Lt=/%20/g,Ht=/#.*$/,Ot=/([?&])_=[^&]*/,Pt=/^(.*?):[ \t]*([^\r\n]*)$/gm,Rt=/^(?:GET|HEAD)$/,Mt=/^\/\//,It={},Wt={},$t="*/".concat("*"),Ft=E.createElement("a");function Bt(o){return function(e,t){"string"!=typeof e&&(t=e,e="*");var n,r=0,i=e.toLowerCase().match(R)||[];if(m(t))while(n=i[r++])"+"===n[0]?(n=n.slice(1)||"*",(o[n]=o[n]||[]).unshift(t)):(o[n]=o[n]||[]).push(t)}}function _t(t,i,o,a){var s={},u=t===Wt;function l(e){var r;return s[e]=!0,k.each(t[e]||[],function(e,t){var n=t(i,o,a);return"string"!=typeof n||u||s[n]?u?!(r=n):void 0:(i.dataTypes.unshift(n),l(n),!1)}),r}return l(i.dataTypes[0])||!s["*"]&&l("*")}function zt(e,t){var n,r,i=k.ajaxSettings.flatOptions||{};for(n in t)void 0!==t[n]&&((i[n]?e:r||(r={}))[n]=t[n]);return r&&k.extend(!0,e,r),e}Ft.href=Et.href,k.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:Et.href,type:"GET",isLocal:/^(?:about|app|app-storage|.+-extension|file|res|widget):$/.test(Et.protocol),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":$t,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":JSON.parse,"text xml":k.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(e,t){return t?zt(zt(e,k.ajaxSettings),t):zt(k.ajaxSettings,e)},ajaxPrefilter:Bt(It),ajaxTransport:Bt(Wt),ajax:function(e,t){"object"==typeof e&&(t=e,e=void 0),t=t||{};var c,f,p,n,d,r,h,g,i,o,v=k.ajaxSetup({},t),y=v.context||v,m=v.context&&(y.nodeType||y.jquery)?k(y):k.event,x=k.Deferred(),b=k.Callbacks("once memory"),w=v.statusCode||{},a={},s={},u="canceled",T={readyState:0,getResponseHeader:function(e){var t;if(h){if(!n){n={};while(t=Pt.exec(p))n[t[1].toLowerCase()+" "]=(n[t[1].toLowerCase()+" "]||[]).concat(t[2])}t=n[e.toLowerCase()+" "]}return null==t?null:t.join(", ")},getAllResponseHeaders:function(){return h?p:null},setRequestHeader:function(e,t){return null==h&&(e=s[e.toLowerCase()]=s[e.toLowerCase()]||e,a[e]=t),this},overrideMimeType:function(e){return null==h&&(v.mimeType=e),this},statusCode:function(e){var t;if(e)if(h)T.always(e[T.status]);else for(t in e)w[t]=[w[t],e[t]];return this},abort:function(e){var t=e||u;return c&&c.abort(t),l(0,t),this}};if(x.promise(T),v.url=((e||v.url||Et.href)+"").replace(Mt,Et.protocol+"//"),v.type=t.method||t.type||v.method||v.type,v.dataTypes=(v.dataType||"*").toLowerCase().match(R)||[""],null==v.crossDomain){r=E.createElement("a");try{r.href=v.url,r.href=r.href,v.crossDomain=Ft.protocol+"//"+Ft.host!=r.protocol+"//"+r.host}catch(e){v.crossDomain=!0}}if(v.data&&v.processData&&"string"!=typeof v.data&&(v.data=k.param(v.data,v.traditional)),_t(It,v,t,T),h)return T;for(i in(g=k.event&&v.global)&&0==k.active++&&k.event.trigger("ajaxStart"),v.type=v.type.toUpperCase(),v.hasContent=!Rt.test(v.type),f=v.url.replace(Ht,""),v.hasContent?v.data&&v.processData&&0===(v.contentType||"").indexOf("application/x-www-form-urlencoded")&&(v.data=v.data.replace(Lt,"+")):(o=v.url.slice(f.length),v.data&&(v.processData||"string"==typeof v.data)&&(f+=(St.test(f)?"&":"?")+v.data,delete v.data),!1===v.cache&&(f=f.replace(Ot,"$1"),o=(St.test(f)?"&":"?")+"_="+kt+++o),v.url=f+o),v.ifModified&&(k.lastModified[f]&&T.setRequestHeader("If-Modified-Since",k.lastModified[f]),k.etag[f]&&T.setRequestHeader("If-None-Match",k.etag[f])),(v.data&&v.hasContent&&!1!==v.contentType||t.contentType)&&T.setRequestHeader("Content-Type",v.contentType),T.setRequestHeader("Accept",v.dataTypes[0]&&v.accepts[v.dataTypes[0]]?v.accepts[v.dataTypes[0]]+("*"!==v.dataTypes[0]?", "+$t+"; q=0.01":""):v.accepts["*"]),v.headers)T.setRequestHeader(i,v.headers[i]);if(v.beforeSend&&(!1===v.beforeSend.call(y,T,v)||h))return T.abort();if(u="abort",b.add(v.complete),T.done(v.success),T.fail(v.error),c=_t(Wt,v,t,T)){if(T.readyState=1,g&&m.trigger("ajaxSend",[T,v]),h)return T;v.async&&0<v.timeout&&(d=C.setTimeout(function(){T.abort("timeout")},v.timeout));try{h=!1,c.send(a,l)}catch(e){if(h)throw e;l(-1,e)}}else l(-1,"No Transport");function l(e,t,n,r){var i,o,a,s,u,l=t;h||(h=!0,d&&C.clearTimeout(d),c=void 0,p=r||"",T.readyState=0<e?4:0,i=200<=e&&e<300||304===e,n&&(s=function(e,t,n){var r,i,o,a,s=e.contents,u=e.dataTypes;while("*"===u[0])u.shift(),void 0===r&&(r=e.mimeType||t.getResponseHeader("Content-Type"));if(r)for(i in s)if(s[i]&&s[i].test(r)){u.unshift(i);break}if(u[0]in n)o=u[0];else{for(i in n){if(!u[0]||e.converters[i+" "+u[0]]){o=i;break}a||(a=i)}o=o||a}if(o)return o!==u[0]&&u.unshift(o),n[o]}(v,T,n)),s=function(e,t,n,r){var i,o,a,s,u,l={},c=e.dataTypes.slice();if(c[1])for(a in e.converters)l[a.toLowerCase()]=e.converters[a];o=c.shift();while(o)if(e.responseFields[o]&&(n[e.responseFields[o]]=t),!u&&r&&e.dataFilter&&(t=e.dataFilter(t,e.dataType)),u=o,o=c.shift())if("*"===o)o=u;else if("*"!==u&&u!==o){if(!(a=l[u+" "+o]||l["* "+o]))for(i in l)if((s=i.split(" "))[1]===o&&(a=l[u+" "+s[0]]||l["* "+s[0]])){!0===a?a=l[i]:!0!==l[i]&&(o=s[0],c.unshift(s[1]));break}if(!0!==a)if(a&&e["throws"])t=a(t);else try{t=a(t)}catch(e){return{state:"parsererror",error:a?e:"No conversion from "+u+" to "+o}}}return{state:"success",data:t}}(v,s,T,i),i?(v.ifModified&&((u=T.getResponseHeader("Last-Modified"))&&(k.lastModified[f]=u),(u=T.getResponseHeader("etag"))&&(k.etag[f]=u)),204===e||"HEAD"===v.type?l="nocontent":304===e?l="notmodified":(l=s.state,o=s.data,i=!(a=s.error))):(a=l,!e&&l||(l="error",e<0&&(e=0))),T.status=e,T.statusText=(t||l)+"",i?x.resolveWith(y,[o,l,T]):x.rejectWith(y,[T,l,a]),T.statusCode(w),w=void 0,g&&m.trigger(i?"ajaxSuccess":"ajaxError",[T,v,i?o:a]),b.fireWith(y,[T,l]),g&&(m.trigger("ajaxComplete",[T,v]),--k.active||k.event.trigger("ajaxStop")))}return T},getJSON:function(e,t,n){return k.get(e,t,n,"json")},getScript:function(e,t){return k.get(e,void 0,t,"script")}}),k.each(["get","post"],function(e,i){k[i]=function(e,t,n,r){return m(t)&&(r=r||n,n=t,t=void 0),k.ajax(k.extend({url:e,type:i,dataType:r,data:t,success:n},k.isPlainObject(e)&&e))}}),k._evalUrl=function(e,t){return k.ajax({url:e,type:"GET",dataType:"script",cache:!0,async:!1,global:!1,converters:{"text script":function(){}},dataFilter:function(e){k.globalEval(e,t)}})},k.fn.extend({wrapAll:function(e){var t;return this[0]&&(m(e)&&(e=e.call(this[0])),t=k(e,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&t.insertBefore(this[0]),t.map(function(){var e=this;while(e.firstElementChild)e=e.firstElementChild;return e}).append(this)),this},wrapInner:function(n){return m(n)?this.each(function(e){k(this).wrapInner(n.call(this,e))}):this.each(function(){var e=k(this),t=e.contents();t.length?t.wrapAll(n):e.append(n)})},wrap:function(t){var n=m(t);return this.each(function(e){k(this).wrapAll(n?t.call(this,e):t)})},unwrap:function(e){return this.parent(e).not("body").each(function(){k(this).replaceWith(this.childNodes)}),this}}),k.expr.pseudos.hidden=function(e){return!k.expr.pseudos.visible(e)},k.expr.pseudos.visible=function(e){return!!(e.offsetWidth||e.offsetHeight||e.getClientRects().length)},k.ajaxSettings.xhr=function(){try{return new C.XMLHttpRequest}catch(e){}};var Ut={0:200,1223:204},Xt=k.ajaxSettings.xhr();y.cors=!!Xt&&"withCredentials"in Xt,y.ajax=Xt=!!Xt,k.ajaxTransport(function(i){var o,a;if(y.cors||Xt&&!i.crossDomain)return{send:function(e,t){var n,r=i.xhr();if(r.open(i.type,i.url,i.async,i.username,i.password),i.xhrFields)for(n in i.xhrFields)r[n]=i.xhrFields[n];for(n in i.mimeType&&r.overrideMimeType&&r.overrideMimeType(i.mimeType),i.crossDomain||e["X-Requested-With"]||(e["X-Requested-With"]="XMLHttpRequest"),e)r.setRequestHeader(n,e[n]);o=function(e){return function(){o&&(o=a=r.onload=r.onerror=r.onabort=r.ontimeout=r.onreadystatechange=null,"abort"===e?r.abort():"error"===e?"number"!=typeof r.status?t(0,"error"):t(r.status,r.statusText):t(Ut[r.status]||r.status,r.statusText,"text"!==(r.responseType||"text")||"string"!=typeof r.responseText?{binary:r.response}:{text:r.responseText},r.getAllResponseHeaders()))}},r.onload=o(),a=r.onerror=r.ontimeout=o("error"),void 0!==r.onabort?r.onabort=a:r.onreadystatechange=function(){4===r.readyState&&C.setTimeout(function(){o&&a()})},o=o("abort");try{r.send(i.hasContent&&i.data||null)}catch(e){if(o)throw e}},abort:function(){o&&o()}}}),k.ajaxPrefilter(function(e){e.crossDomain&&(e.contents.script=!1)}),k.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(e){return k.globalEval(e),e}}}),k.ajaxPrefilter("script",function(e){void 0===e.cache&&(e.cache=!1),e.crossDomain&&(e.type="GET")}),k.ajaxTransport("script",function(n){var r,i;if(n.crossDomain||n.scriptAttrs)return{send:function(e,t){r=k("<script>").attr(n.scriptAttrs||{}).prop({charset:n.scriptCharset,src:n.url}).on("load error",i=function(e){r.remove(),i=null,e&&t("error"===e.type?404:200,e.type)}),E.head.appendChild(r[0])},abort:function(){i&&i()}}});var Vt,Gt=[],Yt=/(=)\?(?=&|$)|\?\?/;k.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var e=Gt.pop()||k.expando+"_"+kt++;return this[e]=!0,e}}),k.ajaxPrefilter("json jsonp",function(e,t,n){var r,i,o,a=!1!==e.jsonp&&(Yt.test(e.url)?"url":"string"==typeof e.data&&0===(e.contentType||"").indexOf("application/x-www-form-urlencoded")&&Yt.test(e.data)&&"data");if(a||"jsonp"===e.dataTypes[0])return r=e.jsonpCallback=m(e.jsonpCallback)?e.jsonpCallback():e.jsonpCallback,a?e[a]=e[a].replace(Yt,"$1"+r):!1!==e.jsonp&&(e.url+=(St.test(e.url)?"&":"?")+e.jsonp+"="+r),e.converters["script json"]=function(){return o||k.error(r+" was not called"),o[0]},e.dataTypes[0]="json",i=C[r],C[r]=function(){o=arguments},n.always(function(){void 0===i?k(C).removeProp(r):C[r]=i,e[r]&&(e.jsonpCallback=t.jsonpCallback,Gt.push(r)),o&&m(i)&&i(o[0]),o=i=void 0}),"script"}),y.createHTMLDocument=((Vt=E.implementation.createHTMLDocument("").body).innerHTML="<form></form><form></form>",2===Vt.childNodes.length),k.parseHTML=function(e,t,n){return"string"!=typeof e?[]:("boolean"==typeof t&&(n=t,t=!1),t||(y.createHTMLDocument?((r=(t=E.implementation.createHTMLDocument("")).createElement("base")).href=E.location.href,t.head.appendChild(r)):t=E),o=!n&&[],(i=D.exec(e))?[t.createElement(i[1])]:(i=we([e],t,o),o&&o.length&&k(o).remove(),k.merge([],i.childNodes)));var r,i,o},k.fn.load=function(e,t,n){var r,i,o,a=this,s=e.indexOf(" ");return-1<s&&(r=mt(e.slice(s)),e=e.slice(0,s)),m(t)?(n=t,t=void 0):t&&"object"==typeof t&&(i="POST"),0<a.length&&k.ajax({url:e,type:i||"GET",dataType:"html",data:t}).done(function(e){o=arguments,a.html(r?k("<div>").append(k.parseHTML(e)).find(r):e)}).always(n&&function(e,t){a.each(function(){n.apply(this,o||[e.responseText,t,e])})}),this},k.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(e,t){k.fn[t]=function(e){return this.on(t,e)}}),k.expr.pseudos.animated=function(t){return k.grep(k.timers,function(e){return t===e.elem}).length},k.offset={setOffset:function(e,t,n){var r,i,o,a,s,u,l=k.css(e,"position"),c=k(e),f={};"static"===l&&(e.style.position="relative"),s=c.offset(),o=k.css(e,"top"),u=k.css(e,"left"),("absolute"===l||"fixed"===l)&&-1<(o+u).indexOf("auto")?(a=(r=c.position()).top,i=r.left):(a=parseFloat(o)||0,i=parseFloat(u)||0),m(t)&&(t=t.call(e,n,k.extend({},s))),null!=t.top&&(f.top=t.top-s.top+a),null!=t.left&&(f.left=t.left-s.left+i),"using"in t?t.using.call(e,f):c.css(f)}},k.fn.extend({offset:function(t){if(arguments.length)return void 0===t?this:this.each(function(e){k.offset.setOffset(this,t,e)});var e,n,r=this[0];return r?r.getClientRects().length?(e=r.getBoundingClientRect(),n=r.ownerDocument.defaultView,{top:e.top+n.pageYOffset,left:e.left+n.pageXOffset}):{top:0,left:0}:void 0},position:function(){if(this[0]){var e,t,n,r=this[0],i={top:0,left:0};if("fixed"===k.css(r,"position"))t=r.getBoundingClientRect();else{t=this.offset(),n=r.ownerDocument,e=r.offsetParent||n.documentElement;while(e&&(e===n.body||e===n.documentElement)&&"static"===k.css(e,"position"))e=e.parentNode;e&&e!==r&&1===e.nodeType&&((i=k(e).offset()).top+=k.css(e,"borderTopWidth",!0),i.left+=k.css(e,"borderLeftWidth",!0))}return{top:t.top-i.top-k.css(r,"marginTop",!0),left:t.left-i.left-k.css(r,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){var e=this.offsetParent;while(e&&"static"===k.css(e,"position"))e=e.offsetParent;return e||ie})}}),k.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(t,i){var o="pageYOffset"===i;k.fn[t]=function(e){return _(this,function(e,t,n){var r;if(x(e)?r=e:9===e.nodeType&&(r=e.defaultView),void 0===n)return r?r[i]:e[t];r?r.scrollTo(o?r.pageXOffset:n,o?n:r.pageYOffset):e[t]=n},t,e,arguments.length)}}),k.each(["top","left"],function(e,n){k.cssHooks[n]=ze(y.pixelPosition,function(e,t){if(t)return t=_e(e,n),$e.test(t)?k(e).position()[n]+"px":t})}),k.each({Height:"height",Width:"width"},function(a,s){k.each({padding:"inner"+a,content:s,"":"outer"+a},function(r,o){k.fn[o]=function(e,t){var n=arguments.length&&(r||"boolean"!=typeof e),i=r||(!0===e||!0===t?"margin":"border");return _(this,function(e,t,n){var r;return x(e)?0===o.indexOf("outer")?e["inner"+a]:e.document.documentElement["client"+a]:9===e.nodeType?(r=e.documentElement,Math.max(e.body["scroll"+a],r["scroll"+a],e.body["offset"+a],r["offset"+a],r["client"+a])):void 0===n?k.css(e,t,i):k.style(e,t,n,i)},s,n?e:void 0,n)}})}),k.each("blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "),function(e,n){k.fn[n]=function(e,t){return 0<arguments.length?this.on(n,null,e,t):this.trigger(n)}}),k.fn.extend({hover:function(e,t){return this.mouseenter(e).mouseleave(t||e)}}),k.fn.extend({bind:function(e,t,n){return this.on(e,null,t,n)},unbind:function(e,t){return this.off(e,null,t)},delegate:function(e,t,n,r){return this.on(t,e,n,r)},undelegate:function(e,t,n){return 1===arguments.length?this.off(e,"**"):this.off(t,e||"**",n)}}),k.proxy=function(e,t){var n,r,i;if("string"==typeof t&&(n=e[t],t=e,e=n),m(e))return r=s.call(arguments,2),(i=function(){return e.apply(t||this,r.concat(s.call(arguments)))}).guid=e.guid=e.guid||k.guid++,i},k.holdReady=function(e){e?k.readyWait++:k.ready(!0)},k.isArray=Array.isArray,k.parseJSON=JSON.parse,k.nodeName=A,k.isFunction=m,k.isWindow=x,k.camelCase=V,k.type=w,k.now=Date.now,k.isNumeric=function(e){var t=k.type(e);return("number"===t||"string"===t)&&!isNaN(e-parseFloat(e))},"function"==typeof define&&define.amd&&define("jquery",[],function(){return k});var Qt=C.jQuery,Jt=C.$;return k.noConflict=function(e){return C.$===k&&(C.$=Jt),e&&C.jQuery===k&&(C.jQuery=Qt),k},e||(C.jQuery=C.$=k),k}); diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.js.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.js.meta new file mode 100644 index 00000000..f27bc022 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/jquery.js.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 6a2c238ce4a4fb44e8b1efb7e8f89500 +TextScriptImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js.meta new file mode 100644 index 00000000..f5824d31 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js.meta @@ -0,0 +1,8 @@ +fileFormatVersion: 2 +guid: 990ff87b32b8d3643b1df73a27dfff91 +folderAsset: yes +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js/modernizr.min.js b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js/modernizr.min.js new file mode 100644 index 00000000..f65d4797 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js/modernizr.min.js @@ -0,0 +1,4 @@ +/* Modernizr 2.6.2 (Custom Build) | MIT & BSD + * Build: http://modernizr.com/download/#-fontface-backgroundsize-borderimage-borderradius-boxshadow-flexbox-hsla-multiplebgs-opacity-rgba-textshadow-cssanimations-csscolumns-generatedcontent-cssgradients-cssreflections-csstransforms-csstransforms3d-csstransitions-applicationcache-canvas-canvastext-draganddrop-hashchange-history-audio-video-indexeddb-input-inputtypes-localstorage-postmessage-sessionstorage-websockets-websqldatabase-webworkers-geolocation-inlinesvg-smil-svg-svgclippaths-touch-webgl-shiv-mq-cssclasses-addtest-prefixed-teststyles-testprop-testallprops-hasevent-prefixes-domprefixes-load + */ +;window.Modernizr=function(a,b,c){function D(a){j.cssText=a}function E(a,b){return D(n.join(a+";")+(b||""))}function F(a,b){return typeof a===b}function G(a,b){return!!~(""+a).indexOf(b)}function H(a,b){for(var d in a){var e=a[d];if(!G(e,"-")&&j[e]!==c)return b=="pfx"?e:!0}return!1}function I(a,b,d){for(var e in a){var f=b[a[e]];if(f!==c)return d===!1?a[e]:F(f,"function")?f.bind(d||b):f}return!1}function J(a,b,c){var d=a.charAt(0).toUpperCase()+a.slice(1),e=(a+" "+p.join(d+" ")+d).split(" ");return F(b,"string")||F(b,"undefined")?H(e,b):(e=(a+" "+q.join(d+" ")+d).split(" "),I(e,b,c))}function K(){e.input=function(c){for(var d=0,e=c.length;d<e;d++)u[c[d]]=c[d]in k;return u.list&&(u.list=!!b.createElement("datalist")&&!!a.HTMLDataListElement),u}("autocomplete autofocus list placeholder max min multiple pattern required step".split(" ")),e.inputtypes=function(a){for(var d=0,e,f,h,i=a.length;d<i;d++)k.setAttribute("type",f=a[d]),e=k.type!=="text",e&&(k.value=l,k.style.cssText="position:absolute;visibility:hidden;",/^range$/.test(f)&&k.style.WebkitAppearance!==c?(g.appendChild(k),h=b.defaultView,e=h.getComputedStyle&&h.getComputedStyle(k,null).WebkitAppearance!=="textfield"&&k.offsetHeight!==0,g.removeChild(k)):/^(search|tel)$/.test(f)||(/^(url|email)$/.test(f)?e=k.checkValidity&&k.checkValidity()===!1:e=k.value!=l)),t[a[d]]=!!e;return t}("search tel url email datetime date month week time datetime-local number range color".split(" "))}var d="2.6.2",e={},f=!0,g=b.documentElement,h="modernizr",i=b.createElement(h),j=i.style,k=b.createElement("input"),l=":)",m={}.toString,n=" -webkit- -moz- -o- -ms- ".split(" "),o="Webkit Moz O ms",p=o.split(" "),q=o.toLowerCase().split(" "),r={svg:"http://www.w3.org/2000/svg"},s={},t={},u={},v=[],w=v.slice,x,y=function(a,c,d,e){var f,i,j,k,l=b.createElement("div"),m=b.body,n=m||b.createElement("body");if(parseInt(d,10))while(d--)j=b.createElement("div"),j.id=e?e[d]:h+(d+1),l.appendChild(j);return f=["­",'<style id="s',h,'">',a,"</style>"].join(""),l.id=h,(m?l:n).innerHTML+=f,n.appendChild(l),m||(n.style.background="",n.style.overflow="hidden",k=g.style.overflow,g.style.overflow="hidden",g.appendChild(n)),i=c(l,a),m?l.parentNode.removeChild(l):(n.parentNode.removeChild(n),g.style.overflow=k),!!i},z=function(b){var c=a.matchMedia||a.msMatchMedia;if(c)return c(b).matches;var d;return y("@media "+b+" { #"+h+" { position: absolute; } }",function(b){d=(a.getComputedStyle?getComputedStyle(b,null):b.currentStyle)["position"]=="absolute"}),d},A=function(){function d(d,e){e=e||b.createElement(a[d]||"div"),d="on"+d;var f=d in e;return f||(e.setAttribute||(e=b.createElement("div")),e.setAttribute&&e.removeAttribute&&(e.setAttribute(d,""),f=F(e[d],"function"),F(e[d],"undefined")||(e[d]=c),e.removeAttribute(d))),e=null,f}var a={select:"input",change:"input",submit:"form",reset:"form",error:"img",load:"img",abort:"img"};return d}(),B={}.hasOwnProperty,C;!F(B,"undefined")&&!F(B.call,"undefined")?C=function(a,b){return B.call(a,b)}:C=function(a,b){return b in a&&F(a.constructor.prototype[b],"undefined")},Function.prototype.bind||(Function.prototype.bind=function(b){var c=this;if(typeof c!="function")throw new TypeError;var d=w.call(arguments,1),e=function(){if(this instanceof e){var a=function(){};a.prototype=c.prototype;var f=new a,g=c.apply(f,d.concat(w.call(arguments)));return Object(g)===g?g:f}return c.apply(b,d.concat(w.call(arguments)))};return e}),s.flexbox=function(){return J("flexWrap")},s.canvas=function(){var a=b.createElement("canvas");return!!a.getContext&&!!a.getContext("2d")},s.canvastext=function(){return!!e.canvas&&!!F(b.createElement("canvas").getContext("2d").fillText,"function")},s.webgl=function(){return!!a.WebGLRenderingContext},s.touch=function(){var c;return"ontouchstart"in a||a.DocumentTouch&&b instanceof DocumentTouch?c=!0:y(["@media (",n.join("touch-enabled),("),h,")","{#modernizr{top:9px;position:absolute}}"].join(""),function(a){c=a.offsetTop===9}),c},s.geolocation=function(){return"geolocation"in navigator},s.postmessage=function(){return!!a.postMessage},s.websqldatabase=function(){return!!a.openDatabase},s.indexedDB=function(){return!!J("indexedDB",a)},s.hashchange=function(){return A("hashchange",a)&&(b.documentMode===c||b.documentMode>7)},s.history=function(){return!!a.history&&!!history.pushState},s.draganddrop=function(){var a=b.createElement("div");return"draggable"in a||"ondragstart"in a&&"ondrop"in a},s.websockets=function(){return"WebSocket"in a||"MozWebSocket"in a},s.rgba=function(){return D("background-color:rgba(150,255,150,.5)"),G(j.backgroundColor,"rgba")},s.hsla=function(){return D("background-color:hsla(120,40%,100%,.5)"),G(j.backgroundColor,"rgba")||G(j.backgroundColor,"hsla")},s.multiplebgs=function(){return D("background:url(https://),url(https://),red url(https://)"),/(url\s*\(.*?){3}/.test(j.background)},s.backgroundsize=function(){return J("backgroundSize")},s.borderimage=function(){return J("borderImage")},s.borderradius=function(){return J("borderRadius")},s.boxshadow=function(){return J("boxShadow")},s.textshadow=function(){return b.createElement("div").style.textShadow===""},s.opacity=function(){return E("opacity:.55"),/^0.55$/.test(j.opacity)},s.cssanimations=function(){return J("animationName")},s.csscolumns=function(){return J("columnCount")},s.cssgradients=function(){var a="background-image:",b="gradient(linear,left top,right bottom,from(#9f9),to(white));",c="linear-gradient(left top,#9f9, white);";return D((a+"-webkit- ".split(" ").join(b+a)+n.join(c+a)).slice(0,-a.length)),G(j.backgroundImage,"gradient")},s.cssreflections=function(){return J("boxReflect")},s.csstransforms=function(){return!!J("transform")},s.csstransforms3d=function(){var a=!!J("perspective");return a&&"webkitPerspective"in g.style&&y("@media (transform-3d),(-webkit-transform-3d){#modernizr{left:9px;position:absolute;height:3px;}}",function(b,c){a=b.offsetLeft===9&&b.offsetHeight===3}),a},s.csstransitions=function(){return J("transition")},s.fontface=function(){var a;return y('@font-face {font-family:"font";src:url("https://")}',function(c,d){var e=b.getElementById("smodernizr"),f=e.sheet||e.styleSheet,g=f?f.cssRules&&f.cssRules[0]?f.cssRules[0].cssText:f.cssText||"":"";a=/src/i.test(g)&&g.indexOf(d.split(" ")[0])===0}),a},s.generatedcontent=function(){var a;return y(["#",h,"{font:0/0 a}#",h,':after{content:"',l,'";visibility:hidden;font:3px/1 a}'].join(""),function(b){a=b.offsetHeight>=3}),a},s.video=function(){var a=b.createElement("video"),c=!1;try{if(c=!!a.canPlayType)c=new Boolean(c),c.ogg=a.canPlayType('video/ogg; codecs="theora"').replace(/^no$/,""),c.h264=a.canPlayType('video/mp4; codecs="avc1.42E01E"').replace(/^no$/,""),c.webm=a.canPlayType('video/webm; codecs="vp8, vorbis"').replace(/^no$/,"")}catch(d){}return c},s.audio=function(){var a=b.createElement("audio"),c=!1;try{if(c=!!a.canPlayType)c=new Boolean(c),c.ogg=a.canPlayType('audio/ogg; codecs="vorbis"').replace(/^no$/,""),c.mp3=a.canPlayType("audio/mpeg;").replace(/^no$/,""),c.wav=a.canPlayType('audio/wav; codecs="1"').replace(/^no$/,""),c.m4a=(a.canPlayType("audio/x-m4a;")||a.canPlayType("audio/aac;")).replace(/^no$/,"")}catch(d){}return c},s.localstorage=function(){try{return localStorage.setItem(h,h),localStorage.removeItem(h),!0}catch(a){return!1}},s.sessionstorage=function(){try{return sessionStorage.setItem(h,h),sessionStorage.removeItem(h),!0}catch(a){return!1}},s.webworkers=function(){return!!a.Worker},s.applicationcache=function(){return!!a.applicationCache},s.svg=function(){return!!b.createElementNS&&!!b.createElementNS(r.svg,"svg").createSVGRect},s.inlinesvg=function(){var a=b.createElement("div");return a.innerHTML="<svg/>",(a.firstChild&&a.firstChild.namespaceURI)==r.svg},s.smil=function(){return!!b.createElementNS&&/SVGAnimate/.test(m.call(b.createElementNS(r.svg,"animate")))},s.svgclippaths=function(){return!!b.createElementNS&&/SVGClipPath/.test(m.call(b.createElementNS(r.svg,"clipPath")))};for(var L in s)C(s,L)&&(x=L.toLowerCase(),e[x]=s[L](),v.push((e[x]?"":"no-")+x));return e.input||K(),e.addTest=function(a,b){if(typeof a=="object")for(var d in a)C(a,d)&&e.addTest(d,a[d]);else{a=a.toLowerCase();if(e[a]!==c)return e;b=typeof b=="function"?b():b,typeof f!="undefined"&&f&&(g.className+=" "+(b?"":"no-")+a),e[a]=b}return e},D(""),i=k=null,function(a,b){function k(a,b){var c=a.createElement("p"),d=a.getElementsByTagName("head")[0]||a.documentElement;return c.innerHTML="x<style>"+b+"</style>",d.insertBefore(c.lastChild,d.firstChild)}function l(){var a=r.elements;return typeof a=="string"?a.split(" "):a}function m(a){var b=i[a[g]];return b||(b={},h++,a[g]=h,i[h]=b),b}function n(a,c,f){c||(c=b);if(j)return c.createElement(a);f||(f=m(c));var g;return f.cache[a]?g=f.cache[a].cloneNode():e.test(a)?g=(f.cache[a]=f.createElem(a)).cloneNode():g=f.createElem(a),g.canHaveChildren&&!d.test(a)?f.frag.appendChild(g):g}function o(a,c){a||(a=b);if(j)return a.createDocumentFragment();c=c||m(a);var d=c.frag.cloneNode(),e=0,f=l(),g=f.length;for(;e<g;e++)d.createElement(f[e]);return d}function p(a,b){b.cache||(b.cache={},b.createElem=a.createElement,b.createFrag=a.createDocumentFragment,b.frag=b.createFrag()),a.createElement=function(c){return r.shivMethods?n(c,a,b):b.createElem(c)},a.createDocumentFragment=Function("h,f","return function(){var n=f.cloneNode(),c=n.createElement;h.shivMethods&&("+l().join().replace(/\w+/g,function(a){return b.createElem(a),b.frag.createElement(a),'c("'+a+'")'})+");return n}")(r,b.frag)}function q(a){a||(a=b);var c=m(a);return r.shivCSS&&!f&&!c.hasCSS&&(c.hasCSS=!!k(a,"article,aside,figcaption,figure,footer,header,hgroup,nav,section{display:block}mark{background:#FF0;color:#000}")),j||p(a,c),a}var c=a.html5||{},d=/^<|^(?:button|map|select|textarea|object|iframe|option|optgroup)$/i,e=/^(?:a|b|code|div|fieldset|h1|h2|h3|h4|h5|h6|i|label|li|ol|p|q|span|strong|style|table|tbody|td|th|tr|ul)$/i,f,g="_html5shiv",h=0,i={},j;(function(){try{var a=b.createElement("a");a.innerHTML="<xyz></xyz>",f="hidden"in a,j=a.childNodes.length==1||function(){b.createElement("a");var a=b.createDocumentFragment();return typeof a.cloneNode=="undefined"||typeof a.createDocumentFragment=="undefined"||typeof a.createElement=="undefined"}()}catch(c){f=!0,j=!0}})();var r={elements:c.elements||"abbr article aside audio bdi canvas data datalist details figcaption figure footer header hgroup mark meter nav output progress section summary time video",shivCSS:c.shivCSS!==!1,supportsUnknownElements:j,shivMethods:c.shivMethods!==!1,type:"default",shivDocument:q,createElement:n,createDocumentFragment:o};a.html5=r,q(b)}(this,b),e._version=d,e._prefixes=n,e._domPrefixes=q,e._cssomPrefixes=p,e.mq=z,e.hasEvent=A,e.testProp=function(a){return H([a])},e.testAllProps=J,e.testStyles=y,e.prefixed=function(a,b,c){return b?J(a,b,c):J(a,"pfx")},g.className=g.className.replace(/(^|\s)no-js(\s|$)/,"$1$2")+(f?" js "+v.join(" "):""),e}(this,this.document),function(a,b,c){function d(a){return"[object Function]"==o.call(a)}function e(a){return"string"==typeof a}function f(){}function g(a){return!a||"loaded"==a||"complete"==a||"uninitialized"==a}function h(){var a=p.shift();q=1,a?a.t?m(function(){("c"==a.t?B.injectCss:B.injectJs)(a.s,0,a.a,a.x,a.e,1)},0):(a(),h()):q=0}function i(a,c,d,e,f,i,j){function k(b){if(!o&&g(l.readyState)&&(u.r=o=1,!q&&h(),l.onload=l.onreadystatechange=null,b)){"img"!=a&&m(function(){t.removeChild(l)},50);for(var d in y[c])y[c].hasOwnProperty(d)&&y[c][d].onload()}}var j=j||B.errorTimeout,l=b.createElement(a),o=0,r=0,u={t:d,s:c,e:f,a:i,x:j};1===y[c]&&(r=1,y[c]=[]),"object"==a?l.data=c:(l.src=c,l.type=a),l.width=l.height="0",l.onerror=l.onload=l.onreadystatechange=function(){k.call(this,r)},p.splice(e,0,u),"img"!=a&&(r||2===y[c]?(t.insertBefore(l,s?null:n),m(k,j)):y[c].push(l))}function j(a,b,c,d,f){return q=0,b=b||"j",e(a)?i("c"==b?v:u,a,b,this.i++,c,d,f):(p.splice(this.i++,0,a),1==p.length&&h()),this}function k(){var a=B;return a.loader={load:j,i:0},a}var l=b.documentElement,m=a.setTimeout,n=b.getElementsByTagName("script")[0],o={}.toString,p=[],q=0,r="MozAppearance"in l.style,s=r&&!!b.createRange().compareNode,t=s?l:n.parentNode,l=a.opera&&"[object Opera]"==o.call(a.opera),l=!!b.attachEvent&&!l,u=r?"object":l?"script":"img",v=l?"script":u,w=Array.isArray||function(a){return"[object Array]"==o.call(a)},x=[],y={},z={timeout:function(a,b){return b.length&&(a.timeout=b[0]),a}},A,B;B=function(a){function b(a){var a=a.split("!"),b=x.length,c=a.pop(),d=a.length,c={url:c,origUrl:c,prefixes:a},e,f,g;for(f=0;f<d;f++)g=a[f].split("="),(e=z[g.shift()])&&(c=e(c,g));for(f=0;f<b;f++)c=x[f](c);return c}function g(a,e,f,g,h){var i=b(a),j=i.autoCallback;i.url.split(".").pop().split("?").shift(),i.bypass||(e&&(e=d(e)?e:e[a]||e[g]||e[a.split("/").pop().split("?")[0]]),i.instead?i.instead(a,e,f,g,h):(y[i.url]?i.noexec=!0:y[i.url]=1,f.load(i.url,i.forceCSS||!i.forceJS&&"css"==i.url.split(".").pop().split("?").shift()?"c":c,i.noexec,i.attrs,i.timeout),(d(e)||d(j))&&f.load(function(){k(),e&&e(i.origUrl,h,g),j&&j(i.origUrl,h,g),y[i.url]=2})))}function h(a,b){function c(a,c){if(a){if(e(a))c||(j=function(){var a=[].slice.call(arguments);k.apply(this,a),l()}),g(a,j,b,0,h);else if(Object(a)===a)for(n in m=function(){var b=0,c;for(c in a)a.hasOwnProperty(c)&&b++;return b}(),a)a.hasOwnProperty(n)&&(!c&&!--m&&(d(j)?j=function(){var a=[].slice.call(arguments);k.apply(this,a),l()}:j[n]=function(a){return function(){var b=[].slice.call(arguments);a&&a.apply(this,b),l()}}(k[n])),g(a[n],j,b,n,h))}else!c&&l()}var h=!!a.test,i=a.load||a.both,j=a.callback||f,k=j,l=a.complete||f,m,n;c(h?a.yep:a.nope,!!i),i&&c(i)}var i,j,l=this.yepnope.loader;if(e(a))g(a,0,l,0);else if(w(a))for(i=0;i<a.length;i++)j=a[i],e(j)?g(j,0,l,0):w(j)?B(j):Object(j)===j&&h(j,l);else Object(a)===a&&h(a,l)},B.addPrefix=function(a,b){z[a]=b},B.addFilter=function(a){x.push(a)},B.errorTimeout=1e4,null==b.readyState&&b.addEventListener&&(b.readyState="loading",b.addEventListener("DOMContentLoaded",A=function(){b.removeEventListener("DOMContentLoaded",A,0),b.readyState="complete"},0)),a.yepnope=k(),a.yepnope.executeStack=h,a.yepnope.injectJs=function(a,c,d,e,i,j){var k=b.createElement("script"),l,o,e=e||B.errorTimeout;k.src=a;for(o in d)k.setAttribute(o,d[o]);c=j?h:c||f,k.onreadystatechange=k.onload=function(){!l&&g(k.readyState)&&(l=1,c(),k.onload=k.onreadystatechange=null)},m(function(){l||(l=1,c(1))},e),i?k.onload():n.parentNode.insertBefore(k,n)},a.yepnope.injectCss=function(a,c,d,e,g,i){var e=b.createElement("link"),j,c=i?h:c||f;e.href=a,e.rel="stylesheet",e.type="text/css";for(j in d)e.setAttribute(j,d[j]);g||(n.parentNode.insertBefore(e,n),m(c,0))}}(this,document),Modernizr.load=function(){yepnope.apply(window,[].slice.call(arguments,0))}; diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js/modernizr.min.js.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js/modernizr.min.js.meta new file mode 100644 index 00000000..5418fa99 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js/modernizr.min.js.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 2f81dd9a21f155b48929d8e1eaef7941 +TextScriptImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js/theme.js b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js/theme.js new file mode 100644 index 00000000..af661a92 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js/theme.js @@ -0,0 +1,169 @@ +require=(function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({"sphinx-rtd-theme":[function(require,module,exports){ +var jQuery = (typeof(window) != 'undefined') ? window.jQuery : require('jquery'); + +// Sphinx theme nav state +function ThemeNav () { + + var nav = { + navBar: null, + win: null, + winScroll: false, + winResize: false, + linkScroll: false, + winPosition: 0, + winHeight: null, + docHeight: null, + isRunning: false + }; + + nav.enable = function () { + var self = this; + + if (!self.isRunning) { + self.isRunning = true; + jQuery(function ($) { + self.init($); + + self.reset(); + self.win.on('hashchange', self.reset); + + // Set scroll monitor + self.win.on('scroll', function () { + if (!self.linkScroll) { + self.winScroll = true; + } + }); + setInterval(function () { if (self.winScroll) self.onScroll(); }, 25); + + // Set resize monitor + self.win.on('resize', function () { + self.winResize = true; + }); + setInterval(function () { if (self.winResize) self.onResize(); }, 25); + self.onResize(); + }); + }; + }; + + nav.init = function ($) { + var doc = $(document), + self = this; + + this.navBar = $('div.wy-side-scroll:first'); + this.win = $(window); + + // Set up javascript UX bits + $(document) + // Shift nav in mobile when clicking the menu. + .on('click', "[data-toggle='wy-nav-top']", function() { + $("[data-toggle='wy-nav-shift']").toggleClass("shift"); + $("[data-toggle='rst-versions']").toggleClass("shift"); + }) + + // Nav menu link click operations + .on('click', ".wy-menu-vertical .current ul li a", function() { + var target = $(this); + // Close menu when you click a link. + $("[data-toggle='wy-nav-shift']").removeClass("shift"); + $("[data-toggle='rst-versions']").toggleClass("shift"); + // Handle dynamic display of l3 and l4 nav lists + self.toggleCurrent(target); + self.hashChange(); + }) + .on('click', "[data-toggle='rst-current-version']", function() { + $("[data-toggle='rst-versions']").toggleClass("shift-up"); + }) + + // Make tables responsive + $("table.docutils:not(.field-list)") + .wrap("<div class='wy-table-responsive'></div>"); + + // Add expand links to all parents of nested ul + $('.wy-menu-vertical ul').not('.simple').siblings('a').each(function () { + var link = $(this); + expand = $('<span class="toctree-expand"></span>'); + expand.on('click', function (ev) { + self.toggleCurrent(link); + ev.stopPropagation(); + return false; + }); + link.prepend(expand); + }); + }; + + nav.reset = function () { + // Get anchor from URL and open up nested nav + var anchor = encodeURI(window.location.hash); + if (anchor) { + try { + var link = $('.wy-menu-vertical') + .find('[href="' + anchor + '"]'); + // If we didn't find a link, it may be because we clicked on + // something that is not in the sidebar (eg: when using + // sphinxcontrib.httpdomain it generates headerlinks but those + // aren't picked up and placed in the toctree). So let's find + // the closest header in the document and try with that one. + if (link.length === 0) { + var doc_link = $('.document a[href="' + anchor + '"]'); + var closest_section = doc_link.closest('div.section'); + // Try again with the closest section entry. + link = $('.wy-menu-vertical') + .find('[href="#' + closest_section.attr("id") + '"]'); + + } + $('.wy-menu-vertical li.toctree-l1 li.current') + .removeClass('current'); + link.closest('li.toctree-l2').addClass('current'); + link.closest('li.toctree-l3').addClass('current'); + link.closest('li.toctree-l4').addClass('current'); + } + catch (err) { + console.log("Error expanding nav for anchor", err); + } + } + }; + + nav.onScroll = function () { + this.winScroll = false; + var newWinPosition = this.win.scrollTop(), + winBottom = newWinPosition + this.winHeight, + navPosition = this.navBar.scrollTop(), + newNavPosition = navPosition + (newWinPosition - this.winPosition); + if (newWinPosition < 0 || winBottom > this.docHeight) { + return; + } + this.navBar.scrollTop(newNavPosition); + this.winPosition = newWinPosition; + }; + + nav.onResize = function () { + this.winResize = false; + this.winHeight = this.win.height(); + this.docHeight = $(document).height(); + }; + + nav.hashChange = function () { + this.linkScroll = true; + this.win.one('hashchange', function () { + this.linkScroll = false; + }); + }; + + nav.toggleCurrent = function (elem) { + var parent_li = elem.closest('li'); + parent_li.siblings('li.current').removeClass('current'); + parent_li.siblings().find('li.current').removeClass('current'); + parent_li.find('> ul li.current').removeClass('current'); + parent_li.toggleClass('current'); + } + + return nav; +}; + +module.exports.ThemeNav = ThemeNav(); + +if (typeof(window) != 'undefined') { + window.SphinxRtdTheme = { StickyNav: module.exports.ThemeNav }; +} + +},{"jquery":"jquery"}]},{},["sphinx-rtd-theme"]); diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js/theme.js.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js/theme.js.meta new file mode 100644 index 00000000..1ad28b61 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/js/theme.js.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 93bdb8f1738ae5649aa3cf3d60e181e7 +TextScriptImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/language_data.js b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/language_data.js new file mode 100644 index 00000000..d2b4ee91 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/language_data.js @@ -0,0 +1,297 @@ +/* + * language_data.js + * ~~~~~~~~~~~~~~~~ + * + * This script contains the language-specific data used by searchtools.js, + * namely the list of stopwords, stemmer, scorer and splitter. + * + * :copyright: Copyright 2007-2020 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +var stopwords = ["a","and","are","as","at","be","but","by","for","if","in","into","is","it","near","no","not","of","on","or","such","that","the","their","then","there","these","they","this","to","was","will","with"]; + + +/* Non-minified version JS is _stemmer.js if file is provided */ +/** + * Porter Stemmer + */ +var Stemmer = function() { + + var step2list = { + ational: 'ate', + tional: 'tion', + enci: 'ence', + anci: 'ance', + izer: 'ize', + bli: 'ble', + alli: 'al', + entli: 'ent', + eli: 'e', + ousli: 'ous', + ization: 'ize', + ation: 'ate', + ator: 'ate', + alism: 'al', + iveness: 'ive', + fulness: 'ful', + ousness: 'ous', + aliti: 'al', + iviti: 'ive', + biliti: 'ble', + logi: 'log' + }; + + var step3list = { + icate: 'ic', + ative: '', + alize: 'al', + iciti: 'ic', + ical: 'ic', + ful: '', + ness: '' + }; + + var c = "[^aeiou]"; // consonant + var v = "[aeiouy]"; // vowel + var C = c + "[^aeiouy]*"; // consonant sequence + var V = v + "[aeiou]*"; // vowel sequence + + var mgr0 = "^(" + C + ")?" + V + C; // [C]VC... is m>0 + var meq1 = "^(" + C + ")?" + V + C + "(" + V + ")?$"; // [C]VC[V] is m=1 + var mgr1 = "^(" + C + ")?" + V + C + V + C; // [C]VCVC... is m>1 + var s_v = "^(" + C + ")?" + v; // vowel in stem + + this.stemWord = function (w) { + var stem; + var suffix; + var firstch; + var origword = w; + + if (w.length < 3) + return w; + + var re; + var re2; + var re3; + var re4; + + firstch = w.substr(0,1); + if (firstch == "y") + w = firstch.toUpperCase() + w.substr(1); + + // Step 1a + re = /^(.+?)(ss|i)es$/; + re2 = /^(.+?)([^s])s$/; + + if (re.test(w)) + w = w.replace(re,"$1$2"); + else if (re2.test(w)) + w = w.replace(re2,"$1$2"); + + // Step 1b + re = /^(.+?)eed$/; + re2 = /^(.+?)(ed|ing)$/; + if (re.test(w)) { + var fp = re.exec(w); + re = new RegExp(mgr0); + if (re.test(fp[1])) { + re = /.$/; + w = w.replace(re,""); + } + } + else if (re2.test(w)) { + var fp = re2.exec(w); + stem = fp[1]; + re2 = new RegExp(s_v); + if (re2.test(stem)) { + w = stem; + re2 = /(at|bl|iz)$/; + re3 = new RegExp("([^aeiouylsz])\\1$"); + re4 = new RegExp("^" + C + v + "[^aeiouwxy]$"); + if (re2.test(w)) + w = w + "e"; + else if (re3.test(w)) { + re = /.$/; + w = w.replace(re,""); + } + else if (re4.test(w)) + w = w + "e"; + } + } + + // Step 1c + re = /^(.+?)y$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(s_v); + if (re.test(stem)) + w = stem + "i"; + } + + // Step 2 + re = /^(.+?)(ational|tional|enci|anci|izer|bli|alli|entli|eli|ousli|ization|ation|ator|alism|iveness|fulness|ousness|aliti|iviti|biliti|logi)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + suffix = fp[2]; + re = new RegExp(mgr0); + if (re.test(stem)) + w = stem + step2list[suffix]; + } + + // Step 3 + re = /^(.+?)(icate|ative|alize|iciti|ical|ful|ness)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + suffix = fp[2]; + re = new RegExp(mgr0); + if (re.test(stem)) + w = stem + step3list[suffix]; + } + + // Step 4 + re = /^(.+?)(al|ance|ence|er|ic|able|ible|ant|ement|ment|ent|ou|ism|ate|iti|ous|ive|ize)$/; + re2 = /^(.+?)(s|t)(ion)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(mgr1); + if (re.test(stem)) + w = stem; + } + else if (re2.test(w)) { + var fp = re2.exec(w); + stem = fp[1] + fp[2]; + re2 = new RegExp(mgr1); + if (re2.test(stem)) + w = stem; + } + + // Step 5 + re = /^(.+?)e$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(mgr1); + re2 = new RegExp(meq1); + re3 = new RegExp("^" + C + v + "[^aeiouwxy]$"); + if (re.test(stem) || (re2.test(stem) && !(re3.test(stem)))) + w = stem; + } + re = /ll$/; + re2 = new RegExp(mgr1); + if (re.test(w) && re2.test(w)) { + re = /.$/; + w = w.replace(re,""); + } + + // and turn initial Y back to y + if (firstch == "y") + w = firstch.toLowerCase() + w.substr(1); + return w; + } +} + + + + + +var splitChars = (function() { + var result = {}; + var singles = [96, 180, 187, 191, 215, 247, 749, 885, 903, 907, 909, 930, 1014, 1648, + 1748, 1809, 2416, 2473, 2481, 2526, 2601, 2609, 2612, 2615, 2653, 2702, + 2706, 2729, 2737, 2740, 2857, 2865, 2868, 2910, 2928, 2948, 2961, 2971, + 2973, 3085, 3089, 3113, 3124, 3213, 3217, 3241, 3252, 3295, 3341, 3345, + 3369, 3506, 3516, 3633, 3715, 3721, 3736, 3744, 3748, 3750, 3756, 3761, + 3781, 3912, 4239, 4347, 4681, 4695, 4697, 4745, 4785, 4799, 4801, 4823, + 4881, 5760, 5901, 5997, 6313, 7405, 8024, 8026, 8028, 8030, 8117, 8125, + 8133, 8181, 8468, 8485, 8487, 8489, 8494, 8527, 11311, 11359, 11687, 11695, + 11703, 11711, 11719, 11727, 11735, 12448, 12539, 43010, 43014, 43019, 43587, + 43696, 43713, 64286, 64297, 64311, 64317, 64319, 64322, 64325, 65141]; + var i, j, start, end; + for (i = 0; i < singles.length; i++) { + result[singles[i]] = true; + } + var ranges = [[0, 47], [58, 64], [91, 94], [123, 169], [171, 177], [182, 184], [706, 709], + [722, 735], [741, 747], [751, 879], [888, 889], [894, 901], [1154, 1161], + [1318, 1328], [1367, 1368], [1370, 1376], [1416, 1487], [1515, 1519], [1523, 1568], + [1611, 1631], [1642, 1645], [1750, 1764], [1767, 1773], [1789, 1790], [1792, 1807], + [1840, 1868], [1958, 1968], [1970, 1983], [2027, 2035], [2038, 2041], [2043, 2047], + [2070, 2073], [2075, 2083], [2085, 2087], [2089, 2307], [2362, 2364], [2366, 2383], + [2385, 2391], [2402, 2405], [2419, 2424], [2432, 2436], [2445, 2446], [2449, 2450], + [2483, 2485], [2490, 2492], [2494, 2509], [2511, 2523], [2530, 2533], [2546, 2547], + [2554, 2564], [2571, 2574], [2577, 2578], [2618, 2648], [2655, 2661], [2672, 2673], + [2677, 2692], [2746, 2748], [2750, 2767], [2769, 2783], [2786, 2789], [2800, 2820], + [2829, 2830], [2833, 2834], [2874, 2876], [2878, 2907], [2914, 2917], [2930, 2946], + [2955, 2957], [2966, 2968], [2976, 2978], [2981, 2983], [2987, 2989], [3002, 3023], + [3025, 3045], [3059, 3076], [3130, 3132], [3134, 3159], [3162, 3167], [3170, 3173], + [3184, 3191], [3199, 3204], [3258, 3260], [3262, 3293], [3298, 3301], [3312, 3332], + [3386, 3388], [3390, 3423], [3426, 3429], [3446, 3449], [3456, 3460], [3479, 3481], + [3518, 3519], [3527, 3584], [3636, 3647], [3655, 3663], [3674, 3712], [3717, 3718], + [3723, 3724], [3726, 3731], [3752, 3753], [3764, 3772], [3774, 3775], [3783, 3791], + [3802, 3803], [3806, 3839], [3841, 3871], [3892, 3903], [3949, 3975], [3980, 4095], + [4139, 4158], [4170, 4175], [4182, 4185], [4190, 4192], [4194, 4196], [4199, 4205], + [4209, 4212], [4226, 4237], [4250, 4255], [4294, 4303], [4349, 4351], [4686, 4687], + [4702, 4703], [4750, 4751], [4790, 4791], [4806, 4807], [4886, 4887], [4955, 4968], + [4989, 4991], [5008, 5023], [5109, 5120], [5741, 5742], [5787, 5791], [5867, 5869], + [5873, 5887], [5906, 5919], [5938, 5951], [5970, 5983], [6001, 6015], [6068, 6102], + [6104, 6107], [6109, 6111], [6122, 6127], [6138, 6159], [6170, 6175], [6264, 6271], + [6315, 6319], [6390, 6399], [6429, 6469], [6510, 6511], [6517, 6527], [6572, 6592], + [6600, 6607], [6619, 6655], [6679, 6687], [6741, 6783], [6794, 6799], [6810, 6822], + [6824, 6916], [6964, 6980], [6988, 6991], [7002, 7042], [7073, 7085], [7098, 7167], + [7204, 7231], [7242, 7244], [7294, 7400], [7410, 7423], [7616, 7679], [7958, 7959], + [7966, 7967], [8006, 8007], [8014, 8015], [8062, 8063], [8127, 8129], [8141, 8143], + [8148, 8149], [8156, 8159], [8173, 8177], [8189, 8303], [8306, 8307], [8314, 8318], + [8330, 8335], [8341, 8449], [8451, 8454], [8456, 8457], [8470, 8472], [8478, 8483], + [8506, 8507], [8512, 8516], [8522, 8525], [8586, 9311], [9372, 9449], [9472, 10101], + [10132, 11263], [11493, 11498], [11503, 11516], [11518, 11519], [11558, 11567], + [11622, 11630], [11632, 11647], [11671, 11679], [11743, 11822], [11824, 12292], + [12296, 12320], [12330, 12336], [12342, 12343], [12349, 12352], [12439, 12444], + [12544, 12548], [12590, 12592], [12687, 12689], [12694, 12703], [12728, 12783], + [12800, 12831], [12842, 12880], [12896, 12927], [12938, 12976], [12992, 13311], + [19894, 19967], [40908, 40959], [42125, 42191], [42238, 42239], [42509, 42511], + [42540, 42559], [42592, 42593], [42607, 42622], [42648, 42655], [42736, 42774], + [42784, 42785], [42889, 42890], [42893, 43002], [43043, 43055], [43062, 43071], + [43124, 43137], [43188, 43215], [43226, 43249], [43256, 43258], [43260, 43263], + [43302, 43311], [43335, 43359], [43389, 43395], [43443, 43470], [43482, 43519], + [43561, 43583], [43596, 43599], [43610, 43615], [43639, 43641], [43643, 43647], + [43698, 43700], [43703, 43704], [43710, 43711], [43715, 43738], [43742, 43967], + [44003, 44015], [44026, 44031], [55204, 55215], [55239, 55242], [55292, 55295], + [57344, 63743], [64046, 64047], [64110, 64111], [64218, 64255], [64263, 64274], + [64280, 64284], [64434, 64466], [64830, 64847], [64912, 64913], [64968, 65007], + [65020, 65135], [65277, 65295], [65306, 65312], [65339, 65344], [65371, 65381], + [65471, 65473], [65480, 65481], [65488, 65489], [65496, 65497]]; + for (i = 0; i < ranges.length; i++) { + start = ranges[i][0]; + end = ranges[i][1]; + for (j = start; j <= end; j++) { + result[j] = true; + } + } + return result; +})(); + +function splitQuery(query) { + var result = []; + var start = -1; + for (var i = 0; i < query.length; i++) { + if (splitChars[query.charCodeAt(i)]) { + if (start !== -1) { + result.push(query.slice(start, i)); + start = -1; + } + } else if (start === -1) { + start = i; + } + } + if (start !== -1) { + result.push(query.slice(start)); + } + return result; +} + + diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/language_data.js.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/language_data.js.meta new file mode 100644 index 00000000..23766604 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/language_data.js.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 09034fa4b481f824e99c4661ceaac86d +TextScriptImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/minus.png b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/minus.png Binary files differnew file mode 100644 index 00000000..d96755fd --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/minus.png diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/minus.png.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/minus.png.meta new file mode 100644 index 00000000..843b6b3a --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/minus.png.meta @@ -0,0 +1,88 @@ +fileFormatVersion: 2 +guid: fdab9985a13099e479941f0a47eca70e +TextureImporter: + fileIDToRecycleName: {} + externalObjects: {} + serializedVersion: 9 + mipmaps: + mipMapMode: 0 + enableMipMap: 1 + sRGBTexture: 1 + linearTexture: 0 + fadeOut: 0 + borderMipMap: 0 + mipMapsPreserveCoverage: 0 + alphaTestReferenceValue: 0.5 + mipMapFadeDistanceStart: 1 + mipMapFadeDistanceEnd: 3 + bumpmap: + convertToNormalMap: 0 + externalNormalMap: 0 + heightScale: 0.25 + normalMapFilter: 0 + isReadable: 0 + streamingMipmaps: 0 + streamingMipmapsPriority: 0 + grayScaleToAlpha: 0 + generateCubemap: 6 + cubemapConvolution: 0 + seamlessCubemap: 0 + textureFormat: 1 + maxTextureSize: 2048 + textureSettings: + serializedVersion: 2 + filterMode: -1 + aniso: -1 + mipBias: -100 + wrapU: -1 + wrapV: -1 + wrapW: -1 + nPOTScale: 1 + lightmap: 0 + compressionQuality: 50 + spriteMode: 0 + spriteExtrude: 1 + spriteMeshType: 1 + alignment: 0 + spritePivot: {x: 0.5, y: 0.5} + spritePixelsToUnits: 100 + spriteBorder: {x: 0, y: 0, z: 0, w: 0} + spriteGenerateFallbackPhysicsShape: 1 + alphaUsage: 1 + alphaIsTransparency: 0 + spriteTessellationDetail: -1 + textureType: 0 + textureShape: 1 + singleChannelComponent: 0 + maxTextureSizeSet: 0 + compressionQualitySet: 0 + textureFormatSet: 0 + platformSettings: + - serializedVersion: 2 + buildTarget: DefaultTexturePlatform + maxTextureSize: 2048 + resizeAlgorithm: 0 + textureFormat: -1 + textureCompression: 1 + compressionQuality: 50 + crunchedCompression: 0 + allowsAlphaSplitting: 0 + overridden: 0 + androidETC2FallbackOverride: 0 + spriteSheet: + serializedVersion: 2 + sprites: [] + outline: [] + physicsShape: [] + bones: [] + spriteID: + vertices: [] + indices: + edges: [] + weights: [] + spritePackingTag: + pSDRemoveMatte: 0 + pSDShowRemoveMatteOption: 0 + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/plus.png b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/plus.png Binary files differnew file mode 100644 index 00000000..7107cec9 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/plus.png diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/plus.png.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/plus.png.meta new file mode 100644 index 00000000..c51a7dff --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/plus.png.meta @@ -0,0 +1,88 @@ +fileFormatVersion: 2 +guid: 669be1803c5a0a04391d3e0c3105c418 +TextureImporter: + fileIDToRecycleName: {} + externalObjects: {} + serializedVersion: 9 + mipmaps: + mipMapMode: 0 + enableMipMap: 1 + sRGBTexture: 1 + linearTexture: 0 + fadeOut: 0 + borderMipMap: 0 + mipMapsPreserveCoverage: 0 + alphaTestReferenceValue: 0.5 + mipMapFadeDistanceStart: 1 + mipMapFadeDistanceEnd: 3 + bumpmap: + convertToNormalMap: 0 + externalNormalMap: 0 + heightScale: 0.25 + normalMapFilter: 0 + isReadable: 0 + streamingMipmaps: 0 + streamingMipmapsPriority: 0 + grayScaleToAlpha: 0 + generateCubemap: 6 + cubemapConvolution: 0 + seamlessCubemap: 0 + textureFormat: 1 + maxTextureSize: 2048 + textureSettings: + serializedVersion: 2 + filterMode: -1 + aniso: -1 + mipBias: -100 + wrapU: -1 + wrapV: -1 + wrapW: -1 + nPOTScale: 1 + lightmap: 0 + compressionQuality: 50 + spriteMode: 0 + spriteExtrude: 1 + spriteMeshType: 1 + alignment: 0 + spritePivot: {x: 0.5, y: 0.5} + spritePixelsToUnits: 100 + spriteBorder: {x: 0, y: 0, z: 0, w: 0} + spriteGenerateFallbackPhysicsShape: 1 + alphaUsage: 1 + alphaIsTransparency: 0 + spriteTessellationDetail: -1 + textureType: 0 + textureShape: 1 + singleChannelComponent: 0 + maxTextureSizeSet: 0 + compressionQualitySet: 0 + textureFormatSet: 0 + platformSettings: + - serializedVersion: 2 + buildTarget: DefaultTexturePlatform + maxTextureSize: 2048 + resizeAlgorithm: 0 + textureFormat: -1 + textureCompression: 1 + compressionQuality: 50 + crunchedCompression: 0 + allowsAlphaSplitting: 0 + overridden: 0 + androidETC2FallbackOverride: 0 + spriteSheet: + serializedVersion: 2 + sprites: [] + outline: [] + physicsShape: [] + bones: [] + spriteID: + vertices: [] + indices: + edges: [] + weights: [] + spritePackingTag: + pSDRemoveMatte: 0 + pSDShowRemoveMatteOption: 0 + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/pygments.css b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/pygments.css new file mode 100644 index 00000000..c9dfef2f --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/pygments.css @@ -0,0 +1,2 @@ +.highlight .hll { background-color: #ffffcc } +.highlight { background: #ffffff; }
\ No newline at end of file diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/pygments.css.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/pygments.css.meta new file mode 100644 index 00000000..c358a71d --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/pygments.css.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 1ce9d1e7501bfa449ac0d7d716ecd377 +DefaultImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/searchtools.js b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/searchtools.js new file mode 100644 index 00000000..d11b33a7 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/searchtools.js @@ -0,0 +1,512 @@ +/* + * searchtools.js + * ~~~~~~~~~~~~~~~~ + * + * Sphinx JavaScript utilities for the full-text search. + * + * :copyright: Copyright 2007-2020 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +if (!Scorer) { + /** + * Simple result scoring code. + */ + var Scorer = { + // Implement the following function to further tweak the score for each result + // The function takes a result array [filename, title, anchor, descr, score] + // and returns the new score. + /* + score: function(result) { + return result[4]; + }, + */ + + // query matches the full name of an object + objNameMatch: 11, + // or matches in the last dotted part of the object name + objPartialMatch: 6, + // Additive scores depending on the priority of the object + objPrio: {0: 15, // used to be importantResults + 1: 5, // used to be objectResults + 2: -5}, // used to be unimportantResults + // Used when the priority is not in the mapping. + objPrioDefault: 0, + + // query found in title + title: 15, + partialTitle: 7, + // query found in terms + term: 5, + partialTerm: 2 + }; +} + +if (!splitQuery) { + function splitQuery(query) { + return query.split(/\s+/); + } +} + +/** + * Search Module + */ +var Search = { + + _index : null, + _queued_query : null, + _pulse_status : -1, + + htmlToText : function(htmlString) { + var htmlElement = document.createElement('span'); + htmlElement.innerHTML = htmlString; + $(htmlElement).find('.headerlink').remove(); + docContent = $(htmlElement).find('[role=main]')[0]; + if(docContent === undefined) { + console.warn("Content block not found. Sphinx search tries to obtain it " + + "via '[role=main]'. Could you check your theme or template."); + return ""; + } + return docContent.textContent || docContent.innerText; + }, + + init : function() { + var params = $.getQueryParameters(); + if (params.q) { + var query = params.q[0]; + $('input[name="q"]')[0].value = query; + this.performSearch(query); + } + }, + + loadIndex : function(url) { + $.ajax({type: "GET", url: url, data: null, + dataType: "script", cache: true, + complete: function(jqxhr, textstatus) { + if (textstatus != "success") { + document.getElementById("searchindexloader").src = url; + } + }}); + }, + + setIndex : function(index) { + var q; + this._index = index; + if ((q = this._queued_query) !== null) { + this._queued_query = null; + Search.query(q); + } + }, + + hasIndex : function() { + return this._index !== null; + }, + + deferQuery : function(query) { + this._queued_query = query; + }, + + stopPulse : function() { + this._pulse_status = 0; + }, + + startPulse : function() { + if (this._pulse_status >= 0) + return; + function pulse() { + var i; + Search._pulse_status = (Search._pulse_status + 1) % 4; + var dotString = ''; + for (i = 0; i < Search._pulse_status; i++) + dotString += '.'; + Search.dots.text(dotString); + if (Search._pulse_status > -1) + window.setTimeout(pulse, 500); + } + pulse(); + }, + + /** + * perform a search for something (or wait until index is loaded) + */ + performSearch : function(query) { + // create the required interface elements + this.out = $('#search-results'); + this.title = $('<h2>' + _('Searching') + '</h2>').appendTo(this.out); + this.dots = $('<span></span>').appendTo(this.title); + this.status = $('<p class="search-summary"> </p>').appendTo(this.out); + this.output = $('<ul class="search"/>').appendTo(this.out); + + $('#search-progress').text(_('Preparing search...')); + this.startPulse(); + + // index already loaded, the browser was quick! + if (this.hasIndex()) + this.query(query); + else + this.deferQuery(query); + }, + + /** + * execute search (requires search index to be loaded) + */ + query : function(query) { + var i; + + // stem the searchterms and add them to the correct list + var stemmer = new Stemmer(); + var searchterms = []; + var excluded = []; + var hlterms = []; + var tmp = splitQuery(query); + var objectterms = []; + for (i = 0; i < tmp.length; i++) { + if (tmp[i] !== "") { + objectterms.push(tmp[i].toLowerCase()); + } + + if ($u.indexOf(stopwords, tmp[i].toLowerCase()) != -1 || tmp[i].match(/^\d+$/) || + tmp[i] === "") { + // skip this "word" + continue; + } + // stem the word + var word = stemmer.stemWord(tmp[i].toLowerCase()); + // prevent stemmer from cutting word smaller than two chars + if(word.length < 3 && tmp[i].length >= 3) { + word = tmp[i]; + } + var toAppend; + // select the correct list + if (word[0] == '-') { + toAppend = excluded; + word = word.substr(1); + } + else { + toAppend = searchterms; + hlterms.push(tmp[i].toLowerCase()); + } + // only add if not already in the list + if (!$u.contains(toAppend, word)) + toAppend.push(word); + } + var highlightstring = '?highlight=' + $.urlencode(hlterms.join(" ")); + + // console.debug('SEARCH: searching for:'); + // console.info('required: ', searchterms); + // console.info('excluded: ', excluded); + + // prepare search + var terms = this._index.terms; + var titleterms = this._index.titleterms; + + // array of [filename, title, anchor, descr, score] + var results = []; + $('#search-progress').empty(); + + // lookup as object + for (i = 0; i < objectterms.length; i++) { + var others = [].concat(objectterms.slice(0, i), + objectterms.slice(i+1, objectterms.length)); + results = results.concat(this.performObjectSearch(objectterms[i], others)); + } + + // lookup as search terms in fulltext + results = results.concat(this.performTermsSearch(searchterms, excluded, terms, titleterms)); + + // let the scorer override scores with a custom scoring function + if (Scorer.score) { + for (i = 0; i < results.length; i++) + results[i][4] = Scorer.score(results[i]); + } + + // now sort the results by score (in opposite order of appearance, since the + // display function below uses pop() to retrieve items) and then + // alphabetically + results.sort(function(a, b) { + var left = a[4]; + var right = b[4]; + if (left > right) { + return 1; + } else if (left < right) { + return -1; + } else { + // same score: sort alphabetically + left = a[1].toLowerCase(); + right = b[1].toLowerCase(); + return (left > right) ? -1 : ((left < right) ? 1 : 0); + } + }); + + // for debugging + //Search.lastresults = results.slice(); // a copy + //console.info('search results:', Search.lastresults); + + // print the results + var resultCount = results.length; + function displayNextItem() { + // results left, load the summary and display it + if (results.length) { + var item = results.pop(); + var listItem = $('<li style="display:none"></li>'); + var requestUrl = ""; + if (DOCUMENTATION_OPTIONS.BUILDER === 'dirhtml') { + // dirhtml builder + var dirname = item[0] + '/'; + if (dirname.match(/\/index\/$/)) { + dirname = dirname.substring(0, dirname.length-6); + } else if (dirname == 'index/') { + dirname = ''; + } + requestUrl = DOCUMENTATION_OPTIONS.URL_ROOT + dirname; + + } else { + // normal html builders + requestUrl = DOCUMENTATION_OPTIONS.URL_ROOT + item[0] + DOCUMENTATION_OPTIONS.FILE_SUFFIX; + } + listItem.append($('<a/>').attr('href', + requestUrl + + highlightstring + item[2]).html(item[1])); + if (item[3]) { + listItem.append($('<span> (' + item[3] + ')</span>')); + Search.output.append(listItem); + listItem.slideDown(5, function() { + displayNextItem(); + }); + } else if (DOCUMENTATION_OPTIONS.HAS_SOURCE) { + $.ajax({url: requestUrl, + dataType: "text", + complete: function(jqxhr, textstatus) { + var data = jqxhr.responseText; + if (data !== '' && data !== undefined) { + listItem.append(Search.makeSearchSummary(data, searchterms, hlterms)); + } + Search.output.append(listItem); + listItem.slideDown(5, function() { + displayNextItem(); + }); + }}); + } else { + // no source available, just display title + Search.output.append(listItem); + listItem.slideDown(5, function() { + displayNextItem(); + }); + } + } + // search finished, update title and status message + else { + Search.stopPulse(); + Search.title.text(_('Search Results')); + if (!resultCount) + Search.status.text(_('Your search did not match any documents. Please make sure that all words are spelled correctly and that you\'ve selected enough categories.')); + else + Search.status.text(_('Search finished, found %s page(s) matching the search query.').replace('%s', resultCount)); + Search.status.fadeIn(500); + } + } + displayNextItem(); + }, + + /** + * search for object names + */ + performObjectSearch : function(object, otherterms) { + var filenames = this._index.filenames; + var docnames = this._index.docnames; + var objects = this._index.objects; + var objnames = this._index.objnames; + var titles = this._index.titles; + + var i; + var results = []; + + for (var prefix in objects) { + for (var name in objects[prefix]) { + var fullname = (prefix ? prefix + '.' : '') + name; + var fullnameLower = fullname.toLowerCase() + if (fullnameLower.indexOf(object) > -1) { + var score = 0; + var parts = fullnameLower.split('.'); + // check for different match types: exact matches of full name or + // "last name" (i.e. last dotted part) + if (fullnameLower == object || parts[parts.length - 1] == object) { + score += Scorer.objNameMatch; + // matches in last name + } else if (parts[parts.length - 1].indexOf(object) > -1) { + score += Scorer.objPartialMatch; + } + var match = objects[prefix][name]; + var objname = objnames[match[1]][2]; + var title = titles[match[0]]; + // If more than one term searched for, we require other words to be + // found in the name/title/description + if (otherterms.length > 0) { + var haystack = (prefix + ' ' + name + ' ' + + objname + ' ' + title).toLowerCase(); + var allfound = true; + for (i = 0; i < otherterms.length; i++) { + if (haystack.indexOf(otherterms[i]) == -1) { + allfound = false; + break; + } + } + if (!allfound) { + continue; + } + } + var descr = objname + _(', in ') + title; + + var anchor = match[3]; + if (anchor === '') + anchor = fullname; + else if (anchor == '-') + anchor = objnames[match[1]][1] + '-' + fullname; + // add custom score for some objects according to scorer + if (Scorer.objPrio.hasOwnProperty(match[2])) { + score += Scorer.objPrio[match[2]]; + } else { + score += Scorer.objPrioDefault; + } + results.push([docnames[match[0]], fullname, '#'+anchor, descr, score, filenames[match[0]]]); + } + } + } + + return results; + }, + + /** + * search for full-text terms in the index + */ + performTermsSearch : function(searchterms, excluded, terms, titleterms) { + var docnames = this._index.docnames; + var filenames = this._index.filenames; + var titles = this._index.titles; + + var i, j, file; + var fileMap = {}; + var scoreMap = {}; + var results = []; + + // perform the search on the required terms + for (i = 0; i < searchterms.length; i++) { + var word = searchterms[i]; + var files = []; + var _o = [ + {files: terms[word], score: Scorer.term}, + {files: titleterms[word], score: Scorer.title} + ]; + // add support for partial matches + if (word.length > 2) { + for (var w in terms) { + if (w.match(word) && !terms[word]) { + _o.push({files: terms[w], score: Scorer.partialTerm}) + } + } + for (var w in titleterms) { + if (w.match(word) && !titleterms[word]) { + _o.push({files: titleterms[w], score: Scorer.partialTitle}) + } + } + } + + // no match but word was a required one + if ($u.every(_o, function(o){return o.files === undefined;})) { + break; + } + // found search word in contents + $u.each(_o, function(o) { + var _files = o.files; + if (_files === undefined) + return + + if (_files.length === undefined) + _files = [_files]; + files = files.concat(_files); + + // set score for the word in each file to Scorer.term + for (j = 0; j < _files.length; j++) { + file = _files[j]; + if (!(file in scoreMap)) + scoreMap[file] = {}; + scoreMap[file][word] = o.score; + } + }); + + // create the mapping + for (j = 0; j < files.length; j++) { + file = files[j]; + if (file in fileMap && fileMap[file].indexOf(word) === -1) + fileMap[file].push(word); + else + fileMap[file] = [word]; + } + } + + // now check if the files don't contain excluded terms + for (file in fileMap) { + var valid = true; + + // check if all requirements are matched + var filteredTermCount = // as search terms with length < 3 are discarded: ignore + searchterms.filter(function(term){return term.length > 2}).length + if ( + fileMap[file].length != searchterms.length && + fileMap[file].length != filteredTermCount + ) continue; + + // ensure that none of the excluded terms is in the search result + for (i = 0; i < excluded.length; i++) { + if (terms[excluded[i]] == file || + titleterms[excluded[i]] == file || + $u.contains(terms[excluded[i]] || [], file) || + $u.contains(titleterms[excluded[i]] || [], file)) { + valid = false; + break; + } + } + + // if we have still a valid result we can add it to the result list + if (valid) { + // select one (max) score for the file. + // for better ranking, we should calculate ranking by using words statistics like basic tf-idf... + var score = $u.max($u.map(fileMap[file], function(w){return scoreMap[file][w]})); + results.push([docnames[file], titles[file], '', null, score, filenames[file]]); + } + } + return results; + }, + + /** + * helper function to return a node containing the + * search summary for a given text. keywords is a list + * of stemmed words, hlwords is the list of normal, unstemmed + * words. the first one is used to find the occurrence, the + * latter for highlighting it. + */ + makeSearchSummary : function(htmlText, keywords, hlwords) { + var text = Search.htmlToText(htmlText); + var textLower = text.toLowerCase(); + var start = 0; + $.each(keywords, function() { + var i = textLower.indexOf(this.toLowerCase()); + if (i > -1) + start = i; + }); + start = Math.max(start - 120, 0); + var excerpt = ((start > 0) ? '...' : '') + + $.trim(text.substr(start, 240)) + + ((start + 240 - text.length) ? '...' : ''); + var rv = $('<div class="context"></div>').text(excerpt); + $.each(hlwords, function() { + rv = rv.highlightText(this, 'highlighted'); + }); + return rv; + } +}; + +$(document).ready(function() { + Search.init(); +}); diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/searchtools.js.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/searchtools.js.meta new file mode 100644 index 00000000..1275d9e8 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/searchtools.js.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 9267d901678a38045a1b52d1ebe64421 +TextScriptImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/underscore-1.3.1.js b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/underscore-1.3.1.js new file mode 100644 index 00000000..208d4cd8 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/underscore-1.3.1.js @@ -0,0 +1,999 @@ +// Underscore.js 1.3.1 +// (c) 2009-2012 Jeremy Ashkenas, DocumentCloud Inc. +// Underscore is freely distributable under the MIT license. +// Portions of Underscore are inspired or borrowed from Prototype, +// Oliver Steele's Functional, and John Resig's Micro-Templating. +// For all details and documentation: +// http://documentcloud.github.com/underscore + +(function() { + + // Baseline setup + // -------------- + + // Establish the root object, `window` in the browser, or `global` on the server. + var root = this; + + // Save the previous value of the `_` variable. + var previousUnderscore = root._; + + // Establish the object that gets returned to break out of a loop iteration. + var breaker = {}; + + // Save bytes in the minified (but not gzipped) version: + var ArrayProto = Array.prototype, ObjProto = Object.prototype, FuncProto = Function.prototype; + + // Create quick reference variables for speed access to core prototypes. + var slice = ArrayProto.slice, + unshift = ArrayProto.unshift, + toString = ObjProto.toString, + hasOwnProperty = ObjProto.hasOwnProperty; + + // All **ECMAScript 5** native function implementations that we hope to use + // are declared here. + var + nativeForEach = ArrayProto.forEach, + nativeMap = ArrayProto.map, + nativeReduce = ArrayProto.reduce, + nativeReduceRight = ArrayProto.reduceRight, + nativeFilter = ArrayProto.filter, + nativeEvery = ArrayProto.every, + nativeSome = ArrayProto.some, + nativeIndexOf = ArrayProto.indexOf, + nativeLastIndexOf = ArrayProto.lastIndexOf, + nativeIsArray = Array.isArray, + nativeKeys = Object.keys, + nativeBind = FuncProto.bind; + + // Create a safe reference to the Underscore object for use below. + var _ = function(obj) { return new wrapper(obj); }; + + // Export the Underscore object for **Node.js**, with + // backwards-compatibility for the old `require()` API. If we're in + // the browser, add `_` as a global object via a string identifier, + // for Closure Compiler "advanced" mode. + if (typeof exports !== 'undefined') { + if (typeof module !== 'undefined' && module.exports) { + exports = module.exports = _; + } + exports._ = _; + } else { + root['_'] = _; + } + + // Current version. + _.VERSION = '1.3.1'; + + // Collection Functions + // -------------------- + + // The cornerstone, an `each` implementation, aka `forEach`. + // Handles objects with the built-in `forEach`, arrays, and raw objects. + // Delegates to **ECMAScript 5**'s native `forEach` if available. + var each = _.each = _.forEach = function(obj, iterator, context) { + if (obj == null) return; + if (nativeForEach && obj.forEach === nativeForEach) { + obj.forEach(iterator, context); + } else if (obj.length === +obj.length) { + for (var i = 0, l = obj.length; i < l; i++) { + if (i in obj && iterator.call(context, obj[i], i, obj) === breaker) return; + } + } else { + for (var key in obj) { + if (_.has(obj, key)) { + if (iterator.call(context, obj[key], key, obj) === breaker) return; + } + } + } + }; + + // Return the results of applying the iterator to each element. + // Delegates to **ECMAScript 5**'s native `map` if available. + _.map = _.collect = function(obj, iterator, context) { + var results = []; + if (obj == null) return results; + if (nativeMap && obj.map === nativeMap) return obj.map(iterator, context); + each(obj, function(value, index, list) { + results[results.length] = iterator.call(context, value, index, list); + }); + if (obj.length === +obj.length) results.length = obj.length; + return results; + }; + + // **Reduce** builds up a single result from a list of values, aka `inject`, + // or `foldl`. Delegates to **ECMAScript 5**'s native `reduce` if available. + _.reduce = _.foldl = _.inject = function(obj, iterator, memo, context) { + var initial = arguments.length > 2; + if (obj == null) obj = []; + if (nativeReduce && obj.reduce === nativeReduce) { + if (context) iterator = _.bind(iterator, context); + return initial ? obj.reduce(iterator, memo) : obj.reduce(iterator); + } + each(obj, function(value, index, list) { + if (!initial) { + memo = value; + initial = true; + } else { + memo = iterator.call(context, memo, value, index, list); + } + }); + if (!initial) throw new TypeError('Reduce of empty array with no initial value'); + return memo; + }; + + // The right-associative version of reduce, also known as `foldr`. + // Delegates to **ECMAScript 5**'s native `reduceRight` if available. + _.reduceRight = _.foldr = function(obj, iterator, memo, context) { + var initial = arguments.length > 2; + if (obj == null) obj = []; + if (nativeReduceRight && obj.reduceRight === nativeReduceRight) { + if (context) iterator = _.bind(iterator, context); + return initial ? obj.reduceRight(iterator, memo) : obj.reduceRight(iterator); + } + var reversed = _.toArray(obj).reverse(); + if (context && !initial) iterator = _.bind(iterator, context); + return initial ? _.reduce(reversed, iterator, memo, context) : _.reduce(reversed, iterator); + }; + + // Return the first value which passes a truth test. Aliased as `detect`. + _.find = _.detect = function(obj, iterator, context) { + var result; + any(obj, function(value, index, list) { + if (iterator.call(context, value, index, list)) { + result = value; + return true; + } + }); + return result; + }; + + // Return all the elements that pass a truth test. + // Delegates to **ECMAScript 5**'s native `filter` if available. + // Aliased as `select`. + _.filter = _.select = function(obj, iterator, context) { + var results = []; + if (obj == null) return results; + if (nativeFilter && obj.filter === nativeFilter) return obj.filter(iterator, context); + each(obj, function(value, index, list) { + if (iterator.call(context, value, index, list)) results[results.length] = value; + }); + return results; + }; + + // Return all the elements for which a truth test fails. + _.reject = function(obj, iterator, context) { + var results = []; + if (obj == null) return results; + each(obj, function(value, index, list) { + if (!iterator.call(context, value, index, list)) results[results.length] = value; + }); + return results; + }; + + // Determine whether all of the elements match a truth test. + // Delegates to **ECMAScript 5**'s native `every` if available. + // Aliased as `all`. + _.every = _.all = function(obj, iterator, context) { + var result = true; + if (obj == null) return result; + if (nativeEvery && obj.every === nativeEvery) return obj.every(iterator, context); + each(obj, function(value, index, list) { + if (!(result = result && iterator.call(context, value, index, list))) return breaker; + }); + return result; + }; + + // Determine if at least one element in the object matches a truth test. + // Delegates to **ECMAScript 5**'s native `some` if available. + // Aliased as `any`. + var any = _.some = _.any = function(obj, iterator, context) { + iterator || (iterator = _.identity); + var result = false; + if (obj == null) return result; + if (nativeSome && obj.some === nativeSome) return obj.some(iterator, context); + each(obj, function(value, index, list) { + if (result || (result = iterator.call(context, value, index, list))) return breaker; + }); + return !!result; + }; + + // Determine if a given value is included in the array or object using `===`. + // Aliased as `contains`. + _.include = _.contains = function(obj, target) { + var found = false; + if (obj == null) return found; + if (nativeIndexOf && obj.indexOf === nativeIndexOf) return obj.indexOf(target) != -1; + found = any(obj, function(value) { + return value === target; + }); + return found; + }; + + // Invoke a method (with arguments) on every item in a collection. + _.invoke = function(obj, method) { + var args = slice.call(arguments, 2); + return _.map(obj, function(value) { + return (_.isFunction(method) ? method || value : value[method]).apply(value, args); + }); + }; + + // Convenience version of a common use case of `map`: fetching a property. + _.pluck = function(obj, key) { + return _.map(obj, function(value){ return value[key]; }); + }; + + // Return the maximum element or (element-based computation). + _.max = function(obj, iterator, context) { + if (!iterator && _.isArray(obj)) return Math.max.apply(Math, obj); + if (!iterator && _.isEmpty(obj)) return -Infinity; + var result = {computed : -Infinity}; + each(obj, function(value, index, list) { + var computed = iterator ? iterator.call(context, value, index, list) : value; + computed >= result.computed && (result = {value : value, computed : computed}); + }); + return result.value; + }; + + // Return the minimum element (or element-based computation). + _.min = function(obj, iterator, context) { + if (!iterator && _.isArray(obj)) return Math.min.apply(Math, obj); + if (!iterator && _.isEmpty(obj)) return Infinity; + var result = {computed : Infinity}; + each(obj, function(value, index, list) { + var computed = iterator ? iterator.call(context, value, index, list) : value; + computed < result.computed && (result = {value : value, computed : computed}); + }); + return result.value; + }; + + // Shuffle an array. + _.shuffle = function(obj) { + var shuffled = [], rand; + each(obj, function(value, index, list) { + if (index == 0) { + shuffled[0] = value; + } else { + rand = Math.floor(Math.random() * (index + 1)); + shuffled[index] = shuffled[rand]; + shuffled[rand] = value; + } + }); + return shuffled; + }; + + // Sort the object's values by a criterion produced by an iterator. + _.sortBy = function(obj, iterator, context) { + return _.pluck(_.map(obj, function(value, index, list) { + return { + value : value, + criteria : iterator.call(context, value, index, list) + }; + }).sort(function(left, right) { + var a = left.criteria, b = right.criteria; + return a < b ? -1 : a > b ? 1 : 0; + }), 'value'); + }; + + // Groups the object's values by a criterion. Pass either a string attribute + // to group by, or a function that returns the criterion. + _.groupBy = function(obj, val) { + var result = {}; + var iterator = _.isFunction(val) ? val : function(obj) { return obj[val]; }; + each(obj, function(value, index) { + var key = iterator(value, index); + (result[key] || (result[key] = [])).push(value); + }); + return result; + }; + + // Use a comparator function to figure out at what index an object should + // be inserted so as to maintain order. Uses binary search. + _.sortedIndex = function(array, obj, iterator) { + iterator || (iterator = _.identity); + var low = 0, high = array.length; + while (low < high) { + var mid = (low + high) >> 1; + iterator(array[mid]) < iterator(obj) ? low = mid + 1 : high = mid; + } + return low; + }; + + // Safely convert anything iterable into a real, live array. + _.toArray = function(iterable) { + if (!iterable) return []; + if (iterable.toArray) return iterable.toArray(); + if (_.isArray(iterable)) return slice.call(iterable); + if (_.isArguments(iterable)) return slice.call(iterable); + return _.values(iterable); + }; + + // Return the number of elements in an object. + _.size = function(obj) { + return _.toArray(obj).length; + }; + + // Array Functions + // --------------- + + // Get the first element of an array. Passing **n** will return the first N + // values in the array. Aliased as `head`. The **guard** check allows it to work + // with `_.map`. + _.first = _.head = function(array, n, guard) { + return (n != null) && !guard ? slice.call(array, 0, n) : array[0]; + }; + + // Returns everything but the last entry of the array. Especcialy useful on + // the arguments object. Passing **n** will return all the values in + // the array, excluding the last N. The **guard** check allows it to work with + // `_.map`. + _.initial = function(array, n, guard) { + return slice.call(array, 0, array.length - ((n == null) || guard ? 1 : n)); + }; + + // Get the last element of an array. Passing **n** will return the last N + // values in the array. The **guard** check allows it to work with `_.map`. + _.last = function(array, n, guard) { + if ((n != null) && !guard) { + return slice.call(array, Math.max(array.length - n, 0)); + } else { + return array[array.length - 1]; + } + }; + + // Returns everything but the first entry of the array. Aliased as `tail`. + // Especially useful on the arguments object. Passing an **index** will return + // the rest of the values in the array from that index onward. The **guard** + // check allows it to work with `_.map`. + _.rest = _.tail = function(array, index, guard) { + return slice.call(array, (index == null) || guard ? 1 : index); + }; + + // Trim out all falsy values from an array. + _.compact = function(array) { + return _.filter(array, function(value){ return !!value; }); + }; + + // Return a completely flattened version of an array. + _.flatten = function(array, shallow) { + return _.reduce(array, function(memo, value) { + if (_.isArray(value)) return memo.concat(shallow ? value : _.flatten(value)); + memo[memo.length] = value; + return memo; + }, []); + }; + + // Return a version of the array that does not contain the specified value(s). + _.without = function(array) { + return _.difference(array, slice.call(arguments, 1)); + }; + + // Produce a duplicate-free version of the array. If the array has already + // been sorted, you have the option of using a faster algorithm. + // Aliased as `unique`. + _.uniq = _.unique = function(array, isSorted, iterator) { + var initial = iterator ? _.map(array, iterator) : array; + var result = []; + _.reduce(initial, function(memo, el, i) { + if (0 == i || (isSorted === true ? _.last(memo) != el : !_.include(memo, el))) { + memo[memo.length] = el; + result[result.length] = array[i]; + } + return memo; + }, []); + return result; + }; + + // Produce an array that contains the union: each distinct element from all of + // the passed-in arrays. + _.union = function() { + return _.uniq(_.flatten(arguments, true)); + }; + + // Produce an array that contains every item shared between all the + // passed-in arrays. (Aliased as "intersect" for back-compat.) + _.intersection = _.intersect = function(array) { + var rest = slice.call(arguments, 1); + return _.filter(_.uniq(array), function(item) { + return _.every(rest, function(other) { + return _.indexOf(other, item) >= 0; + }); + }); + }; + + // Take the difference between one array and a number of other arrays. + // Only the elements present in just the first array will remain. + _.difference = function(array) { + var rest = _.flatten(slice.call(arguments, 1)); + return _.filter(array, function(value){ return !_.include(rest, value); }); + }; + + // Zip together multiple lists into a single array -- elements that share + // an index go together. + _.zip = function() { + var args = slice.call(arguments); + var length = _.max(_.pluck(args, 'length')); + var results = new Array(length); + for (var i = 0; i < length; i++) results[i] = _.pluck(args, "" + i); + return results; + }; + + // If the browser doesn't supply us with indexOf (I'm looking at you, **MSIE**), + // we need this function. Return the position of the first occurrence of an + // item in an array, or -1 if the item is not included in the array. + // Delegates to **ECMAScript 5**'s native `indexOf` if available. + // If the array is large and already in sort order, pass `true` + // for **isSorted** to use binary search. + _.indexOf = function(array, item, isSorted) { + if (array == null) return -1; + var i, l; + if (isSorted) { + i = _.sortedIndex(array, item); + return array[i] === item ? i : -1; + } + if (nativeIndexOf && array.indexOf === nativeIndexOf) return array.indexOf(item); + for (i = 0, l = array.length; i < l; i++) if (i in array && array[i] === item) return i; + return -1; + }; + + // Delegates to **ECMAScript 5**'s native `lastIndexOf` if available. + _.lastIndexOf = function(array, item) { + if (array == null) return -1; + if (nativeLastIndexOf && array.lastIndexOf === nativeLastIndexOf) return array.lastIndexOf(item); + var i = array.length; + while (i--) if (i in array && array[i] === item) return i; + return -1; + }; + + // Generate an integer Array containing an arithmetic progression. A port of + // the native Python `range()` function. See + // [the Python documentation](http://docs.python.org/library/functions.html#range). + _.range = function(start, stop, step) { + if (arguments.length <= 1) { + stop = start || 0; + start = 0; + } + step = arguments[2] || 1; + + var len = Math.max(Math.ceil((stop - start) / step), 0); + var idx = 0; + var range = new Array(len); + + while(idx < len) { + range[idx++] = start; + start += step; + } + + return range; + }; + + // Function (ahem) Functions + // ------------------ + + // Reusable constructor function for prototype setting. + var ctor = function(){}; + + // Create a function bound to a given object (assigning `this`, and arguments, + // optionally). Binding with arguments is also known as `curry`. + // Delegates to **ECMAScript 5**'s native `Function.bind` if available. + // We check for `func.bind` first, to fail fast when `func` is undefined. + _.bind = function bind(func, context) { + var bound, args; + if (func.bind === nativeBind && nativeBind) return nativeBind.apply(func, slice.call(arguments, 1)); + if (!_.isFunction(func)) throw new TypeError; + args = slice.call(arguments, 2); + return bound = function() { + if (!(this instanceof bound)) return func.apply(context, args.concat(slice.call(arguments))); + ctor.prototype = func.prototype; + var self = new ctor; + var result = func.apply(self, args.concat(slice.call(arguments))); + if (Object(result) === result) return result; + return self; + }; + }; + + // Bind all of an object's methods to that object. Useful for ensuring that + // all callbacks defined on an object belong to it. + _.bindAll = function(obj) { + var funcs = slice.call(arguments, 1); + if (funcs.length == 0) funcs = _.functions(obj); + each(funcs, function(f) { obj[f] = _.bind(obj[f], obj); }); + return obj; + }; + + // Memoize an expensive function by storing its results. + _.memoize = function(func, hasher) { + var memo = {}; + hasher || (hasher = _.identity); + return function() { + var key = hasher.apply(this, arguments); + return _.has(memo, key) ? memo[key] : (memo[key] = func.apply(this, arguments)); + }; + }; + + // Delays a function for the given number of milliseconds, and then calls + // it with the arguments supplied. + _.delay = function(func, wait) { + var args = slice.call(arguments, 2); + return setTimeout(function(){ return func.apply(func, args); }, wait); + }; + + // Defers a function, scheduling it to run after the current call stack has + // cleared. + _.defer = function(func) { + return _.delay.apply(_, [func, 1].concat(slice.call(arguments, 1))); + }; + + // Returns a function, that, when invoked, will only be triggered at most once + // during a given window of time. + _.throttle = function(func, wait) { + var context, args, timeout, throttling, more; + var whenDone = _.debounce(function(){ more = throttling = false; }, wait); + return function() { + context = this; args = arguments; + var later = function() { + timeout = null; + if (more) func.apply(context, args); + whenDone(); + }; + if (!timeout) timeout = setTimeout(later, wait); + if (throttling) { + more = true; + } else { + func.apply(context, args); + } + whenDone(); + throttling = true; + }; + }; + + // Returns a function, that, as long as it continues to be invoked, will not + // be triggered. The function will be called after it stops being called for + // N milliseconds. + _.debounce = function(func, wait) { + var timeout; + return function() { + var context = this, args = arguments; + var later = function() { + timeout = null; + func.apply(context, args); + }; + clearTimeout(timeout); + timeout = setTimeout(later, wait); + }; + }; + + // Returns a function that will be executed at most one time, no matter how + // often you call it. Useful for lazy initialization. + _.once = function(func) { + var ran = false, memo; + return function() { + if (ran) return memo; + ran = true; + return memo = func.apply(this, arguments); + }; + }; + + // Returns the first function passed as an argument to the second, + // allowing you to adjust arguments, run code before and after, and + // conditionally execute the original function. + _.wrap = function(func, wrapper) { + return function() { + var args = [func].concat(slice.call(arguments, 0)); + return wrapper.apply(this, args); + }; + }; + + // Returns a function that is the composition of a list of functions, each + // consuming the return value of the function that follows. + _.compose = function() { + var funcs = arguments; + return function() { + var args = arguments; + for (var i = funcs.length - 1; i >= 0; i--) { + args = [funcs[i].apply(this, args)]; + } + return args[0]; + }; + }; + + // Returns a function that will only be executed after being called N times. + _.after = function(times, func) { + if (times <= 0) return func(); + return function() { + if (--times < 1) { return func.apply(this, arguments); } + }; + }; + + // Object Functions + // ---------------- + + // Retrieve the names of an object's properties. + // Delegates to **ECMAScript 5**'s native `Object.keys` + _.keys = nativeKeys || function(obj) { + if (obj !== Object(obj)) throw new TypeError('Invalid object'); + var keys = []; + for (var key in obj) if (_.has(obj, key)) keys[keys.length] = key; + return keys; + }; + + // Retrieve the values of an object's properties. + _.values = function(obj) { + return _.map(obj, _.identity); + }; + + // Return a sorted list of the function names available on the object. + // Aliased as `methods` + _.functions = _.methods = function(obj) { + var names = []; + for (var key in obj) { + if (_.isFunction(obj[key])) names.push(key); + } + return names.sort(); + }; + + // Extend a given object with all the properties in passed-in object(s). + _.extend = function(obj) { + each(slice.call(arguments, 1), function(source) { + for (var prop in source) { + obj[prop] = source[prop]; + } + }); + return obj; + }; + + // Fill in a given object with default properties. + _.defaults = function(obj) { + each(slice.call(arguments, 1), function(source) { + for (var prop in source) { + if (obj[prop] == null) obj[prop] = source[prop]; + } + }); + return obj; + }; + + // Create a (shallow-cloned) duplicate of an object. + _.clone = function(obj) { + if (!_.isObject(obj)) return obj; + return _.isArray(obj) ? obj.slice() : _.extend({}, obj); + }; + + // Invokes interceptor with the obj, and then returns obj. + // The primary purpose of this method is to "tap into" a method chain, in + // order to perform operations on intermediate results within the chain. + _.tap = function(obj, interceptor) { + interceptor(obj); + return obj; + }; + + // Internal recursive comparison function. + function eq(a, b, stack) { + // Identical objects are equal. `0 === -0`, but they aren't identical. + // See the Harmony `egal` proposal: http://wiki.ecmascript.org/doku.php?id=harmony:egal. + if (a === b) return a !== 0 || 1 / a == 1 / b; + // A strict comparison is necessary because `null == undefined`. + if (a == null || b == null) return a === b; + // Unwrap any wrapped objects. + if (a._chain) a = a._wrapped; + if (b._chain) b = b._wrapped; + // Invoke a custom `isEqual` method if one is provided. + if (a.isEqual && _.isFunction(a.isEqual)) return a.isEqual(b); + if (b.isEqual && _.isFunction(b.isEqual)) return b.isEqual(a); + // Compare `[[Class]]` names. + var className = toString.call(a); + if (className != toString.call(b)) return false; + switch (className) { + // Strings, numbers, dates, and booleans are compared by value. + case '[object String]': + // Primitives and their corresponding object wrappers are equivalent; thus, `"5"` is + // equivalent to `new String("5")`. + return a == String(b); + case '[object Number]': + // `NaN`s are equivalent, but non-reflexive. An `egal` comparison is performed for + // other numeric values. + return a != +a ? b != +b : (a == 0 ? 1 / a == 1 / b : a == +b); + case '[object Date]': + case '[object Boolean]': + // Coerce dates and booleans to numeric primitive values. Dates are compared by their + // millisecond representations. Note that invalid dates with millisecond representations + // of `NaN` are not equivalent. + return +a == +b; + // RegExps are compared by their source patterns and flags. + case '[object RegExp]': + return a.source == b.source && + a.global == b.global && + a.multiline == b.multiline && + a.ignoreCase == b.ignoreCase; + } + if (typeof a != 'object' || typeof b != 'object') return false; + // Assume equality for cyclic structures. The algorithm for detecting cyclic + // structures is adapted from ES 5.1 section 15.12.3, abstract operation `JO`. + var length = stack.length; + while (length--) { + // Linear search. Performance is inversely proportional to the number of + // unique nested structures. + if (stack[length] == a) return true; + } + // Add the first object to the stack of traversed objects. + stack.push(a); + var size = 0, result = true; + // Recursively compare objects and arrays. + if (className == '[object Array]') { + // Compare array lengths to determine if a deep comparison is necessary. + size = a.length; + result = size == b.length; + if (result) { + // Deep compare the contents, ignoring non-numeric properties. + while (size--) { + // Ensure commutative equality for sparse arrays. + if (!(result = size in a == size in b && eq(a[size], b[size], stack))) break; + } + } + } else { + // Objects with different constructors are not equivalent. + if ('constructor' in a != 'constructor' in b || a.constructor != b.constructor) return false; + // Deep compare objects. + for (var key in a) { + if (_.has(a, key)) { + // Count the expected number of properties. + size++; + // Deep compare each member. + if (!(result = _.has(b, key) && eq(a[key], b[key], stack))) break; + } + } + // Ensure that both objects contain the same number of properties. + if (result) { + for (key in b) { + if (_.has(b, key) && !(size--)) break; + } + result = !size; + } + } + // Remove the first object from the stack of traversed objects. + stack.pop(); + return result; + } + + // Perform a deep comparison to check if two objects are equal. + _.isEqual = function(a, b) { + return eq(a, b, []); + }; + + // Is a given array, string, or object empty? + // An "empty" object has no enumerable own-properties. + _.isEmpty = function(obj) { + if (_.isArray(obj) || _.isString(obj)) return obj.length === 0; + for (var key in obj) if (_.has(obj, key)) return false; + return true; + }; + + // Is a given value a DOM element? + _.isElement = function(obj) { + return !!(obj && obj.nodeType == 1); + }; + + // Is a given value an array? + // Delegates to ECMA5's native Array.isArray + _.isArray = nativeIsArray || function(obj) { + return toString.call(obj) == '[object Array]'; + }; + + // Is a given variable an object? + _.isObject = function(obj) { + return obj === Object(obj); + }; + + // Is a given variable an arguments object? + _.isArguments = function(obj) { + return toString.call(obj) == '[object Arguments]'; + }; + if (!_.isArguments(arguments)) { + _.isArguments = function(obj) { + return !!(obj && _.has(obj, 'callee')); + }; + } + + // Is a given value a function? + _.isFunction = function(obj) { + return toString.call(obj) == '[object Function]'; + }; + + // Is a given value a string? + _.isString = function(obj) { + return toString.call(obj) == '[object String]'; + }; + + // Is a given value a number? + _.isNumber = function(obj) { + return toString.call(obj) == '[object Number]'; + }; + + // Is the given value `NaN`? + _.isNaN = function(obj) { + // `NaN` is the only value for which `===` is not reflexive. + return obj !== obj; + }; + + // Is a given value a boolean? + _.isBoolean = function(obj) { + return obj === true || obj === false || toString.call(obj) == '[object Boolean]'; + }; + + // Is a given value a date? + _.isDate = function(obj) { + return toString.call(obj) == '[object Date]'; + }; + + // Is the given value a regular expression? + _.isRegExp = function(obj) { + return toString.call(obj) == '[object RegExp]'; + }; + + // Is a given value equal to null? + _.isNull = function(obj) { + return obj === null; + }; + + // Is a given variable undefined? + _.isUndefined = function(obj) { + return obj === void 0; + }; + + // Has own property? + _.has = function(obj, key) { + return hasOwnProperty.call(obj, key); + }; + + // Utility Functions + // ----------------- + + // Run Underscore.js in *noConflict* mode, returning the `_` variable to its + // previous owner. Returns a reference to the Underscore object. + _.noConflict = function() { + root._ = previousUnderscore; + return this; + }; + + // Keep the identity function around for default iterators. + _.identity = function(value) { + return value; + }; + + // Run a function **n** times. + _.times = function (n, iterator, context) { + for (var i = 0; i < n; i++) iterator.call(context, i); + }; + + // Escape a string for HTML interpolation. + _.escape = function(string) { + return (''+string).replace(/&/g, '&').replace(/</g, '<').replace(/>/g, '>').replace(/"/g, '"').replace(/'/g, ''').replace(/\//g,'/'); + }; + + // Add your own custom functions to the Underscore object, ensuring that + // they're correctly added to the OOP wrapper as well. + _.mixin = function(obj) { + each(_.functions(obj), function(name){ + addToWrapper(name, _[name] = obj[name]); + }); + }; + + // Generate a unique integer id (unique within the entire client session). + // Useful for temporary DOM ids. + var idCounter = 0; + _.uniqueId = function(prefix) { + var id = idCounter++; + return prefix ? prefix + id : id; + }; + + // By default, Underscore uses ERB-style template delimiters, change the + // following template settings to use alternative delimiters. + _.templateSettings = { + evaluate : /<%([\s\S]+?)%>/g, + interpolate : /<%=([\s\S]+?)%>/g, + escape : /<%-([\s\S]+?)%>/g + }; + + // When customizing `templateSettings`, if you don't want to define an + // interpolation, evaluation or escaping regex, we need one that is + // guaranteed not to match. + var noMatch = /.^/; + + // Within an interpolation, evaluation, or escaping, remove HTML escaping + // that had been previously added. + var unescape = function(code) { + return code.replace(/\\\\/g, '\\').replace(/\\'/g, "'"); + }; + + // JavaScript micro-templating, similar to John Resig's implementation. + // Underscore templating handles arbitrary delimiters, preserves whitespace, + // and correctly escapes quotes within interpolated code. + _.template = function(str, data) { + var c = _.templateSettings; + var tmpl = 'var __p=[],print=function(){__p.push.apply(__p,arguments);};' + + 'with(obj||{}){__p.push(\'' + + str.replace(/\\/g, '\\\\') + .replace(/'/g, "\\'") + .replace(c.escape || noMatch, function(match, code) { + return "',_.escape(" + unescape(code) + "),'"; + }) + .replace(c.interpolate || noMatch, function(match, code) { + return "'," + unescape(code) + ",'"; + }) + .replace(c.evaluate || noMatch, function(match, code) { + return "');" + unescape(code).replace(/[\r\n\t]/g, ' ') + ";__p.push('"; + }) + .replace(/\r/g, '\\r') + .replace(/\n/g, '\\n') + .replace(/\t/g, '\\t') + + "');}return __p.join('');"; + var func = new Function('obj', '_', tmpl); + if (data) return func(data, _); + return function(data) { + return func.call(this, data, _); + }; + }; + + // Add a "chain" function, which will delegate to the wrapper. + _.chain = function(obj) { + return _(obj).chain(); + }; + + // The OOP Wrapper + // --------------- + + // If Underscore is called as a function, it returns a wrapped object that + // can be used OO-style. This wrapper holds altered versions of all the + // underscore functions. Wrapped objects may be chained. + var wrapper = function(obj) { this._wrapped = obj; }; + + // Expose `wrapper.prototype` as `_.prototype` + _.prototype = wrapper.prototype; + + // Helper function to continue chaining intermediate results. + var result = function(obj, chain) { + return chain ? _(obj).chain() : obj; + }; + + // A method to easily add functions to the OOP wrapper. + var addToWrapper = function(name, func) { + wrapper.prototype[name] = function() { + var args = slice.call(arguments); + unshift.call(args, this._wrapped); + return result(func.apply(_, args), this._chain); + }; + }; + + // Add all of the Underscore functions to the wrapper object. + _.mixin(_); + + // Add all mutator Array functions to the wrapper. + each(['pop', 'push', 'reverse', 'shift', 'sort', 'splice', 'unshift'], function(name) { + var method = ArrayProto[name]; + wrapper.prototype[name] = function() { + var wrapped = this._wrapped; + method.apply(wrapped, arguments); + var length = wrapped.length; + if ((name == 'shift' || name == 'splice') && length === 0) delete wrapped[0]; + return result(wrapped, this._chain); + }; + }); + + // Add all accessor Array functions to the wrapper. + each(['concat', 'join', 'slice'], function(name) { + var method = ArrayProto[name]; + wrapper.prototype[name] = function() { + return result(method.apply(this._wrapped, arguments), this._chain); + }; + }); + + // Start chaining a wrapped Underscore object. + wrapper.prototype.chain = function() { + this._chain = true; + return this; + }; + + // Extracts the result from a wrapped and chained object. + wrapper.prototype.value = function() { + return this._wrapped; + }; + +}).call(this); diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/underscore-1.3.1.js.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/underscore-1.3.1.js.meta new file mode 100644 index 00000000..55fb8442 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/underscore-1.3.1.js.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 57b717769c0f5c046ac96a7b9faf3e3b +TextScriptImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/underscore.js b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/underscore.js new file mode 100644 index 00000000..5b55f32b --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/underscore.js @@ -0,0 +1,31 @@ +// Underscore.js 1.3.1 +// (c) 2009-2012 Jeremy Ashkenas, DocumentCloud Inc. +// Underscore is freely distributable under the MIT license. +// Portions of Underscore are inspired or borrowed from Prototype, +// Oliver Steele's Functional, and John Resig's Micro-Templating. +// For all details and documentation: +// http://documentcloud.github.com/underscore +(function(){function q(a,c,d){if(a===c)return a!==0||1/a==1/c;if(a==null||c==null)return a===c;if(a._chain)a=a._wrapped;if(c._chain)c=c._wrapped;if(a.isEqual&&b.isFunction(a.isEqual))return a.isEqual(c);if(c.isEqual&&b.isFunction(c.isEqual))return c.isEqual(a);var e=l.call(a);if(e!=l.call(c))return false;switch(e){case "[object String]":return a==String(c);case "[object Number]":return a!=+a?c!=+c:a==0?1/a==1/c:a==+c;case "[object Date]":case "[object Boolean]":return+a==+c;case "[object RegExp]":return a.source== +c.source&&a.global==c.global&&a.multiline==c.multiline&&a.ignoreCase==c.ignoreCase}if(typeof a!="object"||typeof c!="object")return false;for(var f=d.length;f--;)if(d[f]==a)return true;d.push(a);var f=0,g=true;if(e=="[object Array]"){if(f=a.length,g=f==c.length)for(;f--;)if(!(g=f in a==f in c&&q(a[f],c[f],d)))break}else{if("constructor"in a!="constructor"in c||a.constructor!=c.constructor)return false;for(var h in a)if(b.has(a,h)&&(f++,!(g=b.has(c,h)&&q(a[h],c[h],d))))break;if(g){for(h in c)if(b.has(c, +h)&&!f--)break;g=!f}}d.pop();return g}var r=this,G=r._,n={},k=Array.prototype,o=Object.prototype,i=k.slice,H=k.unshift,l=o.toString,I=o.hasOwnProperty,w=k.forEach,x=k.map,y=k.reduce,z=k.reduceRight,A=k.filter,B=k.every,C=k.some,p=k.indexOf,D=k.lastIndexOf,o=Array.isArray,J=Object.keys,s=Function.prototype.bind,b=function(a){return new m(a)};if(typeof exports!=="undefined"){if(typeof module!=="undefined"&&module.exports)exports=module.exports=b;exports._=b}else r._=b;b.VERSION="1.3.1";var j=b.each= +b.forEach=function(a,c,d){if(a!=null)if(w&&a.forEach===w)a.forEach(c,d);else if(a.length===+a.length)for(var e=0,f=a.length;e<f;e++){if(e in a&&c.call(d,a[e],e,a)===n)break}else for(e in a)if(b.has(a,e)&&c.call(d,a[e],e,a)===n)break};b.map=b.collect=function(a,c,b){var e=[];if(a==null)return e;if(x&&a.map===x)return a.map(c,b);j(a,function(a,g,h){e[e.length]=c.call(b,a,g,h)});if(a.length===+a.length)e.length=a.length;return e};b.reduce=b.foldl=b.inject=function(a,c,d,e){var f=arguments.length>2;a== +null&&(a=[]);if(y&&a.reduce===y)return e&&(c=b.bind(c,e)),f?a.reduce(c,d):a.reduce(c);j(a,function(a,b,i){f?d=c.call(e,d,a,b,i):(d=a,f=true)});if(!f)throw new TypeError("Reduce of empty array with no initial value");return d};b.reduceRight=b.foldr=function(a,c,d,e){var f=arguments.length>2;a==null&&(a=[]);if(z&&a.reduceRight===z)return e&&(c=b.bind(c,e)),f?a.reduceRight(c,d):a.reduceRight(c);var g=b.toArray(a).reverse();e&&!f&&(c=b.bind(c,e));return f?b.reduce(g,c,d,e):b.reduce(g,c)};b.find=b.detect= +function(a,c,b){var e;E(a,function(a,g,h){if(c.call(b,a,g,h))return e=a,true});return e};b.filter=b.select=function(a,c,b){var e=[];if(a==null)return e;if(A&&a.filter===A)return a.filter(c,b);j(a,function(a,g,h){c.call(b,a,g,h)&&(e[e.length]=a)});return e};b.reject=function(a,c,b){var e=[];if(a==null)return e;j(a,function(a,g,h){c.call(b,a,g,h)||(e[e.length]=a)});return e};b.every=b.all=function(a,c,b){var e=true;if(a==null)return e;if(B&&a.every===B)return a.every(c,b);j(a,function(a,g,h){if(!(e= +e&&c.call(b,a,g,h)))return n});return e};var E=b.some=b.any=function(a,c,d){c||(c=b.identity);var e=false;if(a==null)return e;if(C&&a.some===C)return a.some(c,d);j(a,function(a,b,h){if(e||(e=c.call(d,a,b,h)))return n});return!!e};b.include=b.contains=function(a,c){var b=false;if(a==null)return b;return p&&a.indexOf===p?a.indexOf(c)!=-1:b=E(a,function(a){return a===c})};b.invoke=function(a,c){var d=i.call(arguments,2);return b.map(a,function(a){return(b.isFunction(c)?c||a:a[c]).apply(a,d)})};b.pluck= +function(a,c){return b.map(a,function(a){return a[c]})};b.max=function(a,c,d){if(!c&&b.isArray(a))return Math.max.apply(Math,a);if(!c&&b.isEmpty(a))return-Infinity;var e={computed:-Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;b>=e.computed&&(e={value:a,computed:b})});return e.value};b.min=function(a,c,d){if(!c&&b.isArray(a))return Math.min.apply(Math,a);if(!c&&b.isEmpty(a))return Infinity;var e={computed:Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;b<e.computed&&(e={value:a,computed:b})}); +return e.value};b.shuffle=function(a){var b=[],d;j(a,function(a,f){f==0?b[0]=a:(d=Math.floor(Math.random()*(f+1)),b[f]=b[d],b[d]=a)});return b};b.sortBy=function(a,c,d){return b.pluck(b.map(a,function(a,b,g){return{value:a,criteria:c.call(d,a,b,g)}}).sort(function(a,b){var c=a.criteria,d=b.criteria;return c<d?-1:c>d?1:0}),"value")};b.groupBy=function(a,c){var d={},e=b.isFunction(c)?c:function(a){return a[c]};j(a,function(a,b){var c=e(a,b);(d[c]||(d[c]=[])).push(a)});return d};b.sortedIndex=function(a, +c,d){d||(d=b.identity);for(var e=0,f=a.length;e<f;){var g=e+f>>1;d(a[g])<d(c)?e=g+1:f=g}return e};b.toArray=function(a){return!a?[]:a.toArray?a.toArray():b.isArray(a)?i.call(a):b.isArguments(a)?i.call(a):b.values(a)};b.size=function(a){return b.toArray(a).length};b.first=b.head=function(a,b,d){return b!=null&&!d?i.call(a,0,b):a[0]};b.initial=function(a,b,d){return i.call(a,0,a.length-(b==null||d?1:b))};b.last=function(a,b,d){return b!=null&&!d?i.call(a,Math.max(a.length-b,0)):a[a.length-1]};b.rest= +b.tail=function(a,b,d){return i.call(a,b==null||d?1:b)};b.compact=function(a){return b.filter(a,function(a){return!!a})};b.flatten=function(a,c){return b.reduce(a,function(a,e){if(b.isArray(e))return a.concat(c?e:b.flatten(e));a[a.length]=e;return a},[])};b.without=function(a){return b.difference(a,i.call(arguments,1))};b.uniq=b.unique=function(a,c,d){var d=d?b.map(a,d):a,e=[];b.reduce(d,function(d,g,h){if(0==h||(c===true?b.last(d)!=g:!b.include(d,g)))d[d.length]=g,e[e.length]=a[h];return d},[]); +return e};b.union=function(){return b.uniq(b.flatten(arguments,true))};b.intersection=b.intersect=function(a){var c=i.call(arguments,1);return b.filter(b.uniq(a),function(a){return b.every(c,function(c){return b.indexOf(c,a)>=0})})};b.difference=function(a){var c=b.flatten(i.call(arguments,1));return b.filter(a,function(a){return!b.include(c,a)})};b.zip=function(){for(var a=i.call(arguments),c=b.max(b.pluck(a,"length")),d=Array(c),e=0;e<c;e++)d[e]=b.pluck(a,""+e);return d};b.indexOf=function(a,c, +d){if(a==null)return-1;var e;if(d)return d=b.sortedIndex(a,c),a[d]===c?d:-1;if(p&&a.indexOf===p)return a.indexOf(c);for(d=0,e=a.length;d<e;d++)if(d in a&&a[d]===c)return d;return-1};b.lastIndexOf=function(a,b){if(a==null)return-1;if(D&&a.lastIndexOf===D)return a.lastIndexOf(b);for(var d=a.length;d--;)if(d in a&&a[d]===b)return d;return-1};b.range=function(a,b,d){arguments.length<=1&&(b=a||0,a=0);for(var d=arguments[2]||1,e=Math.max(Math.ceil((b-a)/d),0),f=0,g=Array(e);f<e;)g[f++]=a,a+=d;return g}; +var F=function(){};b.bind=function(a,c){var d,e;if(a.bind===s&&s)return s.apply(a,i.call(arguments,1));if(!b.isFunction(a))throw new TypeError;e=i.call(arguments,2);return d=function(){if(!(this instanceof d))return a.apply(c,e.concat(i.call(arguments)));F.prototype=a.prototype;var b=new F,g=a.apply(b,e.concat(i.call(arguments)));return Object(g)===g?g:b}};b.bindAll=function(a){var c=i.call(arguments,1);c.length==0&&(c=b.functions(a));j(c,function(c){a[c]=b.bind(a[c],a)});return a};b.memoize=function(a, +c){var d={};c||(c=b.identity);return function(){var e=c.apply(this,arguments);return b.has(d,e)?d[e]:d[e]=a.apply(this,arguments)}};b.delay=function(a,b){var d=i.call(arguments,2);return setTimeout(function(){return a.apply(a,d)},b)};b.defer=function(a){return b.delay.apply(b,[a,1].concat(i.call(arguments,1)))};b.throttle=function(a,c){var d,e,f,g,h,i=b.debounce(function(){h=g=false},c);return function(){d=this;e=arguments;var b;f||(f=setTimeout(function(){f=null;h&&a.apply(d,e);i()},c));g?h=true: +a.apply(d,e);i();g=true}};b.debounce=function(a,b){var d;return function(){var e=this,f=arguments;clearTimeout(d);d=setTimeout(function(){d=null;a.apply(e,f)},b)}};b.once=function(a){var b=false,d;return function(){if(b)return d;b=true;return d=a.apply(this,arguments)}};b.wrap=function(a,b){return function(){var d=[a].concat(i.call(arguments,0));return b.apply(this,d)}};b.compose=function(){var a=arguments;return function(){for(var b=arguments,d=a.length-1;d>=0;d--)b=[a[d].apply(this,b)];return b[0]}}; +b.after=function(a,b){return a<=0?b():function(){if(--a<1)return b.apply(this,arguments)}};b.keys=J||function(a){if(a!==Object(a))throw new TypeError("Invalid object");var c=[],d;for(d in a)b.has(a,d)&&(c[c.length]=d);return c};b.values=function(a){return b.map(a,b.identity)};b.functions=b.methods=function(a){var c=[],d;for(d in a)b.isFunction(a[d])&&c.push(d);return c.sort()};b.extend=function(a){j(i.call(arguments,1),function(b){for(var d in b)a[d]=b[d]});return a};b.defaults=function(a){j(i.call(arguments, +1),function(b){for(var d in b)a[d]==null&&(a[d]=b[d])});return a};b.clone=function(a){return!b.isObject(a)?a:b.isArray(a)?a.slice():b.extend({},a)};b.tap=function(a,b){b(a);return a};b.isEqual=function(a,b){return q(a,b,[])};b.isEmpty=function(a){if(b.isArray(a)||b.isString(a))return a.length===0;for(var c in a)if(b.has(a,c))return false;return true};b.isElement=function(a){return!!(a&&a.nodeType==1)};b.isArray=o||function(a){return l.call(a)=="[object Array]"};b.isObject=function(a){return a===Object(a)}; +b.isArguments=function(a){return l.call(a)=="[object Arguments]"};if(!b.isArguments(arguments))b.isArguments=function(a){return!(!a||!b.has(a,"callee"))};b.isFunction=function(a){return l.call(a)=="[object Function]"};b.isString=function(a){return l.call(a)=="[object String]"};b.isNumber=function(a){return l.call(a)=="[object Number]"};b.isNaN=function(a){return a!==a};b.isBoolean=function(a){return a===true||a===false||l.call(a)=="[object Boolean]"};b.isDate=function(a){return l.call(a)=="[object Date]"}; +b.isRegExp=function(a){return l.call(a)=="[object RegExp]"};b.isNull=function(a){return a===null};b.isUndefined=function(a){return a===void 0};b.has=function(a,b){return I.call(a,b)};b.noConflict=function(){r._=G;return this};b.identity=function(a){return a};b.times=function(a,b,d){for(var e=0;e<a;e++)b.call(d,e)};b.escape=function(a){return(""+a).replace(/&/g,"&").replace(/</g,"<").replace(/>/g,">").replace(/"/g,""").replace(/'/g,"'").replace(/\//g,"/")};b.mixin=function(a){j(b.functions(a), +function(c){K(c,b[c]=a[c])})};var L=0;b.uniqueId=function(a){var b=L++;return a?a+b:b};b.templateSettings={evaluate:/<%([\s\S]+?)%>/g,interpolate:/<%=([\s\S]+?)%>/g,escape:/<%-([\s\S]+?)%>/g};var t=/.^/,u=function(a){return a.replace(/\\\\/g,"\\").replace(/\\'/g,"'")};b.template=function(a,c){var d=b.templateSettings,d="var __p=[],print=function(){__p.push.apply(__p,arguments);};with(obj||{}){__p.push('"+a.replace(/\\/g,"\\\\").replace(/'/g,"\\'").replace(d.escape||t,function(a,b){return"',_.escape("+ +u(b)+"),'"}).replace(d.interpolate||t,function(a,b){return"',"+u(b)+",'"}).replace(d.evaluate||t,function(a,b){return"');"+u(b).replace(/[\r\n\t]/g," ")+";__p.push('"}).replace(/\r/g,"\\r").replace(/\n/g,"\\n").replace(/\t/g,"\\t")+"');}return __p.join('');",e=new Function("obj","_",d);return c?e(c,b):function(a){return e.call(this,a,b)}};b.chain=function(a){return b(a).chain()};var m=function(a){this._wrapped=a};b.prototype=m.prototype;var v=function(a,c){return c?b(a).chain():a},K=function(a,c){m.prototype[a]= +function(){var a=i.call(arguments);H.call(a,this._wrapped);return v(c.apply(b,a),this._chain)}};b.mixin(b);j("pop,push,reverse,shift,sort,splice,unshift".split(","),function(a){var b=k[a];m.prototype[a]=function(){var d=this._wrapped;b.apply(d,arguments);var e=d.length;(a=="shift"||a=="splice")&&e===0&&delete d[0];return v(d,this._chain)}});j(["concat","join","slice"],function(a){var b=k[a];m.prototype[a]=function(){return v(b.apply(this._wrapped,arguments),this._chain)}});m.prototype.chain=function(){this._chain= +true;return this};m.prototype.value=function(){return this._wrapped}}).call(this); diff --git a/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/underscore.js.meta b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/underscore.js.meta new file mode 100644 index 00000000..67f39c55 --- /dev/null +++ b/VRCSDK3Worlds/Assets/Udon/ReferenceDocs/_static/underscore.js.meta @@ -0,0 +1,7 @@ +fileFormatVersion: 2 +guid: 832acbf018ac87e4293111e55828bc68 +TextScriptImporter: + externalObjects: {} + userData: + assetBundleName: + assetBundleVariant: |